Answer:
None of the given options
Explanation:
Let's go case by case:
A. No matter the volume, the concentration of Fe(NO₃)₃ (and thus of [Fe³⁺] as well) is 0.050 M.
B. We can calculate the moles of Fe₂(SO₄)₃:
0.020 M * 0.80 L = 0.016 mol Fe₂(SO₄)₃Given that there are two Fe⁺³ moles per Fe₂(SO₄)₃ mol, in the solution we have 0.032 moles of Fe⁺³. With that information in mind we can calculate [Fe⁺³]:
0.032 mol Fe⁺³ / 0.80 L = 0.040 MC. Analog to case A., the molar concentration of Fe⁺³ is 0.040 M.
D. Similar to cases A and C., [Fe⁺³] = 0.010 M.
Thus none of the given options would have [Fe⁺³] = 0.020 M.
Convert to moles 12.06 x 10^22 molecules
Answer:
0.2 mole
Explanation:
From the question given above, the following data were obtained:
Number of molecules = 12.06×10²²
Number of mole =?
From Avogadro's hypothesis,
6.02×10²³ molecules = 1 mole
Therefore,
12.06×10²² molecules = 12.06×10²² / 6.02×10²³
12.06×10²² molecules = 0.2 mole
Thus, 12.06×10²² molecules is equivalent to 0.2 mole
Which phrase describes conduction?
transfer of heat between two objects that are touching
transfer of heat by the actual movement of warmed matter
the process in which energy is released by molecules breaking apart
the process in which energy is emitted by one object, transmitted through space, and absorbed by another
Answer:
Transfer of heat between two objects that are touching.
Explanation:
Conduction is the process by which heat is transferred from one object to another object that is touching and has different temperatures.
Eg: We can use a hot water pack to warm our back. Or While cooking we can feel the conduction process when heat process from the bottom of the pan to the top of the pan
Answer:
A. Transfer of heat between two objects that are touching
Explanation:
1.03 Quiz: Three Kinds of Heat Transfer
I am in K12
A student sets up the following equation to convert a measurement.
(The ? stands for a number the student is going to calculate.)
Fill in the missing part of this equation.
mol
(12) 0-
mol
0.0
X
Н
00
The value in mol/Kg would be 12000 g/mol from the calculation.
What is unit conversion?When converting from mol/kg (moles per kilogram) to g/mol (grams per mole), it's important to take the substance's molar mass into account.
Consider a material that has a 12 mol/kg concentration and a molar mass of M g/mol.
You can perform the following conversion from mol/kg to g/mol:
Find out how many grams there are in a kilogram (1000 grams). This conversion factor is dependent on how the kilogram is defined.
To get the concentration in g/mol, multiply the concentration in mol/kg by the molar mass conversion factor.
Consequently, this conversion would be:
Concentration in mol/kg * 1000 g/kg is 12 mol/kg * 1000 g/kg, or 12000 g/mol.
In light of this, 12 mol/kg is equal to 12000 g/mol.
Learn more about unit conversion:https://brainly.com/question/28600662
#SPJ1
A gas occupies a volume of 50.0 mL at 27°C and 630 mmHg. At what
temperature, in *C, would the pressure be 101.3 kPa if the volume remains constant?
Answer:
T2+500k - 273 = 223 *C
Explanation:
How do I write the Empirical Formula for: A compound composed of: 9.93% carbon, 58.6% chlorine, and 31.4% fluorine
The empirical formula for a compound composed of 9.93% carbon, 58.6% chlorine, and 31.4% fluorine is CCl₂F₂.
To write the empirical formula, let us assume that total mass of the compound is 100 g, then-
Mass of carbon = 9.93 g
Mass of chlorine = 58.6 g
Mass of fluorine = 31.4 g
We know that,
Molar mass of Carbon = 12.0 g/mol
Molar mass of Chlorine = 35.5 g/mol
Molar mass of Fluorine = 18.9 g/mol
Now, we will calculate the number of moles of each using the formula -
Number of moles = Given mass
Molar mass
Moles of Carbon = 9.93 g = 0.82 mol
12.01 g/mol
Moles of Chlorine = 58.6 g = 1.65 mol
35.5 g/mol
Moles of fluorine = 31.4 g = 1.66 mol
18.9 g/mol
Now, divide each value with the smallest amount of mole we got,
carbon = 0.82 = 1
0.82
chlorine = 1.65 = 2
0.82
fluorine = 1.66 = 2
0.82
Therefore, the empirical formula of the compound can be written as - CCl₂F₂
To learn more about empirical formula,
brainly.com/question/14044066
#SPJ1
Why was the morning session stopped unsuccessfully?
