Answer:
Step-by-step explanation:
$2.4
12 divided by 15= 2.4
3 of 25 After running a coiled tubing unit for 81 minutes, Tom has 9,153 feet of coiled tubing in the well. After running the unit another 10 minutes, he has 10,283 feet of tubing in the well. His call sheet shows he needs a total of 15,728 feet of tubing in the well. How many more feet of coiled tubing does he need to run into the well? feet 4 of 25 Brendan is running coiled tubing in the wellbore at a rate of 99.4 feet a minute. At the end of 8 minutes he has 795.2 feet of coiled tubing inside the wellbore. After 2 more minutes he has run an additional 198.8 feet into the wellbore. How many feet of coiled tubing did Brendan run in the wellbore altogether? 5 of 25 Coiled tubing is being run into a 22,000 foot wellbore at 69.9 feet per minute. It will take a little more than 5 hours to reach the bottom of the well. After the first four hours, how deep, in feet, is the coiled tubing? feet
3) The extra number of feet of coiled tubing Tom needs to run into the well is: 5445 ft
4) The total length of coiled tubing Brendan ran in the wellbore is: 994 ft
5) The distance that the coiled tubing has reached after the first four hours is: a depth of 16,776 feet in the well.
How to solve Algebra Word Problems?3) Initial amount of coiled tubing he had after 81 minutes = 9,153 feet
Amount of tubing after another 10 minutes = 10,283 feet
The total tubing required = 15,728 feet.
The extra number of feet of coiled tubing Tom needs to run into the well is: Needed tubing length - Current tubing length
15,728 feet - 10,283 feet = 5,445 feet
4) Speed at which Brendan is running coiled tubing = 99.4 feet per minute.
Coiled tubing inside the wellbore after 8 minutes is: 795.2 feet
Coiled tubing inside the wellbore after 2 more minutes is: 198.8 feet
The total length of coiled tubing Brendan ran in the wellbore is:
Total length = Initial length + Additional length
Total length = 795.2 feet + 198.8 feet
Total Length = 994 feet
5) Rate at which coiled tubing is being run into a 22,000-foot wellbore = 69.9 feet per minute. After the first four hours, we need to determine how deep the coiled tubing has reached.
A time of 4 hours is same as 240 minutes
Thus, the distance covered in the first four hours is:
Distance = Rate * Time
Distance = 69.9 feet/minute * 240 minutes
Distance = 16,776 feet
Read more about Algebra Word Problems at: https://brainly.com/question/21405634
#SPJ4
Suppose a hypertension trial is mounted and 18 participants are randomly assigned to one of the comparison treatments. Each participant takes the assigned medication and their systolic blood pressure (SBP) is recorded after 6 months on the assigned treatment. Is there a difference in mean SBP among the three treatment groups at the 5% significance level? The data are as follows. Placebo 134 143 148 142 150 160 Standard Treatment New Treatment 124 114 133 125 128 115 121 124 122 128 Step 4. Compute the test statistic. The ANOVA table is presented as below. You should be able to figure out values in the numbered cells with information provided in the question statement and the table above: Source Between-Group Within-Group Total Sum of Squares 237 846.2 3222.9 df Mean Sqaure 6.8 What is the between-group mean square, that is, value in Cell (4)? a. 1188.4 b.158.5 c. 423.1 d. 1611.5
The correct option is b. 118.5. The between-group mean square, that is, value in Cell (4) is 118.5.
To find the between-group mean square (value in Cell 4), you need to divide the between-group sum of squares by its degrees of freedom. In this case, the between-group sum of squares is 237 and the degrees of freedom is 2 (since there are 3 treatment groups - 1).
Here's the calculation:
Between-group mean square (Cell 4)
= Between-group sum of squares / Degrees of freedom
= 237 / 2
= 118.5
So the between-group mean square, or value in Cell 4, is b. 118.5.
To learn more about mean: https://brainly.com/question/1136789
#SPJ11
A city has a population of people. Suppose that each year the population grows by . What will the population be after years?
