A mixture of 0.463 M H2, 0.309 M I2, and 0.905 M HI is enclosed in a vessel and heated to 430 °C.

H2(g)+I2(g)↽−−⇀2HI(g)c=54.3 at 430 ∘C

Calculate the equilibrium concentrations of each gas at 430 ∘C .

Answers

Answer 1

The equilibrium concentrations of each gas at 430 °C is 5.72 M.

What is equilibrium concentration?

Equilibrium concentration is defined as a situation where the rate of forward and reverse reactions in a chemical process are equal. The equilibrium will adjust to minimize the impact of a change in a substance's concentration. If a reactant's concentration rises, the equilibrium will change in favor of the reaction that utilises it, causing the reactant concentration to fall.

Kc = [ Product ]² / [ Reactant ]

Kc = [ 0.905 ]² / [ 0.463 ] [ 0.309 ]

Kc = [ 0.8190 ] / [ 0.14306 ]

Kc = 5.72 M

Thus, the equilibrium concentrations of each gas at 430 °C is 5.72 M.

To learn more about equilibrium concentration, refer to the link below:

https://brainly.com/question/16645766

#SPJ1


Related Questions

The passage's author most vividly conveys the sense that Plumpp's poetry is like music when he
O uses words like "swing," "dance," and "sway" to characterize phrases in Plumpp's poems
O defines Plumpp as "the poet laureate of Chicago jazz and blues"
explains how long Plumpp has been writing about "Chicago jazz giants"
urges people to read Plumpp's poems and listen to the music Plumpp "immortalizes in print"

Answers

It is an amine, and it has less polar nitrogen-hydrogen and oxygen-hydrogen bonds.

A compound's boiling point is a physical characteristic. These intramolecular linkages between the molecules that make up a chemical affect these physical characteristics.

Alcohols and amino acids have the same kind of intermolecular linkages. The hydrogen bond is the name of this kind of bond.

The electrical attraction between a hydrogen atom from one molecule and an electronegative atom from a nearby molecule is known as a hydrogen bond.

The strength of the bond is in the following order: H.....F > H.....O > H......N

The H....N hydrogen bonds exist in amines, whereas the H....O hydrogen bonds exist in alcohols.

Consequently, the alcohol's hydrogen bonds are stronger and it will impart a higher boiling point on the compound.

Learn more about hydrogen bonds here-

https://brainly.com/question/10904296

#SPJ9

Answer:uses world like

Explanation:

PLEASE HELP ME THERES 100 POINTS ON THE LINE

PLEASE HELP ME THERES 100 POINTS ON THE LINE
PLEASE HELP ME THERES 100 POINTS ON THE LINE

Answers

Answer:

1.93 2.86

Explanation:

exactly the reason for the above text

What is the length of an average solar cycle? A. 5 years B. 11 years C. 22 years D. 10 years

Answers

B. A solar cycle usually lasts 11 years.

Ascorbic acid (C₆H₈O₆) is also known as Vitamin C. What quantity in molecules of C₆H₈O₆ does a Vitamin C drink with 1025 mg C₆H₈O₆ contain? Show Math.

Answers

Vitamin C drink with 1025 mg of ascorbic acid contains 3.50 × 10^21 molecules of C6H8O6.

What is Molecules?

A molecule is the smallest particle in a chemical element or compound that has the chemical properties of that element or compound. It is made up of two or more atoms that are chemically bonded together. The atoms can be of the same element, as in the case of diatomic molecules like O2 and H2, or they can be different elements, as in the case of water (H2O) or carbon dioxide (CO2).

First, let's calculate the molar mass of ascorbic acid (C6H8O6):

Molar mass of C = 12.01 g/mol

Molar mass of H = 1.008 g/mol

Molar mass of O = 16.00 g/mol

Molar mass of C6H8O6 = (6 × 12.01) + (8 × 1.008) + (6 × 16.00) = 176.12 g/mol

Now we can use the molar mass to convert the given mass of ascorbic acid into moles:

Number of moles = Mass / Molar mass

Mass of ascorbic acid = 1025 mg = 1.025 g

Number of moles of ascorbic acid = 1.025 g / 176.12 g/mol = 0.00582 moles

Finally, we can use Avogadro's number to convert from moles to molecules:

