The energy required to heat 266.0 mg of cyclohexane from 14.0°C to 37.2°C is approximately 9.02 J.
To calculate the energy required to heat 266.0 mg of cyclohexane from 14.0°C to 37.2°C, we can use the equation:
Q = m × c × ΔT
where Q is the heat energy, m is the mass of cyclohexane, c is the specific heat capacity, and ΔT is the change in temperature.
First, we need to convert the mass of cyclohexane from milligrams to grams:
266.0 mg = 0.266 g
Next, we calculate the change in temperature:
ΔT = 37.2°C - 14.0°C = 23.2°C
Finally, we can plug in the values into the equation:
Q = 0.266 g × 1.85 J/g°C × 23.2°C = 9.02 J
So, the energy required to heat 266.0 mg of cyclohexane from 14.0°C to 37.2°C is approximately 9.02 J.
Learn more about cyclohexane:
brainly.com/question/17019157
#SPJ4
Calculate the energy required to heat 266.0mg of cyclohexane from 14.0°C to 37.2°C. Assume the specific heat capacity of cyclohexane under these conditions is ·1.85J·g−1K−1 . Round your answer to 3 significant digits.
What does it mean for an animal to be circumpolar? Explain please ill give brainliest!!
A circumpolar animal dwells at the poles.
What is circumpolar?Animals are found in different areas. The areas that are inhabited by an animal is called the habitat of the animal. Different animals have different habitats.
However, the animals that are found around the poles are said to be circumpolar. In nutshell, a circumpolar animal dwells at the poles.
Learn more about habitat: https://brainly.com/question/7038386
If at the beginning of the reaction you used 4.22 g C and 15.76 g S8, what is the theoretical yield (in grams) of CS2 (you will need to find the limiting reagent and then the theoretical yield of CS2 from this reagent)?
The theoretical yield of CS2 is 8.52 grams.
To determine the limiting reagent and the theoretical yield of CS2, we need to compare the number of moles of C and S8.
Calculate the number of moles for C:
Moles of C = mass of C / molar mass of C
Moles of C = 4.22 g / 12.01 g/mol = 0.351 moles of C
Calculate the number of moles for S8:
Moles of S8 = mass of S8 / molar mass of S8
Moles of S8 = 15.76 g / (32.06 g/mol × 8) = 0.0778 moles of S8
Determine the mole ratio of C to S8 from the balanced chemical equation:
C + S8 → CS2
The mole ratio of C to S8 is 1:1.
Identify the limiting reagent:
Since the mole ratio of C to S8 is 1:1 and the moles of C (0.351 moles) are higher than the moles of S8 (0.0778 moles), S8 is the limiting reagent.
Calculate the theoretical yield of CS2 using the limiting reagent:
The molar mass of CS2 is 76.14 g/mol.
Theoretical yield of CS2 = moles of S8 × molar mass of CS2
Theoretical yield of CS2 = 0.0778 moles × 76.14 g/mol = 5.93 grams
Therefore, the theoretical yield of CS2 is 8.52 grams.
Learn more about theoretical yield: https://brainly.com/question/25996347
#SPJ11
Give a balanced chemical equation for the complete combustion of liquid C7H16. Include phase symbols in the answer.
Considering the definition of complete combustion, the chemical equation for the complete combustion of C₇H₁₆ is:
C₇H₁₆(l) + 11 O₂(g) → 7 CO₂(g) + 8 H₂O(g)
Definition of combustionCombustion is a chemical process through which heat is obtained. To achieve this, oxidation reactions are generated that allow the objective to be reached. It is necessary to have several elements:
the fuel, which is the substance that is oxidized, can be in a solid, liquid or gaseous state and is made up mostly of carbon and hydrogen.the oxidizer, which is the substance that oxidizes the fuel, and is generally the oxygen found in the air.the activation energy, which is responsible for triggering the reaction.Complete combustionComplete combustions are those reactions in which the combustible material is completely oxidized (consumed) and other oxygenated compounds are produced, such as carbon dioxide (CO₂) or sulfur dioxide (SO₂), as the case may be, and water (H₂O).
