a fictional element has two isotopes, each making up 50% of the population. isotope 1 has a mass of 80.0 amu, isotope 2 has a mass of 85.0 amu. calculate the atomic mass of the fictional element.

Answers

Answer 1

The atomic mass of a fictional element can be calculated by finding the weighted average of the masses of its isotopes, taking into account their relative abundances. the atomic mass of the fictional element is 82.5 amu.

By calculating the weighted average of the masses of an imaginary element's isotopes while accounting for their relative abundances, it is possible to determine the element's atomic mass.

Since 50% of the population is represented by each of the two isotopes of the hypothetical element, we can determine the weighted average as follows:

Atomic mass is equal to (mass of isotope 1 times its fraction) plus (mass of isotope 2 times its fraction)

Atomic mass is equal to (80.0 amu*0.5) plus (85.0 amu*0.5).

Nuclear mass is 82.5 amu.

As a result, the hypothetical element has an atomic mass of 82.5 amu.

For more such questions on fictional element, Refer:

https://brainly.com/question/4258277

#SPJ4


Related Questions

1. A newspaper article wrote about a study in which researchers subjected laboratory gloves to stress. Among 240 vinyl gloves, 63% leaked. Among 240 latex gloves, 7% leaked. Calculate the claim that vinyl gloves have a higher leak rate than latex gloves. Use 0.005 significance level.

Answers

The claim that vinyl gloves have a higher leak rate than latex gloves is supported by the study at a significance level of 0.005.

To determine if vinyl gloves have a higher leak rate than latex gloves, we can conduct a hypothesis test.

The z-value is calculated as:

z = (p₁ - p₂) / √((p₁(1 - p₁) / n₁) + (p₂(1 - p₂) / n₂))

where p₁ and p₂ are the sample proportions, and n₁ and n₂ are the sample sizes.

Certainly! Let's calculate the z-value to determine if vinyl gloves have a higher leak rate than latex gloves.

For vinyl gloves:

Sample size (n₁) = 240

Leaking gloves (x₁) = 0.63 * 240 = 151.2 (approximated to 151)

For latex gloves:

Sample size (n₂) = 240

Leaking gloves (x₂) = 0.07 * 240 = 16.8 (approximated to 17)

We will calculate the z-value using the formula:

z = (p₁ - p₂) / √((p₁(1 - p₁) / n₁) + (p₂(1 - p₂) / n₂))

where p₁ and p₂ are the sample proportions.

p₁ = x₁ / n₁ = 151 / 240 ≈ 0.629

p₂ = x₂ / n₂ = 17 / 240 ≈ 0.071

Calculating the z-value:

z = (0.629 - 0.071) / √((0.629 * (1 - 0.629) / 240) + (0.071 * (1 - 0.071) / 240))

z ≈ 13.239

The calculated z-value is approximately 13.239. To determine if the claim is supported, we compare this value to the critical z-value for a one-tailed test at a significance level of 0.005.

learn more about significance level Here:

https://brainly.com/question/30766149

#SPJ4

How does carbon cycle through the ocean, atmosphere, soil, and biosphere?

Answers

Carbon moves from one storage reservoir to another through a variety of mechanisms. For example, in the food chain, plants move carbon from the atmosphere into the biosphere through photosynthesis. Respiration, excretion, and decomposition release the carbon back into the atmosphere or soil, continuing the cycle.
make sure to paraphrase and give thanks:) good luck

NEED THIS ASAP PLEASE HELP
Which of these is an example of a physical change?
A. a banana ripening in the air
B. hydrogen burning in the air
C. zinc reacting with an acid
D. liquid water turning into vapor

Answers

Answer:

A

Explanation:

Banana ripening in air is an example of oxidation reaction.

I am used for making sari and I obtained from animals who am I​

Answers

Answer:

used for making sari obtained from animal is silk

After benzocaine is mixed with hydrochloric acid, it will be _______ and soluble in the ________.

