An atmospheric concentration of 380 ppm CO2 corresponds to a partial pressure of 0.00038 atm. What percentage of the CO2 originally dissolved in the solution in Part A remains in solution after the soft drink reaches equilibrium with the ambient atmosphere

Answers

Answer 1

Answer:

8.44 * 10^-3 %

Explanation:

The solubility of CO2 gas in water is 0.15g/100 ml at a CO2 pressure of 760 mmHg.

Determine the percentage of the CO2 that dissolved originally in the solution that remains

Amount remaining ( Sg = kpg )

Sg = solubility of gas = 0.15 / 100 g/ml

pg. = partial pressure of gas = 760 mmHg = 1 atm

therefore ; K = 1.5 * 10^-3 gm^-1 atm^-1

solubility of gas inside container

Sg = 0.675 * 10^-2 g/ml

solubility of gas during/after dissolution ( amount that remains )

sg = 1.5 * 10^-3 * 0.00038

    =  5.7 * 10^-7  g/ml

therefore the percentage remaining

= (5.7 * 10^-7  / 0.675 * 10^-2 ) * 100

= 8.44 * 10^-3 %

Answer 2

The percentage of CO2 remaining in the solution after the soft drink reaches equilibrium is 8.4 × 10⁻³ %

There exists some missing information in the question.

Let us assume that:

the solubility of CO2 gas in the water = 0.15 g/100 mL = 1.5 × 10⁻³ the partial pressure of CO2 = 760 mmHg = 1 atm

Then, by applying Henry's law:

\(\mathbf{S_g = k P_g}\)

\(\mathbf{k = \dfrac{S_g}{P_g}}\)

\(\mathbf{k =\dfrac{1.5 \times 10^{-3} g/mL}{1\ atm}}}\)

k = 1.5 × 10⁻³ g/m* atm

The percentage of CO2 that was originally dissolved in the solution is:

\(\mathbf{S_g = k P_g}\)

Assuming the partial pressure of CO2 = 4.5 atm

Then;

\(\mathbf{S_g = 1.5 \times 10^{-3} g/mL* atm \times 4.5 \ atm}\)

\(\mathbf{S_g =0.00675 \ g/mL}\)

The partial pressure in the can when the soft drink is being opened is 0.00038 atm.

The solubility of the gas \(\mathbf{S_g = 1.5 \times 10^{-3} g/mL* atm \times 0.00038 \ atm}\)

\(\mathbf{S_g =5.7 \times 10^7 \ g/mL}\)

Thus, the percentage of CO2 remaining in the solution after the soft drink reaches equilibrium is:

\(\mathbf{=\dfrac{5.7\times 10^{-7}}{0.00675} \times 100 \%}\)

\(\mathbf{=0.0084 \%}\)

= 8.4 × 10⁻³ %

Learn more about Henry's Law here:

https://brainly.com/question/20377656?referrer=searchResults


Related Questions

Example of change in substance

Answers

The original substance has undergone a transformation into a new substance with different properties, indicating a change in the chemical composition of the material.

An example of a change in substance is the process of combustion. When a substance, such as wood, is burned, it undergoes a chemical reaction with oxygen in the air, which produces a new substance: carbon dioxide gas, water vapor, and ash. This change in the chemical composition of the wood means that it has transformed into a completely new substance with different physical and chemical properties.

Another example is the process of electrolysis, where an electric current is passed through a solution containing ions. This can cause a chemical reaction to occur, resulting in the breakdown of the original substance into its component parts or the formation of a new substance.

for more questions on transformation
https://brainly.com/question/29713522
#SPJ11

Question
The equilibrium constant for the reaction below is 9.0. What is the equilibrium concentration of CO₂ when a mixture that is
1.5M in CO and 1.2M in CO₂ are mixed to make 1.0L of solution?
CoO(s) + CO(g) = Co(s) + CO2(g)
• Report your answer with two significant figures.

QuestionThe equilibrium constant for the reaction below is 9.0. What is the equilibrium concentration

Answers

The equilibrium concentration of CO₂ when a mixture that is

1.5M in CO and 1.2M in CO₂ are mixed to make 1.0L of the solution is 2.43 M.