Number of molecules = Number of moles × Avogadro's number

Number of molecules of C6H8O6 = 0.00582 moles × 6.022 × 10^23 molecules/mol = 3.50 × 10^21 molecules

Learn more about Molecules from the given link

https://brainly.com/question/475709

#SPJ1

A different brand of iron tablet was analysed by Hitration with 0.0093 mol.L" potassium
dichromate via the reaction listed below;
Cr2O72- + 6Fe2+ + 14H+ + 2Cr3+ + 6Fe3+ + 7H20
In this experiment 4 tablets were crushed and dissolved in 200 cm3 of dilute acid. 25cm3
of this solution was used in the titration. The results of the titrations were as follows;
Titration Volume dichromate (cm)
1
33.0
2
32.05
3
32.15
4
32.10
Calculate the concentration of iron used in the titration (4 dp).
C1V1/C2V2 = n/n2

A different brand of iron tablet was analysed by Hitration with 0.0093 mol.L" potassiumdichromate via

Answers

The concentration of iron used in the titration : 0.009 M

Further explanation

Given

Reaction

Cr₂O₇²⁻ + 6Fe²⁺ + 14H⁺ ⇒ 2Cr³⁺ + 6Fe³⁺ + 7H₂O

0.0093 mol/L potassium  dichromate

200 cm³ of dilute acid, 25cm³   was used in the titration.

Required

the concentration of iron

Solution

Titration formula

C₁V₁n₁=C₂V₂n₂⇒ From equation : n₁=6n₂(1=Cr₂O₇, 2=Fe)

titration average : 33+32.05+32.15+32.1 / 4 = 32.325 cm³(ml)

25 cm³ of iron solution used in titration :

\(\tt V_1=32.325~ml\\\\V_2=25~ml\\\\C_1=0.0093~M\\\\\\\\C_1.V_1.n_2=C_2.V_2.n_1\\\\0.0093\times 32.325\times 6=C_2\times 25\times 1\\\\C_2=0.07215~M\)

Dilution(25 ml from 200 ml iron solution)

\(\tt C_2.V_2=C_1.V_1\\\\0.007215\times 25=C_1\times 200\\\\C_1=0.009~M\)

A decrease in entropy is associated with which of the following types of reaction?

A) dehydration B) catabolic C) depolymerization D) hydrolysis

Answers

Dehydration of the process is linked to a decrease in entropy. correct option is (A).

Entropy is a measurement of a system's disorganization. It is an extended attribute of a thermodynamic system, which means that the amount of matter in the system affects its value. Entropy is frequently represented in equations by the letter S and is measured in joules per kelvin.

By combining several molecules into one, a dehydration reaction lowers the system's entropy. On the other hand, entropy is raised by catabolic, depolymerizing, and hydrolytic activities that break down molecules into smaller parts.

To know more about Entropy click here:

https://brainly.com/question/13448613

#SPJ4

How many centimeters are in .479 kilometers

Answers

Answer:

47900 cm

General Formulas and Concepts:

Chemistry

Base 10 Decimal SystemUsing Dimensional Analysis

Explanation:

Step 1: Define

0.479 km

Step 2: Identify Conversions

1 km = 1000 m

1 m = 100 cm

Step 3: Convert

\(0.479 \ km(\frac{1000 \ m}{1 \ km} )(\frac{100 \ cm}{1 \ m} )\) = 47900. cm

Step 4: Check

We are given 3 sig figs. Follow sig fig rules.

47900. cm ≈ 47900 cm

What is an intensive property that can be measured?

Answers

Answer:

Extensive properties, such as mass and volume, depend on the amount of matter being measured. Intensive properties, such as density and color, do not depend on the amount of the substance present. Physical properties can be measured without changing a substance's chemical identity.

An intensive property is a physical property which does not depend on amount of substance present that can be measured.

What are measurable properties?

Measurable properties are defined as those properties which can be measured using scientific tools.

Measurable properties always provide numerical values. This properties are a quantitative measures.

Non measurable properties are defined as those properties which can be measured without any scientific tools.

Non measurable properties are qualitative measures.

Intensive property and extensive property both are a measurable properties.

Intensive property are not dependent on amount of substance present while extensive property depend on amount of substance present.

Thus, intensive property is a physical property which does not depend on amount of substance present that can be measured.

