Answer:
4 cups?
Explanation:
Fractional distillation
Miscible liquids are separated via a kind of distillation called fractional distillation. he mixture is typically divided into component parts after a series of distillations and condensations.
Miscible liquids are separated via a kind of distillation called fractional distillation. The mixture is typically divided into component parts after a series of distillations and condensations. When the combination is heated to a specific temperature where some of the mixture begins to vaporise, the separation takes place.
To know more about Fractional distillation, here:
https://brainly.com/question/31829958
#SPJ1
Is HNO3 an acid or a base
I NEED HELP ASAP
Answer:
HNO3 is a potent acid, a base, a nitrating agent and a heavy oxidising agent at times. In the presence of a stronger acid, it serves as a base.
Explanation:
Answer:
It is a strong acid
Explanation:
PLEASE HELP!
The vapor pressure of benzene at 25 °C is 95.1 mm Hg and of toluene 28.4 mm Hg. The mass fractions of benzene and toluene in a solution are 0.5.
a) Calculate the partial pressure of benzene and toluene above the solution.
b) Calculate the total vapor pressure above the solution.
c) Calculate the vapor composition above the solution.
Benzene be B
Toluene be T
We have made then one lettered to make things easier
\(\sf P^0_B=95.1mmHg,P^0_T=28.4mmHg\)\(\sf x_B=x_T=0.5\)\(\\ \rm\Rrightarrow \dfrac{P^0_B-P_B}{P^0_B}=x_B\)
\(\\ \rm\Rrightarrow 95.1-P_B=95.(0.5)\)
\(\\ \rm\Rrightarrow 95.1-P_B=47.55\)
\(\\ \rm\Rrightarrow P_B=47.55mmHg\)
And
\(\\ \rm\Rrightarrow \dfrac{P^0_T-P_T}{P^0_T}=x_T\)
\(\\ \rm\Rrightarrow 28.4-P_T=28.4(0.5)\)
\(\\ \rm\Rrightarrow P_T=14.2mmHg\)
Total vapour pressure
28.4+95.1123.6mmHgComplete the Lewis Dot structure for the molecule H-C≡N and determine how many bonding and non-bonding electrons nitrogen has:
Answer:
I believe that in H-C≡N, Nitrogen has 4 bonding electrons and 2 non-bonding electrons.
(:
Explanation:
Briefly explain how will you describe which object is moving fast and which one is moving slow?
Which of these waves has the greatest wavelength? (3 points) Wave shown with 2 wavelengths. Wave shown with 3 wavelengths. Wave shown with 1 wavelength stretch over a short distance. Wavelength shown with 1 wavelength stretched over a long distance.
The waves that has the greatest wavelength is Wavelength shown with 1 wavelength stretched over a long distance.
Waves explained.A wave could be a disturbance or variety that voyages through a medium or space, carrying vitality without transporting matter. Waves can take different shapes and happen totally different sorts of waves, counting mechanical waves and electromagnetic waves.
Mechanical waves require a medium to propagate, meaning they require a substance like water, discuss, or a strong fabric to transmit the wave. Illustrations of mechanical waves incorporate water waves, sound waves, and seismic waves. In these waves, particles of the medium sway or vibrate in a design, exchanging energy from one molecule to another.
Electromagnetic waves, on the other hand, don't require a medium and can travel through vacuum, such as in space. Electromagnetic waves comprise of electric and attractive areas swaying opposite to each other and to the heading of wave engendering. Illustrations of electromagnetic waves incorporate obvious light, radio waves, microwaves, infrared waves, bright waves, X-rays, and gamma beams.
Learn more about waves below.
https://brainly.com/question/26116832
#SPJ1
Which compound is more soluble in water at 25°C?
A.
MgF2 (Ksp = 5.2 x 10-11)
B.
SrF2 (Ksp = 7.9 x 10-10)
C.
AgBr (Ksp = 5.0 x 10-13)
D.