Answers

After benzocaine is mixed with hydrochloric acid, it will be 4-aminobenzoic acid and soluble in the water.

Benzocaine, sold beneath the counter emblem called Orajel amongst over-the-counters, is an ester nearby ones over the counter normally used as a topical ache reliever or in cough drops. it's a far over-the-counter lively factor in many ones over counter ointments consisting of merchandise for oral ulcers.

Benzocaine is used to relieve aches and itching resulting from conditions that include sunburn or different minor burns, insect bites or stings, poison ivy, poison oak, poison sumac, minor cuts, or scratches.

Benzocaine is a local over-the-counter used in pain manage management, and it's far over-the-counter ester neighborhood ones over-the-counter elegance of medication. This pastime describes over-the-counter symptoms, actions, and contraindications for benzocaine as a valuable agent in coping with ache control.

Learn more about benzocaine here:-https://brainly.com/question/16821258

#SPJ4

suppose you separate a 2.18 g mixture of sand and salt and recover 1.61 g of salt. what is the percent by mass of salt in the mixture?

Answers

In reference to the given data concerning the separation of the mixture, the percent by mass of salt in the mixture is 73.9%.

Finding the percent by mass of salt in the mixture

To find the percent by mass of salt in the mixture, we need to divide the mass of salt by the total mass of the mixture and multiply by 100.

First, we need to calculate the mass of sand in the mixture:

Mass of sand = Total mass of mixture - Mass of salt

Mass of sand = 2.18 g - 1.61 g = 0.57 g

Now we can calculate the percent by mass of salt in the mixture:

Percent by mass of salt = (Mass of salt / Total mass of mixture) x 100%

Percent by mass of salt = (1.61 g / 2.18 g) x 100%

The percent by mass of salt = 73.9%

Therefore, the percent by mass of salt in the mixture is 73.9%.

To know more about  percent by mass, visit:https://brainly.com/question/14990953

#SPJ4

How many sulfur atoms will you need to react with two atoms of Gallium 2

Answers

You will need four sulfur atoms to react with two atoms of gallium. This is because each sulfur atom will react with one gallium atom, forming a compound with the chemical formula Ga₂S₃.

What is gallium atom?

Gallium is a chemical element with the symbol Ga and atomic number 31. It is a soft, silvery-white metal used primarily in electronics and semiconductors. It is also used in alloys and to make low-melting alloys, such as gallium-indium-tin and gallium-arsenide. Gallium has a relatively low melting point of 29.7646°C (85.5763°F) and is liquid near room temperature. It is also one of the few metals that expand upon freezing. Gallium is a metal of the boron group, and is one of the few metals that are not toxic. It is used in applications such as fluorescent light bulbs, high-temperature thermometers, and solar cells. Gallium is also used in the production of integrated circuits, semiconductors, and transistors.

To learn more about gallium atom
https://brainly.com/question/4036727
#SPJ1

How many unhybridized p orbitals are there around the central atom of beryllium chloride, becl2?.

Answers

Around the centre beryllium atom, there are two zones of electron density that will arrange themselves in a linear geometry. There must be two unhybridized p orbitals in BeCl2 since beryllium must be sp hybridised.

The areas of electron density are corresponding to hybridised orbitals. The number of unhybridized p orbitals can be calculated by deducting the number of electron density regions from the maximum number of hybridised 1s and 3p orbitals, which is 4.

What is the unhybridized orbital?

The common atomic orbitals that we are familiar with are those that are not hybridised. Orbitals that are hybridised are made up of a variety of unhybridized orbitals. These orbitals aid in determining the shape of molecules by illuminating the actual bonding process.

