Answer:
B
Explanation:
actin and reaction force are equal Newton 3 law
A solution of potassium sulfate dissolved in 750 g of phenol boils at 183.5 degrees Celsius. What is the molal concentration of the solution. Phenol boils at 181.8 degrees Celsius.
A. 0.48 m
B.0.34 m
C.0.21 m
D.0.16 m
Answer:
D.
Explanation:
Yan Lang po Alam ko
2. You are tasked with calculating the average weight of kindergartners in a class of
21 students. Their weights range from a low of 40.5 lbs to a high of 58.6 lbs.
How many significant figures should be in the average that you find?
Which of the following layers of the atmosphere has the coldest temperatures?
A. Thermosphere
B. Mesosphere
C. Exosphere
D. Stratosphere
Answer:
mesosphere
Explanation:
The coldest layer of the atmosphere is known as the mesosphere.
The layers of the atmosphere have the coldest temperatures is mesosphere. Therefore, option B is correct.
What is mesosphere ?The third layer of the atmosphere, the mesosphere, is situated just above the stratosphere and under the thermosphere. As altitude rises, temperature drops in the mesosphere.
The third of the five layers that make up the Earth's atmosphere, the mesosphere, is located between the thermosphere and the stratosphere.
It is distinguished by a temperature that drops with altitude, becoming the coldest region of the entire atmosphere at a minimum of around 55 miles above the surface.
The coldest part of the Earth's atmosphere is the top of the mesosphere, where temperatures can locally drop as low as 100 K (-173°C).
Thus, option B is correct.
To learn more about mesosphere, follow the link;
https://brainly.com/question/13497783
#SPJ6
For electron as a particle, Energy, E=
For an electron as a particle, E = \(1/2mv^2\)
Electron as a particleFor an electron as a particle, the energy E can be described using the equation:
E = \(1/2mv^2\)
where
This equation represents the kinetic energy of the electron, which is the E is the energy
m is the mass of the electronv is the velocity of the electron.energy associated with its motion.
This equation assumes classical mechanics and does not take into account relativistic effects that become significant at high speeds close to the speed of light.
More on electrons can be found here: https://brainly.com/question/12001116
#SPJ1
g You are given a 1.25 gram mixture of calcium nitrate and calcium chloride. You dissolve this mixture in 200.0 mL of water and add an excess of 0.300 M silver nitrate. You collect and dry the white precipitate which forms and find it has a mass of 0.535 grams. Calculate the percent calcium chloride by mass in the original mixture.
Answer:
16.51%
Explanation:
The reaction that takes place is
CaCl₂(aq) + 2AgNO₃(aq) → 2AgCl(s) + Ca(NO₃)₂(aq)Meaning that the white precipitate that formed is AgCl. Now we convert 0.535 g of AgCl into moles, using its molar mass:
0.535 g ÷ 143.43 g/mol = 0.00373 mol AgClThen we convert 0.00373 moles of AgCl into moles of CaCl₂, using the stoichiometric coefficients:
0.00373 mol AgCl * \(\frac{1molCaCl_2}{2molAgCl}\) = 0.00186 mol CaCl₂We convert moles of CaCl₂ into grams, using its molar mass:
0.00186 mol CaCl₂ * 110.98 g/mol = 0.206 gFinally we calculate the percent of CaCl₂ by mass in the original mixture:
0.206 g / 1.25 g * 100% = 16.51%The percent calcium chloride by mass in the original mixture is 16.4%
The equation of the reaction between calcium nitrate and silver chloride is:
\(\mathbf{CaCl_2 + 2AgNO_3 \to 2 AgCl+Ca(NO_3)_2}\)
Given that;
the weight mass of the white precipitate formed is = 0.535 gramsthe number of moles of the precipitated AgCl is:
= 0.535 g / 143.32 g/mol
= 0.0037 moles
From the above reaction, If 2 moles of AgCl are formed by 1 mole of CaCl2
Then, 0.0037 moles of AgCl will form (0.0037 × 1)/2 moles of CaCl2.
0.0037 moles of AgCl will form 0.00185 moles of CaCl2.