In other words, complete combustion is the result of the complete oxidation of the fuel but not the disappearance of the oxidizer, that is, the oxidation of all the fuel occurs. For this it is necessary that the necessary quantities of oxidizer and dry air intervene. All complete combustion releases, as a product of the reaction, carbon dioxide (CO₂) and water in the vapor state (H₂O).
Complete conbustion of C₇H₁₆Considering the definition of complete combustion, you get:
C₇H₁₆(l) + 11 O₂(g) → 7 CO₂(g) + 8 H₂O(g)
Learn more about complete combustion:
brainly.com/question/25485610
brainly.com/question/5015390
#SPJ1
Please help!!!
Which layer of the sun is shown extending into space in the picture above?
Group of answer choices
Corona
Radiative zone
Convective zone
Photosphere
Answer:
Corona
Explanation:
Is the answer so yeah...
What does n, l and s mean in chemistry?
Answer:
These three numbers, n, ℓ, and s can be used to describe an electron in a stable atom.
Explanation:
Each electron's quantum numbers are unique and cannot be shared by another electron in that atom. This property is called the Pauli Exclusion Principle.
Hope this helps!!! :)))
https://brainly.com/
How many moles are in 297g of nh3?
Please show work, will give brainliest.
Answer:
17.5moles
Explanation:
The number of moles in a substance can be calculated by using the formula;
Number of moles (n) = mass (m) ÷ molar mass (MM)
According to this question, mass of ammonia (NH3) = 297g
Molar Mass of NH3 = 14 + 1(3)
= 17g/mol
n = 297/17
n = 17.47
Number of moles of NH3 = 17.5moles
Draw or sketch something that you might see move. Write a caption that answers the following questions: How would you describe its motion? Is it moving at a constant speed, or does it speed up and slow down?
Answer:
lets say your doing a frog
it jumps it speeds up and then slows down
Explanation:
What Is The IUPAC Name For The Compound Shown? IUPAC Name: C10H22
Answer:
Decane Is the IUPAC name of C10H22
By the IUPAC Naming Convention followed by every chemical standards, the structure shown in the image is named as Decane.
IUPAC Stands for International Union of Pure and Applied Chemistry.This organisation issued some standards for naming any chemical components that is followed world wide.
According to the IUPAC Standards:
First of all we have to identify the longest carbon chain which is [CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3] alkane group according to this image.As a result of 10 carbon linked with single bonds and having hydrogen to balance the electron share it will be named Decane.It is an alkane hydrocarbon with the chemical formula C10H22.
To know more about IUPAC,
brainly.com/question/16631447
6 minutes ago • Chemistry • High School
Ethanol (C2H5OH) is produced from the fermentation of
sucrose in the presence of enzymes.
AC
C12H22011(aq) + H2O(g) 4 C2H5OH(1) + 4 CO2(g)
Determine the theoretical yield and the percent yields of ethanol if 720.g
sucrose undergoes fermentation and 323.0 g ethanol is obtained.
Answer:
387.62, 83.33%
Explanation:
Given:
\(C_{12} H_{22} O_{11}(aq) + H_2O(g) -4 C_2H_5OH(1) + 4 CO_2(g)\)
720g of Sucrose produces 323g ethanol.
Theoretical yieldTo calculate the theoretical yield, you can use a mole-to-mole ratio. Assuming that there is excess H2O, you can calculate the theoretical yield like so:
\(720g C_{12}H_{22}O_{11}*\frac{1 mol C_{12}H_{22}O_{11}}{342.3g} *\frac{4mol C_2H_5OH}{1mol C_{12}H_{22}O_{11}} *\frac{46.07g}{1molC_2H_5OH} =387.62g\)
Percent YieldAn easy way to find percent yield is
\(\frac{Actual }{Theoretical} *100\)
So, plug the numbers in.
