Collision theory states that when suitable particles of the reactant hit each other with correct orientation, only a certain amount of collisions result in a perceptible or notable change; these successful changes are called successful collisions.
Explanation:here your answer matehave a great day
For a reversible reaction, what would a large equilibrium constant indicate? Question 14 options: A) At equilibrium, the concentration of the products will be much higher than the concentration of the reactants. B) At equilibrium, the concentration of the products will be about the same as the concentration of the reactants. C) At equilibrium, there will be no reactants left because they will all have been turned into products. D) At equilibrium, the concentration of the reactants will be much higher than the concentration of the products.
Answer:
B) At equilibrium, the concentration of the products will be about the same as the concentration of the reactants.
This is because equilibrium means equal state
Answer: B) At equilibrium, the concentration of the products will be about the same as the concentration of the reactants.
Explanation:
Chemist I found that 24.31 g magnesium combined with 71.33 g chlorine. Chemist II found that
109.4 mg magnesium combined with 319.1 mg chlorine. You found that 3.647 g magnesium
combined with 10.700 g chlorine? How do your results compare to the two chemists? Show your
work
A. You disagree with both chemists.
B. You agree with Chemist I only.
C. You agree with Chemist II only.
D. You agree with both chemists.
The compound magnesium chloride is produced when magnesium and chlorine interact. Below is a formula for the equation. Mg+Cl2→MgCl2.
To determine accuracy or systematic error, an experiment using different methodologies is conducted.
What is the purpose of comparison in an experiment?If a significant difference exists between an experimental average and the population mean (), also known as the "true value," the t-test is employed to ascertain this. With the help of standard reference materials and quality control standards, this method is used to assess the findings of experiments.
In the range of research techniques currently employed in science, comparative studies play a crucial role. They enable scientists to use a treatment-control design in circumstances where experimentation is not an option, and they can offer priceless knowledge on the relationships between variables.
To determine accuracy or systematic error, an experiment using different methodologies is conducted. To see how this experiment works with the others, review MV - The Experimental Plan.
To learn more about experiment refer to:
https://brainly.com/question/25303029
#SPJ1
Which of the following regions has an economy based on processing food and consumer goods?
A. Western Europe
B. Eastern Europe
C. northern Europe
D. southern Europe
No links plz
Answer:
B. Eastern Europe
Explanation:
The economy of Eastern Europe depends on producing foods. For example, Poland and Belarus are two countries in Eastern Europe, and they both produce chocolates. Producing foods isn't the only detrimental part of the region's economic data. The other half depends on consumer goods. For example, Estonia and Latvia are good countries in packaging food. The answer to the question is B.
Identify the type of reaction and predict the product: Calcium + water -->
Answer:
Exothermic Reaction
Product = Calcium hydroxide + hydrogen
Explanation:
Shivani measures out 6.0 moles of epsom salt (MgSO) to put her bath. How many grams MgSO4 went in the bath?
Answer: 720 g
Explanation:
To solve this we must be knowing each and every concept related to mole. Therefore, shivani measures out 6.0 moles of epsom salt (MgSO\(_4\)) to put her bath. 1,566g MgSO\(_4\) went in the bath.
What is mole?A mole is merely a measuring unit. In reality, it is one of its International System of Units' seven foundation units. When current units are insufficient, new units are created.
Chemical reactions frequently occur at levels where employing grams would be inappropriate, but using absolute quantities of atoms/molecules/ions would also be misleading.
For all practical reasons, one mole of a substance in grams is nearly equal to 1 molecule for the compound per daltons.
Mathematically,
number of mole =given mass ÷ molar mass
number of mole=6.0 moles
molar mass of epsom= 261.47g/mol
substituting all the given values in the above equation, we get
6.0 moles =mass of epsom ÷ 261.47g/mol
mass of epsom =1,566g
Therefore, 1,566g MgSO\(_4\) went in the bath.
To know more about mole, here:
brainly.com/question/15209553
#SPJ2
naming compounds
does anyone know the answers for these or at least one of them ?
Answer:
KNO3- Potassium Nitrate, KOH- Potassium hydroxide, K2CRO4- Potassium chromate
Explanation:
Answer:
KNO3=Potassium, nitrogen, oxygen3
KOH= Potassium, oxygen, and hydrogen
K2CRO4=Potassium2, chromium, oxygen4
Compound names
KNO3= Potassium Nitrate
KOH= Potassium hydroxide
K2CrO4= Potassium chromate
Hope it helps
What will be formed when 2,2,3-trimethylcyclohexanone reacts with hydroxylamine?
