The distance of the image formed is 48 cm behind the lens.
What is the distance of the image formed?
The new distance of the image formed is determined by applying the following lens equation.
1/v + 1/u = 1/F
where;
v is the image distanceu is the object distanceat a constant focal length, the new image distance will be calculated as follows;
1/v₁ + 1/u₁ = 1/v₂ + 1/u₂
1/v₂ = 1/v₁ + 1/u₁ - 1/u₂
1/v₂ = 1/24 - 1/16
1/v₂ = 0.041667 - 0.0625
1/v₂ = -0.020833
v₂ = -48 cm
Learn more about image distance here: https://brainly.com/question/12629638
#SPJ1
Capacitors in series share the same charge and capacitors in parallel share the same voltage.
a)true
b)false
The statement Capacitors in series share the same charge and capacitors in parallel share the same voltage is True.
Capacitors are electrical components that store energy in an electric field. When capacitors are connected in series, the charge is the same on all the capacitors. This is because there is no pathway for current to flow between the capacitors, and thus the charges on the plates of each capacitor are equal.
When capacitors are connected in parallel, they share the same voltage across them. This is because the voltage applied across each capacitor is the same, and thus the charge on each plate of the capacitor is the same. This property of capacitors is fundamental to understanding how they are used in electrical circuits.
To know more about capacitors refer here
https://brainly.com/question/31627158#
#SPJ11
if control requirements are very complex or extensive, a double reley can be installed.T/F
The statement is True because If the control requirements are very complex or extensive, a double relay can be installed. A double relay is a type of electrical relay that includes two separate relay circuits within a single housing.
Double relays are a type of control system that consists of two separate relay circuits that work in parallel to control a process or system. If one relay circuit fails, the other circuit takes over and continues to provide control, preventing any dangerous situations from occurring.
This redundancy is crucial in applications where safety is a top priority, as it ensures that the system will continue to operate even in the event of a failure. In industrial settings, such as chemical plants, power plants, and oil refineries, double relays are often used to prevent accidents that could be caused by equipment failure or malfunction.
These relays can also be found in aerospace and military systems, where failure could have catastrophic consequences. Overall, the use of double relays is an important safety measure that helps to ensure the reliable and safe operation of critical systems.
To know more about relay, refer here:
https://brainly.com/question/28103948#
#SPJ11
3. Michelle failed her most recent exam, which has
brought her class grade down to a D. The
semester is ending in 2 weeks and she has 1
assignment and 1 quiz left to make up for the
class. She sets the goal to do well on both so that
those will improve her class grade. Which of the
following SMART goal components is her goal
missing?(This is physical education)
a. The goal is not specific
b. The goal is not important
c. The goal is not relevant
d. The goal is not timely
An arrow of mass 30 gram is pulled across a bow which extends its length by 6cm. Young's Modulus of the given material is 5×10^8 N/m². The area of the cross section of material of the bow is 2×10^-5 m². Calculate the initial velocity of the arrow.
The initial velocity of the arrow is -2×10⁴ m/s and the negative sign indicates the velocity decreases with time and becomes zero.
Young's modulus defines the property of the material that determines the elasticity of the material. The elasticity of the material shows the property of regaining of original shape after deformation when force F is applied to the material. It defines the ratio of stress and strain.
Stress is defined as the force per unit area and strain is defined as the change in length of the conductor when force is applied. Young modulus is obtained when a solid object deforms when a load is applied to it.
From the given,
mass of arrow (m) = 30 g = 30 ×10⁻³ kg.
Change in length (Δl/l) = 6 cm
Young's modulus (Y) = 5×10⁸N/m²
cross-sectional area of material = 2×10⁻⁵m²
final velocity = 0
time = 1s
initial velocity =?
Young's modulus, Y = (F.l)/A.Δl, F is the force and force is a product of mass and acceleration. Acceleration is the rate of change of velocity per unit time.
Y = (m.a.l)/A.Δl
(Y×A×Δl)/m×l = a
a =(5×10⁸×2×10⁻⁵×6×10⁻²)/(30 ×10⁻³×1)
a = 2×10⁻⁴ m/s²
(v-u)/t = 2×10⁻⁴
0-2×10⁻⁴ = u
u = -2×10⁻⁴ m/s.