Now, we can say that the number of moles of CaCl2 present in the mixture is = 0.00185 moles
Mass amount of CaCl2 present = 0.00185 moles × 110.98 g/mol
Mass amount of CaCl2 present = 0.205 grams
Finally, the mass percentage \(\mathbf{=\dfrac{0.205}{1.25}\times 100\%}\)
= 16.4%
Therefore, we can conclude that the percent calcium chloride by mass in the original mixture is 16.4%
Learn more about mass percentage here:
https://brainly.com/question/23991850?referrer=searchResults
propose a solution to decrease the total amount of chemical pesticides used in britain for agriculture.
What is genetic modified organisms?
genetically modified organism (GMO) is associate animal, plant, or germ whose DNA has been altered victimization gene-splicing techniques. For thousands of years, humans have used breeding ways to change organisms.
Many GMO crops are wont to create ingredients that Americans eat adore cornstarch, corn syrup, corn oil, soybean oil, canola oil, or coarse sugar. many contemporary fruit and vegetables are on the market in GMO varieties, together with potatoes, summer squash, apples, papayas, and pink pineapples
Hence solutions are:
The response proposes an answer such as the subsequent for decreasing the full quantity of chemical pesticides employed in United Kingdom of Great Britain and Northern Ireland for agriculture:
Use genetically changed organisms () that are designed for gadfly resistance. observe integrated pest-management techniques to regulate pests.
Hence use of Genetic modified organisms is solution.
To know more about Genetic modified organisms please visit:
https://brainly.com/question/21411587
#SPJ4
Fluoride, a very stable form of fluorine, is often added to toothpaste and drinking water to prevent
tooth decay. What is the formula of this species?
a. F
b. Fl-
C. Fl+
d. F²-
I HAVE 25 MINUTES TO FINISH True or false the deeper you go into Earth the temperature goes up ?
Answer:
true
Explanation:
you are getting closer to the core hope this helps!
What might happen if an endocrine hormone such as thyroid hormone was controlled by positive instead of negative feedback?
Answer:
cdg I will be a little late to the party but I have to go to the store and get ❤️❤️❤️❤️❤️❤️
PLEASE HELP ASP...Patsy wants to find out that it would take her to walk a 10 K (10 km) if she maintains a
pace of 6.5 km/hr. How long will it take her?
Answer:
I tried doing the math I believe it is 0.65 min. converted is an 1 hour and 5 min
40 g of ice at 0 °C and 80 g water at 40 oC are mixed thoroughly, the temperature of the mixture will be
The temperature of the mixture will be approximately 32°C.
To determine the final temperature of the mixture, we can use the principle of conservation of energy. The energy gained or lost by a substance can be calculated using the equation:
Q = m * c * ΔT
where:
Q = heat energy gained or lost
m = mass of the substance
c = specific heat capacity of the substance
ΔT = change in temperature
Let's calculate the heat energy gained or lost by each component separately and then equate them to find the final temperature.
For ice:
m_ice = 40 g
c_ice = 2.09 J/g°C (specific heat capacity of ice)
ΔT_ice = final temperature - 0°C (change in temperature)
Q_ice = m_ice * c_ice * ΔT_ice
For water:
m_water = 80 g
c_water = 4.18 J/g°C (specific heat capacity of water)
ΔT_water = final temperature - 40°C (change in temperature)
Q_water = m_water * c_water * ΔT_water
According to the principle of conservation of energy, the heat lost by the water will be equal to the heat gained by the ice:
Q_water = -Q_ice
Now let's substitute the respective values and solve for the final temperature:
m_water * c_water * ΔT_water = -m_ice * c_ice * ΔT_ice
80 g * 4.18 J/g°C * (final temperature - 40°C) = -40 g * 2.09 J/g°C * (final temperature - 0°C)
Simplifying the equation:
334.4 * (final temperature - 40) = -83.6 * final temperature
334.4 * final temperature - 13376 = -83.6 * final temperature
334.4 * final temperature + 83.6 * final temperature = 13376
418 * final temperature = 13376
final temperature = 13376 / 418
final temperature ≈ 32°C
Therefore, the temperature of the mixture will be approximately 32°C.