Answer:
The question is missing the values, I found a possible matching question:
a city has a population of 380,000 people. suppose that each year the population grows by 7.5%. what will be the population after 6 years
Answer:
After 6 years, the population will be 586, 455 people
Step-by-step explanation:
This growth is similar to the growth of an invested amount of money, which is compounded annually, yielding a future value, when it increases by a certain interest rate. Hence the formula for compound interest is used to determine the population after 6 years as follows:
\(FV = PV (1+ \frac{r}{n})^({n \times t})\)
where
FV = future value = population after 6 years = ???
PV = present value = current population = 380,000 people
r = interest rate = growth rate = 7.5% = 7.5/100 = 0.075
n = number of compounding periods per year = annually = 1
t = time of growth = 6 years
\(FV = 380,000 (1+ \frac{0.075}{1})^({1 \times 6})\\FV = 380,000 (1.075)^{6}\\FV= 380,000 (1.5433015256)\\FV = 586,454.58\\FV= 586,455\ people\)
Therefore, after 6 years, the population will be 586, 455 people
T/F. if you have 23 people in a room, there is a 50% chance that 2 of them have the same birthday.T
The statement 'if you have 23 people in a room, there is a 50% chance that 2 of them have the same birthday' is True.
The Birthday Paradox states that with 23 people in a room, there is a 50% chance that two of them have the same birthday . This may seem counterintuitive, but the math behind it works as follows:
Calculate the probability that everyone has a different birthday.
Subtract that probability from 1 to get the probability that at least two people share a birthday.
There are 365 possible birthdays for the first person.
For the second person to have a different birthday, there are 364 remaining options.
For the third person, 363 remaining options, and so on.
The probability of everyone having different birthdays is calculated as:
(365/365) × (364/365) × (363/365) × ... × (343/365)
1 - (calculated probability) = probability that at least two people share a birthday
Using this calculation, the probability is approximately 50% that two people have the same birthday with 23 people in the room.
for such more question on probability
https://brainly.com/question/13604758
#SPJ11
What are the zeros of f(x) = (x - 2)(x + 7)? Select all that apply.
x= 7
O x=2
0
x= -2
Ox--7
Solve each set of parentheses so they equal 0:
(X-2) = 0 add 2 to both sides : x = 2
(X + 7) = 0 subtract 7 from both sides: x = -7
The zeros are 2 and -7
Answer:
Value of x could be = 2 or -7
Step-by-step explanation:
If you like my answer than please mark me brainliest thanks
A bakery can make 21 cheesecakes for every 7 blocks of cream cheese. Which table represents the relationship between the number of cheesecakes the bakery makes and the number of blocks of cream cheese the bakery uses? A B Cheesecakes Cream Cheese (blocks) Cheesecakes Cream Cheese (blocks) 21 7 21 7 28 14 24 8 35 21 27 9 с D Cheesecakes Cream Cheese (blocks) Cheesecakes Cream Cheese (blocks) 3 1 3 1 4 2 6 4 5 3 9 7
Answer:
it would be D me child
Step-by-step explanation:
on an algebra quiz, 10\% of the students scored 7070 points, 35\5% scored 8080 points, 30\0% scored 9090 points, and the rest scored 100100 points. what is the difference between the mean and median score of the students' scores on this quiz?
Using the Mean and median formulae ,
The difference between the mean and median score of the students' scores on this quiz is 3.
Mean : The mean is the number which we get by dividing the sum of a set of values by the number of values in the set.
Median: the median is the middle number in a set of values when those values are arranged in either ascending or descending order.
let us consider there are a total 100 students.
and X denotes the marks obtained by students.
We have given that,
10% of student scored 70 points i.e.,
P(X=70) = 10% of 100 = 10
35% of students scored 80 points i.e., number of students whose obtained 80 points
= 35% of 100 = 35
30% of students scored 90 points , number of students whose obtained 90 points
= 30% of 100 = 30
remained ( 25%) of students scored 100 points
= 100 - 10 - 35 - 30 = 25
total marks obtained by students
= 80+70+90+100
= 340
Mean of score of students'scores on the quiz
= (70×10+ 80×35 + 90×30 + 100×25)/100 = 87
when we arranged the in ascending students in order , the 50th and 51th student lies in middle and marks obtained by both (50th and 51th) is 90 points .