\($\begin{aligned} k_{c} &=\frac{\left[\mathrm{CO}_{2}\right]}{[\mathrm{C0}]}=\frac{(1.2+x)}{(1.5-x)} \\ \therefore \quad 9.0 &=\frac{(1.2+x)}{\left(1.5^{-\pi} x\right)} \\ \text { or, } 9 \times 1.5 &-9 x=1.2+x \end{aligned}$\)

or, \($\begin{aligned} 10 x &=13.5-1.2=12.3 \\ \text { or, } x &=1.23 \end{aligned}$\)

\(\therefore \begin{aligned}\therefore eq^{n}{com}^{n} \text { of } \mathrm{CO}_{2} &=(1.2+\lambda) \mathrm{M} \\&=(1.2+1.23) \\&=2.43 \mathrm{M} .\end{aligned}\)

A chemical reaction is considered to be in a state of chemical equilibrium when both the reactants and the products are in a concentration that does not change over time anymore. The forward response rate and the backward reaction rate are equal in this condition.

The equilibrium will adjust to minimise the impact of a change in a substance's concentration. Reactant concentration will drop if a reactant's concentration is raised because the equilibrium will change in favour of the reaction that utilises the reactants.

Learn more about equilibrium concentration https://brainly.com/question/16645766

#SPJ9


The absolute temperature of a gas is increased four times while maintaining a constant volume. What happens to the
pressure of the gas?
Olt decreases by a factor of four.
O It increases by a factor of four.
It decreases by a factor of eight
It increases by a factor of eight.

Answers

Answer:

The pressure increases by a factor of four.

Explanation:

Let's consider a gas at a given temperature and pressure (T₁, P₁). The absolute temperature of a gas is increased four times (T₂ = 4 T₁) while maintaining a constant volume. We can assess the effect on the pressure (P₂) by using Gay Lussac's law.

P₁/T₁ = P₂/T₂

P₂ = P₁ × T₂/T₁

P₂ = P₁ × 4 T₁/T₁

P₂ = 4 P₁

The pressure increases by a factor of four.

Determine the energy released per kilogram of fuel used.

Given MeV per reaction, calculate energy in joules per kilogram of reactants.
Consider 1 mole of tritium plus 1 mole of deuterium to be a mole of “reactions” (total molar mass = 5 grams).

Answers

The energy released per kilogram of fuel used can be calculated as follows:

1. Calculate the energy released per reaction using Einstein's famous equation E = mc^2, where E is the energy released, m is the mass defect of the reactants, and c is the speed of light. The mass defect is the difference between the mass of the reactants and the mass of the products.

2. Convert the energy released per reaction from MeV (mega-electron volts) to joules using the conversion factor 1 MeV = 1.602 × 10^-13 joules.

3. Calculate the number of reactions per kilogram of reactants. Since 1 mole of tritium plus 1 mole of deuterium is a mole of "reactions," and the total molar mass of the reactants is 5 grams, we can calculate the number of moles of reactants per kilogram.

4. Multiply the energy released per reaction by the number of reactions per kilogram of reactants to get the energy released per kilogram of fuel used.

Here's the formula:

Energy released per kilogram of fuel used = (Energy released per reaction x Conversion factor x Reactions per kilogram of reactants) / 1000

Describe a chemical property of iron that you observed.​

Answers

Answer:

Iron can rust in damp conditions. Or, it can dissolve readily in dilute acids.

Explanation:

Suppose you are titrating a sulfuric acid solution of unknown concentration with a sodium hydroxide solution according to the equation
H2SPO4+2NaOH⟶2H2O+Na2SO4 If you require 30.44 mL of 0.605 M NaOH solution to titrate 210.3 mL of H2SO4 solution, what is the concentration of the H2SO4 solution?

Answers

25.46 mL x NaOH times 1L NaOH times/    1,000 mL of NaOH  x  0.959 moles NaOH/ 1 L NaOH    1 mole EqualsH2SO4/2 moles NaOH =    0.0122 moles H2SO4                                                    

 Moles + Molarity/  L

 201.7 milliliters H2SO4    1 liter  H2SO4 /  1000 mL H2SO4 = 0.2017 liters.H2SO4.      

molarity =  0.0122 moles.H2SO4/  0.2017 L H2SO4 =  =  0.0605 M H2SO4.

One mole of H2SO4 will be present in a liter of a 1 M solution of the acid, but when the solution is titrated with a base, it is revealed to contain two moles of acid. This is due to the fact that each H2SO4 molecule has two acidic protons (H+ Ions). A 1 M solution of H2SO4 will be 2 N as a result.