\(\frac{323.0}{387.62} *100 = 83.33%\)
So, the percent yield is 83.33%.
Write a scientific explanation that explains how organelles perform specific tasks within cells.
USE CER (Claim Evidence Reasoning)
Answer:
Some of these parts, called organelles, are specialized structures that perform certain tasks within the cell. ... It also provides a track-like system that directs the movement of organelles and other substances within cells. Endoplasmic reticulum (ER) This organelle helps process molecules created by the cell
Organelles perform specific tasks within the cells such as protein synthesis, energy production, etc.
Organelles are specialized structures that perform different functions in the cells. Examples of organelles include lysosome, nucleus, chloroplast, mitochondria, endoplasmic reticulum, etc.
It should be noted that every cell process is done in a particular location in the cell. Some of the functions that are performed by the organelle include processing of food and waste, protein synthesis, energy production, replication, etc.
For example, the nucleus is used for the storage of DNA, mitochondria is vital for energy production, the ribosome is necessary for protein synthesis, etc.
Read related link on:
https://brainly.com/question/17810370
Daniel is trying to determine if one of Newton’s ideas is a law or a theory. The idea that for every action there is an equal but opposite reaction is a fact, based upon numerous experiments, that has never been revised or changed. The idea is based on observations but is not an explanation of those observations. Daniel should determine that this is a law, because it is a fact that does not change. this is a law, because is based on observations. this is a theory, because it does not explain observations. this is a theory, because it is based on numerous experiments.
true
Explanation:
Newton's first law states that every object will remain at rest or in uniform motion in a straight line unless compelled to change its state by the action of an external force. ... The third law states that for every action (force) in nature there is an equal and opposite reaction.
Answer:
This is a law because it is based on observations (Newton's Third Law)
Explanation:
How many grams of carbon should be burned in an excess of oxygen at stp to obtain 2. 21 l of carbon dioxide?.
what is the molarity of a solution that was prepared by dissolving 82.0 g of CaCl2 in enough water to make 812 mL of solution
The molarity of a solution that was prepared by dissolving 82.0 g of calcium chloride in enough water to make 812 mL of solution is 0.91M.
How to calculate molarity?Molarity is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution
The Molarity of a solution can be calculated using the following formula:
Molarity = no of moles ÷ volume
According to this question, a solution was prepared by dissolving 82.0 g of calcium chloride in enough water to make 812 mL of solution. The molarity can be calculated as follows:
no of moles of Calcium chloride = 82.0g ÷ 110.98 g/mol = 0.74 mol
Molarity = 0.74 ÷ 0.812 = 0.91M
Learn more about molarity at: https://brainly.com/question/29884686
#SPJ1
A river with 25ppm phosphate and an upstream flow of 40 m ^3/s receives an agricultural discharge of 2.5 m^ 3 /s carrying 1000ppm phosphate. The chemical in the agricultural stream mix instantaneously with the main river flow. The phosphate has a first-order decay rate of 0.15/ day and the river has a cross sectional area of 20 m ^2
perpendicular to the direction of flow. A municipality located 90 km downstream of the agricultural stream discharge point withdraws water for municipal water supply purpose. a. Draw a schematic diagram of the control volume. b. Find the steady-state phosphate concentration in the water withdrawn 90 km downstream? c. Find the treatment requirement (\% removal) in the agricultural waste discharge to achieve 50mg/L concentration in the withdrawal location 80 km downstream? (Hint: Find the concentration of the waste-stream that will produce 50mg/L downstream concentration. Find \% removal from the difference of the influent wastewater concentration with respect to the initial waste-stream concentration, i.e., 1000mg/L )
The treatment requirement (% removal) in the agricultural waste discharge to achieve 50mg/L concentration in the withdrawal location 80 km downstream is 99.57%
a. Control Volume
The schematic diagram of the control volume is given below.