Agl (Ksp = 1.5 * 10-16)
Answer:
B
Explanation:
The solubility depends on the ksp. As the value of ksp increases the compound becomes more and more soluble.
In the options, the highest ksp value is 10^-10, thus that one is the most soluble.
PLEASE HELP ME! I am confused on this.
Answer:
Mohammed has less kinetic energy
Explanation:
m=Kg
V= m/s
KE= kinetic energy = J
the way you work out the answer is:
KE = 1/2 × m × v squared
help me with this question?!!
Answer:
Glow sticks and match would be light emission, slime would be preciptate, and cookies would be gas.
Explanation:
NEED HELP ASAP WILL MARK BRAINLY PLS HURRY I DONT HAVE LONG
Is this a scientific model? Use complete sentences to explain why or why not. (5 points) A graphic organizer showing the water cycle
Answer:
Yes it is, because scientist use this to demostrate the water cycle
Explanation:
Calculate the pH of a solution with [H+] = 2.52 x 10^-5.
Answer:
pH = 4.6
Explanation:
pH is the negative of the log of the hydrogen ion concentration
- log { 2.52 x 10^-5) = ~ 4.6
HELP ME SOLVE THIS NEUTRAL REDOX REACTION USING HALF METHOD, I BEEN STUCK ON IT FOR 2 HOURS
H6TeO6 + Br2 = TeO2 + BrO3-
The balanced equation of the redox reaction is given as follows:
5 H₆TeO₆ + 2 Br₂ + 12 H₂O → 5 TeO₂ + 4 BrO₃⁻ + 24 H⁺What is the balanced equation of the reaction?The balanced equation of the reaction is determined using the half-reaction method.
The given equation of the redox reaction is:
H₆TeO₆ + Br₂ ----> TeO₂ + BrO₃⁻
Reduction half-reaction:
H₆TeO₆ → TeO₂
The oxidation state of Te changes from +6 to +4, showing that it has lost gained electrons.
H₆TeO₆ → TeO₂ + 2e⁻
Oxidation half-reaction:
Br₂ → BrO₃⁻
The oxidation state of Br changes from 0 to +5, showing that it has lost five electrons.
Balancing the electrons transferred and the atoms by adding electrons, H₂O, and H⁺ to the appropriate sides:
Br₂ + 6 H₂O → 2 BrO₃⁻ + 12 H⁺ + 10 e⁻
The number of electrons transferred in both half-reactions balanced is by multiplying the oxidation half-reaction by 5 and the reduction half-reaction by 2:
5 (H₆TeO₆ → TeO₂ + 2 e⁻) → 5 H₆TeO₆ → 5 TeO₂ + 10 e⁻
2 * (Br₂ + 6H₂O → 2 BrO₃⁻ + 12 H⁺ + 10e⁻) → 2 Br₂ + 12 H₂O → 4 BrO₃⁻ + 24 H⁺ + 20 e⁻
The two half-reactions are added together and the electrons are canceled out to obtain the balanced redox reaction:
5 H₆TeO₆ + 2 Br₂ + 12 H₂O → 5 TeO₂ + 4 BrO₃⁻ + 24 H⁺
Learn more about redox reactions at: https://brainly.com/question/21851295
#SPJ1
For lunch today, I ate an apple. What type of carbohydrate did I ingest?
Answer:
Monosaccharide
Explanation:
Apples contain high levels of fructose, which is a monosaccharide.