Molarity (M), which is determined by dividing the solute's mass in moles by the volume of the solution in liters, is the most widely used unit to express solution concentration: M = liters of solution/moles of solute

The number of moles of protons in the solution is a measure of normality. Each H2SO4 molecule has 2 protons available to react, so 2 N is the normality.

Learn more about One mole from here;

https://brainly.com/question/14585733

#SPJ1

                           

               

             

The analysis of a compound gives the following percent composition by mass:
C: 58.59 percent; H: 10.16 percent; S: 10.43 percent; O: 20.82 percent. What is its molecular formula
given that its molar mass is 307.5 g?

Answers

Answer:

C15 H31 O4 S

Explanation:

molecular formula is also the same because the value of "n" is 1

what is indicator? give three examples of indicator.​

Answers

Indicators are weak acids or bases that exhibit a color change as hydrogen ion concentration in a solution varies or as a solution's pH changes.

In the water, the indicators gently separate to produce ions.

The three examples of indicators are

Litmus: It is one of the naturally occurring chemical indicators. It is naturally obtained from lichens. It is usually found in form of paper strips. Paler strips are of 2 colors red and blue. Acids change the blue paler to red color whereas the base changes red paper to blue color. Some solutions don't give any color with litmus paper because they are neutral Turmeric: it is a type of natural indicator. It is used in our daily life while preparing food. Turmeric gives a yellow color when the acidic medium is the ent brownish-red red color when the basic medium is present. This effect of turmeric is due to a yellow pigment present in it known as curcumin.Vanilla extract: It is a type of olfactory indicator. It works by changing the smell when reacted. It gives a pungent smell when reacted with acid. But when the base is added to this extract the reaction is odorless. This is due to certain chemicals present in it.

A gas occupies a volume of 180 mL at 35 °C and 95.9 kPa. What is the volume of the gas at conditions of STP?

Answers

Answer:

the volume of the gas at conditions of STP = 151.04998 ml

Explanation:

Data given:

V1 = 180 ml

T1 = 35°C or 273.15 + 35 = 308.15 K

P1 = 95.9 KPa

V2  =?

We know that at STP

P2 = 1 atm or 101.3 KPa

T2 = 273.15 K

At STP the pressure is 1 atm and the temperature is 273.15 K

applying Gas Law:

\(\frac{P_1V_1}{T_1} =\frac{P_2V_2}{T_2}\)

putting the values in the equation of Gas Law:

\(V_2=\frac{P_1V_1T_2}{T_1P_2}\)

V_2 =\(\frac{95.9\times180\times273.15}{308.15\times101.3}\)

V2 = 151.04998

therefore, V2 = 151.04998 ml

Answer:

151 mL is the correct answer to the given question .

Explanation:

We know that

\(PV =n RT\)

Where P =pressure ,V=volume and T=Temperature

Given

P=95.9 kPa.

V=\(180 * 10 ^{-3}\)

R=25/3

T=273 + 35 =308k

Putting these value into the equation we get

\(95.9\ * 180\ *\ 10^{-3} \ =\ n * \frac{25}{3} * 308\)

n=\(6.72 * 10^{-3}\)

Now using the equation

\(n= \ \frac{V}{22.4}\)

\(6.72 * 10^{-3} =\frac{V}{22.4}\\ V\ =\ 150.6mL\)

This can be written as  151mL

6) The density of ammonia gas (NHs) in a 6.0 L container at a pressure of 820 mm Hg and a g/L.

Answers

The density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.

To determine the density of ammonia gas (NH3) in a 6.0 L container at a pressure of 820 mm Hg, we need to use the ideal gas law equation, which relates pressure, volume, number of moles, and temperature for a given gas.

The ideal gas law equation is:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.

Since we are given the pressure (820 mm Hg), volume (6.0 L), and assuming standard temperature and pressure (STP), we can use the values for R (0.0821 L·atm/(mol·K)) and convert the pressure to atm by dividing by 760 (1 atm = 760 mm Hg).

820 mm Hg / 760 mm Hg/atm = 1.08 atm

Now we can rearrange the ideal gas law equation to solve for density (d):

d = (P * M) / (RT)

Where M is the molar mass of ammonia (NH3), which is approximately 17.03 g/mol.