To know more about orbitals , visit:

https://brainly.com/question/18914648

#SPJ4

calculate the standard free-energy change, in kilojoules, at 25 °c for the reaction 3 pb (s) 2 fe3 (aq) → 3 pb2 (aq) 2 fe (s) e∘cell = 0.090 v
a. 52 kJ b. -52,000 kJ c. -52 kJ d. -26 kJ

Answers

The answer is (c) -52 kJ by using the formula the formula for calculating the standard free-energy change (ΔG°) is:
ΔG° = -nFE°

Where n is the number of moles of electrons transferred in the balanced chemical equation, F is the Faraday constant (96,485 C/mol e^-), and E° is the standard cell potential.

In this case, the balanced chemical equation is:

3 Pb(s) + 2 Fe3+(aq) → 3 Pb2+(aq) + 2 Fe(s)

The number of moles of electrons transferred is 6 (3 electrons for each of the two Fe3+ ions). So n = 6.

The standard cell potential is given as E°cell = 0.090 V.

Plugging these values into the formula, we get:

ΔG° = -nFE°
ΔG° = -(6 mol e^-)(96,485 C/mol e^-)(0.090 V)
ΔG° = -52,006 J
ΔG° = -52 kJ (rounded to the nearest kilojoule)

Therefore, the answer is (c) -52 kJ.

To calculate the standard free-energy change (ΔG°) for the reaction, you can use the equation ΔG° = -nFE°_cell, where n is the number of moles of electrons transferred, F is the Faraday constant (96,485 C/mol), and E°_cell is the standard cell potential.

In this reaction, 3Pb (s) + 2Fe3+ (aq) → 3Pb2+ (aq) + 2Fe (s), the number of moles of electrons transferred (n) is 6 (2 electrons for each Pb, 3Pb in total).

ΔG° = -nFE°_cell = -6 × 96,485 C/mol × 0.090 V

ΔG° = -519,570 J/mol or -52 kJ/mol (rounded to nearest kJ)

So, the correct answer is c. -52 kJ.

Visit here to learn more about  free-energy : https://brainly.com/question/15319033
#SPJ11

To calculate the standard free-energy change (ΔG°) at 25°C for the reaction 3 Pb(s) + 2 Fe³⁺(aq) → 3 Pb²⁺(aq) + 2 Fe(s) with E°cell = 0.090 V, follow these steps:

1. Use the formula: ΔG° = -nFE°cell, where n is the number of moles of electrons transferred, F is Faraday's constant (96,485 C/mol), and E°cell is the standard cell potential.

2. Determine the number of moles of electrons transferred (n) by balancing the half-reactions:
  Pb(s) → Pb²⁺(aq) + 2e⁻ (oxidation half-reaction)
  Fe³⁺(aq) + 3e⁻ → Fe(s) (reduction half-reaction)
  Multiply the first half-reaction by 3 and the second half-reaction by 2 to balance the number of electrons:
  3Pb(s) → 3Pb²⁺(aq) + 6e⁻
  2Fe³⁺(aq) + 6e⁻ → 2Fe(s)
  Therefore, n = 6.

3. Plug the values into the formula: ΔG° = -6 * 96,485 * 0.090.

4. Calculate ΔG°: ΔG° = -51,960 J or -51.96 kJ.

The closest answer is (c) -52 kJ. So, the standard free-energy change at 25°C for this reaction is approximately -52 kJ.

To know more about standard free-energy change:

https://brainly.com/question/13625901

#SPJ11

What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?

Answers

The balanced equation for this reaction is:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).

Learn more about the condensation reaction:

brainly.com/question/6256866

#SPJ11

A solution containing 28.85 mg of an unknown protein per 29.0mL of solution was found to have an osmotic pressure of 3.28 torr at 16 C

Answers

To calculate the molar mass of the unknown protein, we can use the formula for osmotic pressure:

π = (n/V)RT

where:

π is the osmotic pressure,

n is the number of moles of solute,

V is the volume of the solution in liters,

R is the ideal gas constant (0.0821 L·atm/(mol·K)), and

T is the temperature in Kelvin.

