Period 2 elements are Lithium (Li), Berillium (Be), Boron (B), Carbon (C), Nitrogen ( N), Oxygen (O), Fluorine (Fe), Neon (Ne).
Period 3 elements are Sodium (Na), Magnesium (Mg), Aluminum (AI), Silicon (Si), Phosphorus (P), Sulfur (S), Chlorine (CI, Argon, (Ar)
Define periodic table.
All identified chemical elements are arranged in rows (referred to as periods) and columns (referred to as groups) in the periodic table of chemical elements, also known as the periodic table, in ascending order of atomic number.
Period 3 elements have a tendency toward being hard (APART FROM Group 1), glossy, and having a metallic shine. They are also solids at room temperature and pressure (apart from mercury, which is a liquid metal), and they are good electrical conductors.
All elements in period 2 experience a decrease in atomic radius, an increase in electronegativity, and an increase in ionization energy as their atomic number rises. Only two metals (lithium and beryllium) are present in Period 2, which is fewer than any other period in terms of both quantity and proportion.
To learn more about periodic table use link below:
https://brainly.com/question/1173237
#SPJ1
under which conditions do you expect helium gas to deviate most from ideal behavior?
Answer:
Explanation:
[2-0] NC Special Operation
[2] Supervisor
[2-1] Emergency Response
[2-2] Juggernaut
[2-3] Commander
[2-4] Division Director
Would a tighter or a looser cover heat the oven faster? How about no covering at all?
write the basic different between exothermic and endothermic reaction and some examples?
Answer
The endothermic process is a term that describes a reaction where the system absorbs the energy from its surrounding in the form of heat. A few examples of the endothermic process are photosynthesis, evaporating liquids, melting ice, dry ice, alkanes cracking, thermal decomposition, ammonium chloride in water and much more.
The exothermic reaction is the opposite of an endothermic reaction. It releases energy by light or heat to its surrounding. A few examples are neutralization, burning a substance, reactions of fuels, deposition of dry ice, respiration, solution of sulfuric acid into water and much more.
Explanation:
Endo example= ice cream
Exo example= Hot coffee
Why is the left side of the periodic table more reactive?
As we go down the group 1 from lithium to potassium the IE decreases, the metals become more reactive.
The metal can only be reactive, when ir can make bonds with other atoms of molecules.
we know ionization energy, decreases when we move down the group and increases along the period.
when IE increases, along the period the distance between nuclei and electron is strong and to remove electron is hard and therefore the they are not reactive.
This IE decreases, it also increases the distance between the nuclei and valence shells electrons, which leads to weaker force of attraction between them and helps in easy removal of electrons.
This easy removal of electrons makes the metals reactive.
To know more about periodic table,
https://brainly.com/question/11155928
#SPJ4
in addition to the distance between two particles what other factor determines the magnitude of the electric force between the particles?
In addition to the distance between two particles what the other factor that determines the magnitude of the electric force between the particles is the charge.
What is electric force?Electric force is described as repulsive or attractive interaction between any two charged bodies . Just like any other force, electric force impact and effects on any given body are described by Newton's laws of motion.
The electric force between the two particles are calculated through the equation,
F = kQ₁Q₂ / d²
where F is the force, k is a constant called Coulomb's law constant, Q₁ and Q₂ are the charges, and d is the distance. This equation is called the Coulomb's law.
Learn more about electric force at:
https://brainly.com/question/30236242
#SPJ1
Which statement is true for one molecule of sulfur trioxide?
A.
There are three atoms of sulfur and one atom of oxygen.
B.
There are three atoms of sulfur and three atoms of oxygen.
C.
There is one atom of sulfur and one atom of oxygen.
D.
There is one atom of sulfur and three atoms of oxygen.
The correct option is D, in sulfur trioxide there is one atom of sulfur and three atoms of oxygen.
Sulfur trioxide has a chemical formula \(SO_{3}\) which clearly signifies one atom of sulfur and three atoms of oxygen.
In the case of option B: three atoms of sulfur and one atom of oxygen, do not make the chemical composition \(SO_{3}.\) Hence option B is incorrect.
In the case of option C: one atom of sulfur and one atom of oxygen, do not make the chemical composition as \(SO_{3}.\). Hence option C is incorrect.
In the case of option D: one atom of sulfur and three atoms of oxygen, do not make the chemical composition \(SO_{3}.\) Hence option D is incorrect.