Substituting the values, we have:

d = (1.08 atm * 17.03 g/mol) / (0.0821 L·atm/(mol·K) * 298 K)

Simplifying the equation, we find:

d ≈ 0.805 g/L

Therefore, the density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.

For more question on density

https://brainly.com/question/26364788

#SPJ8

What is bonding all about in chemistry?

Answers

A chemical bond is a lasting attraction between atoms, ions or molecules that enables the formation of chemical compounds. The bond may result from the electrostatic force of attraction between oppositely charged ions as in ionic bonds or through the sharing of electrons as in covalent bonds.

Answer:

It is like about a attraction between atoms, molecules, and more.

how do one get this solution
-log10 (2* 10^-2)​

Answers

The result of the computation when you follow the steps is 1.699.

What is logarithm?

A logarithm is a mathematical function that represents the exponent or power to which a specific base must be raised to obtain a given number. In simpler terms, it answers the question: "To what power must we raise a base number to obtain a certain value?"

What you should do is that on your calculator, you could press the logarithm key and then put in the value that has been shown and then the result would be displayed on your calculator.

Learn more about logarithm:https://brainly.com/question/30226560

#SPJ1

Click the "draw structure" button to launch the drawing utility.
Draw the structural formula for (E,E)-3,5-octadiene.
draw structure...

Answers

(E, E)-3,5-octadiene, molecular formula is C8H14, molecular weight is 110.20,(3E,5E)-octa-3,5-diene is its IUPAC name.

What is IUPAC?

The International Union of Pure and Applied Chemistry (IUPAC) is a global federation of National Adhering Organizations dedicated to the progress of the chemical sciences, particularly through the creation of nomenclature and terminology. It is an International Science Council member (ISC).

What is the Molecular formula?

A molecule is made up of two or more atoms that have joined together chemically. A molecular formula is the chemical representation of a molecular compound that lists the types and quantities of atoms that make up each molecule.

Hence, the structure of the compound (E, E)-3,5-octadiene is in the image attached. The image is from Pubchem, National library of medicine (NCBI).

To know more about Molecular formula, check out:

https://brainly.com/question/23948807

#SPJ9

Click the "draw structure" button to launch the drawing utility.Draw the structural formula for (E,E)-3,5-octadiene.draw

CHEM FINAL TOMORROW!!! I'm struggling with a few concepts, if anyone could help explain this to me & how to do it, I'd be very grateful!!!

CHEM FINAL TOMORROW!!! I'm struggling with a few concepts, if anyone could help explain this to me &

Answers

Based on the given reaction, the acid-base pairs in this reaction are:

HCO₃⁻ (acid) and NH₃ (base)NH₄⁺ (acid) and CO₃²⁻ (base)

What are the acid-base pairs in the given reaction?

An acid-base pair refers to a set of two chemical species that are related through the transfer of a proton (H+ ion) during a chemical reaction.

One species acts as an acid by donating a proton, while the other acts as a base by accepting that proton.

In the given reaction:

HCO₃⁻ (aq) + NH₃ (aq) → NH₄⁺ + CO₃²⁻

An acid-base pair can be identified as follows:

HCO₃⁻ (bicarbonate ion) can act as an acid by donating a proton (H⁺), becoming CO₃⁻.

NH₃ (ammonia) can act as a base by accepting a proton (H⁺), becoming NH₄⁺ (ammonium ion).

Learn more about acid-base pairs at: https://brainly.com/question/22514615

#SPJ1

The table describes a gas stored in four different containers. Properties of Stored Gas Container Properties 1 · Low number of collisions with container walls · Medium average kinetic energy · Large number of particles 2 · Large number of collisions with container walls · Medium average kinetic energy · Small number of particles with little spaces between them 3 · Large number of collisions with container walls · High average kinetic energy · Large number of particles with large spaces between them 4 · Few collisions with container walls · Low average kinetic energy · Small number of particles Which container has gas stored at the highest temperature? 1 2 3 4

Answers

Container 3 has the gas stored at the highest temperature.

Temperature is a measure of the average kinetic energy of the particles in a substance. In the given table, it is stated that container 3 has a large number of collisions with container walls, high average kinetic energy, and large number of particles with large spaces between them.

These properties indicate that the gas in container 3 has higher kinetic energy and more vigorous movement compared to the other containers.