Thus, the initial velocity is -2×10⁻⁴ m/s. The negative sign indicates the velocity decreases with time and becomes zero.
To learn more about Young's modulus:
https://brainly.com/question/9163788
#SPJ1
What is a 7 letter word that describes the relationship between frequency and period?
What is the index of refraction of a refractive medium which slows the light to 1.88 x 10^8 m/s. What the index of the second medium
If the index of refraction of a refractive medium slows the light to 1.88 x 10^8 m/s. The index of the second medium is: 1.60.
How to find the index of the second medium?Using this formula to find the index of the second medium
n = c/v
Where:
n = refractive index of the medium
c = velocity of light in vacuum
v = velocity of light in the medium.2
Let plug in the formula
n = (3 x 10^8 m/s)/ 1.88 x 10^8 m/s
n = 300,000,000/188,000,000
n = 1.595
n = 1.60 (Approximately)
Therefore we can conclude that the refractive index of the medium is 1.60.
Learn more about refractive index of the medium here:https://brainly.com/question/12768121
#SPJ1
Speed of electromagnetic wave is independent of
1) Wavelength
2) Frequency
3) Intensity
4) Medium in which it travels
CLASS 12 TH PHYSICS
ANSWER IF URE SURE !
AND GIVE PROPER REASON FOR URE ANSWER
c. a stronger station at 1200 khz produces a 15 mv antenna signal. what is the current at this frequency when the radio is tuned to 1020khz?
To calculate the value of the capacitor for tuning to the 1020 kHz radio station, we can use the formula for resonant frequency:
f = 1 / (2 * π * √(LC))
Rearranging the formula to solve for capacitance (C), we get:
C = 1 / (4 * π² * f² * L)
Substituting the given values of frequency (1020 kHz) and inductance (70 μH), we can calculate the capacitance to be tuned as approximately 118.7 pF.
To find the peak current at resonance, we can use the formula for the peak current (I) in a series RLC circuit:
I = V_peak / √(R² + (ωL - 1 / (ωC))²)
Substituting the given values of peak voltage (6.0 mV), inductor resistance (0.28 Ω), and the resonant angular frequency (2 * π * f), where f is 1020 kHz, we find the peak current to be approximately 20.7 mA.
However, the current at 1020 kHz when the radio is tuned to a stronger station at 1200 kHz cannot be determined without additional information.
To learn more about antenna signal, here
https://brainly.com/question/31525513
#SPJ4
The complete question is:
An AM radio antenna picks up a 1020 kHz signal with a peak voltage of 6.0 mV. The tuning circuit consists of a 70 μH inductor in series with a variable capacitor. The inductor coil has a resistance of 0.28 Ω and the resistance of the rest of the circuit is negligible.
To what value should the capacitor be tuned to listen to this radio station?What is the peak current through the circuit at resonance?A stronger station at 1200 kHz produces a 15 mV antenna signal. What is the current at this frequency when the radio is tuned to 1020kHz?Which type of energy is stored in a battery?
O A. Nuclear energy
O B. Electrical energy
O C. Electromagnetic energy
O D. Chemical energy
Answer:
Chemical energy is in a battery
The type of energy is stored in a battery is Chemical energy (option d)
Batteries store chemical energy. When a battery is charged, a chemical reaction occurs inside it, converting the reactants into different products. This process stores energy in the form of chemical bonds within the battery's components.
When you use the battery to power a device, the reverse chemical reaction takes place, releasing the stored energy as electrical energy. This flow of electrons creates an electric current that powers the device connected to the battery.
The capacity of a battery to store and release energy depends on the type and quantity of chemicals used in its construction. Different types of batteries, such as alkaline, lithium-ion, or lead-acid batteries, have varying chemical compositions, affecting their energy storage capabilities and overall performance.
So, the correct option is (d).
To know more about energy here
https://brainly.com/question/1932868
#SPJ6
What is the purpose of using the string to tie the forelegs and hind legs during dissection?