The reactor was overheating.
The automatic control system was not adjusted properly.
The vernier control rod became stuck.
The emergency rod failed.
Answer:
the reactor was overheating
How many moles are equal to 145g of zinc nitrate
Answer:
there are 6 MOLES of zinc nitrate in 145 g
A gas in a 6.2 mL cylinder has a pressure of 1.4 atmospheres. A piston is pushed in until the gas volume is 3.1 mL, while the temperature remains constant. What's the final pressure of the gas in the cylinder?
Answer:
2.8 atm.
Explanation:
From the question given above, we obtained the following data:
Initial volume (V1) = 6.2 mL
Initial pressure (P1) = 1.4 atm
Final volume (V2) = 3.1 mL
Final pressure (P2) =?
The final pressure of the gas cylinder can be obtained by using the Boyle's law equation as shown below:
P1V1 = P2V2
1.4 × 6.2 = P2 × 3.1
8.68 = P2 × 3.1
Divide both side by 3.1
P2 = 8.68/3.1
P2 = 2.8 atm
Therefore, the final pressure of the gas cylinder is 2.8 atm
Answer:
2.8 atm
Explanation:
The weather is warm and dry
Which change would bring a cold front in
A.several days of gray skies
A.dry air and sunny skies
B.rain or thunderstorms
C.extended period of rain or snow
because im d and god is go od and 9 x 10 is 99999because im god and god is good a nd 9 x 10 i d and god is goo d and 9 x 10 is 99999because im god and god is good a nd 9 x 10 is 99999because im god and god is good and 9 x 10 is 99999
Answer:the answer is c
Explanation:
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
URGENT PLZ HELP
According to AUFBAU, which of the following sublevels is of highest energy?
a) 2p
b) 3d
c) 3s
d) 4s
Does modern industrial agriculture have a sustainable future?
What is the molarity of a solution containing 2.50 moles in 35 mL of solution?
Answer: 71.43 M.
Explanation: To calculate the molarity of a solution, we divide the number of moles of solute by the volume of the solution in liters. The volume of the solution in this case is given in milliliters, so we need to convert it to liters before we can calculate the molarity.
35 mL = 0.035 L (since 1 mL = 0.001 L)
So, the molarity of the solution can be calculated as follows:
Molarity = moles of solute / volume of solution in liters
Molarity = 2.50 moles / 0.035 L
Molarity = 71.43 M
Therefore, the molarity of the solution is 71.43 M.
How many oxygen atoms are in H2SO4?
Which statement best Describe the people in Mississippi period
Answer:Explanation:
The statement that best describes the people of the Mississippian Period is that they were farmers who used simple tools to grow their food in small gardens. They would also fish and gather food such as muscles, in order to create a large enough food supply in addition to produce from these gardens and farms.
Identify another chemical reaction that is important to your daily life hint this is a good resource
Photosynthesis is a chemical reaction it leads to the generation of oxygen and provides food for both plants and animals.
This is the process by which plants convert carbon dioxide and water into glucose and oxygen using energy from the sun. It is the basis for all life on Earth, as it provides the energy and oxygen necessary for life.
Photosynthesis is the process by which plants, algae, and some bacteria convert light energy from the sun into chemical energy in the form of glucose and other organic compounds.
This process is carried out by special structures called chloroplasts, which contain a pigment called chlorophyll that gives plants their green color.
To learn more about the photosynthesis, follow the link:
https://brainly.com/question/29764662
#SPJ1
The helium tank has a pressure of 650 torr at 25 degree celsius what will be the pressure if the temperature is tripled?
pa help po
The helium tank has a pressure of 650 torr at 25 degree Celsius and when the temperature is tripled, the pressure will be approximately 1945.71 torr
To find the new pressure when the temperature is tripled, we can use the ideal gas law, which states that the pressure of a gas is directly proportional to its temperature when the volume and the number of particles remain constant. The ideal gas law is given by the equation:
PV = nRT
Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.