Container 1 has a low number of collisions with container walls and a medium average kinetic energy. This suggests that the gas in container 1 has lower energy and less movement than the gas in container 3.

Container 2 has a large number of collisions with container walls, but it also has a small number of particles with little spaces between them. While the collisions may be frequent, the limited number of particles and the lack of space between them may result in lower overall kinetic energy compared to container 3.

Container 4 has few collisions with container walls, low average kinetic energy, and a small number of particles. These properties indicate that the gas in container 4 has the lowest energy and least movement among all the containers.

Container 3

For more such questions on temperature visit;

https://brainly.com/question/4735135

#SPJ8

An atom with 14 protons, 14 neutrons, and 16 electrons is stable, -2 charge
stable, +2 charge
unstable, -2 charge
unstable, no charge *​

Answers

We can see that an atom with 14 protons, 14 neutrons, and 16 electrons is unstable, and has a -2 charge.

So the correct option is the third one.

What can we say about the atom?

An atom with 14 protons, 14 neutrons, and 16 electrons is not stable. The number of protons in an atom, also known as its atomic number, determines its element and its chemical properties. In this case, the atom has 14 protons, which corresponds to the element silicon (Si) on the periodic table.

For an atom to be stable, it should have a balanced number of protons and electrons. Electrons are negatively charged particles that orbit the nucleus of an atom in energy levels or electron shells. The number of electrons in a stable atom should be equal to the number of protons, resulting in a neutral charge overall.

In this case, the atom has 14 protons and 16 electrons, which means it has two more electrons than protons, resulting in a net charge of -2. This is an example of an ion.

Learn more about atoms.

https://brainly.com/question/17425565

#SPJ1

What is rent? A. The amount you spend on needs each month B. The amount you pay to purchase a house C. The amount you pay to live in a space such as an apartment D. The amount you pay for electricity and water

Answers

C. The amount you pay to live in’s space such as a apartment
the answer is c because that is right and the other person said

What is the mass of 87.94 mL of ethanol, which has a density of 0.79 g/mL?

Answers

Answer:

The answer is

69.47 g

Explanation:

The mass of a substance when given the density and volume can be found by using the formula

mass = Density × volume

From the question

volume of ethanol = 87.94 mL

density = 0.79 g/mL

The mass of ethanol is

mass = 87.94 × 0.79

mass = 69.4726

We have the final answer as

69.47 g

Hope this helps you

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Why does the solubility of many substances increase with temperature? (Remember what an increase in temperature means on a microscopic scale.)

Answers

The solubility of many substances increases with temperature, there are exceptions. Some substances exhibit a decrease in solubility with temperature due to specific interactions or changes in solute-solvent interactions at higher temperatures.

The increase in solubility of many substances with temperature can be attributed to the effect of temperature on the kinetic energy and intermolecular interactions of molecules.

On a microscopic scale, an increase in temperature corresponds to an increase in the kinetic energy of molecules. As the kinetic energy increases, the molecules move more rapidly and collide with each other and with the solvent molecules more frequently and with greater force.

These increased collisions and kinetic energy result in enhanced molecular interactions and overcome the forces holding the solute particles together. This increased energy disrupts the intermolecular forces within the solute, allowing the solvent molecules to surround and interact more effectively with the solute particles, leading to greater solubility.

Additionally, an increase in temperature can cause solvent molecules to move more freely, reducing their cohesion and allowing them to interact more readily with solute particles.

for more questions on  solubility

https://brainly.com/question/24057916

#SPJ8

b) Explain why Carbon (IV) oxide and water are removed before liquefaction of air​

Answers

Answer:

Before air is liquefied, water vapor and carbon dioxide are removed, because these substances solidify when cooled and would clog the pipes of the air liquefaction plant.

Would an action potential be possible without the presence of proteins? Explain your
response.

A. Yes, the action potential would be possible since the Na+ being hydrophobic can enter the neuron through the phospholipid bilayer.

B. No, the action potential would not be possible since Na+ being hydrophilic would not be able to move across the plasma membrane.

C. No, the action potential would not be possible since Na+ being hydrophilic would not be able to move across the plasma membrane unless ATP was available

Answers

Action potential would not be possible because ions would not be able to move across the plasma membrane without the channels provided by proteins.

What is action potential ?