Determine whether the following five molecules are polar or nonpolar and explain your answer:
a) Beryllium chloride b) Hydrogen sulphide c) Sulphur trioxide d) Water e) Trichloromethane
The following are categorized into polar or nonpolar molecules:
a) Beryllium chloride - nonpolar b) Hydrogen sulphide - polar c) Sulphur trioxide - nonpolar d) Water - polar e) Trichloromethane - polar How to determine polar or nonpolar?a) Beryllium chloride (BeCl₂) is a nonpolar molecule. The Be-Cl bond is polar due to the electronegativity difference between beryllium and chlorine, but the molecule is linear with the two polar bonds pointing in opposite directions, resulting in a net dipole moment of zero.
b) Hydrogen sulphide (H₂S) is a polar molecule. The H-S bond is polar due to the electronegativity difference between hydrogen and sulfur, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.
c) Sulphur trioxide (SO₃) is a nonpolar molecule. The S-O bonds are polar due to the electronegativity difference between sulfur and oxygen, but the molecule is trigonal planar with the three polar bonds pointing in different directions, resulting in a net dipole moment of zero.
d) Water (H₂O) is a polar molecule. The H-O bond is polar due to the electronegativity difference between hydrogen and oxygen, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.
e) Trichloromethane (CHCl₃) is a polar molecule. The C-Cl bonds are polar due to the electronegativity difference between carbon and chlorine, and the molecule has a tetrahedral shape, resulting in a net dipole moment that is not zero.
Find out more on polar or nonpolar here: https://brainly.com/question/17118815
#SPJ1
A. How many moles of O₂ would 13.0 mol of Al2O3 produce?
19.5 moles of oxygen will be produced by 13 moles of Al₂O₃.
What is a mole?
The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.
A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.
Given,
Moles of Al₂O₃ = 13 moles
From the reaction -
2 Al₂O₃ ⇒ 4Al + 3O₂
2 moles of Al₂O₃ produces 3 moles of O₂
1 mole of Al₂O₃ produces 3 ÷ 2 moles of O₂
1 mole of Al₂O₃ = 1.5 mole of O₂
So, 13 moles of Al₂O₃ = 1.5 × 13 moles of O₂
= 19.5 moles of O₂.
Therefore, 19.5 moles of oxygen will be produced by 13 moles of Al₂O₃.
Learn more about Moles, here:
https://brainly.com/question/20486415
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K
At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
1: Write the balanced chemical equation:
\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)
2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.
Initial:
\(C_O\)(g) = 0.3500 mol
\(Cl_2\)(g) = 0.05500 mol
\(C_OCl_2\)(g) = 0 mol
Change:
\(C_O\)(g) = -x
\(Cl_2\)(g) = -x
\(C_OCl_2\)(g) = +x
Equilibrium:
\(C_O\)(g) = 0.3500 - x mol
\(Cl_2\)(g) = 0.05500 - x mol
\(C_OCl_2\)(g) = x mol
3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:
Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]
4: Substitute the given equilibrium constant (Kc) value into the expression:
1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)
5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:
1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x
6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.
7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.
8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):
\(Cl_2\)(g) = 0.05500 - x
9: Calculate the value of \(Cl_2\)(g) at equilibrium:
\(Cl_2\)(g) = 0.05500 - x
\(Cl_2\)(g) = 0.05500 - (positive value of x)
10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.
Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
For more such questions on equilibrium, click on:
https://brainly.com/question/517289
#SPJ8
The Mackenzie River in northern Canada contains, on average,
0.820 mM Ca2+
0.430 mM Mg2+
0.300 mM Na+
0.0200 mM K+
0.250 mM Cl–
0.380 mM SO42–
and
1.82 mM HCO3–.
What, on average, is the total mass of these ions in 4.75 L of Mackenzie River water?
On average, the total mass of ions in 4.75 liters of Mackenzie River water is 0.466 g grams.
What is the total mass of ions?The formula mass of an ionic compound is determined in the same manner as the formula mass of a covalent compound is determined: by adding the average atomic masses of all the atoms in the compound's formula.