To learn more about sulfur trioxide:
https://brainly.com/question/3994710
1. Which of these sentences tells a main idea of "Starting Small," the article you just read?
Ella Bradna began performing on her own at age eleven.
Girls are more likely to become circus performers than boys.
Successful circus performers start training when they are children.
Today you can't be a circus performer until you're an adult.
Answer:
"successful circus performers start training when they are children"
Explanation:
this explains it well because most skills start at a young age.
Answer: Successful circus performers start training when they are children.
Explanation:
a ______ is an example of a liquid asset. group of answer choices fixed deposit of 3 years savings account tax retirement account car
A savings account is an example of a liquid asset.
An asset is something that has monetary value, and liquidity is the ease with which an asset can be converted to cash.
Thus, a liquid asset refers to an asset that can be easily converted to cash.
A savings account is a deposit account held at a bank or other financial institution.
It earns interest on the balance and allows customers to deposit and withdraw funds easily.
It is a liquid asset because money can be withdrawn at any time without penalties or fees, and it can be quickly converted to cash.
Therefore, the answer is Savings account.
Learn more about savings account from this link:
https://brainly.com/question/12643178
#SPJ11
what is precipitating ???
anyone please tell me how to delete an I'd
Explanation:
Desposition of solid matter in a solution
Helpp
What is the relationship between pressure and temperature and pressure and volume
a 30.1 ml sample of vinegar is titrated with 0.596 m naoh(aq). if the titration requires 25.5 ml of naoh(aq) to reach the equivalence point, what is the concentration of acetic acid in the vinegar?
The concentration of acetic acid in the vinegar sample is 3.30 M.
How to determine the concentration of the analyte?In this titration problem, we can use the balanced chemical equation for the reaction between acetic acid and sodium hydroxide:
CH3COOH (acetic acid) + NaOH (sodium hydroxide) → CH3COONa (sodium acetate) + H2O (water)
From the equation, we can see that the stoichiometric ratio of acetic acid to sodium hydroxide is 1:1. This means that the number of moles of sodium hydroxide used in the titration is equal to the number of moles of acetic acid in the vinegar sample.
We can start by calculating the number of moles of sodium hydroxide used:
n(NaOH) = M(NaOH) x V(NaOH)
n(NaOH) = 0.596 mol/L x 25.5 mL / 1000 mL/L
n(NaOH) = 0.0152 mol
Since the stoichiometric ratio of acetic acid to sodium hydroxide is 1:1, the number of moles of acetic acid in the vinegar sample is also 0.0152 mol.
Now we can calculate the concentration of acetic acid in the vinegar sample:
M(CH3COOH) = n(CH3COOH) / V(CH3COOH)
We have the number of moles of acetic acid, but we need to calculate the volume of the vinegar sample used in the titration. Since we know the initial volume of the vinegar sample (30.1 mL), we can use the volume of sodium hydroxide used (25.5 mL) to calculate the volume of acetic acid in the vinegar sample:
V(CH3COOH) = V(titrant) - V(NaOH)
V(CH3COOH) = 30.1 mL - 25.5 mL
V(CH3COOH) = 4.6 mL
Now we can calculate the concentration of acetic acid in the vinegar sample:
M(CH3COOH) = 0.0152 mol / 4.6 mL / 1000 mL/L
M(CH3COOH) = 3.30 mol/L
Therefore, the concentration of acetic acid in the vinegar sample is 3.30 M.
Learn more about stoichiometry
brainly.com/question/30215297
#SPJ11
Why does potassium have a higher second ionization energy than calcium?
Answer:
The first ionization energy for K is less than Ca because Ca has a larger effective nuclear charge. There is a large increase in the second ionization energy for K compared to Ca because removal of the second electron from K is a core electron that is in a quantum shell closer to the nucleus.
Explanation:
What mass of nickel (Ni) is in a 2.4 Kg sample of propanol if the concentration is 20 ppb ? (atomic mass of Ni = 58.69)
Answer:
The mass of nickel is 48μg
Explanation:
Parts per billion is a way to describe small concentrations and is defined as the ratio between μg of solute and kg of solvent.
If a solution of nickel in propanol is 20ppb, contains 20μg of nickel in 1 kg of propanol.
Thus, a sample of 2.4kg of propanol will contain:
2.4kg × (20μg nickel / 1kg) = 48μg nickel
The mass of nickel is 48μgwhat is the weathering?