First, let's convert the given values to the appropriate units:

Mass of protein = 28.85 mg = 0.02885 g

Volume of solution = 29.0 mL = 0.0290 L

Osmotic pressure = 3.28 torr

Now, we rearrange the osmotic pressure formula to solve for n:

n = (πV) / (RT)

Substituting the values:

n = (3.28 torr * 0.0290 L) / (0.0821 L·atm/(mol·K) * 289 K)

n ≈ 0.0386 mol

Next, we can calculate the molar mass (M) of the protein using the formula:

M = mass / moles

M = 0.02885 g / 0.0386 mol

M ≈ 0.746 g/mol

Therefore, the molar mass of the unknown protein is approximately 0.746 g/mol.

Learn more about  osmotic pressure here:

https://brainly.com/question/29823250

#SPJ11

how many sodium atoms are there in 6.0 g of na3n

Answers

There are 2.928 x 10²³ sodium atoms in 6.0 g of Na₃N.

This can be calculated as follows:

The molar mass of Na₃N= (23g + 14g) = 27g

wherein 23g is the molar mass of Na and 14g is the molar mass of N.

So, in 1 mole (37g) there is Avagadro,s number(Na) of Na₃N molecules, and sodium atoms are 3(Na)in number.

Now,

37g of Na₃N  = 1mole of Na₃N

Given mass of Na₃N = 6g

⇒6g of Na₃N  = 6/37 g=0.162 mole of Na₃N

So, 1mole of Na₃N has Na molecules, then 0.162 mole of Na₃N will have:

0.162 * Na molecules = 0.162 * 6.023 x 10²³ molecules= 9.76 x 10²² molecules.

Now, since 1 molecule has 3 sodium (Na) atoms, 9.76 x 10²² molecules will have:

3 x 9.76 x 10²² =29.28 x 10²² = 2.928 x 10²³ atoms.

Therefore, in 6.0 g of Na₃N, there will be 2.928 x 10²³ Na atoms.

To know more about sodium atoms, refer here:

https://brainly.com/question/1703949#

#SPJ11

A solution contains 1.27×10 −2
M sodium sulfide and 1.35×10 −2
M potassium hydroxide. Solid iron(III) nitrate is added slowly to this mixture. What is the concentration of sulfide ion when hydroxide ion begins to precipitate? [sulfide] =

Answers

To find the concentration of sulfide ion when hydroxide ion begins to precipitate, we need to determine the point at which the reaction between sodium sulfide and iron(III) nitrate produces a precipitate.

This reaction can be represented by the following balanced equation: Na2S(aq) + Fe(NO3)3(aq) → FeS(s) + 2NaNO3(aq) First, let's write the balanced equation for the reaction between potassium hydroxide and iron(III) nitrate:

3KOH(aq) + Fe(NO3)3(aq) → Fe(OH)3(s) + 3KNO3(aq)

From the balanced equation, we can see that for every 3 moles of potassium hydroxide (KOH), we get 1 mole of Fe(OH)3(s) precipitate.

Therefore, when hydroxide ion begins to precipitate, the concentration of sulfide ion will be equal to the concentration of potassium hydroxide. Given that the concentration of sodium sulfide is 1.27×10^(-2) M and the concentration of potassium hydroxide is 1.35×10^(-2) M, the concentration of sulfide ion [S^2-] at the point of precipitation is also 1.35×10^(-2) M. Therefore, the concentration of sulfide ion when hydroxide ion begins to precipitate is 1.35×10^(-2) M.

To know more about concentration visit:

https://brainly.com/question/30862855

#SPJ11


Explain why, when a force is applied to a piece of steel, it does not break but just
changes its shape.

Answers

Steel is a metal. Metals atoms are able to roll over each other into new positions without breaking the metallic bond. So, steel doesn't break but changes its shape.

Why do the changes to the mass of the star affect the orbital path of earth?

Answers

The changes to the mass of the star affect the orbital path of the earth because the sun exerts a gravitational force on the planet.

What is the meaning of the gravitational forces on a celestial body?