Answer:
To holds the legs apart without rupturing any vein
Explanation:
The purpose of using string to tie the forelegs and hind legs during dissection is to hold the legs apart without rupturing ant vein or artillery for easy dissection procedure( the dismembering of the body of a deceased animal or plant to study its anatomical structure)
when tieing the forelegs and the hind legs the same string is used to tie them and the string is then passed/looped under the dissecting table/tray this way the legs will be held apart and the dissection can commence.
An object that is falling has the following type(s) of energy. Ignore air resistance.
Kinetic Energy
Potential Energy
Electrical Energy
Thermal Energy
A 500 μH inductor is connected across an AC generator that produces a peak voltage of 4.6 V .
Part A
At what frequency f is the peak current 40 mA ?
Express your answer in hertz.
Part B
What is the instantaneous value of the emf at the instant when iL=IL?
Express your answer in volts.
The instantaneous value of the emf at the instant when iL = I_L is 0 volts.
Part A:
To find the frequency (f) at which the peak current (I_peak) is 40 mA, we can use the formula:
I_peak = V_peak / (2 * π * f * L)
Where V_peak is the peak voltage (4.6 V), L is the inductor value (500 μH), and I_peak is the peak current (40 mA).
Rearranging the formula for frequency:
f = V_peak / (2 * π * L * I_peak)
f = 4.6 V / (2 * π * 500 * 10^-6 H * 40 * 10^-3 A)
f ≈ 579.77 Hz
Part B:
When iL = I_L (instantaneous current equals the peak current), the emf across the inductor can be found using the formula:
emf = - L * (dI_L / dt)
Since the Instantaneous current is at its peak, the derivative of the current with respect to time (dI_L / dt) will be zero. Therefore:
emf = - L * 0
emf = 0 V
So, the instantaneous value of the emf at the instant when iL = I_L is 0 volts.
Learn more about emf click here:
https://brainly.com/question/17329842
#SPJ11
QUESTION 17
Which statement best describes the difference between strong nuclear forces and weak nuclear forces? (2 points)
O Weak nuclear forces are involved when certain types of atoms break down. Strong nuclear forces are responsible for
holding atoms' nucleus together.
O Weak nuclear forces hold bonds between atoms together. Strong nuclear forces hold together the nucleus of an
atom,
O Strong nuclear bonds prevent atoms from falling apart. Weak nuclear bonds prevent compounds from falling apart.
O Strong nuclear forces are involved in breaking electrons from their shells. Weak nuclear forces hold protons in the
nucleus.
Answer: Weak nuclear forces are involved when certain types of atoms break down. Strong nuclear forces are responsible for holding atoms' nucleus together.
A simple pendulum is swinging back and forth through a small angle, its motion repeating every 1.13 s. How much longer should the pendulum be made in order to increase its period by 0.29 s?
The pendulum should be made approximately 8.7 cm longer in order to increase its period by 0.29 s.
The period of a simple pendulum is given by the formula T=2π√(l/g), where T is the period, l is the length of the pendulum, and g is the acceleration due to gravity. In this case, the original period of the pendulum is given as 1.13 s.
To find out how much longer the pendulum should be made, we can use the following equation:
(T + 0.29) = 2π√((l+x)/g), where x is the additional length that the pendulum needs to be made longer by.
Substituting the given values, we get:
(1.13 + 0.29) = 2π√((l+x)/9.81)
Simplifying the equation, we get:
1.42 = √(l+x)
Squaring both sides, we get:
2 = l/g + x/g
Therefore, x/g = 2 - l/g.
Substituting the values of l and g, we get:
x/9.81 = 2 - (1.13/2π)^2
Solving for x, we get:
x = 0.087 m or 8.7 cm (approx.)
Hence, the pendulum should be made approximately 8.7 cm longer in order to increase its period by 0.29 s.
To know more about gravity refer to
https://brainly.com/question/31321801
#SPJ11
To increase the period by 0.29 s, the pendulum should be made approximately 0.0941 m (or 9.41 cm) longer. To answer your question, we need to use the formula for the period of a simple pendulum: T = 2π√(L/g). where T is the period, L is the length of the pendulum, and g is the acceleration due to gravity.