Answer:
The process of breaking down stones or rocks into small pieces is called weathering.
Explanation:
Explanation:
refer the above attachment
Weathering is the breaking down or dissolving of rocks and minerals on Earths surface. Once a rock has been broken down, a process called erosion transports the bits of rock and minerals away. Water, acids, salt, plants, animals, and changes in temperature are all agents of weathering and erosion.
Types of Mechanical Weathering
Plant Activity. The roots of plants are very strong and can grow into the cracks in existing rocks. ...
Animal Activity. ...
Thermal Expansion. ...
Frost action. ...
Exfoliaton.
Word Bank:
amount
atomic mass
atomic mass
atomic mass
atomic number
name
charge
electrons
neutrons
nucleus
protons
same
The number of protons in one atom of an element determines the atom’s _________________, and the number of electrons determines the _________________________ of the element.
The atomic number tells you the number of ___________________________ in one atom of an element. It also tells you the number of __________________________ in a neutral atom of that element. The atomic number gives the “identity” of an element as well as its location on the periodic table. No two different elements will have the ____________________ atomic number.
The ______________________ of an element is the average mass of an element’s naturally occurring atom, or isotopes, taking into account the ____________________ of each isotope.
The _______________________ of an element is the total number of protons and neutrons in the ___________________ of the atom.
The atomic mass is used to calculate the number of ______________________ in one atom of an element. In order to calculate the number of neutrons you must subtract the ______________________ from the ______________________.
Answer:
name,atomic mass,electrons,protons,same,charge,amount,atomic mass,charge,neutrons,atomic number,atomic mass
what is the molecular component that makes each individual amino acid unique?
The molecular component that makes each individual amino acid unique is the side chain or R group
Amino acids are made up of three different components, and these components make each individual amino acid unique. The three components are the amino group (-NH2), the carboxyl group (-COOH), and the side chain or R group.
Amino acids are the building blocks of proteins and each of the 20 different types of amino acids has a unique side chain that determines its unique molecular properties. For example, some amino acids have polar side chains that make them hydrophilic or water-soluble, while others have nonpolar side chains that make them hydrophobic or water-insoluble.
There are 20 different amino acids that are used to make proteins. The molecular component that makes each individual amino acid unique is the side chain or R group. The side chain can be any of the 20 different types of chemical groups, and it determines the unique properties of the amino acid. For example, the side chain of glycine is a hydrogen atom, while the side chain of tryptophan is a complex ring structure containing nitrogen and carbon atoms.
learn more about molecular component on:
https://brainly.com/question/15092254
#SPJ11
What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?
The balanced equation for this reaction is:
CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).Learn more about the condensation reaction:
brainly.com/question/6256866
#SPJ11
When this reaction is run , 57.75 g H2O is produced. What is the percent yield for this result?
The theoretical yield is the amount of product that would be obtained if the reaction proceeded with 100% efficiency.
Once you have the theoretical yield and the actual yield (which is given as 57.75 g of H2O in this case), you can use the following formula to calculate the percent yield:
Percent Yield = (Actual Yield / Theoretical Yield) x 100
In this case, the actual yield is 57.75 g and the theoretical yield is 60.00 g. Therefore, the percent yield is:
Percent yield = (57.75 g / 60.00 g) * 100% = 96.25%
Therefore, the percent yield for this reaction is 96.25%.
To know more about theoretical yield:
https://brainly.com/question/14966377
#SPJ1
a gas at constant volume has a pressure of 3.20 atm at 300. k. what will be the pressure of the gas at 290. k? 2.86 atm 3.09 atm 3.31 atm 3.56 atm
The relationship between pressure and temperature of a fixed amount of gas in a rigid container is called Charles’ Law.
According to Charles’ Law, for a given mass of gas at a constant volume, the volume of the gas varies directly with the temperature. It can be represented by the formula :V/T = constant where, V = volume of the gas T = temperature of the gas (in Kelvin)constant = proportionality constant Since pressure, volume, and temperature of the gas are interdependent, we can write:
PV/T = constant. We can use this formula to solve the problem. We know that the volume of the gas is constant. So, we can write:
P1/T1 = P2/T2 where, P1 = 3.20 atm (pressure at 300 K)T1 = 300 K (temperature at 3.20 atm)T2 = 290 K (temperature at unknown pressure)
Now, we can calculate P2 (pressure at 290 K) as:
P2 = P1 × (T2/T1) = 3.20 atm × (290 K/300 K) = 3.09 atmAnswer:3.09 atm
When the temperature of a fixed amount of gas is increased, its volume also increases. Similarly, when the temperature is decreased, the volume also decreases. This relationship between the volume of a gas and its temperature at a constant pressure is called Charles’ Law. It can be stated as:
V/T = constant, where V is the volume of the gas and T is its temperature in Kelvin. The proportionality constant in the above equation is the number of moles of the gas multiplied by the gas constant (R).