The meaning of the gravitational forces on a celestial body is based on the forces that attract celestial bodies such as in this case occurs with the sun that attracts the earth planet.

Therefore, with this data, we can see that the meaning of the gravitational forces on a celestial body is associated with attractive forces.

Learn more about the gravitational forces here:

https://brainly.com/question/7045923

#SPJ1

Tyler measured the force of his grip. Which is the most likely reading?

A.
190kg

B.
190N

C.
1 lb

D.
20,000 N

E.
5 seconds

F.
18mg

Answers

Answer:

190n

Explanation:

190 190 and because it is easy to understand if you didn't understand my answer ask any man

why can't you balance CaC2 + H2O > Ca(OH)2 + CH4?

Answers

Answer:

Balance The Chemical Equation Cac2 H2o Ca Oh 2 C2h2 Balance the chemical equation CaC 2 + H 2 O → Ca (OH) 2 + C 2 H 2 Calcium carbide react with water to produce calcium hydroxide and acetylene.

Explanation:

CaC2 + H2O > Ca(OH)2 + CH4

Ca + 2 H2O → Ca(OH)2 + H2 - Balanced equation

What is balance equation with example?

A balanced chemical equation occurs when the number of the atoms involved in the reactants side is equal to the number of atoms in the products side. In this chemical reaction, nitrogen (N2) reacts with hydrogen (H) to produce ammonia (NH3). The reactants are nitrogen and hydrogen, and the product is ammonia

What is the balance chemical formula?

Balanced chemical equation - A chemical equation in which the number of each type of atom is equal on the two sides of the equation. Subscripts - Part of the chemical formulas of the reactants and products that indicate the number of atoms of the preceding element.

To learn more about balanced chemical equation, refer

https://brainly.com/question/11345231

#SPJ2

i have a question, what does a man have to do to get the love of his life.

Answers

A man have to get their friend bond with someone they like a lot closer. Then, if the man is ready to confess his feeling, try buying his love of his life their favorite flower or favorite candy/food.

hope this help-(even though im a girl ;v;)

how many moles are there in 9.2g of ethanol

Answers

Answer:

0.199702876850182 that's it

First you need to find the molar mass of ethanol (C2H6O), 46
Then you need to divide the mass by the molar mass. 9.2/46=0.2moles

uifuiiiddiixkxkdkddkdi

Answers

Answer:

haksonnehejskznnd

Explanation:

jdudubebs sbit

how many moles of gaseous boron trifluoride, bf3, are contained in a 4.3410-l bulb at 788.0 k if the pressure is 1.220 atm? how many grams of bf3?

Answers

The total mass of BF3 present is 5.552 g

What do you mean by ideal gas equation?

The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as.

PV = nRT

Where,

P is the pressure of the ideal gas.

V is the volume of the ideal gas.

n is the amount of ideal gas measured in terms of moles.

R is the universal gas constant.

T is the temperature.

Given situation is ,

( P) Pressure of BF3 gas is 1.220 atm

( V) Volume of BF3 is 4.3410L

( T) Temperature of BF3 is 788.0 K

Now, assuming this as an ideal gas,

Let us apply ideal gas equation,

PV = nRT

n = PV/RT = 1.220 atm * 4.3410L / 0.0821 L atm k-1 mol-1 * 788 K

n = 0.08186 moles of BF3 are present.

Now, we know molar mass of BF3 = 67.82 gmol-1

i.e. total mass of BF3 present = Number of moles * molar mass

                                                = 0.08186 * 67.82g mol-1

                                                = 5.552 g of BF3 is present.

To know more about ideal gas equation from the given link:

https://brainly.com/question/20348074

#SPJ4

The melting point of Argon is:


-189 degrees Celcius


-92 degrees Celcius


37 degrees Celcius


14 degrees Celcius

Answers

Answer:

In solid state, melting point of Argon is -189 degrees Celcius.

calculate the pH and pOH when [H+] = .025 M

Answers

The pH of a solution is a measure of the activity of hydrogen ions (H+) in the solution. pOH is a measure of the activity of hydroxide ions (OH-) in a solution.