First, we need to convert the initial temperature of 25 degrees Celsius to Kelvin. Adding 273.15 to the Celsius temperature gives us 298.15 K.
Let's assume that the volume, number of moles, and the gas constant remain constant.
If the temperature is tripled, the new temperature would be 3 times the initial temperature, which is 3 * 298.15 K = 894.45 K.
Now, we can set up a proportion to find the new pressure:
P1 / T1 = P2 / T2
Solving for P2 (the new pressure), we get:
P2 = (P1 * T2) / T1
Plugging in the values, we have:
P2 = (650 torr * 894.45 K) / 298.15 K
Calculating this expression, we find:
P2 ≈ 1945.71 torr
Therefore, when the temperature is tripled, the pressure will be approximately 1945.71 torr.
for more questions on pressure
https://brainly.com/question/24719118
#SPJ11
Assignment Summary
For this assignment, your teacher will give you an egg and some building materials. You will use these
materials to build a device that will keep an egg from cracking when it is dropped from a certain height.
Then you will test the device, determine how well it worked, and make recommendations to improve its
design. You will present your final design and the logic that supports it in a lab report. Your lab report
should include a title, an initial design, observations from your experimental tests, and recommendations
for a final design based on force and momentum concepts as well as observations from the tests
conducted. To help you write your lab report, there is a Student Worksheet on the last few pages of this
document.
I
Background Information
The shell of an egg is designed to distribute the force of an adult bird sitting on the egg, but it does not
retain its form as well when faced with a sudden impact. Unprotected, the shell of the egg cracks and the
contents of the egg splatter in many directions. During this project, you will design a device to protect an
egg on impact. The egg will be dropped from a designated height and allowed to collide with the ground. To
protect the egg from impact, you will need to lengthen the time before impact by using your knowledge of
force, Newton's third law of motion, and momentum. This is an engineering challenge because it combines
physics principles with real building materials and design constraints. It provides you with the opportunity to
think about a problem, construct a solution, and evaluate your solution's effectiveness.
Safety
Wear safety goggles, as the egg will be dropped and pieces could break off upon impact. The eggs
not be consumed during or after the experiment
The eggs
Based on the law of conservation of momentum, the design of the egg cushion will have to ensure that the momentum of the egg is distributed across the material in order to avoid cracking.
What is momentum?Momentum of a body is the product of its mass and velocity.
Momentum = mass × velocityThe principle of conservation of momentum states that in an isolated system of colliding bodies, the total momentum is conserved.
Based on the principle above, the design of the egg cushion will be such that the momentum of dropping the egg will be distributed across the material in order to avoid cracking.
Learn more about momentum at: https://brainly.com/question/26138070
Which of these is an organic compound?
CaO
H2SO4
C3H8
H2O2
Answer:
which class are you please mention
Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?
A compound has the empirical formula given below. C3H4O3 Which compound represents the molecular formula with a scale factor of 2? A. C6H8O6 B. C2H2O2 C. C3H4O3
The compound which represents the molecular formula with a scale factor of 2 is \(C_6H_8O_6\) . The correct answer is option A
The empirical formula of a compound gives the simplest whole-number ratio of the atoms present in the compound. To obtain the molecular formula, we need to know the actual number of atoms in the molecule.
To find the molecular formula with a scale factor of 2, we need to multiply the subscripts in the empirical formula by 2.
Therefore, the molecular formula with a scale factor of 2 would be:
\(C_3H_4O_3\) × \(2\) = \(C_6H_8O_6\)
So option A is the correct answer.
For more such questions on molecular formula, click on:
https://brainly.com/question/26388921
#SPJ11
Brainliest will be rewarded!
Option B, where [OH-] is 1.0 x 10-13 mol dm-³3, is the only one that can be considered basic. Therefore, Option B is the correct answer.
To determine whether a solution is basic or acidic at 25 °C, we can compare the concentration of hydroxide ions ([OH-]) with the concentration of hydronium ions ([\(H_3O\)+]). In a neutral solution, the concentrations of [\(H_3O\)+] and [OH-] are equal, resulting in a pH of 7.
Option A states that the concentration of [\(H_3O\)+] is 1.0 x 10-3 mol dm-3. Since [\(H_3O\)+] represents the concentration of hydronium ions, this solution would be acidic because the concentration of [\(H_3O\)+] is higher than [OH-], indicating an excess of hydronium ions.