Mathematically, we can represent this relationship between pressure, volume, and temperature of a gas as: PV/T = constant.
When the volume of the gas is constant, the above equation becomes:
P1/T1 = P2/T2where P1 and T1 are the initial pressure and temperature of the gas, and P2 and T2 are the new pressure and temperature of the gas, respectively.
Using this equation, we can calculate the pressure of the gas at a new temperature, provided we know its initial pressure and temperature, and the new temperature.
Therefore, the pressure of the gas at 290 K will be 3.09 atm.
To know more about Charles’ Law visit:
brainly.com/question/27820267
#SPJ11
What happens where Earth's plates meet?
Answer:
an earthquake
Explanation:
the tectonic plates rub together sending shockwaves
Why is the right side
of the periodic table
negative (gaining
electrons) and the
left side positive
(loosing electrons)?
Answer:
The elements on the left-side of the periodic table are relatively electron deficient. So due to their comparatively low effective nuclear charges (the net positive charge of the protons minus the shielding core electrons below the valence level), their electrostatic hold on these electrons are weak.
Elements further right on the period table though, have higher effective nuclear charges and stabilize electrons more effectively. Which leads to localized covalent bonding and the formation of molecules.
The right side contains non metals while the left side contains metals.
Metals lose electrons (negative electrons). They now have more protons, therefore making the ion positive.
Non metals gain electrons (positive electrons). So the ion has more electrons than protons which makes the ion negative.
I will give brainliest. 1. A spiderweb and a Kevlar jacket have some obvious differences. Which property is similar between the web and the jacket?
- surface area
- thickness, expressed as a number of atoms
- overall strength
- arrangement of atoms in molecules
2. Assuming silk from spiderwebs could be made just as strong as Kevlar, why would a company still choose to use Kevlar in producing bulletproof fabrics?
- A much larger amount of silk might be needed to produce the same effect.
- Spiderweb silk would likely be rejected by the body.
- The cost might be higher for producing spiderweb silk.
- Spiderweb silk likely involves more chemicals.
3. Which microscopic detail affects the strength of different forms of silk?
- Different silk strands are made with different types of atoms.
- Different types of silk are in long strands or in other very different arrangements.
- Different silk strands have different combinations of amino acids.
- Different types of silk do not have the same strength if they come from different sources.
4. Which type silk is the strongest?
- nonbiodegradable
- minor ampullate
- major ampullate
- biodegradable
5. Which natural source has been bioengineered to make silk proteins?
- mulberry leaves
- goat milk
- goat hair
- mulberry bark
Answer:
arrangement of atoms in molecules.A much larger amount of silk might be needed to produce the same effect.- Different silk strands have different combinations of amino acids. .major ampullate.goat milkExplanation:
Using Organic Compounds quick check
do you know the refining design quick check
Answer: connections academy?
Explanation: do you go there? I saw that you were answering questions and asking for help on the midterm for A&P and the same one is currently on schedule for me
This is the area where all the cell organelles are located.
O Cytoplasm
O DNA
O Chloroplast
O Cell Wall
What environmental factors affect animal characteristics?
factor that could affect
Answers:
There's many factors, such as the temperature, rainfall, food available, and the surrounding terrain, that all can effect an animal's characteristics.
How much more average Kinetic Energy do molecules have at 50°C compared to 25°C?
The kinetic energy is 0.5177 × 10⁻²¹ J more at 50°C compared to 25°C.
The average kinetic energy of a molecule is directly proportional to the absolute temperature of a gas.
KE = ( 3/2 ) ( R / Nₐ ) T
Where T is the temperature of the molecule, R is the gas constant, and Nₐ is Avogadro's number.