To calculate pH and pOH, when [H+] = 0.025 M, we can use the equation pH + pOH = 14. First, we calculate pH. Since [H+] is given, we can calculate pH directly from [H+] using the equation pH = -log[H+]. Plugging in [H+] = 0.025 M gives pH = -log(.025) = 2.6.

Next, we can calculate the pOH. Since pH + pOH = 14, we can calculate pOH by subtracting pH from 14. Plugging in pH = 2.6 gives pOH = 14 - 2.6 = 11.4. Therefore, the pH and pOH of a solution with [H+] = 0.025 M are 2.6 and 11.4, respectively.

Learn more about pH  at :

https://brainly.com/question/15289741

#SPJ1

given the following data C =66.7% H =11.1% Calculate the empirical formula of the compund

Answers

First, we calculate the moles of each element taking the percentages as a mass:

\(66,7g\text{ C}\cdot\frac{1\text{ mol C}}{12\text{ g C}}=5,56\text{ mol C}\)\(11,1\text{ g H}\cdot\frac{1\text{ mol H}}{1\text{ g H}}=11,1\text{ mol H}\)

We divided the number of moles by the smaller number of moles. In this case, C is the smallest:

\(5,56\text{ mol C/5,56 =1}\)\(11,1\text{ mol H/5,56=1,99}\approx2\)

These numbers give us the empirical formula wich is: CH2

Give a mess occupied 919 mL in a tri State at STP the same mass when collected over water at 15°C in 750 mmHg pressure occupies 1 L volume calculate vapor pressure at 15°C

Answers

The answer is 28 C in

at physiological ph (7.4), what charge would be observed on the tripeptide khr?

Answers

At physiological pH (pH 7.4), the charge observed on the tripeptide KHR would be +2.

This is because both lysine (K) and arginine (R) have positively charged side chains at this pH. Lysine's amino group (NH3+) and arginine's guanidinium group (NH2+) would both be protonated and carry a positive charge. Histidine's charge is dependent on its protonation state, and at pH 7.4, it can exist in both a protonated (positive charge) and deprotonated (no charge) form.

Since the specific protonation state of histidine in KHR is not provided, we cannot determine its charge contribution. However, considering the positive charges from lysine and arginine, the overall charge of the tripeptide would be +2.

To know more about tripeptide:

https://brainly.com/question/31827580

#SPJ11


Which is the smallest volume?
A
2.3 liters
B
0.4 mL
С
980 cm
D
1050 mL
heat

Answers

The smallest volume is B

A 10.0 g sample of a gas occupies 7.69 L at 1.00 atm and 27.0 C. The gas has been determined to be diatomic. What is the gas

Answers

ANSWER

EXPLANATION

Given that

The mass of the gas is 10.0g

The volume of the gas is 7.69L

The pressure of the gas is 1.00 atm

The temperature of the gas is 27 degrees Celcius

Follow the steps below to find the molar mass of the gas

Step1; Assume the gas is an ideal gas

\(\text{ Pv = nRT}\)

Step 2; Find the number of mole of the gas using the equation above

\(\begin{gathered} \text{ T K = t}\degree C\text{ + 273.15} \\ \text{ T K = 27 + 273.15} \\ \text{ T K = 300.15K} \end{gathered}\)\(\begin{gathered} \text{ R is 0.0825 L.atm . K}^{-1}\text{ mol}^{-1} \\ \text{ 1 }\times\text{ 7.69 = n }\times\text{ 300.15 }\times\text{ 0.08205} \\ \text{ 7.69 = n24.627} \\ \text{ Divide both sides by 24.627} \\ \text{ n = }\frac{7.69}{24.627} \\ \text{ n = 0.312 moles} \end{gathered}\)