To learn more about measurable properties, refer to the link below:

https://brainly.com/question/7297841

#SPJ2

Calculate the molarity of an aqueous solution that is 22. 3% by mass calcium chloride. You might need to know that the density is 1. 20 g/ml.

Answers

Answer:

Explanation:

To calculate the molarity of the solution, we first need to determine the mass of calcium chloride (CaCl2) in 100 g of the solution.

If the solution is 22.3% calcium chloride by mass, this means that there are 22.3 g of CaCl2 in 100 g of the solution.

We can use the density of the solution to convert 100 g of the solution to its volume:

volume of 100 g of the solution = mass of the solution / density of the solution

volume of 100 g of the solution = 100 g / 1.20 g/mL = 83.3 mL

Now, we can calculate the molarity of the solution using the following formula:

molarity = moles of solute / volume of solution (in L)

The molar mass of CaCl2 is 40.08 + 2(35.45) = 110.98 g/mol. Therefore, the number of moles of CaCl2 in 22.3 g of the solution is:

moles of CaCl2 = 22.3 g / 110.98 g/mol = 0.2008 mol

The volume of the solution containing 22.3 g of CaCl2 is:

volume of solution = 83.3 mL / 1000 mL/L = 0.0833 L

Substituting these values into the formula for molarity, we get:

molarity = 0.2008 mol / 0.0833 L = 2.41 M

Therefore, the molarity of the aqueous solution that is 22.3% by mass calcium chloride is 2.41 M.

Calculate the volume of 0.5 M HCOOH and 0.5 M HCOONa required to prepare 0.1 L of pH 4.50 buffer with a buffer strength of 0.1 M. The pa of HCOOH is 3.75.

Answers

The volume of 0.5 M HCOOH required is 50 mL and the volume of 0.5 M HCOONa required is 150 mL.

To prepare a pH 4.50 buffer with a buffer strength of 0.1 M, we need to use a mixture of HCOOH and HCOONa in a specific ratio. The buffer equation for this system is:

\(pH = pKa + log([HCOO-]/[HCOOH])\)

Substituting the given pH of 4.50 and pKa of 3.75:

We can then use the Henderson-Hasselbalch equation:

\([HCOOH]/[HCOO-] = 3.16 \\\\[HCOOH] + [HCOO-] = 0.1 M\)

Solving these equations simultaneously, we get:

\([HCOOH] = 0.0253 M\) and \([HCOO-] = 0.0747 M.\)

Therefore, the volume required is 50 mL and the volume of 0.5 M HCOONa required is 150 mL, to prepare 0.1 L of pH 4.50 buffer with a buffer strength of 0.1 M.

To know more about Henderson-Hasselbalch equation, here

brainly.com/question/30466186

#SPJ1

How many grams of moles are in 94.2 g of C02?

Answers

Answer:

Moles to grams carbon dioxide

1 mole is equal to 1 moles Carbon Dioxide, or 44.0095 grams.

Explanation:

Moles to grams carbon dioxide

1 mole is equal to 1 moles Carbon Dioxide, or 44.0095 grams.

Complete this example: A 0.67 molal solution was
made by dissolving glucose in water. The boiling
point of pure water is 100.00°C. The boiling point
constant for water is 0.51°C kg/mol.
on
the
Set up the problem.
• 4T2 = (0.51°C•kg/mole)(0.67 m)
of
• What is the 473 value?
vc
• What is the boiling point for the glucose
solution?
УРС

Answers

Answer:

A then C

Explanation:

Complete this example: A 0.67 molal solution wasmade by dissolving glucose in water. The boilingpoint

Answer:

a,c

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Chemistry Lab Determination of the Universal Gas Constant (R)
SHOW ALL WORK

Given:

Initial mass of butane lighter: 54.24g

Final Mass of Butane Lighter: 54.01g

Temperature of water: 23.0°C

Volume of gas collected: 100.0mL

FIND:
Barometric pressure of room: 766.86 mmHg CONVERTED TO atm

Vapor pressure of water at room temperature(PH2O) (IN atm)

FIND:

Mass difference if butane lighter in grams

Moles of Butane gas collected in moles of C4H10

Partial pressure if butane gas in atm

Converted temperature of water in Kelvin

Converted volume of gas collected in Liters

Experimental value of R in Latm/molk

Accepted value of R in Latm/molk

Percent error in experimental value of R in %

CONCLUSION QUESTIONS:

1. List at least 3 factors that either did it could contribute to the percent error

2. Should the value of R go up or down if the gas had not been corrected for the partial pressure of water. Why?

3. How could this experiment be repeated to increase the accuracy, or in other words, decrease the percent error?


NOTE: LET ME KNOW IF YOU WANT A PICTURE OF THE LAB INSTRUCTIONS TO HELP SOLVE

ALSO SHOW ALL WORK PLS

Answers

To solve this problem, I'll need some additional information related to the molar mass of butane (C4H10). Please provide the molar mass of butane so that I can proceed with the calculations.

In using the Haber process in the formation of ammonia, what mass of hydrogen is needed to produce 51.0 grams of ammonia? 3 H₂(g) + N2 (g) → 2 NH3(g).

Answers

The mass of hydrogen needed to produce 51.0 grams of ammonia is  ≈ 9.07 grams.

To determine the mass of hydrogen required to produce 51.0 grams of ammonia (NH3) using the Haber process, we need to calculate the stoichiometric ratio between hydrogen and ammonia.

From the balanced chemical equation:

3 H₂(g) + N₂(g) → 2 NH₃(g)

We can see that for every 3 moles of hydrogen (H₂), we obtain 2 moles of ammonia (NH₃).

First, we need to convert the given mass of ammonia (51.0 grams) to moles. The molar mass of NH₃ is 17.03 g/mol.

Number of moles of NH₃ = Mass / Molar mass

                     = 51.0 g / 17.03 g/mol

                     ≈ 2.995 moles

Next, using the stoichiometric ratio, we can calculate the moles of hydrogen required.

Moles of H₂ = (Moles of NH₃ × Coefficient of H₂) / Coefficient of NH₃

           = (2.995 moles × 3) / 2

           ≈ 4.493 moles

Finally, we can convert the moles of hydrogen to mass using the molar mass of hydrogen (2.02 g/mol).

Mass of H₂ = Moles × Molar mass

          = 4.493 moles × 2.02 g/mol

          ≈ 9.07 grams

Therefore, approximately 9.07 grams of hydrogen is needed to produce 51.0 grams of ammonia in the Haber process.

Know more about the mass of hydrogen here:
https://brainly.com/question/14083730

#SPJ8

Calculate P[NO]eq, if P [NOCI]eq = 0.33 atm, P [C12]eq = 0.50 atm, and Kp = 1.9 x 10-2.
2 NOCI(g) = 2 NO(g) + C12(g)

Answers

Answer:

0.064 atm. that's the answer

cool air tends to...
A. be less dense and flow over warm air.
B.be lifted up by more dense air
C.be more dense and flow under warm
D. mix easily with warm air masses
20 POINTS!!!

Answers

C. flow under dense and become more thick.

What does the chemical term "dense" mean?

A substance that is tightly packed or has a high density.

The term "density" refers to the relationship between a substance's mass and the volume it takes up in space (volume). The mass, size, and arrangement of an object's atoms influence its density. The ratio of a substance's mass to its volume is said to be its density, or D.

Why does chemistry consider density?

Because it enables us to predict which compounds will float and which will sink in a liquid, density is a crucial notion. An object will frequently float as long as its density is less than that of the liquid.

To know more about dense visit:

https://brainly.com/question/26364788

#SPJ1

How many grams of NaCl

How many grams of NaCl

Answers

You would recover 36.525g of NaCl after evaporating all of the water.

How to find the how many grams of NaCl that would be recover when  all water is evaporated off of this solution?

To find the grams of NaCl that would be recovered after evaporating all the water, we can use the following formula:

mass = moles * molar mass

Where:

Moles = Molarity * Volume

Molarity = 0.250 M

Volume = 2500.0 mL = 2.5 L

Molar mass of NaCl = 58.44 g/mol

mass = 0.250 M * 2.5 L * 58.44 g/mol

mass = 36.525 g

Learn about evaporation here https://brainly.com/question/2013258

#SPJ1

C c Why did they work an average brightness for each length of graphite tested?​

Answers

An average brightness was calculated for each length of graphite tested to get a better understanding of the relationship between the length of the graphite and the brightness of the line it produced.