Hence, the total mass is computed as follows:
(0.820 mM Ca 2⁺) X ( 2.25 L) = 1.845 mmoles at 40.0 g/mol = 73.8 mg
(0.430 mM Mg 2⁺) X ( 2.25 L) = 0.9675 mmoles at 24.3 g/mol = 23.51 mg
(0.300 mM Na⁺) X ( 2.25 L) = 0.675 mmol at 23.0 g/mol = 15.52 mg
(0.0200 mM K⁺) X ( 2.25 L) = 0.045 mmol at 39.1 = 1.75 mg
(0.250 mM Cl-) X ( 2.25 L) = 0.5625 mmol at 35.45 g/mol = 19.94 mg
(0.380 mM SO₄²-) X ( 2.25 L) = 0.855 mmol at 96.06 g/mol = 82.13 mg
(1.82 mM HCO₃ -) X ( 2.25 L) = 4.095 mmol at 61.02 g/mol = 249.87 mg
Thus, total mass = 73.8 + 23.51 + 15.52 + 1.75 + 19.94 + 82.13 + 249.87
= 466.52mg
Converted into grams we have:
466.52/1000
= 0.46652
Hence, on average, the total mass of these ions 4.75 L \(\approx\) 0.47 grams.
Learn more about Total Mass:
https://brainly.com/question/17552181
#SPJ1
in diagram A, what is the value of ^H
The value of h in the right triangle is 7.7 cm.
Why is this so?Trigonometric ratio is used to show the relationship between the sides and angles of a right angled triangle.
In the right triangle, using trigonometric ratio:
a) sin(31) = h/15
⇒ 0.515 = h/15
Making H the subject of the formula we have:
0.515 x 15 = h/15 x 15
h = 7.725
h \(\approx\) 7,7
Hence, is is correct to state that the value of h in the diagram is 7.7 cm approximately. See the attached image.
Learn more about right triangle at:
https://brainly.com/question/6322314
#SPJ1
Full Question:
Although part of your question is missing, you might be referring to this full question:
the diagram shows a right-angled triangle. what is the value of h? give your answer correct to 1 decimal place.
Condensation polymers that contain the amide functional group are called ?
Answer:
Polyamides
(not entirely sure if this is right)
If we place 15 moles of NaN3, how many
grams of NaN3 do you have before the
reaction?
Answer:
25.8 g C6H12O6
Explanation:
How much potassium chloride will dissolve in 25 grams of water at 80°C?
Please I need help
Answer:
The problem provides you with the solubility of potassium chloride,
KCl
, in water at
20
∘
C
, which is said to be equal to
34 g / 100 g H
2
O
.
This means that at
20
∘
C
, a saturated solution of potassium chloride will contain
34 g
of dissolved salt for every
100 g
of water.
As you know, a saturated solution is a solution that holds the maximum amount of dissolved salt. Adding more solid to a saturated solution will cause the solid to remain undissolved.
In your case, you can create a saturated solution of potassium chloride by dissolving
34 g
of salt in
100 g
of water at
20
∘
C
.
Now, your goal here is to figure out how much potassium chloride can be dissolved in
300 g
of water at this temperature. To do that, use the given solubility as a conversion factor to take you from grams of salt to grams of water
What is the de Broglie wavelength of an electron traveling at 1.59×105m/s ?
The de Broglie wavelength of an electron traveling at 1.59×105m/s is 0.4547 x 10⁻⁹ m.
What is an electron ?The elementary electric charge of the electron is a negative one, making it a subatomic particle. Due to their lack of known components or substructure, electrons, which are part of the first generation of the lepton particle family, are typically regarded to be elementary particles.
The length scale at which a particle's wave-like characteristics are significant is indicated by its de Broglie wavelength. The symbol or dB is typically used to indicate the De Broglie wavelength. The de Broglie wavelength for a particle with momentum p is given by dB = hp.
λ = h/mv
Where,
λ = wavelength of electron
m = mass of electron = 9.11e-31 kg
v = speed of electron = 1.59 × 10⁵ m/s
h = constant
Therefore,
λ = (6.626x10⁻³⁴J-s) ÷ [(9.11e-31 kg) (1.59 x 10⁵ m/s)]
λ = 0.4547 x 10⁻⁹ m
Thus, The de Broglie wavelength of an electron traveling at 1.59×105m/s is 0.4547 x 10⁻⁹ m.