So, Median score of the students' scores on this quiz = 90
Now, we shall calculate the difference between mean and median of score of the students' scores on this quiz which is equal to( 90 -87)
= 3
Hence, difference between the mean and median score of the students' scores on this quiz = 3
To learn more about Mean and median, refer:
https://brainly.com/question/14532771
#SPJ4
HELP! The slope of Similar Triangles. Explain your answer!! Will mark brainliest!
Answer:
A
Step-by-step explanation:
please answer and i will mark you as brainliest
Answer:
The answer will be B. V^6
Kenzie runs at an average speed of 6.25mi/h. The length of her typical run is within one mile of 6 miles long.
Write an absolute value equation to represent the situation. Find the shortest or longest amount of time for Kenzie’s run. Round to the nearest minute.
Answer: 13512
100332
Step-by-step explanation:
The shortest time for her run is approximately 36 minutes and the longest time is approximately 67 minutes.
To represent Kenzie's situation, we can use an absolute value equation. Let x represent the length of her run in miles.
The equation would then be |x - 6| ≤ 1, which means the distance between x and 6 is less than or equal to 1.
To find the shortest or longest amount of time for Kenzie's run, we need to consider the speed.
The time can be found by dividing the distance by the speed, so the minimum time would be (6 - 1)/6.25 hours,
which is approximately 0.6 hours or 36 minutes.
The maximum time would be (6 + 1)/6.25 hours,
which is approximately 1.12 hours or 67 minutes.
Learn more about Absolute value equation here:
https://brainly.com/question/32899684
#SPJ3
In the figure, m_2 = 75. Find the measures of the
remaining angles.
PA
Х
1/2
4/3
-m
5/6
8/7
-N
Answer:
Step-by-step explanation:
If angle 2 is 75, the other angles that are also 75 are angles 4 (it's vertical to angle 2), angle 6 (it's corresponding to angle 2), angle 8 (it's alternate exterior to angle 2). All the other angles measure 180 - 75 which is 105.
The fifth grade has 152 students. Each student has 18
pencils. About how many pencils do the students have altogether?
There are total of 152 students in 5th grade, then the number of pencils altogether will be equal to 2,736 pencils.
What are arithmetic operations?The four basic operations of arithmetic can be used to add, subtract, multiply, or divide two or even more quantities.
They cover topics like the study of integers and the order of operations, which are relevant to all other areas of mathematics including algebra, data processing, and geometry.
As per the given information in the question,
Total number of students in 5th grade = 152
Amount of pencil each student have = 18
Then, the total number of pencils altogether,
= 152 × 18
= 2,736 pencils.
To know more about arithmetic operations:
https://brainly.com/question/13585407
#SPJ1
I need help again /:
Step-by-step explanation:
I would go with a or b but one sec let me work it out
3(5m + 2) - 20m - 14 + 5
Answer:
-5m-3
Step-by-step explanation:
step 1 Collect like terms.
3(5m+2)-20m+(-14+5)
step 2 Simplify.
3(5m+2)-20m-9
step 3 Expand by distributing terms.
15m+6-20m-9
step 4 Collect like terms.
(15m-20m)+(6-9)
step 5 Simplify.
-5m-3
Answer:-5m - 3
Step-by-step explanation:
1) Distribute
3(5m + 2) - 20m - 14 + 5
15m+6 - 20m - 14+5
2) Add the numbers
15m+6 - 20m- 14+5
15m-3 - 20m
3) Combine like terms
15m - 3-20m
Answer
-5m - 3
Hope this helps
What are the advantages of Partial Fractions Expansion? 2- Obtain the inverse Laplace transform of the Following F(s) ? F(s)=s3+6s2+8ss5+8s4+23s3+35s2+28s+3 3- Solve the following differential equation? dt2d2x+2dtdx+10x=t2 where x(0)=dtdx(0)=0
Simplification of Complex Rational Functions: Partial Fractions Expansion helps to break down complex rational functions into simpler, more manageable fractions.
Integration: Partial Fractions Expansion is often used in calculus to simplify the integration of rational functions. By breaking down the function into simpler fractions, it becomes easier to integrate each fraction separately.