What is the use of graphite?

Graphite has many uses in various industries. Some of its uses include: Pencils, Lubricants, Refractories, Batteries, Electrodes, Nuclear reactors, Aerospace industry.

By calculating the average, it is possible to see if there is a trend in the data and if longer or shorter lengths of graphite produce brighter or duller lines. This information can be useful in determining the best length of graphite to use for a particular task or project.

Find out more on graphite here: https://brainly.com/question/27860158

#SPJ1

A 32.9 L sample of a gas at constant pressure increases in temperature from 25C to 45C. Should the volume increase or decrease?

Answers

If the temperature of the sample of gas changes from 25°C to 45°C, the volume of the gas will increase.

What is Charles's law?

Charles's law is the gas law stating that the density of an ideal gas is inversely proportional to its temperature at constant pressure.

In other words, the law states the volume of a gas is directly proportional to the temperature of the gas. The equation is given as follows:

V₁/T₁ = V₂/T₂

Where;

V₁ and T₁ are the initial volume and temperatureV₂ and T₂ are the final volume and temperature respectively.

According to this question, a sample of a gas at constant pressure increases in temperature from 25°C to 45°C. This means that as the temperature increases, the volume also increases.

Learn more about Charles's law at: https://brainly.com/question/16927784

#SPJ1

Why are cats better than dogs?

Answers

Answer:

Cats are eazy to take care for and relatively affordable

Answer:

cats r better cuz there cats ovi

Explanation:

there small, easy to take care of, and the are good with kids depending on the breed.

Explain the process of sedimentation

Answers

Answer:

Am coming to answer you ok

We Can’t see it the question

All of the following reactions can be described as displacement reactions except:____________.
a.) Zn(s) + FeCl2(aq) → ZnCl2(aq) + Fe(s).
b.) C6H6(l) + Cl2(g) → C6H5Cl(l) + HCl(g).
c.) 2Na(s) + 2H2O(l) → 2NaOH(aq) + H2(g).
d.) Cu(s) + 2AgNO3(aq) → Cu(NO3)2(aq) + 2Ag(s).
e.) CuSO4(aq) + Fe(s) → Cu(s) + FeSO4(aq).

Answers

Answer:

b

Explanation:

The reaction that is not a displacement reaction from all the options is \(C_6H_6_{(l)} + Cl_{2(g)} --> C_6H_5Cl_{(l)} + HCl_{(g)}\)

In a displacement reaction, a part of one of the reactants is replaced by another reactant. In single displacement reactions, one of the reactants completely displaces and replaces part of another reactant. In double displacement reaction, cations and anions in the reactants switch partners to form products.

Options a, c, d, and e involves the displacement of a part of one of the reactants by another reactant while option b does not.

Correct option = b.

The reaction given in Option A is not a displacement reaction. In Displacement reaction functional group of one reactant is replaced by the functional group of the another reactant.

Displacement reaction:

In this reaction functional group of one reactant is replaced by the functional group of the another reactant.

\(\bold { Zn(s) + FeCl_2(aq) \rightarrow ZnCl_2(aq) + Fe(s).}\)

In the above reaction Zinc does not any functional group to exchange with iron chloride.

Therefore, the reaction given in Option A is not a displacement reaction.

To know more about Displacement reaction,

https://brainly.com/question/4339209

Which part of the cell is the anode?
Х
Y
W
Z

Which part of the cell is the anode?YWZ

Answers

X: part of the cell that is the anode

Select the answer that correctly describes the charge of subatomic particles A)electron=+1;neutron =0B)proton=-1;electron=+1C) electron=-1;neutron=0D) protons =-1;neutron =0

Answers

6. We can use the number of protons of the atom in order to identify the atom, since there is a direct correlation between number of protons, electrons and atomic number, in a neutral atom, all 3 values are equal, therefore, 17 protons it is Chlorine

7. In old times it was thought that the atom was the smallest unit of everything, but now we know that atoms are made of subatomic particles, the most common ones are: protons, electrons and neutrons. These particles have a few differences, one of these differences is their charge, for electrons we will have a negative charge, or -1, for protons, a positive charge, or +1, and for neutrons they are neutral particles, charge 0. Therefore the answer will be letter C electron = -1 and neutron = 0

Triglycerides, waxes, and steroids are all _______ lipids because they contain only carbon, hydrogen, and oxygen.Question 20 options:A) long-chain compoundsB) methyl estersC) complexD) simple

Answers

Answer:

Explanation:

Here, we want to get the class of lipids that the given substances belong to

These substances are formed from glycerol and fatty acids

From their make up,we know that they are simple lipids

Thus, the answer here is simple

What is inside a Atom?