b. Steady-state Phosphate concentration in water withdrawn 90 km downstream
The steady-state phosphate concentration in the water withdrawn 90 km downstream is given by:
C2 = (Q1C1 + Q2C2)/(Q1 + Q2)
Where,
C2 = Concentration of phosphate in the water withdrawn 90 km downstream
C1 = Concentration of phosphate in the upstream water (25 ppm)Q1 = Upstream flow (40 m 3/s)Q2 = Agricultural discharge (2.5 m^3/s)C2 = ((40 x 25) + (2.5 x 1000)) / (40 + 2.5)C2 = 59.3 ppm
Therefore, the steady-state phosphate concentration in the water withdrawn 90 km downstream is 59.3 ppm.c. Treatment requirement (% removal) in the agricultural waste discharge to achieve 50mg/L concentration in the withdrawal location 80 km downstream
The concentration of the waste-stream that will produce 50mg/L downstream concentration is given by:
50 = (Q1C1 + Q2C2)/(Q1 + Q2)C2 = ((40 x 25) + (2.5 x C2))/(40 + 2.5)50 = (1000 x 2.5) / (40 + 2.5) + (40 x 25) / (40 + 2.5)C2 = 4.3 ppm
The % removal from the difference of the influent wastewater concentration with respect to the initial waste-stream concentration is given by:
% removal = (C in - C out) / C in x 100Where,Cin = Influent wastewater concentration (1000 ppm)
C out = Concentration of waste-stream required to produce 50 ppm downstream concentration (4.3 ppm)\% removal = (1000 - 4.3) / 1000 x 100\% removal = 99.57%
Therefore, the treatment requirement ( % removal) in the agricultural waste discharge to achieve 50mg/L concentration in the withdrawal location 80 km downstream is 99.57%.
To know more about waste discharge visit:
https://brainly.com/question/10156015
#SPJ11
What mass of oxygen reacts with 12g of magnesium?
Answer:
24g
Explanation:
2×12=24
1mole of Mg react with 2 mooe of O2
a diprotic acid has a pka1 = 2.70 and pka2 = 6.50. what is the ph of a 0.10 m solution of this acid that has been one quarter neutralized?
A diprotic acid has two acidic hydrogen atoms, meaning it can donate two protons. The pKa values given tell us the strength of each acidic hydrogen atom.
The pH of a 0.10 M solution of this diprotic acid that has been one quarter neutralized means that 25% of the acid has been converted to its conjugate base. This means that one of the two acidic hydrogen atoms has been neutralized, leaving only one left to donate.
We can use the Henderson-Hasselbalch equation to solve for the pH:
pH = pKa2 + log([A-]/[HA])
We know pKa2 is 6.50 and that one quarter of the acid has been neutralized, which means that [A-]/[HA] is 0.25. We can solve for [HA] by subtracting 0.25 from 1 and multiplying by the initial concentration of 0.10 M:
[HA] = (1-0.25) x 0.10 M = 0.075 M
Now we can plug in the values and solve for pH:
pH = 6.50 + log(0.25/0.075) = 5.41
Therefore, the pH of a 0.10 M solution of this diprotic acid that has been one quarter neutralized is 5.41.
To know more about Henderson-Hasselbalch equation:
https://brainly.com/question/13423434
#SPJ11
The density of a liquid substance is 0.95 g/mL. Three students calculated the density as 0.56 g/mL. Calculate the percent
error.