To learn more about conserconservation of energy from the given link
https://brainly.com/question/27422874
https://brainly.com/question/166559
Use the Lewis model to determine the formula for the compound that forms from each pair of atoms.
K and I
Express your answer as a chemical formula.
Answer:
KI
Explanation:
K is 1+ & I is 1- so we need 1 of each to balance out the compound.
Consider a metal ion with the outer electron configuration of d4. In a coordination complex, the number of unpaired electrons in that metal ion depends on the orientation and type of ligands that surround it. Classify each description of a complex by the number of unpaired electrons in the d4 metal ion. Hint: read pages 1061 and 1062 in the 8th edition Silberberg book. 1. square planar strong field [Select] 2. octahedral weak field [Select] < 3. tetrahedral strong field [Select] 4. octahedral strong field [Select] 5. tetrahedral weak field [Select ] 6. square planar weak field [Select]
complexes can be classified based on number of unpaired electron as follows square planar strong field: 2 unpaired electrons, octahedral weak field: 4 unpaired electrons, tetrahedral strong field: 2 unpaired electrons, octahedral strong field: 0 unpaired electrons, tetrahedral weak field: 4 unpaired electrons, square planar weak field: 4 unpaired electrons.
In a coordination complex, the number of unpaired electrons in the metal ion depends on the strength of the ligand field and the orientation of the ligands. Strong field ligands have a higher affinity for the d orbitals and can more effectively stabilize them, leading to a lower number of unpaired electrons in the metal ion.
Weak field ligands have a lower affinity for the d orbitals and do not stabilize them as effectively, leading to a higher number of unpaired electrons in the metal ion. The number of unpaired electrons also depends on the orientation of the ligands, with an octahedron (6 ligands) and a tetrahedron (4 ligands) leading to different numbers of unpaired electrons.
To know more about coordinate bond
https://brainly.com/question/23847201
#SPJ4
How do ionic bonds differ from covalent bonds?
What is the number of moles in 3.0 X 10^24 atoms of Carbon
Answer:the number of moles represented by 3.0 x 10^24 atoms of Ag is 0.500mol 0.500 m o l .
Explanation:
I am very confused on how to do this please read the following attachments
Answer:
you will add then subtract to get the answer
Which change to the ecosystem had the largest effect on the the population of trout in Wisconsin?
The largest effect on the population of trout in Wisconsin was caused by the introduction of non-native species into the ecosystem.
The introduction of non-native species into an ecosystem can cause a disruption in the food chain, leading to a decrease in the population of native species. In Wisconsin, the introduction of non-native species such as the brown trout and rainbow trout has had a significant impact on the population of native brook trout.
The non-native species compete with the native brook trout for food and habitat, which has led to a decrease in the brook trout population. This highlights the importance of preserving the natural balance of ecosystems and avoiding the introduction of non-native species.
To know more about ecosystem, click here.
https://brainly.com/question/13979184
#SPJ1
The Law of Conservation of Matter states that in a chemical reaction matter cannot be ___ or ____
Answer:
The law of conservation of matter states that in a chemical reaction matter cannot be created or destroyed
Explanation:
5. The density of water at 4.00°C is 0.967 g/mL. How many molecules of water are present in a 499.8 mL bottle of water? Express your answer to the correct number of significant figures
There are approximately 1.62 x 10^25 water molecules in the 499.8 mL bottle of water.
To determine the number of water molecules in the given volume of water, we need to use the relationship between mass, volume, and molar mass of water.
First, we need to find the mass of water in the bottle:
Mass = Density * Volume
Mass = 0.967 g/mL * 499.8 mL = 483.9 g
Next, we need to convert the mass of water to moles using the molar mass of water. The molar mass of water (H2O) is approximately 18.015 g/mol.
Moles = Mass / Molar mass
Moles = 483.9 g / 18.015 g/mol = 26.88 mol
Finally, we can calculate the number of water molecules using Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.