Given that the pendulum's period is 1.13 s, we can solve for its current length as follows: 1.13 s = 2π√(L/g),Squaring both sides, we get: 1.28 s^2 = 4π^2(L/g),Solving for L, we get: L = (g/4π^2) * 1.28 s^2
Now we can find the new length of the pendulum that would increase its period by 0.29 s. Let's call this new length L'.
The new period would be: T' = T + 0.29 s = 1.13 s + 0.29 s = 1.42 s,L' = (g/4π^2) * 2.01 s^2.Finally, to find how much longer the pendulum should be made, we can subtract L from L': L' - L = (g/4π^2) * 0.73 s^2
Since we don't know the value of g, we can't calculate this difference exactly. However, we can use the approximate value of g = 9.81 m/s^2 to estimate the answer. Plugging in this value, we get: L' - L ≈ 0.295 m
Therefore, the pendulum should be made approximately 0.295 m longer to increase its period by 0.29 s.
To know more about pendulum visit :-
https://brainly.com/question/31880331
#SPJ11
An object slides at constant speed on the frictionless surface. What forces act on the object? What work is done by each force?
There are two main forces acting on an object sliding at a constant speed on a frictionless surface: gravity and the normal force. No force happens in the direction of displacement of the object because the object is sliding at a constant speed.
Gravity is the force that pulls the object downward, while normal force is the force that pushes the object upward to counteract gravity. Since the object is sliding at a constant speed, these two forces are equal and opposite, which means that they cancel each other out. As a result, there is no net force acting on the object, and therefore no work is being done by either force.
Learn more about force at https://brainly.com/question/25825478
#SPJ11
what is the particle's de broglie wavelength, expressed in terms of m , q , and v ?
The de Broglie wavelength (λ) of a particle is given by λ = h / (m * v), where m represents the mass, q represents the charge (if applicable), and v represents the velocity of the particle.
The de Broglie wavelength (λ) of a particle can be expressed in terms of its mass (m), charge (q), and velocity (v) using the de Broglie relation:
λ = h / (m * v),
where h is the Planck constant.
The de Broglie wavelength relates the wave-like properties of particles to their momentum. It suggests that particles, such as electrons or other elementary particles, can exhibit wave-like behavior.
In the equation, m represents the mass of the particle, q represents its charge (if applicable), and v represents its velocity. By substituting these values into the equation, we can calculate the de Broglie wavelength.
It's important to note that the de Broglie wavelength applies to particles with both classical and relativistic velocities. However, for particles with relativistic velocities (approaching the speed of light), the full relativistic formulation of the de Broglie equation is required.
Learn more about velocity at: brainly.com/question/30559316
#SPJ11
If a skateboarder is moving at 4 meters per second then changes its velocity to 10
meters per second over the course of 10 seconds what is the skateboards acceleration?
Answer:
i was doing this is it actually 0.6
Explanation:
;D
The acceleration of the skateboard from its initial velocity to the final velocity over the given time is 0.6m/s².
What is Motion?Motion is simply the change in position of an object over time.
From the First Equation of Motion;
v = u + at
Where v is final velocity, u is initial velocity, a is acceleration and t is time elapsed.
Given the data in the question;
Initial velocity u = 4m/sFinal velocity v = 10m/sTime elapsed t = 10sAcceleration of the skateboard a = ?To determine the acceleration of the skateboard, we substitute our given values into the expression above.
v = u + at
10m/s = 4m/s + ( a × 10s)
( a × 10s) = 10m/s - 4m/s
a × 10s = 6m/s
a = 6m/s ÷ 10s
a = 0.6m/s²
Therefore, the acceleration of the skateboard from its initial velocity to the final velocity over the given time is 0.6m/s².
Learn more about Equations of Motion here: brainly.com/question/18486505
Which property describes the amount of energy that flows past a given area
per unit of time?
A. Wavelength
B. Speed
c. Intensity
D. Pitch
Answer:
c. Intensity
Explanation:
Wavelength is a distance (meters).
Speed is distance per time (meters / second).
Intensity is power per area (Watts / square meter).
Pitch is frequency (cycles / second).
A football is thrown due north across a 40 meter river and it takes 2 seconds to cover that distance.