When the membrane potential of a particular cell site rapidly increases and decreases, an action potential happens.  Following this depolarization, nearby areas also experience depolarization. Excitable cells, which include neurons, muscle cells, and some plant cells, are a class of animal cells that exhibit action potentials.

Larger protein molecules are integrated within a lipid bilayer that makes up a cell membrane. The lipid bilayer serves as an insulator because it impedes the flow of electrically charged ions very effectively.

Action potentials are produced by channel proteins, which change their state from closed to open depending on the voltage differential between the cell's interior and exterior.

Therefore, action potential is not possible without proteins.

To find more on action potential, refer here:

https://brainly.com/question/4305583

#SPJ1

Explain how to use the periodic table to deduce the number of protons, neutrons and electrons of an atom of a specific element

Answers

Answer:

See explanation

Explanation:

The periodic table shows the atomic number and mass number of each element.

We know that the atomic number shows;

The number of protons in the nucleus of the atomThe number of electrons in the neutral atom of the element.

So we obtain the number of protons and electrons by looking at the atomic number shown in the periodic table.

We also know that;

Mass number = Number of protons + number of neutrons

Since number of protons = atomic number of the atom

Number of neutrons = Mass number - atomic number

Hence we obtain the number of protons by subtracting the atomic number from the mass number given in the periodic table.

What is the mass (in grams) of 2.55 x 1022 molecules of water?

Answers

Explanation:

hope the picture above make sense:)

What is the mass (in grams) of 2.55 x 1022 molecules of water?
What is the mass (in grams) of 2.55 x 1022 molecules of water?

What is the mass of 1.70 mol of carbon-12?
Select one:
O
20.49
O
0.140 g
O
12.0 g
7.069

Answers

Answer:

20.49

Explanation:

number of mole equal mass/molar mass and the number of mol is 0.17 and the molar mass is 12 then you substitute and solve.

URGENT HELP PLEASEEEEE

















URGENT HELP PLEASEEEEE

Answers

The answer is D as one increases, the other will increase at the same rate the graph will show an inverse curve
C
Inverse means when one increases the other decreases and the line take a curve

For an electron with n=4, l=2, and ml=-1, what are the allowed values of ms?

Answers

Answer:

4d¹ electron has quantum numbers

n=4; l=2; ml= -2; ms= 1/2

Explanation:

There are 4 quantum numbers, namely

the principal quantum number (n)

the orbital angular momentum quantum number (l)

the magnetic quantum number (ml)

the electron spin quantum number (ms)

The principal quantum number describes the orbit or shell of the electron

here n = 4 ⇒ electron is in 4th shell

the orbital angular momentum quantum number describes the shape of orbital the electron is present in.

l= 0 ⇒ s-orbital

l= 1 ⇒ p-orbital

l= 2 ⇒ d-orbital

l= 3 ⇒ f-orbital

In our case l= 2 ⇒ p-orbital

ml specifies in which orbital electron is present of given shape

ml has 2l+1 values,which range from -1 to +l

here l = 2 ⇒ ml has 2(2)+1 = 5 values (-2 to +2)

so electron is present in one of the five d-orbitals

ms represents the spin of electron (+1/2 or -1/2)

If  +1/2 represents clockwise then -1/2 represents anti-clockwise and vice-versa.

⇒  4d¹ electron has quantum numbers

n=4; l=2; ml= -2; ms= 1/2.

Hope this helped!

How do you determine the mass number of an atom?

Answers

the number of protons and the number of neutrons determine an element's mass number: mass number

Explanation:

The number of protons and neutrons. you can simply subtract the number of protons, or atomic number, from the mass number to get your final answer.

Neutralization is a type of chemical reaction in which an acid and a base react with each other to form water and a salt.
Calculate the % yield of a reaction that combined 28.0 grams of sodium hydroxide with 125.0 mL of 3.10 M solution of sulfuric acid hat produced 24.5 g of Na2SO4 in the laboratory.

Balanced equation:
2 NaOH + H₂SO4 → Na₂SO4 + 2 H₂O

Answers

The percent yield of the reaction is 45.44%

Percentage yield is basically,

 \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

2 NaOH + H₂SO₄ → Na₂SO₄ + 2 H₂O

To calculate the theoretical yield, consider the stoichiometry of the reaction.

2 moles of NaOH reacts with 1 mole of H₂SO₄ to give 1 mole of Na₂SO₄ and 2 moles of H₂O. The mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

For this mole ratio to be useful, convert the given concentration of H₂SO₄ into moles.  