Answer:
Following are the solution to this equation:
Explanation:
In the given-question, an attachment file of the choices was missing, which can be attached in the question and its solution can be defined as follows:
In the given question "Option (iii)" is correct, which is defined in the attachment file.
When 2,2,3-trimethylcyclohexanone reacts with hydroxylamine it will produce the 2,2,3-trimethylcyclohexanoxime.
What frequency does a photon of wavelength 4.5 x 10-4 m have?
A. 6.67 x 1011 Hz
B. 1.47 x 10-30 Hz
C. 2.98 x 10-37 Hz
D. 1.35 x 105 Hz
SUBMIT
Answer:
6.67* 1011 Hz
Explanation:
a p e x
Answer:
Awnser above is correct
Explanation:
a. 6.67
How many protons, neutrons and electrons are there in the species
26 Si+4?
Coloumb's Law shows that opposite charges (positive and negative) attract
whereas charges that are both positive or both negative repel and a greater
distance decreases the force between objects. TRUE or FLASE
Explanation:
TRUE
the answer is true. Trust me. Im an expert at this.
For a galvanic cell that uses the following two half-reactions, Cr2O72-(aq) + 14 H+(aq) + 6 e- → 2 Cr3+(aq) + 7 H2O(l) Pb(s) → Pb2+(aq) + 2 e- how many moles of Pb(s) are oxidized by three moles of Cr2O72-?
Answer:
9 mol
Explanation:
Let's consider the following half-reactions taking place in a galvanic cell.
Reduction: Cr₂O₇²⁻(aq) + 14 H⁺(aq) + 6 e⁻ → 2 Cr³⁺(aq) + 7 H₂O(l)
Oxidation: Pb(s) → Pb²⁺(aq) + 2 e⁻
We can establish the following relationships.
1 mole of Pb is oxidized when 2 moles of electrons circulate.1 mole of Cr₂O₇²⁻ is reduced when 6 moles of electrons circulate.The moles of Pb(s) are oxidized by three moles of Cr₂O₇²⁻ are:
\(3molCr_2O_7^{2-} \times \frac{6mol\ e^{-} }{1molCr_2O_7^{2-}} \times \frac{1molPb}{2 mol\ e^{-} } = 9molPb\)
According to the information in the question, 9 moles of Pb(s) is oxidized by three moles of dichromate ion.
A redox reaction involves loss and gain of electrons. The oxidizing agent gains electrons while the reducing agent looses electrons. For the reaction stated in the question;
Oxidation half equation;
6Pb(s) → 6Pb2+(aq) + 12 e-
Reduction half equation;
2Cr2O72-(aq) + 28 H+(aq) + 12 e- → 4 Cr3+(aq) + 14 H2O(l)
The overall equation is;
6Pb(s) + 2Cr2O72-(aq) + 28 H+(aq) → 6Pb2+(aq) + 4 Cr3+(aq) + 14 H2O(l)
If 6 moles of Pb(s) is oxidized by 2 moles of Cr2O72-
x moles of Pb(s) is oxidized by 3 moles of Cr2O72-
x = 6 moles × 3 moles/ 2 moles
x = 9 moles of Pb(s)
Learn more: https://brainly.com/question/8646601
HELP ASAP! I WILL GIVE YOU BRAINLIST IF YOU SOLVE THESE TWO QUESTIONS
Answer: All visible light waves except red are absorbed by the ball. The wave transfers its energy to the material.
Explanation: The red is reflected back, which is how we see color. This is why most plants look green, they cannot absorb green light.
Wave Absorption Source: https://study.com/academy/lesson/what-is-wave-absorption-definition-examples.html
What is the net force
A. 7 N left
B. 2 N right
C. 9 N left
D. 5 N left
Answer: 9 N left
Explanation:
i know it i just took the test and got a 100
\({\huge\color{red}{\boxed{\fcolorbox{red}{blue}{✪ANSWER✪}}}}\)
D. 5 N leftExplanation:
7-2=5
Hydrogengasand oxygengas react to form water vapor. Suppose you have of and of in a reactor. Calculate the largest amount of that could be produced. Round your answer to the nearest .