Option B states that the concentration of [OH-] is 1.0 x 10-13 mol dm-³3. In this case, [OH-] is higher than [\(H_3O\)+], indicating an excess of hydroxide ions. Therefore, this solution would be considered basic.
Option C states that the solution has a pH of 4.00. A pH of 4.00 is below the neutral pH of 7, indicating an excess of hydronium ions and an acidic solution. Therefore, this option does not represent a basic solution.
Option D states that the concentration of [\(H_3O\)+] is 1.0 x 10-13 mol dm-3. Similar to Option A, this concentration of [\(H_3O\)+] indicates an acidic solution, not a basic one.
Option B
For more such question on basic visit:
https://brainly.com/question/29886197
#SPJ8
Answer:
D is the correct answer
Explanation:
In order for a solution to be basic at 25 C, the H+ concentration has to be less than the OH- concentration, and given that H+ times OH- is 10^-14, we deduce that H+ must be less than 10^-7 for the solution to be acidic. Thus, A can be eliminated, and so can C. With B, we calculate an H+ concentration of 0.1M, which also fails to be less than 10^-7
Thus, D is the correct answer and we can verify that as H+ is less than 10^-7.
Note: I do not know why my previous answer was deleted for "being incorrect", and i'm not sure how the incorrect answer was "expert verified", but I am as certain that D is the correct answer as i am sure of 3*(4+5-1) being equal to 24.
Part C
How many grams of H₂ are needed to produce 12.13 g of NH3?
Grams of H\(_{2}\) are needed to produced 12.13 g of NH\(_{3}\) are 2.13 g
The balanced chemical equation is :
N\(_{2}\) + 3H\(_{2}\) ------> 2NH\(_{3}\)
H = 1 g/mol and N =14 g/mol
NH\(_{3}\) = 17 g/mol =
6g of H\(_{2}\) ( 3×2) = 34 g of NH\(_{3}\) (2× 17)
mass of hydrogen in coumpond ( % mass ) = 6 / 34
= 0.1764 or 17.64%
mass of H\(_{2}\) required = % mass × mass of ammonia
= ( 0.1764 × 12.13 ) g
2.13 g
Thus , Grams of H\(_{2}\) are needed to produced 12.13 g of NH\(_{3}\) are 2.13 g
To learn more about ammonia here
https://brainly.com/question/1098222
#SPJ1
Hãy tính pH của dung dịch thu được khi trộn 20 mL NaOH 0,1 M và 10 mL
CH3COOH 0,1 M. Biết pKa (CH3COOH) = 4,75.
Answer:frh
Explanation:
what properties of a natural resource make it useful for humans as a materials or energy source?
The properties of a natural resource that make it useful for humans as a material or energy source is the ability to convert mass into energy and vice versa.
What are natural resources?The expression natural resources make reference to all types of matter and energy extracted from nature that can be used to produce goods and services.
Some examples of natural resources include for example irreversible resources such as fossil fuels (i.e., oil, or coal, gas, minerals such as metals, rocks, etc) as well as those based on the use of reversible energy such as eolic air energy, solar radiation or sunlight, soil and hydric resources or water.
Therefore, with this data, we can see that natural resources can be defined as any material and or energy obtained from nature that may be irreversible or reversibly used to produce goods and services.
Learn more about natural resources here:
https://brainly.com/question/24514288
#SPJ1
A 16 gram sample of O2(g) fills a container at STP.
What volume is the container?
Answer:
V = 11.2 L
Explanation:
Hello there!
In this case, according to the ideal gas equation:
\(PV=nRT\)
It is possible to compute the volume as shown below:
\(V=\frac{nRT}{P}\)
Whereas the moles are computed are computed given the mass and molar mass of oxygen:
\(n=16g*\frac{1mol}{32g} =0.5mol\)
Now, since the STP stands for a temperature of 273.15 K and a pressure of 1 atm, the resulting volume is:
\(V=\frac{0.5mol*0.08206\frac{atm*L}{mol*K}*273.15K}{1atm}\\\\V=11.2L\)
Best regards!
Helen knit a total of 175 centimeters of scarf over 35 nights. How many nights will Helen have to spend knitting in order to knit a total of 180 centimeters of scarf? Solve using unit rates.