10. What is the speed of the football in meters per second?
11. What is the velocity of the football in meters per second?
HELP DUE TODAY!!
Answer:
I. Speed = 20m/s
II. Velocity = 20m/s due North.
Explanation:
Given the following data;
Distance = 40m
Time = 2secs
To find the speed;
Mathematically, speed is given by the formula;
\(Speed = \frac{distance}{time}\)
Substituting into the equation, we have;
\(Speed = \frac{40}{2}\)
Speed = 20m/s.
In physics, we use the same formula for calculating speed and velocity. The only difference is that speed is a scalar quantity and as such has magnitude but no direction while velocity is a vector quantity and as such it has both magnitude and direction.
\(Velocity = \frac{distance}{time}\)
Therefore, the velocity is 20m/s due North.
Two wires are made of the same material andhave the same length but different radii. Theyare joined end-to-end and a potentialdifference is maintained across thecombination, which of the following quantitythat is the same for both wires isA. potential differenceB. electric currentС. current densityD. electric field
Two wires are made of the same material and have the same length but different radii. They are joined end-to-end and a potential difference is maintained across the combination, and the following quantity that is the same for both wires is the electric current.
What is an electric current?Electric current refers to the movement of electric charge that is carried by moving electrons in a wire or an electric circuit. It is measured in amperes (A) and is a basic component of the study of electricity.
The current density is the current per unit of cross-sectional area of the material through which the current flows. It is represented by the symbol J and is given in amperes per meter squared (A/m²).
The electric field is the force per unit charge that a charged particle would experience when placed in the field. It is represented by the symbol E and is given in volts per meter (V/m).
Finally, the potential difference is defined as the difference in electric potential energy per unit of charge between two points in a circuit. It is also called voltage and is represented by the symbol V. It is measured in volts (V).
Based on the information given, both wires are of the same material and length, but their radii are different. This indicates that the wires' cross-sectional areas are not the same, which implies that their current densities would differ. Because the potential difference is the same across the wires, it must be the electric current that is identical in both wires. Thus, the right option is B, electric current.
Learn more about the electric current here:
https://brainly.com/question/1100341
#SPJ11
In a tank full of water, the pressure on a surface 2 meters below the water level is 1.5 kPA. What's the pressure on a surface 6 meters below the water level ?
Answer:
P = 40.7kPa
Explanation:
To find the pressure on a surface 6 meter below you use the following formula, which takes into account the heights in which pressures are measured and also the density of the fluid and the gravitational acceleration:
\(P_2-P_1=-\rho g(y_2-y_1)\) (1)
P2: pressure for a height of -6 m = ?
P1: pressure for a height of -2 m = 1.5kPa = 1500 Pa
ρ: density of water = 1000kg/m^3
g: gravitational acceleration = 9.8 ms^2
y2: -6m
y1: -2m
(the height is measure from the water level, because of that, the heights are negative)
You solve the equation (1) for P1:
\(P_1=P_2-\rho g(y_2-y_1)\) (2)
Next, you replace the values of all variables in equation (2):
\(P_2=1500Pa-(1000kg/m^3)(9.8m/s^2)(-6-(-2))m=40700Pa\\\\P_2=40.7kPa\)
hence, the pressure on a surface 6 m below the water level is 40.7kPa
Ideally, when a thermometer is used to measure the temperature ofan object, the temperature of the object itself should not change.However, if a significant amount of heat flows from the object tothe thermometer, the temperature will change. A thermometer has amass of 26.0 g, a specific heat capacity of c =896 J/(kg C°), and a temperature of 16.4 °C. It is immersedin 166 g of water, and the final temperature of the water andthermometer is 65.6 °C. What was the temperature of the waterin degrees Celsius before the insertion of the thermometer?
The temperature of the water before the insertion of the thermometer was 22.6 °C.
We can use the equation Q = mcΔT to solve this problem, where Q is the heat gained or lost, m is the mass of the substance, c is the specific heat capacity, and ΔT is the change in temperature.