The question is incomplete. The complete question is :
Hydrogen \((H_2)\) gas and oxygen \((O_2)\) gas react to form water vapor \((H_2O)\). Suppose you have 11.0 mol of \(H_2\) and 13.0 mol of \(O_2\) in a reactor. Calculate the largest amount of \(H_2O\) that could be produced. Round your answer to the nearest 0.1 mol .
Solution :
The balanced reaction for reaction is :
\($2H_2(g) \ \ \ \ + \ \ \ \ \ O_2(g)\ \ \ \rightarrow \ \ \ \ 2H_2O(g)$\)
11.0 13.0
11/2 13/1 (dividing by the co-efficient)
6.5 mol 13 mol (minimum is limiting reagent as it is completely consumed during the reaction)
Therefore, \(H_2\) is limiting reagent. It's stoichiometry decides the product formation amount from equation above it is clear that number of moles for \(H_2O\) will be produced = number of moles of \(H_2\)
= 11.0 mol
How does having knowledge about viscosity may affect you in simple ways in your daily life?
Viscosity is an crucial factor in food preparation and serving. Cooking oils' viscosity may or may not change as they heat, but many become much more viscous as they cool.
What is viscosity?Viscosity refers to the resistance of a fluid (liquid or gaseous state) to a shape shift or mobility of neighboring portions relative to one another. Viscosity indicates flow resistance.
Gathering viscosity data on a material allows manufacturers to predict how the material will start behaving in the real world. For example, if toothpaste does not have the correct viscosity, it may be difficult or impossible to pump out of the tube.
Thus, it is important to have the knowledge of viscosity.
For more details regarding viscosity, visit:
https://brainly.com/question/13385698
#SPJ1
Which one of these are a physical property? Select all that apply. a. Luster (shininess) Conducts Electricity Reactivity with water d. Temperature b. 0 0
Arrange these species in the order of increasing size:
(i) Ar, Cl- , K+ , S2-, Ca2+
(ii) Fe, Fe2+, Fe+
(iii) Na, Rb, K
(iv) N, C, O, B, F
Just Note the below follow the below principle
\(\boxed{\sf SCLA}\)
It stands for Smaller cation and larger anion.#1
\(\\ \sf\longmapsto Ar<Ca^{2+}<K^+Cl^-<S^{2-}\)
#2
\(\\ \sf\longmapsto Fe^{2+}<Fe^+<Fe\)
#3
\(\\ \sf\longmapsto Na<K<Rb\)
#4
\(\\ \sf\longmapsto B<C<N<O<F\)
Please help me asap
(Do not balance the equation)
Explanation:
decrease T = eq shifts left, because youre taking energy from the system and this is an endothermic reaction, it needs energy to make products = co2 concentration decreases
add CO = eq shifts right, because you're adding reactants in the equilibrium = i2o5 concentration decreases
increase i2o5 = same = can't affect T
decrease co2 = eq shifts right, because by
decreasing co2 you'll have less of this product than you normally have in the equilibrium, then eq will shift toward making more product = both reactants, CO and I2O5 decrease their concentration because they're being used to shift equilibrium right
what are two elements that could displace iron in a single replacement reaction? how did you make this determination?
Two elements that could displace iron in a single replacement reaction are magnesium and zinc. This determination is made based on the reactivity series, which ranks metals according to their ability to displace other metals in aqueous solutions.
What is a single replacement reaction?An element replaces another element in a compound in a single replacement reaction, creating a new compound and a different element.
How does the reactivity series determine the displacement of metals in single replacement reactions?The reactivity series determines the displacement of metals in single replacement reactions by ranking metals in order of their reactivity, with the most reactive metal displacing less reactive metals from their compounds.
Magnesium and zinc, which are more reactive than iron, can displace iron in a single replacement reaction.
To know more about metals;visit:
https://brainly.com/question/28650063
#SPJ1
Which of the following are steps for balancing chemical equations?
Check all that apply
A. Subtract the total amount of elements from the products.
B. Write the chemical equation using formulas and symbols.
C. Add all the elements together.
D. Count the atoms in each substance in the reactants and products,
Answer:
B. Write the chemical equation using formulas and symbols.
D. Count the atoms in each substance in the reactants and products,
Explanation:
When balancing chemical equation, it implies that the law of conservation of matter be strictly adhered to.
By so doing, the number of atoms on both sides of the reaction must be the same. Number of atoms in the products and reactants must have the same value.