Answers

Answer:

there are three different subatomic particles inside them: the protons, neutrons, and electrons

I a lab situation, add magnesium to HCl and perform a reaction.a. Write the valences equation b. If you start with .11 grams of Mg, how much hydrogen gas (L) should you produce? (this is at STP since you are using 22.4L/mole of gas)c. If your classroom conditions are 23 Celsius and 105.2Kpa, what would be theoretical volume of hydrogen gas at these conditions? d. If the students actually collected 145 mL of gas (.145L), what is the % yield for the experiment?

Answers

So,

The reaction that we're performing is the next one:

\(Mg+HCl\to MgCl_2+H_2\)

We need to balance it first:

\(Mg+2HCl\to MgCl_2+H_2\)

To balance, we verify that the number of atoms of each element in the reaction is the same before and after it occurs. As you can see, we have the same amount of atoms of each type before and after so the reaction is balanced now.

Now, we want to find the amount of Hydrogen gas (in liters) that we would obtain if we start with 0.11 grams of Mg. For this, we could follow the next steps:

Step 1. First, we should pass the 0.11 grams of Mg to moles of Mg. To do this, we divide by the molar mass of Mg:

\(n=\frac{mass}{molar\text{ }mass}=\frac{0.11gMg}{\frac{24.3gMg}{molMg}}=0.00452675molesMg\)

Step 2. Apply the stoichiometry of the given reaction and then use the fact that 1 mole of any gas is equal to 22.4L of the gas:

\(0.00452675molesMg\cdot\frac{1molH_2}{1molMg}\cdot\frac{22.4LH_2}{1molH_2_{}}=0.1014LH_2\)

Therefore, we produce 0.1014 L of H2.

c. If the conditions are 23 Celsius and 105.2Kpa, we could use the ideal gas formula to find the theoretical volume of hydrogen gas.

\(PV=nRT\)

Remember that 23 Celcius = 296K and 105.2Kpa = 1,0382atm.

Now, if we replace:

\((1.0382atm)(V)=(0.00452675molH_2)(\frac{0.082atmL}{molK})(296K)\)

Solving for V, we obtain that the theoretical volume is:

\(V=\frac{(0.00452675molH_2)(\frac{0.082atmL}{molK})(296K)}{1.0382\text{atm}}=0.1058L\)

Which is approximately equal to the volume of the point b.

How many grams of KClO3 are needed to produce 6.75 Liters of O2 gas measured at 1.3 atm pressure and 298 K?

Answers

Answer

29.3171 g KClO₃

Procedure

To solve this question consider the following chemical reaction:

2KClO₃→2KCl+3O₂

Then we will use the ideal gas formula to determine the number of moles present in 6.75 L of oxygen gas.

Data:

V=6.75 L

T= 298 °K

P= 1.3 atm

R= 0.08206 L⋅atm⋅°K⁻¹⋅mol⁻¹

Equation

PV=nRT

Solve for n to get the moles

\(n=\frac{PV}{RT}=\frac{1.3\text{ atm }6.75\text{ L mol }\degree\text{K}}{0.08206\text{ L.atm 298}\degree\text{K}}=0.3588\text{ mol O}_2\)

Use the stoichiometry of the reaction to convert from moles of oxygen to moles of KClO₃.

\(0.3588\text{ mol O}_2\frac{2\text{ mol KClO}_3}{3\text{ mol O}_2}=0.2392\text{ mol KClO}_3\)

Finally, convert from moles to grams

\(0.2392\text{ mol KClO}_3\frac{122.55\text{ g KClO}_3\text{ }}{1\text{ mol KClO}_3}=\text{ 29.3171 g KClO}_3\)

Calculate the heat in calories needed to freeze 55 g of water at 0 degrees * C . Express your answer to two significant figures and include the appropriate units.

Answers

The heat needed to freeze the water is 4400 calories

From the question given above, the following data were obtained:

Mass of water (m) = 55 g

Heat (Q) =?