First, we need to find the heat gained by the thermometer from the water:
Q₁ = mcΔT = (0.026 kg)(896 J/(kg⋅°C))(65.6 °C - 16.4 °C) = 120.64 J
Next, we can use the heat gained by the thermometer to find the initial temperature of the water:
Q₂ = mcΔT = (0.166 kg)(4184 J/(kg⋅°C))(T₂ - 65.6 °C) = -120.64 J
Solving for T₂, we get:
T₂ = (120.64 J)/((0.166 kg)(4184 J/(kg⋅°C))) + 65.6 °C = 22.6 °C
Therefore, the temperature is 22.6 °C.
To know more about temperature, refer here:
https://brainly.com/question/900679#
#SPJ11
The "hang time" of a punt is measured to be 4.30 s
.If the ball was kicked at an angle of 68.0 ∘ above the horizontal and was caught at the same level from which it was kicked, what was its initial speed?
t^2=10.97 sin(68)-3.05cos(68)/4.905cos(68)
t=2.2164
10.97/cos68 x 2.21= vo
I got v0=13.25
13.25/1000=.0133 x 3600=47.88 kh/m(which is wrong)
13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
What, in physics, is speed, and what is its unit?The rate at which distance and time change is what is meant by speed. It has the aspect of temporal and spatial distance. The combination of a fundamental units of distance and time is what is described as the System of units ( si of speed. As a result, the SI unit for speed is the meter per second.
Describe velocity and speed.In contrast to velocity, which describes the speed and direction of the an object's movement, speed is the rate of movement along a path. Instead, velocity is a vector while speed is a scalar quantity.
t = (2 * v0 * sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows: t = (2 * v0 * sin) / g 4.30 ≈ (2 * v0 * sin68) / 9.81 v0 = (4.30 * 9.81) / (3 ) * sin68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h: 13.25 m/s * 3.6 ≈ 47.88 km/h
To know more about speed visit:
https://brainly.com/question/28224010
#SPJ1
The initial speed 13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
Speed in physics is measured in what unit?Speed refers to the rate at which distance and time change. It has a temporal and spatial distance component. The System of units (s of speed) is the amalgamation of fundamental units of time and distance. Consequently, the meter per second is the SI unit for speed.
Depict speed and speed :Speed is the rate of movement along a path, in contrast to velocity, which describes the speed and direction of an object's movement. Speed, on the other hand, is a scalar quantity while velocity is a vector.
t = (2 × v₀ × sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows:
t = (2 × v₀ × sin) / g 4.30 ≈ (2 × v₀ × sin 68) / 9.81 v₀
= (4.30 × 9.81) / (3 ) × sin 68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h:
13.25 m/s × 3.6 ≈ 47.88 km/h
Learn more about speed :
brainly.com/question/28224010
#SPJ1
The chemical bonds in sugar, is that potential or kinetic energy?
Answer:
If something has atoms that are bound together in covalent bonds like sugar, it usually has potential energy or chemical energy. Because potential energy is often stored in covalent bonds that hold atoms together in the form of molecules.
What is heat in kinetic theory? A) The transfer of random kinetic energy B) The transfer of potential energyC) The transfer of work done
Heat in kinetic theory refers to the transfer of random kinetic energy between particles. Hence, option A is correct.
According to kinetic theory, when two particles come into contact, energy is transferred between them in the form of heat. This transfer of energy causes the particles to move faster and thus increases the temperature of the substance.
Heat is not the transfer of potential energy (option B) or the transfer of work done (option C), although both of these processes can also affect the temperature of a substance.
The boiling of water is perhaps one of the better examples to demonstrate the transfer of energy from one particle to another. If you heat water to a rolling boil on the stove, you can see the active, kinetic energy of the very hot water. On a microscopic level, the individual water molecules are equally active that results in boiling.
To know more about Kinetic theory:
https://brainly.com/question/14349214
#SPJ11
I NEED HELP PLEASE, THANKS! :)
Holiday lights are often connected in series and use special lamps that short out when the potential difference across a lamp increases to the line voltage. Generate an explanation why and explain why these light sets might blow their fuses after many bulbs have failed.