Number of molecules = Moles * Avogadro's number
Number of molecules = 26.88 mol * (6.022 x 10^23 molecules/mol) = 1.62 x 10^25 molecules
Therefore, there are approximately 1.62 x 10^25 water molecules in the 499.8 mL bottle of water.
for more questions on molecules
https://brainly.com/question/24191825
#SPJ8
To determine the density of an irregularly shaped object, a student immersed the object in 22.2 mL of water in a
graduated cylinder, causing the level of the water to rise to 37.8 ml. If the object had a mass of 22.4 g, what is the
density of the object?
Answer:
Explanation:
The density would be 4.
Wyndirbu lie the following best describes the role played by
hydraulic fluid a hydraulic machine?
А
A source of fuel
B
A medium for the transfer of force
С
A coolant
D
A cleaning agent
Help pls
The role played by hydraulic fluid in a hydraulic machine is as a medium for
the transfer of force.
Hydraulic fluid is used primarily in a hydraulic machine for the transfer of
force from one point to another. This makes the system able to perform the
required functions.
Hydraulic fluid also has other functions such as being a coolant and as a
cleaning agent(removal of contaminants) which aren't its major function.
Read more on https://brainly.com/question/25514384
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A student is tasked with writing the net ionic equation for the following
reaction:
4
Al(s) + 3 AgNO3(aq) → Al(NO3)3(aq) + 3 Ag(s)
What is the net ionic equation?
The net ionic equation of the reaction is as follows:
4 Al3+(aq) + 12 NO3-(aq) + 3 Ag(s) = 4 Al(s) + 12 Ag+(aq) + 12 NO3-(aq)
Ions which remain in their ground state and do not take part in the reaction are called spectator ions. The net ionic equation cancels out these ions, which are present on both the reactant and product sides of the equation.
Spectator ions, which can be found on both the reactant and product sides, but are not included in the finished reaction from the net ionic equation. The \(NO^3^-\) ions are spectator ions in this example, thus taking them out of the equation. The net ionic equation makes up the rest of the species.
Learn more about spectator ions, here:
https://brainly.com/question/15053039
#SPJ1
A sample of helium gas initially at 37.0 C , 785 torr and 2.00 L was heated to 58.0 C while the volume expanded to 3.24 L . What is the final pressure in atm ?
Answer:
T1 = 37.0 + 273.15 = 310.15 K P
Explanation:
hope this helps
50 points, and I’ll mark as brainliest!!!!!
Tasks are in the picture.
pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.
Thus, The pH of a solution is defined mathematically as the negative logarithm of the molar concentration of hydrogen ions therein.
NaOH is a strong alkaline, as indicated by a pH testing strip, but in order to determine its exact pH, you must first determine its molarity.
A scale known as pH is used to describe how basic or acidic a water-based solution is. Basic solutions have a higher pH than acidic solutions, which have a lower pH.
Thus, pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.
Learn more about pH, refer to the link:
https://brainly.com/question/15289741
#SPJ1
The pH of HNO₂ is 2.15, pH of NH₄OH is 10.98 and pH of H₂S is 3.76.
pH is defined as the negative logarithm of H⁺ ion concentration.
pH is a measure of how acidic or basic a substance is. In our everyday routine, we encounter and drink many liquids with different pH. Water is a neutral substance. Soda and coffee are often acidic.
The pH is an important property, since it affects how substances interact with one another and with our bodies. In our lakes and oceans, pH determines what creatures are able to survive in the water.
Given,
1. Concentration = 0.1
Ka = 4.5 × 10⁻⁴
\(pH = \frac{1}{2} (pka - log c)\)
pH = 0.5 × ( 3.3 + 1)
= 2.15
2. Concentration = 0.05
Ka = 1.8 × 10⁻⁵
\(pOH = \frac{1}{2} (pkb - log c)\)
pOH = 0.5 × ( 4.74 + 1.3)
= 3.02
pH = 14 - pOH
= 14 - 3.02
= 10.98
3. Concentration = 0.3
Ka = 1 × 10⁻⁷
\(pH = \frac{1}{2} (pka - log c)\)
pH = 0.5 × ( 7 + 0.52)
= 3.76
Learn more about pH, here:
https://brainly.com/question/15289714
#SPJ1
Guys! I need a long inforation about...