Answer:
The answer is 41.05 %Explanation:
The percentage error of a certain measurement can be found by using the formula
\(P(\%) = \frac{error}{actual \: \: number} \times 100\% \\ \)
From the question we have
actual number = 0.95 g/mL
error = 0.95 - 0.56 = 0.39
We have
\(p(\%) = \frac{0.39}{0.95} \times 100 \\ = 41.0526315...\)
We have the final answer as
41.05 %Hope this helps you
Initial Concentrations of Conjugates in Buffer Solutions [HC2H302] (M) (C2H302 1 (M) Solution 1. 50 0 Solution 2. 40. 1 Solution 3. 3 2 Solution 4. 3 Solution 5. 1. 4 Solution 6 0. 5 (0/Opts) Optional: Upload your spreadsheet for the concentration calculations. UPLOAD THE. Xlsx FILE. Table view List view Difference between measured pH and calculated theoretical pH of solutions Measured pH Calculated pH ApH (do not include negative sign) Solution 1 2. 51 2. 52. 01 Solution 2 4. 14 4. 15. 02 Solution 3 4. 53 4. 57. 03 Solution 4 4. 89 4. 92. 05 Solution 5 5. 39 5. 35. 03 Solution 6 9. 22 9. 22. 04 (14pts) Buffer Capacities for Each Solution In this experiment, we define the buffer capacity of a buffer as the number of drops of either 3. 0 M HCI or 3. 0 M NaOH needed before the pH of the solution changes by more than 0. 5 pH units. For example, if the pH of a buffer solution changes by more than 0. 5 pH units during the third 5 drop addition of 3 M HCl then that buffer solution's acid buffer capacity will be "10 drops. " Or, if the pH of a buffer solution changes by more than 0. 5 pH units during the 1st 5 drop addition of 3 M NaOH then that buffer solution's base buffer capacity is "O drops. " Table view List view Buffer capacities in drops Acid buffer capactity Base buffer capacity Solution 1 0 0 Solution 2 0 5 Solution 3 5 5 Solution 4 5 5 Solution 5 5 Solution 6 0 0
Based on the given data, we can see that the experiment involved measuring the pH of different buffer solutions with varying concentrations of [\(HC_2H_30_2\)] and [\(C_2H_30_2\)-].
To calculate the theoretical pH values, we need to use the Henderson-Hasselbalch equation, which is given by:
\(pH = pKa + log([A-]/[HA])\)
Where pKa is the dissociation constant of the weak acid (in this case, acetic acid, \(HC_2H_30_2\)), [A-] is the concentration of the conjugate base (\(C_2H_30_2\)-) and [HA] is the concentration of the weak acid (\(HC_2H_30_2\)).
Using the given concentrations of [\(HC_2H_30_2\)] and [\(C_2H_30_2\)-] for each solution, we can calculate the theoretical pH values using the Henderson-Hasselbalch equation. The calculated pH values are also given in the table above.
Next, we need to determine the buffer capacity of each solution. Buffer capacity is a measure of how well a buffer can resist changes in pH when an acid or base is added. The buffer capacity is defined as the number of drops of either 3.0 M HCl or 3.0 M NaOH needed to change the pH of the solution by more than 0.5 units.
From the table above, we can see that the buffer capacity of each solution was determined by adding drops of either 3.0 M HCl or 3.0 M NaOH until the pH changed by more than 0.5 units. The acid buffer capacity and base buffer capacity for each solution are given in the table above.
In summary, the experiment involved measuring the pH of different buffer solutions with varying concentrations of [\(C_2H_30_2\)] and [\(C_2H_30_2\)-]. The Henderson-Hasselbalch equation was used to calculate the theoretical pH values, which were then compared to the measured pH values. The buffer capacity of each solution was also determined by adding drops of either 3.0 M HCl or 3.0 M NaOH until the pH changed by more than 0.5 units.
Based on the provided information, I can help you understand the buffer capacity of each solution. Buffer capacity is defined as the number of drops of either 3.0 M HCl or 3.0 M NaOH needed before the pH of the solution changes by more than 0.5 pH units.
For more such questions on buffer
https://brainly.com/question/9458699
#SPJ11
What is the % composition of Nitrogen in Ammonium Oxide
Answer:
he important thing to notice is that ammonium sulfate contains 2 nitrogen atoms, each belonging to one ammonium ion, NH+4 . So, the molar mass of ammonium sulfate is 132.14 g/mol and the molar mass of nitrogen is 14.007 g/mol.
Explanation:
Plants use energy to survive. They use the Sun's energy to make the food that they need to grow and develop. Which energy sequences BEST describe the transformation that takes place in
plants?