Solving Linear Differential Equations: Partial Fractions Expansion can be used to solve linear differential equations involving rational functions. By decomposing the function into partial fractions, it becomes possible to find the solution to the differential equation.
As for the third part of your question, to solve the differential equation dt2d2x+2dtdx+10x=t2, you can use the method of undetermined coefficients. Assume a solution of the form
x(t)=At2+Bt+C, where A, B, and C are constants.
Differentiate this equation twice and substitute it back into the original differential equation. Equate the coefficients of each power of t and solve the resulting system of equations to find the values of A, B, and C.
Finally, substitute the values back into the assumed solution to obtain the specific solution to the differential equation.
To know more about coefficients visit:
https://brainly.com/question/13431100
#SPJ11
Partial fraction expansion is advantageous in simplifying algebraic expressions and facilitating integration and inverse Laplace transform calculations. To solve the given differential equation, various techniques such as the method of undetermined coefficients or variation of parameters can be used to obtain the particular and complementary solutions.
Partial fraction expansion is a useful technique in mathematics, particularly in the field of algebra and calculus, for simplifying and solving problems involving rational functions. It involves decomposing a complex rational function into simpler fractions called partial fractions. Here are some advantages of partial fraction expansion:
1. Simplification: By decomposing a complex rational function into partial fractions, it becomes easier to manipulate and analyze. It allows for simplification of algebraic expressions, making calculations more manageable.
2. Integration: Partial fraction expansion is commonly used in calculus for integrating rational functions. By decomposing a rational function into partial fractions, the integration process becomes simpler and can be performed term by term.
3. Inverse Laplace Transform: Partial fraction expansion is essential in finding the inverse Laplace transform of a given function. By decomposing the function into partial fractions, the inverse transform can be applied to each term individually, leading to a solution in the time domain.
Now, let's move on to the second part of your question:
To obtain the inverse Laplace transform of the given function F(s) = s^3 + 6s^2 + 8s/(s^5 + 8s^4 + 23s^3 + 35s^2 + 28s + 3), we need to perform partial fraction expansion. By factoring the denominator, we find that it can be expressed as (s + 1)(s + 3)(s^3 + 4s + 1).
By applying partial fraction decomposition and solving for the unknown coefficients, the function F(s) can be expressed as F(s) = A/(s + 1) + B/(s + 3) + (Cs^2 + Ds + E)/(s^3 + 4s + 1).
Next, we can use the method of inverse Laplace transforms to find the inverse transform of each term separately. This involves consulting Laplace transform tables or using known Laplace transform properties to obtain the final solution in the time domain.
Now, let's move on to the third part of your question:
The given differential equation is d^2x/dt^2 + 2(dx/dt) + 10x = t^2, with initial conditions x(0) = dx/dt(0) = 0.
To solve this differential equation, we can use various techniques such as the method of undetermined coefficients or variation of parameters. These methods involve assuming a particular form for the solution and determining the coefficients or functions that satisfy the given equation and initial conditions.
Once the particular solution is found, we add it to the complementary solution obtained by solving the associated homogeneous equation, which is obtained by setting the right-hand side of the differential equation to zero.
By applying the appropriate method, the solution to the given differential equation can be obtained. It is important to note that without specific initial conditions or further constraints, the solution may not be unique.
Learn more about Partial fraction
https://brainly.com/question/30404141
#SPJ11
Evaluate the following expression.
Using the laws of exponents, the solution to the given problem is: 25
How to use laws of exponents?Some of the laws of exponents are:
1) Product of powers rule: This means that we add powers together when multiplying like bases.
2) Quotient of powers rule: This means that we subtract powers when dividing like bases.
3) Power of powers rule: This means that we multiply powers together when raising a power by another exponent.
4) Power of a product rule: This means that when any base is being multiplied by an exponent, distribute the exponent to each part of the base.