Now, R = 8.314 J/mol.K
Avogadro's number, Nₐ = 6.022 × 10²³ atoms/ mol
The average kinetic energy at 50° C is:
T = 50° C = 323 K
KE₁ = ( 3/2 ) × ( R / Nₐ ) × T₁
KE₁ = ( 3 × 8.314 × 323 ) / ( 2 × 6.022 × 10²³ )
KE₁ = 668.90 × 10⁻²³ J
KE₁ = 6.6890 × 10⁻²¹ J
The average kinetic energy at 25°C is:
KE₂ = ( 3/2 ) × ( R / Nₐ ) × T₂
KE₂ = ( 3 × 8.314 × 298 ) / ( 2 × 6.022 × 10²³ )
KE₂ = 617.13 × 10⁻²³ J
KE₂ = 6.1713 × 10⁻²¹ J
Now,
The average kinetic energy of the molecules at 50° C compared to 25° C is:
KE = KE₁ - KE₂
KE = 6.6890 × 10⁻²¹ - 6.1713 × 10⁻²¹
KE = 0.5177 × 10⁻²¹ J
Hence, the average kinetic energy is 0.5177 × 10⁻²¹ J more at 50° C compared to 25° C.
Learn more about kinetic energy here:
https://brainly.com/question/8101588
#SPJ9
Which solution has the greatest number of hydroxide ions?
i need a friend....
Answer:
homogeneous solutions
A gas at 300 k and 4. 0 atm is moved to a new location with a temperature of 250 k. The volume changes from 5. 5 l to 2. 0 l. What is the pressure of the gas at the new location? use the formula: p1v1 t1 = p2v2 t2
The pressure of the gas at the new location is approximately 7.92 atm.
To solve this problem using the formula provided, we need to plug in the given values for the initial state (denoted by subscript 1) and the final state (denoted by subscript 2) of the gas:
p₁v₁t₁ = p₂v₂t₂
where:
p₁ = 4.0 atm (initial pressure)
v₁ = 5.5 L (initial volume)
t₁ = 300 K (initial temperature)
p₂ = ? (what we are solving for)
v₂ = 2.0 L (final volume)
t₂ = 250 K (final temperature)
We can rearrange the equation to solve for p₂:
p₂ = p₁v₁t₁ / v₂t₂
Substituting the given values:
p₂ = (4.0 atm) x (5.5 L) x (300 K) / (2.0 L) x (250 K)
p₂ = 7.92 atm
To know more about pressure here
https://brainly.com/question/356585
#SPJ4
Answer:
its 9.2 atm
Explanation:
Which indicator would tell scientists the most about future climate change
The diagram above represents the melting of H2O(s). A 2.00mole sample of H2O(s) at 0°C melted, producing H2O(l) at 0°C. Based on the diagram, which of the following best describes the amount of heat required for this process and the changes that took place at the molecular level?
Heat : 12 kJ, to maintain hydrogen bonds
Further explanationGiven
A 2.00mole sample ⇒ n = 2 mol
H₂O(s) at 0°C melted, producing H₂O(l) at 0°C
Required
the amount of heat required
the changes that took place
Analysis
Conversion of mol to mass
Use formula of Heat :
Q = mLf (melting/freezing)
Lf=latent heat of fusion (for water=334 J/g)
Solution
mass H₂O(MW=18 g/mol) :
\(\tt mass=2\times 18=36~g\)
Heat required :
\(\tt Q=36\times 334=12024~J\approx 12~kJ\)
The absorbed heat is used to maintain hydrogen bonds in water molecules (there are two hydrogen bonds per molecule)
Paraphrase
The amount of heat required : 12 kJ, and to maintain hydrogen bonds
How many half-lives did a radioactive sample complete if 2. 5 g of a sample remains from 20 g of initial material?.
The number of half lives will be 3 if the initial mass is 20 g and the remaining mass is 2.5 g.
Half-life, in the radioactivity, is the amount of time needed for half of a radioactive sample's atomic nuclei to decay the (change spontaneously into other nuclear species by emitting the particles and energy), or, alternatively, amount of the time needed for a radioactive material's rate of disintegrations per second to decrease by the half.
mi = mr × 2ⁿ
mi= initial mass
mr= remaining mass after n periods
n = number of periods
2ⁿ= mi/ mr
2ⁿ=
20/ 2.5
2ⁿ= 8
n= 3
Thus the number of half lives will be 3.
To know more about radioactivity, please refer:
https://brainly.com/question/2320811
#SPJ4