"Colloidal solutions
Types of colloids
Formation of colloids"
Please! And thank you
A colloid is a mixture in which one substance of microscopically dispersed insoluble particles are suspended throughout another substance. However, some definitions specify that the particles must be dispersed in a liquid, and others extend the definition to include substances like aerosols and gels.
The types of colloids includes sol, emulsion, foam, and aerosol.
Sol is a colloidal suspension with solid particles in a liquid.Emulsion is between two liquids.Foam is formed when many gas particles are trapped in a liquid or solid.Aerosol contains small particles of liquid or solid dispersed in a gas.Explanation:
everything can be found in the picture
This is a quiz not a question from cambridge!
What is 2NaOH + Cl2→NaCl + NaOCl + H2O???
Answer::::
As products sodium chloride, sodium chlorate(I) and water are given. Hot concentrated Chlorine reacts with hot and concentrated sodium hydroxide solution to form sodium chloride and sodium chlorate.
Answer:
the answer is it's a balance chemical equation.
Explanation:
hope this helps u!!
Concentrated sufuric acid has a concentration of 18.4 M. 1 mL of concentrated sulfuric acid is added to 99 mL of a solution containing 0.505M*H_{2}*S and 0.505 M HS what is the resulting pH of that solution?
The resulting pH of the solution is 1.74(approx).
To solve this problem, we need to use the concept of acid-base equilibrium and the pH scale. The addition of sulfuric acid will increase the concentration of H+ ions in the solution, which will shift the equilibrium of the \(H_2S\)/HS- system. We can use the following equation to calculate the pH of the resulting solution:
Ka = [H+][HS-]/\(H_2S\)]
where Ka is the acid dissociation constant for \(H_2S\), [\(H_2S\)], [HS-], and [H+] are the concentrations of the \(H_2S\), HS-, and H+ ions, respectively.
First, we need to calculate the initial concentrations of\(H_2S\) and HS- in the solution:
[\(H_2S\)] = 0.505 M
[HS-] = 0.505 M
Next, we need to calculate the amount of H+ ions added to the solution by 1 mL of concentrated sulfuric acid. To do this, we can use the following equation:
[H+] = (n/V) = (18.4 mol/L) x (1x\(10^{-3}\) L) = 1.84 x\(10^{-2}\)mol
where n is the amount of sulfuric acid added in moles, V is the volume of the solution in liters, and 18.4 mol/L is the concentration of the sulfuric acid.
Now, we can calculate the new concentrations of \(H_2S\), HS-, and H+ ions in the solution:
[\(H_2S\)] = [\(H_2S\)]0 - [H+] = 0.505 - 1.84x\(10^{-2}\)= 0.486 M
[HS-] = [HS-]0 + [H+] = 0.505 + 1.84x\(10^{-2}\) = 0.524 M
[H+] = 1.84 x \(10^{-2}\)M
Finally, we can use the equation for Ka to calculate the pH of the resulting solution:
Ka = 1.1 x \(10^{-7}\)
[H+] x [HS-]/[\(H_2S\)] = Ka
pH = -log[H+]
Substituting the values, we get:
(1.84 x \(10^{-2}\)) x (0.524)/(0.486) = 1.98 x \(10^{-2}\)
pH = -log(1.98 x \(10^{-2}\)) = 1.74(approx)
Therefore, the resulting pH of the solution is 1.74(approx)
Know more about pH here:
https://brainly.com/question/26856926
#SPJ11
Duncan takes a break from studying and goes to the gym to swim laps if swimming burns, 615,000 cal per hour, how many kilojoules does swimming burn in the same amount of time?
A lung holding a residual air volume of 1.50 L at 36 ºC has a pressure of 1.00 atm. How many moles of residual air is the lung holding? R = 0.0821 L.atm/mol.K.
Answer:
0.05909882564 mol
Explanation:
PV=nRT
n = 1.00atm*1.50L /(0.0821L.atm/mol.k * 309.15 k)
= 0.05909882564 mol