To learn more about an electron, follow the link;
https://brainly.com/question/1255220
#SPJ1
A compound is found to contain 36.5% Na, 25.4% S, and 38.1% O. Find its empirical formula.
The empirical formula of the compound is =NaSO2
Empirical formulaThis is the formula that analyses the different ratios of atoms in a compound in its simplest form.
To calculate the empirical formula use the least atom percentage ratio. That is,
\(na = \frac{36.5}{25.4} = 1.437\)
\(s = \frac{25.4}{25.4} = 1\)
\(o = \frac{38.1}{25.4} = 2\)
From the calculation, the ratio of the various atoms are
NaSO2
Therefore the empirical formula is NaSO2
Learn more about empirical formula here:
https://brainly.com/question/1603500
Which example accurately describes a solution? (1 point)
Nonpolar oil molecules dissolve in water, which is polar.
Polar sugar molecules dissolve in water, which is polar.
Nonpolar fat molecules dissolve in water, which is polar.
Polar sugar molecules dissolve in oil, which is nonpolar.
The example which accurately describes a solution is; Polar sugar molecules dissolve in water, which is polar.
According to the question:
We are required to determine Which example accurately describes a solution.The formation of a solution requires that the solvent and solute be of the same polarity.
In essence, the example which accurately describes a solution is; Polar sugar molecules dissolve in water, which is polar.
Read more on solutions and polarity:
https://brainly.com/question/9485955
Answer:
Polar sugar molecules dissolve in water, which is polar.
Explanation:
I did the Exam and got it right!
If your equation includes 7(CrO4)2, how many Cr's are there?
If your equation includes 7(CrO4)2, how many O's are there?
If an equation includes 7(CrO₄)₂, the numbers of Cr's and O's atoms that are there are 14 and 56 respectively.
How to calculate number of atoms?The number of atoms present in a chemical compound can be calculated by multiplying the subscript of the particular element by any coefficient.
According to this question, 7 moles of chromate with the chemical formula; (CrO₄)₂ is given. The number of oxygen and chromium atoms in this compound can be calculated as follows:
Chromium = 7 (coefficient) × 2 = 14 atomsOxygen = 7 (coefficient) × 8 = 56 atomsLearn more about no of atoms at: https://brainly.com/question/14190064
#SPJ1
Increasing temperature can
Answer:
increases reaction rates
Explanation:
Increasing the temperature increases reaction rates because of the disproportionately large increase in the number of high energy collisions. It is only these collisions (possessing at least the activation energy for the reaction) which result in a reaction.
Xavier used a chart to list the roles of two different molecules in protein production.
Which headings best complete the chart?
Y: DNA
Z: tRNA
Y: tRNA
Z: DNA
Y: mRNA
Z: tRNA
Y: tRNA
Z: mRNA
Answer:
Y: tRNA
Z: DNA
Explanation:
This question involves two different nucleic acid molecules that are involved in protein production. Xavier used a chart to highlight the functions these nucleic acids perform during protein synthesis.
- Transfer RNA known as tRNA is a type of RNA molecule found in the ribosomes. It functions to read the mRNA codon and carry corresponding amino acid to the ribosomes for linking with one another. Based on this, "Y" on the chart is a tRNA molecule.
- Deoxyribonucleic acid, also known as DNA, is a molecule found in the NUCLEUS whose function is to store the genetic information in the cell. DNA carries the information needed for the synthesis of protein. Based on this, Z is a DNA molecule.
Answer:
The guy above is right! I got 100 on my test :]
How is science based on observation used as evidence? How can this evidence be used?
15 POINTS AND BRAINLIEST
Answer:
w
Explanation:
What energy keeps the water cycle going?
Answer:
the the that keeps the water cycle going is heat