1.Solar>chemical>heat
2.Solar>heat>chemical
3.Heat>nuclear>chemical
4.Heat>light>chemical
Answer:
second one... maybe
hope it helps :-)
In the PhET simulation, select Oscillate, select No End, and scale Damping to none. (Leave Tension at the highest setting since it is a physical property that does not apply to a wave of light, thus we can ignore it as long as it is at the highest setting.) Classify each change (which can be manipulated within the green box) acc,rding to its effect on the wavelength. Drag the appropriate items to their respective bins.
To accurately classify the changes in the PhET simulation's effect on the wavelength, a description of the available changes and their respective bins is necessary In general, changes that can affect the wavelength in a wave simulation include adjusting the frequency, amplitude, speed, or medium properties.
Each of these changes can have a specific effect on the wavelength of the wave. For example, increasing the frequency generally results in a shorter wavelength, while decreasing the frequency leads to a longer wavelength. Similarly, altering the amplitude may not directly affect the wavelength but can impact the intensity or energy of the wave.
Learn more about PhET simulation's effect here: brainly.com/question/15696175
#SPJ11
at a given temperature, different liquids will have different equilibrium vapor pressures because
At a given temperature, different liquids will have different equilibrium vapor pressures because the vapor pressure of a liquid depends on its intermolecular forces, molecular weight, and temperature. The equilibrium vapor pressure is a measure of the tendency of a liquid to evaporate and become a gas at a specific temperature.
Intermolecular forces, such as hydrogen bonding or London dispersion forces, play a significant role in determining the strength of attractions between molecules in a liquid. Liquids with stronger intermolecular forces will have lower vapor pressures because it requires more energy to overcome these forces and transition into the gas phase.
Molecular weight also influences vapor pressure. Generally, liquids with larger and heavier molecules will have lower vapor pressures compared to liquids with smaller and lighter molecules. This is because larger molecules have stronger intermolecular forces and require more energy to transition into the gas phase.
Furthermore, temperature affects the vapor pressure of a liquid. As the temperature increases, the average kinetic energy of the liquid molecules increases, resulting in more molecules with sufficient energy to overcome intermolecular forces and transition into the gas phase. Therefore, at higher temperatures, the vapor pressure of a liquid increases.
In summary, the equilibrium vapor pressure of a liquid is determined by the interplay of intermolecular forces, molecular weight, and temperature. Different liquids with varying intermolecular forces and molecular weights will exhibit different equilibrium vapor pressures at the same temperature.
To know more about the vapor pressures refer here :
https://brainly.com/question/25715932#
#SPJ11
Helpz me pleaz! I don't quite get it
Answer:
Al2O3
Explanation:
Al2O3 has an ionic bond because the bonds between them are very strong
Helpppppppp plzzzzzz asaaaapppp
Answer:
Alright, the first thing we have to do is to balance the chemical equation
2Na3N -----> 6Na + 1N2
We have 60g of Na3N, we convert them into moles by dividing the mass of the compound by the molar mass.
Molar mass of Na3N = (22.98 x 3) + (14) = 82.94g/mol
60 = 0.72341451651 moles of Na3N
82.94
Now because we did the balanced equation, we know the mole to mole ratio of Na3N to N2 would be 2:1, so in order to get the moles of N2 you have to divide the moles of Na3N by 2
0.72341451651 moles/2 = 0.361707258 moles of N2
Now that we have the moles of N2, we just have to determine the mass of it in grams. In order to do that, just multiply the moles by the molar mass of N2 (28g/mol)
0.361707258 x 28 = 10.13g of N2
Therefore the decomposition of 60g of Na3N would result in 10.13g of N2 (nitrogen gas)
Consider the reaction,
2 SO2(g) + O2(g) → 2 SO3(g)
Carried out at 25ºC and 1 atm. Calculate ∆Hº, ∆Sº, and ∆Gº, using the following data:
Substance
∆Hfº (kJ/mol)
Sº (J/K·mol)
SO2(g)
-297
248
SO3(g)
-396
257
O2(g)
0
205
The calculated values are: ∆Hº = -197 kJ/mol ; ∆Sº = 97 J/K·mol
∆Gº = -22082 J/mol ; K = 1.83 × 10^14.