     \(\rm Molarity\ =\ \frac{No.\ of\ moles}{Volume\ of\ solution (L)}\)

            \(\rm 3.10\ =\ \frac{No.\ of\ moles}{0.125}\)

\(\rm No.\ of\ moles\ =\ 3.10 \times 0.125\\)

                     \(=\ 0.38\)

Since, mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

Amount of Na₂SO₄ formed would be also 0.38 mol

Convert this amount in moles to amount in grams

\(\rm No.\ of\ moles\ =\ \frac{Mass\ formed\ }{Molecular\ mass}\)

\(\rm Mass\ formed\ =\ No.\ of\ moles\times molecular\ mass\)

                     \(\rm =\ 0.38\times 142.04\)

                     \(\rm =\ 53.97\ grams\)

Theorical yield of Na₂SO₄ is 53.97 grams

Therefore,   \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

                                          \(\rm =\ \frac{24.5}{53.97}\times 100\)

                                          =  45.44%

The percent yield of the reaction is 45.44%

To know more on percent yield, click on

https://brainly.com/question/12704041

#SPJ1

answer? giving brainlyest

answer? giving brainlyest

Answers

Answer:

r=3

Explanation:

Answer:

rc

Explanation:

Other Questions
A 60 kg skater at 0. 0 meters has 1,470 J of kinetic energy. a. At what speed is the skater moving?b. Determine the gravitational potential energy. C. What is this skater's total energy? Mind helping? Thanks you so much 1/2z+6=3/2(z+6) need the answer asap Iron is one of the macro minerals fond in a healthy human body.True or false Solve: 10(1 + 3y) = 20 What does y equal?Y = Nina knows that it is a myth to think steroids are not addictive. What evidence can Nina use from the passage to confirm the effects of steroid addiction?People may continue to abuse steroids despite negative side effects.The addictive nature of steroids goes away after sustaining a physical injury.Steroid addiction will improve the social interaction between individuals.Mood swings and sleeping patterns due to steroid use will eventually balance out. which of the following explains why online banks often offer their customers better interest rates than traditional banks? select one: a. online banks provide their customers a greater sense of security. b. traditional banks charge lower prices for financial services. c. online banks have lower overhead costs. d. traditional banks offer the electronic transfer of customer funds. 3/8, 4/12, 4/9, 3/6, 1/4 from least to greatest a landlord owns 4 apartments bulidings. each building has 4 floors. each floor has 4 apartments and 4 people live in each apartment. how many people live in the landlords apartment a conducting rod slides over two horizontal metal bars with a constant speed v to the left. the entire set up is in a region of uniform magnetic field that is perpendicular to the plane of the rod and bars. if the induced current through the resistor is as indicated, what is the direction of the magnetic field? out of the page into the page According to Greek history, which war was The Odyssey written about? BRAINLIETS IF CORRECT What does Hess's law say about the enthalpy of a reaction? A. The enthalpy of a reaction does not depend on the reactant path taken. B. The enthalpy of a reaction depends on the pathway the reactants followed See SUS C. The sum of the enthalpy and entropy is the free energy of a reaction. O D. The entropy of a reaction is the sum of the enthalpies of intermediate steps. write a debate against the motion which is"schooling in the village is more advantageous than schooling in a City Which dynasty of China was controlled by foreigners (people outside of China)? O Ming Song Sui Yuan Question 2 ASAPPP GIVING BRAINLIST TO FIRST PERSON WHO ANSWERS CORECT consisting of an electric coil on a small paddle held over an area of the brain, __________ deactivates areas of the brain, allowing scientists to learn their function. What is included in a basic metabolic panel? Un cilindro contiene 10 L de oxgeno y otro contiene 10 L de dixido de carbono, ambos se encuentran a 25 C. De acuerdo con el modelo cintico de partculas, se puede afirmar que... Why is early onset an important factor in crime?a. Because the earlier that antisocial behavior is identified, the earlier that turning points can be implemented.b. Because latent traits may have gone unnoticed or unidentified at birth.c. Because early onset of antisocial behavior predicts later and more serious criminality.d. Because early onset of antisocial behavior is void of the crime-non-crime choice mechanism suggested by Wilson and Herrnstein. i need to write sentences but i am not good at spanish please help me