Step 3; find the molar mass of the sample

\(\begin{gathered} \text{ mole = }\frac{\text{ mass}}{molar\text{ mass}} \\ \text{ cross multiply} \\ \text{ mass = mole x molar mass} \\ \text{ molar mass =}\frac{mass}{\text{ mole}} \\ \\ \text{ molar mass = }\frac{10}{0.312} \\ \text{ molar mass = 32.05} \end{gathered}\)

Which substance is considered to be neutral on the pH Scale? *
2 points
battery acid
pure water
bleach
ocean water

Answers

Answer:

Pure Water  

Explanation:

Battery acid is well and acid

Bleach is a base

Ocean water is impure so it could lean either way

what is electron shielding?

Answers

Answer:

Electron shielding is when the inner electrons shield the outer electrons from the full force of the nucleus

Electrons in an atom can shield each other from the pull of the nucleus. This effect, called the shielding effect, describes the decrease in attraction between an electron and the nucleus in any atom with more than one electron shell. ... The more shielding that occurs, the further the valence shell can spread out.
Other Questions
Michael bakes a soft pretzel and a loaf of bread. Use the system of equations to find c, the amount of flour, in cups, needed for the soft pretzel, and b, the amount of flour, in cups, needed for the loaf of bread. Show your work. b = 24c(1/4)b + 4c = 5/4 Examine the diagram, where BD is tangent to circle M at point D, and BA is secant to the same circle at points E and A. homophobia and racism are just honestly the worst ways to think what are the main sources of industry? Last forensic science questionWho discovered DNA typing? If A=2x+8 and B=2x4, find an expression that equals 2A+B in standard form. Michael needs at least $200 to buy airpods. He already has $50. If he saves $15 each week, how many weeks will it take for Michael to reach his goal? Write and solve an inequality. graphically, the solution to a system of two independent linear equations is usually Which action constitutes substance abuse? use of psychological medications use of caffeine use of fortified "power" drinks use of medication belonging to someone els as a result of the dust bowl people migrated from ___ to ___.answer: from the Great Plains to the West Why does Turkey have an advantage over other countries in Southwest Asia (Middle East) with regard to the distribution of water? (AKS 42a) A. because Turkeys economy is less dependent on industries that create large amounts of water pollution B. because the Black Sea, the largest source of freshwater in the region, is located off of Turkeys northern coast C. because the Tigris and Euphrates Rivers, two of the primary sources of freshwater in the region, begin in Turkey D. because Turkeys population is less dependent on commercial agriculture than other countries in the region [tex]\huge\mathcal\color{black}QUEStion[/tex] Difference between neurogenic heart and myogenic heart. what is the magnitude e1e1e_1 of the electric field e e at radius r=r= 12.7 cmcm , just outside the inner sphere? 331 students were on a field trip. Six buses were filled and seven students traveled in cars. How many students were in each bus?pls help and dont answer just for points! In a raisin in the sun, who is george murchison?a. A friend of walter's who wants to be partners in the liquor store businessb. One of beneatha's suitors, who is obsessed with moneyc. A representative of the clybourne park new neighbors orientation committeed. A nigerian student who likes beneatha Assume that you purchased 250 shares of a stock for $54 a share, that you received an annual dividend of $1.50 a share, and that you sold your stock for $83 a share at the end of one year. What is the total return for your investment PPP company uses the percentage of sales model to expect sales. The company expects sales to increase by 5% annually over the next five years. If costs are proportional to sales at 70%, and last year's sales were SAR 3,000, what is the projected net income in year 5? What is the main reason for the social contract? Marissa's car accelerates at a rate Of 42.60 m/?. How long does it takefor Marissa's car to accelerate from a speed of 88.5 km/h to a speed of96.5 km/h? A spherical balloon has a radius of 7.15 m and is filled with helium. How large a cargo can it lift, assuming that the skin and structure of the balloon have a mass of 930 kg? Neglect the buoyant force on the cargo volume itself.