Answer:
if there isn't a shorting mechanism, the whole sets will be blown out several lamps and then shortened, the overall resistance of the remaining operating lamps will be decreased resulting in an increased working current that is adequate to blast the fuse
mr. montana and mr. perry both purchase the same model of refrigerator. mr. montana pushes his refrigerator up a frictionless ramp and into his truck. mr. perry picks his refrigerator up and directly lifts it into his truck. who applied more force in moving the refrigerator and why?
Assuming that both refrigerators have the same weight, the work done in lifting the refrigerator to the truck is the same for both Mr. Montana and Mr. Perry, regardless of the method they used to lift it. However, the force required to lift the refrigerator is different.
Mr. Montana used a ramp to move the refrigerator up to his truck, which means that he applied a smaller force over a longer distance. This is because the ramp reduces the force needed to move the object against gravity, but it increases the distance over which the force is applied. In contrast, Mr. Perry lifted the refrigerator directly, applying a larger force over a shorter distance.
Therefore, Mr. Perry applied more force than Mr. Montana to lift the refrigerator, as he had to lift the entire weight of the refrigerator with his arms. On the other hand, Mr. Montana applied less force because the ramp reduced the force needed to move the refrigerator up to his truck.
Learn more about force here:
https://brainly.com/question/13191643
#SPJ11
Which statement below is Gauss's Law for electric fields? Please note, we are not asking which statement is true, we are asking which statement is Gauss's Law. As an example, 2+2-4 is true but it is not a statement of Gauss's Law. O The electric flux through a surface is equal to the integral of the normal component of the electric field over the surface O 2+2-4 The electric flux through a closed surface is equal to the net charge inside the surface divided by the physical constant The electric flux is equal to the amount of charge flowing through a surface in a given time.
“The electric flux through a closed surface is equal to the net charge inside the surface divided by the physical constant. This law is a fundamental principle in electrostatics and is expressed mathematically as E.ds = Q/ε0.
Gauss’s Law for electric fields is a fundamental principle in physics, specifically in the study of electrostatics. The law describes the relationship between the electric flux and the distribution of electric charges in a given space. Simply put, it states that the electric flux through a closed surface is proportional to the total amount of electric charges inside the surface. In mathematical terms, the statement of Gauss’s Law for electric fields is as follows: E.ds = Q/ε0Here, E.ds represents the electric flux through a closed surface, Q represents the total electric charge enclosed within the surface, and ε0 is the physical constant known as the permittivity of free space. This equation can be used to calculate the electric field created by a given charge distribution, provided that the electric flux through a closed surface around the distribution is known.
Gauss’s Law for electric fields states that the electric flux through a closed surface is proportional to the net electric charge enclosed within the surface. This law is a fundamental principle in electrostatics and is expressed mathematically as E.ds = Q/ε0.
To know more about Gauss’s Law visit:
brainly.com/question/14767569
#SPJ11
Solar energy is a form of
energy from the Sun.
OA) heat
OB) nuclear
OC) mechanical
OD) electromagnetic
Answer:
Solar energy is a form of Electromagnetic energy
Explanation:
Solar energy is constantly flowing away from the sun and throughout the solar system. Solar energy warms the Earth, causes wind and weather, and sustains plant and animal life. The energy, heat, and light from the sun flow away in the form of electromagnetic radiation (EMR
Below, the two-way table is given for a class of students. Freshmen Sophomore Juniors Seniors Total Male 4 6 2 2 Female 3 4 6 3 Total If a student is selected at random, find the probability the student is a female given that it's a junior. P( Female | Junior ) = [?] % Round to the nearest whole percent.
The required probability is 3/4.We have to compute the probability
P(Female |Junior) because we have to find the probability of the female student and the given condition is that the student is junior.
Determine the total number of juniors.Juniors=2+6=8
What is the probability?Probability is the branch of mathematics concerning numerical descriptions of how likely an event is to occur, or how likely it is that a proposition is true. The probability of an event is a number between 0 and 1, where, roughly speaking, 0 indicates the impossibility of the event and 1 indicates certainty.
Since the number of females who are junior is 6, determine the required probability.
P(Female|Junior)=6/8=3/4
Therefore, the required probability is 3/4.
To learn more about the probability visit:
brainly.com/question/24756209
#SPJ1