Helen takes 35 nights to knit a total of 175 centimeters of scarf. Hence, she will take 36 nights to knit 180 centimeters of scarf.
What are length units?Length is a basic measurement in for an object which is basically taken in meters or centimeters. The basic unit of length in American standard is meters (m) and in CGS system it is centimeters.
It is given that, Helen knit a total of 175 centimeters of a scarf over 35 nights. Then, the length she knit in one nigh is calculated as:
175/35 = 5 cm.
Therefore, the number of nights required to complete 180 cm is :
180 /5 = 36
Thus, she will take 36 nights to knit a total of 180 cm of scarf.
Find more on length units:
https://brainly.com/question/3217720
#SPJ1
Two common household cleaners - bleach and ammonia - are very effective when used alone. However, they can be deadly when mixed, even in small amounts. Household bleach contains 5.0% sodium hypochlorite (NaOCl) by mass. Household ammonia contains 5.0% NH3 by mass. If 50.00 g of bleach are mixed with 50.00 g of 5.0% ammonia, what mass of the toxic chloramine gas would be produced by the following unbalanced reaction equation? NaOCl + NH3 ® NH2Cl + NaOH
Answer:
1.73g of chloroamine would be produced
Explanation:
To balance the reaction:
NaOCl + NH3 → NH2Cl + NaOH
There is 1 mole of Na, 1 mole of O, 1 mole of Cl, 1 mole of N, and 3 moles of H in both sides of the reaction. That means the reaction is balanced yet.
To know how many NH2Cl is produced we need to calculate moles of NH3 and NaOCl that reacts:
Moles NH3:
50.00g * 5% = 2.5g NH3. To moles using its molar mass (Molar mass NH3: 17g/mol):
2.5g NH3 * (1mol / 17g) = 0.147 moles NH3
Moles NaOCl:
50.00g * 5% = 2.5g NaOCl
Molar mass NaOCl is 74.44g/mol. Moles of 2.5g are:
2.5g NaOCl * (1mol / 74.44g) = 0.0336 moles NaOCl
That means just 0.0336 moles of each reactant will react until NaOCl is over producing 0.0336 moles of chloroamine gas.
As molar mass of chloroamine is 51.48g/mol. The mass produced of this gas is:
0.0336 moles * (51.48g / mol) =
1.73g of chloroamine would be producedPretend you are a scientist observing three different varieties of a single bird species that are part of the same population. In three to five sentences, describe what genetic variations exist in your population. Then, using reasoning skills and mock evidence from your observations, describe the impact these traits have on the birds’ relationships with their environment and predators
The genetic variations in the bird population can lead to differences in behavior, physiology and morphology which can impact birds' survival and reproductive success.
What are the impact these traits have on the birds’ relationships with their environment and predators?In the population of bird species, there may be genetic variations such as difference in feather color, beak size and shape, and wing shape. Some birds may have brown feathers and others may have black or white feathers.
Beak size and shape may vary, with some birds having longer or shorter beaks, and some having curved or straight beaks. Wing shapes may also differ with some birds having longer, narrower wings and others having shorter and wider wings.
To know more about genetic variation refer
https://brainly.com/question/14926046
#SPJ1
Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K
At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
1: Write the balanced chemical equation:
\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)
2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.
Initial:
\(C_O\)(g) = 0.3500 mol
\(Cl_2\)(g) = 0.05500 mol
\(C_OCl_2\)(g) = 0 mol
Change:
\(C_O\)(g) = -x
\(Cl_2\)(g) = -x
\(C_OCl_2\)(g) = +x
Equilibrium:
\(C_O\)(g) = 0.3500 - x mol
\(Cl_2\)(g) = 0.05500 - x mol
\(C_OCl_2\)(g) = x mol
3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:
Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]
4: Substitute the given equilibrium constant (Kc) value into the expression:
1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)
5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:
1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x
6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.
7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.
8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):
\(Cl_2\)(g) = 0.05500 - x
9: Calculate the value of \(Cl_2\)(g) at equilibrium:
\(Cl_2\)(g) = 0.05500 - x
\(Cl_2\)(g) = 0.05500 - (positive value of x)
10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.
Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
For more such questions on equilibrium, click on:
https://brainly.com/question/517289
#SPJ8