5) Negative exponent rule: This means that when there is a number being raised by a negative exponent, flip it into a reciprocal to turn the exponent into a positive
We are given the expression:
\(\frac{1}{5^{-2} }\)
Using the negative exponent rule, we will have:
5² = 25
Read more about Laws of Exponents at: https://brainly.com/question/11761858
#SPJ1
The population of a town is decreasing at a rate of 2% per year. In 2000 there were 1100 people. Question 1 Part A Find an exponential decay function to model this situation
Answer:
bot
Step-by-step explanation:
Ambitious
Jared is 10 years old. His brother Peter is 15 years old. What are some chewy fruit worms they can share without having to make new cuts?
Answer:
gummy worms
Step-by-step explanation:
If you are trying to make an equal amount of distributed chewy fruit worms, then any number that is even will be okay, if they are only two people, and age doesn't really matter, unless one of them as some sort of age-induced medical problem or a sugar deficiency.
WILLL MARK BRAINLIEST IF GOTTEN RIGHT
Answer:
8
Step-by-step explanation:
S.P. = Rs 132, profit percent = 10%, find C.P.
The C.P is Rs.120
Here we can use the formula,
CP=Rs. {100÷100+gain%*S. P}
=Rs. {100÷100+10*132}
=Rs. {100÷110*132}
=Rs.13200÷110
=Rs.120
Hence the CP is Rs.120
To know more about C.P refer
https://brainly.com/question/22699644
The temperature rose 5 degrees from 6:00am to 12:00pm.
The average rate of change per hour in the temperature is 0.83 degrees.
What is the average rate of change per hourTo find the average rate of change per hour, we need to divide the total change in temperature by the number of hours over which the temperature changed.
The temperature rose by 5 degrees from 6:00 am to 12:00 pm, which is a period of 6 hours.
Therefore, the average rate of change per hour can be calculated as follows:
average rate of change per hour = total change in temperature / number of hours
So, we have
average rate of change per hour = 5 degrees / 6 hours
average rate of change per hour = 0.83 degrees/hour (rounded to two decimal places)
So, the average rate of change per hour is 0.83 degrees.
Read more about rate of change at
https://brainly.com/question/17131025
#SPJ1
Select the correct answer from each drop-down menu.Consider this equation.First Step is to 1. take the cube root of both sides. 2. Add x to both sides. 3. cube both sidesSecond Step is 1. Add the cube root of X to both sides. 2. Cube both sides. 3. Add the cube of x to both sidesSolving this equation for x initially yields 1. Two possible Solutions. 2. One possible solution. 3. Three possible solutionsChecking the Solutions show that. 1. 0 and 2 are valid solutions. 2. only 0 is valid. 3. -2,0, and 2 are valid solutions. 4. None are valid
First step is to add x to both sides.
Second step is cube both sides.
Solving this equation for x initially yields three possible solutions.
\(\begin{gathered} (4x)^{\frac{1}{3}}-x=0 \\ (4x)^{\frac{1}{3}}=x \\ 4x=x^3 \\ x^3-4x=0 \\ x(x^2-4)=0 \\ then_{} \\ x=0 \\ or \\ x^2-4=0 \\ x^2=4 \\ x=\pm2 \end{gathered}\)Checking the solutions show that -2, 0 and 2 are valid solutions.
K-7: Write a conversation with your friend in Telugu explaining the symmetry you observe in nature
A conversation with your friend explaining the symmetry you observe in nature is given below.
What is the conversation about?Me: Hey, have you ever noticed how symmetrical nature can be?
Friend: What do you mean?
Me: Well, think about things like snowflakes, leaves, and flowers. They all have a certain amount of symmetry to them.
Friend: Yeah, I guess I've noticed that before. But why is that?
Me: It's actually because of the way that nature grows and develops. The growth of these things is guided by physical laws and processes that tend to produce symmetrical shapes.
Learn more about symettry on
https://brainly.com/question/1002723
#SPJ1
Solve the system of equation (only real solutions) by the elimination method. Check your solutions.
x² + y^2 + 2x = 25
x² + 4y^2 + 3x = 32
9514 1404 393
Answer:
(-17/3, -√38/3), (-17/3, √38/3), (4, -1), (4, 1)
Step-by-step explanation:
We can subtract the second equation from 4 times the first to obtain a quadratic in x, with y eliminated.