NOTE:

Enthalpy of fusion of water (ΔHբ) = 79.7 cal/g

The heat needed to freeze the water can be obtained as illustrated below:

Q = m•ΔHբ

Q = 55 × 79.7

Q = 4383.5 calories

Q = 4400 calories ( 2 sf)

Therefore, the heat needed to freeze the water is 4400 calories

Learn more: https://brainly.com/question/24686030

Other Questions
A 50.0-mL sample of 0.50 M HCl is titrated with 0.50 M NaOH. What is the pH of the solution after 28.0 mL of NaOH have been added to the acid? 1.85 2.96 2.85 1.49 3.81 If it is 7:00 AM at letter F, what time is it at letter A?5:00 AM5:00 PM4:00 AM4:00 PM Sodium sulfate reacts with an excess barium chloride solution and forms barium sulfate:BaCh(aq) + NaSO4 (ag) - > BaSOA(s) + 2NaC|(ag)10.56 g BaSO4 of is precipitated from 500 mL of NaSO. What is the molarity of sodium sulfate? A bank run occurs when:too many people are trying to borrow more at one time.many bank depositors are trying to withdraw their funds from the bank.interest rates start to increase.interest rates are higher than inflation rates. (PLS HELP WILL MARK BRAINLIEST TO CORRECT ANSWER) John leaves his house one morning to go to the store which is 16 middles dude my north. Suzie, his wife, leaves the house and drives to work, which is directly east of the store.John needs to drop off lunch for suzie because she forgot to pack a lunch today. If suzie has a 20 mile drive to work from home, how far must John drive to store to deliver her lunch? Charlie's rectangular swimming pool has a volume of 600 cubic feet. The neighbor'spool has the same length and height, but the width is three times larger. What is thevolume of the neighbor's pool?A 1200 cu ftB 1800 cu ftC 603 cu ftD 200 cu ft Which of the following best describes nativism during the 1800s?a policy favoring native-born Americans over immigrantsan interest in learning about the native cultures of immigrantsa regional policy of maintaining traditional econonfic systemsa practice in most factories of hiring only native-born Americans g the south african rand has a one-year forward premium of 2 percent. one-year interest rates in the u.s. are 3 percentage points higher than in south africa. based on this information, is covered interest arbitrage possible for a u.s. investor if interest rate parity holds?, covered interest arbitrage possible for a u.s. investor because the interest rate differential is than the forward premium. What single event caused a re-evaluation of Americas first government? The right rectangular prism shown below has square bases and rectangular faces. What shape is the cross section?trianglerectangle not a squaretrapezoidsquare Based on research, it is likely that since Shauna has a more mature body shape than her best friend, she is also more likely to report more thoughts and feelings that are related to. depression Which of the following is closest in size (radius) to a neutron star?A) the EarthB) a cityC) a football stadium D) a basketballE) the SunAnswer: B Solve the following equation. Then place the correct number in the box provided. 7y - 3 10y + 9 Look at this map of current volcano hazards. Click a few volcanoes to determine their warning levels. Why is it possible to have a warning system for volcanoes? If you were a volcanologist, would you watch certain volcanoes on the map more than others? what are at least 10 words that you can use in your informative essay. A cake recipe says to bake the cake until the center is 180F, then let the cake cool to 120F. The table shows temperature readings for the cake.a. Given a room temperature of 70F, what is anexponential model for this data set?b. How long does it take the cake to cool to the desiredtemperature? The unit has you writing a script that ends each level when a sprite gets to the right edge of the screen. Propose another level completed solution where the levels ends when the player hits a certain part of the screen WITHOUT relying on coordinates. Describe your solution, including the code blocks you would use instead of coordinates. Which substance would evaporate the fastest at room temperature? (Assume each substance has approximately the same molecularweight.)O a polar liquida non-polar liquidO a hydrogen-bonded liquid how many moles of Na3AlO3 can be formed from 7.24 moles of NaOH A square prism has a height of 10 inches and a base with an area of 20 square inches. A cylinder is inscribed inside the prism. Which statement about the volume of the cylinder, V, is true? V is less than 200 cubic inches. V equals 200 cubic inches. V is greater than 200 cubic inches. There is not enough information to answer the question.