It is always a good approach to first write the chemical equation of the reaction. This will give an overview of the reacting species and the products being formed. Then, go on to count the number atoms in the reactants and product sides of the expression. Then balance it using any of the method of balancing chemical equations.Answer: b and d
Explanation:
Hope it helps
. What is the difference between a temporary and a permanent dipole? Give an example of each.
A sample of baby oil has a volume of12 mL and a mass of 10 g. What is the density of the baby oil?
The density of the baby oil, ρ = 0.833 g/ml.
Equation :density = mass / volume
ρ = m / V
where,
ρ is density
m is mass
V is volume
So putting the values in the formula,
ρ = 10g / 12ml
ρ = 0.833 g/ml
What is density, mass and volume?The three most fundamental characteristics of an object are mass, volume, and density. Volume indicates something's size, mass indicates how heavy it is, and density is calculated as mass divided by volume. Although you deal with mass and volume on a daily basis, the concept of density is less clear-cut and requires careful consideration.
To know more about mass :
https://brainly.com/question/19694949
#SPJ9
1. Which of the following is true regarding a Dynamic Equilibrium? A) it may occur in both open and closed systems B) the forward reaction is only occurring C) the concentrations found at equilibrium are different if a system approaches equilibrium from different directions D) the concentration of reactants and products remains constant
Answer:
D) the concentration of reactants and products remains constant.
Explanation:
1. Which of the following is true regarding a Dynamic Equilibrium?
A) it may occur in both open and closed systems. FALSE. It can only occur in closed systems. Otherwise, gases would leave the recipient and it would be impossible to reach the equilibrium.
B) the forward reaction is only occurring. FALSE. The forward reaction and the reverse reaction occur at the same rate.
C) the concentrations found at equilibrium are different if a system approaches equilibrium from different directions. FALSE. The equilibrium is the same regardless of the direction from which it comes.
D) the concentration of reactants and products remains constant. TRUE.
In which type of chemical bond are electrons transferred from 1 atom to another?.
Ionic bonds are bonds that occur due to the handover of electrons to form positive ions and negative ions whose electron configuration is the same as that of the noble gasses.
Chemical bondsChemical bonds are the forces that hold atoms in elements and compounds together. Chemical bonds can occur with several types of bonds.
Based on the electron configuration that occurs in bond formation, chemical bonds are divided into 4 types:
1. Ionic or electrovalent bonds
This bond occurs because of the electrostatic attraction between positive ions and negative ions in a chemical compound
2. Covalent bonds
Covalent bonds occur when the sharing of electron pairs from each of the bonding atoms.
3. Coordinate covalent bond
Coordinate covalent bond is a bond that uses a shared pair of electrons, but the electrons only come from one of the atoms.
4. Metallic bond
This bond is formed due to the attractive force of the metal atomic nucleus with a sea of electrons.
Learn more about chemical bonds here: https://brainly.com/question/819068#SPJ4
How many moles in 5 grams?
Answer:
The molar mass of atoms of an element is given by the standard relative atomic mass of the element multiplied by the molar mass constant
Explanation:
help me pleaseeeeee
Answer:
Arthropod (3)
Annelids (2)
Cnidarians (1)
Echinoderms (4)
Explanations:
I hope all this helps if u don't understand it let me know.
What is the mass of 750 atoms of Nitrogen?
Answer:
53.545803079954496
Explanation:
Brainliest pls
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the mass (in g) of a solid piece of iron which has a specific heat of 0.449 J/g°C if when it absorbed 948.0 J of heat the temperature rose from 24.0°C to
82.1°C? Give your answer in 3 sig figs.
Answer:
Explanation:
We can use the formula:
q = mcΔT
where q is the heat absorbed, m is the mass, c is the specific heat, and ΔT is the change in temperature.
Given:
specific heat of iron (c) = 0.449 J/g°C
initial temperature (T1) = 24.0°C
final temperature (T2) = 82.1°C
heat absorbed (q) = 948.0 J
Substituting the given values into the formula, we get:
q = mcΔT
948.0 J = m(0.449 J/g°C)(82.1°C - 24.0°C)
948.0 J = m(0.449 J/g°C)(58.1°C)
m = 948.0 J ÷ (0.449 J/g°C × 58.1°C)
m = 33.1 g
Therefore, the mass of the iron piece is 33.1 g (to three significant figures)
Which is a description of objects found in abundance between Mars and
Jupiter?
I am not sure but rocky bodies ranging from large to small in size