4(x² +y² +2x) -(x² +4y² +3x) = 4(25) -(32)
3x² +5x -68 = 0 . . . . . simplify to standard form
(3x +17)(x -4) = 0 . . . . . factor
x = -17/3, +4 . . . . . . . . . solutions that make the factors zero
The corresponding values of y can be found from ...
y = ±√(25 -x(2 +x)) . . . . solve the first equation for y
For x = -17/3, we get ...
y = ±√(25 -(-17/3)(2 -17/3)) = ±√(38/9) = ±(√38)/3 ≈ ±2.05480
For x = 4, we get ...
y = ±√(25 -4(2 +4)) = ±1
__
The solutions are ...
(-17/3, -√38/3), (-17/3, √38/3), (4, -1), (4, 1)
David and Denise share n pears in the ratio 4:9. If n = 39 how many pears does David have?
Answer:
David has 12 pears.
Step-by-step explanation:
4 + 9 = 13
39 / 13 = 3
3 x 4 = 12
3 x 9 = 27
in how many ways can we pick three different numbers out of the group 1,2,3, . .. ,100 such that the largest number is larger than the product of the two smaller ones? (the order in which we pick the numbers does not matter.)
We can pick three different numbers in 161700 ways out of the group 1,2,3, . .. ,100 such that the largest number is larger than the product of the two smaller ones.
It is possible to pick three different numbers out of the group 1,2,3, . .. ,100 such that the largest number is larger than the product of the two smaller ones.
The order in which we pick the numbers does not matter. To calculate how many ways this can be done, we can use the following formula:
Number of ways = (100*99*98)/(3*2*1) = 161700.
Therefore, there are 161700 different ways to pick three different numbers out of the group 1,2,3, . .. ,100 such that the largest number is larger than the product of the two smaller ones.
To learn more about number, click here:
https://brainly.com/question/17429689
#SPJ4
A= (3x-12) b=(4x-25)
Answer:
Step-by-step explanation:
Which table shows only values that represent the following relationship between q andre r= q + 10.1 9 q 9 9 5 50.5 5 15.1 5 10.6 5 15.1 A 7 70.7 B 7 17.1 с 7. D 10.8 7 15.3 9 90.9 9 19.1 9 11.0 9 15.5 11 111.1 11 21.1 11 11.2 11 15.7
Answer:
B
Step-by-step explanation:
r=q+10.1
• take q=5 then r= 5+10.1= 15.1
• take q=7 then r= 7+10.1= 17.1
• take q=9 then r= 9+10.1= 19.1
• take q=11 then r= 11+10.1= 21.1
How do you solve the compound inequality? 6 – x > 15 or 2x – 9 ≥ 3
Answer:
x < -9 or x ≥ 6
Step-by-step explanation:
6 – x > 15 or 2x – 9 ≥ 3
Solve each inequality
6-x > 15
Subtract 6 from each side
6-x-6 > 15-6
-x > 9
Multiply by -1 remembering to flip the inequality
x < -9
Then the other inequality
2x – 9 ≥ 3
Add 9 to each side
2x -9+9≥ 3 +9
2x≥ 12
Divide by 2
2x/2 ≥ 12/2
x ≥ 6
Put back together
x < -9 or x ≥ 6
If $300 is invested at a rate of 5% per year and is compounded quarterly, how much will the investment be worth in 20 years?
Use the compound interest formula A equals P times the quantity 1 plus r divided by n end quantity raised to the power of n times t..
$810.45
$515.28
$384.61
$109.67
Answer:
(a) $810.45
Step-by-step explanation:
You want the value of an investment of $300 earning 5% interest compounded quarterly for 20 years.
Compound interestThe compound interest formula tells you the value is ...
A = P(1 +r/n)^(nt)
where P = 300, r = 0.05, n = 4, t = 20.
Using the given parameters in the given equation, you find the account value to be ...
A = $300(1 +0.05/4)^(4·20) ≈ $810.45
__
Additional comment
The "rule of 72" tells you the account value will approximately double in a number of years equal to 72 divided by the interest rate percentage: 72/5 = 14.4 years. After 20 years, it will be worth more than that doubled amount, $600. This only leaves one reasonable answer choice.
<95141404393>