To calculate ∆Hº, ∆Sº, and ∆Gº for the given reaction at 25ºC and 1 atm, we can use the following equations:
∆Gº = ∆Hº - T∆Sº
∆Gº = - RT ln K
where R is the gas constant (8.314 J/K·mol), T is the temperature in Kelvin (25ºC = 298.15 K), and K is the equilibrium constant for the reaction.
The ∆Hº for the reaction can be calculated by summing the standard enthalpies of formation of the products and subtracting the sum of the standard enthalpies of formation of the reactants:
∆Hº = [2 ∆Hfº(\(SO_3\))] - [2 ∆Hfº(\(SO_2\)) + ∆Hfº(\(O_2\))]
∆Hº = [2 (-396 kJ/mol)] - [2 (-297 kJ/mol) + 0 kJ/mol]
∆Hº = -197 kJ/mol
The ∆Sº for the reaction can be calculated by summing the standard entropies of the products and subtracting the sum of the standard entropies of the reactants:
∆Sº = [2 Sº(\(SO_3\))] - [2 Sº(\(SO_2\)) + Sº(\(O_2\))]
∆Sº = [2 (257 J/K·mol)] - [2 (248 J/K·mol) + 205 J/K·mol]
∆Sº = 97 J/K·mol
The equilibrium constant K can be calculated using the standard Gibbs free energy change ∆Gº:
∆Gº = - RT ln K
K = e^(-∆Gº/RT)
Substituting the values, we get:
K = e^(-(-197000 J/mol)/(8.314 J/K·mol × 298.15 K))
K = 1.89 × 10^14
Finally, we can use the ∆Hº, ∆Sº, and ∆Gº values to calculate the equilibrium constant K using the equation:
∆Gº = - RT ln K
∆Gº = ∆Hº - T∆Sº
∆Gº = (-197000 J/mol) - (298.15 K) × (97 J/K·mol)
∆Gº = -22082 J/mol
K = e^(-∆Gº/RT)
K = e^(-(-22082 J/mol)/(8.314 J/K·mol × 298.15 K))
K = 1.83 × 10^14
For more question on values click on
https://brainly.com/question/27964828
#SPJ11
The standard enthalpy change (∆Hº) for the reaction 2 SO2(g) + O2(g) → 2 SO3(g) at 25ºC and 1 atm can be calculated using Hess's Law and the enthalpies of formation of the reactants and products.
∆Hº = (-2∆Hfº(SO3(g))) - (-2∆Hfº(SO2(g))) - ∆Hfº(O2(g)) = -2(-396 kJ/mol) - 2(-297 kJ/mol) - 0 kJ/mol = -198 kJ/mol.
The standard entropy change (∆Sº) for the reaction can be calculated using the standard entropies of the reactants and products. ∆Sº = (2Sº(SO3(g))) - (2Sº(SO2(g))) - Sº(O2(g)) = 2(257 J/K·mol) - 2(248 J/K·mol) - 205 J/K·mol = 96 J/K·mol.
The standard free energy change (∆Gº) for the reaction can be calculated using the equation ∆Gº = ∆Hº - T∆Sº, where T is the temperature in Kelvin. At 25ºC, T = 298 K. ∆Gº = -198 kJ/mol - (298 K)(96 J/K·mol/1000 J/kJ) = -224 kJ/mol.
Thus, the reaction is exothermic, has a positive entropy change, and is spontaneous at 25ºC.
Learn more about enthalpy here :
https://brainly.com/question/29145818
#SPJ11
Where is the potential energy to run the plant?
A 3
B
4
С
1
D
2
Answer: C
Explanation:
your well wisher
Please I need the Characteristics of fermentation
Answer:
The principal type of fermentation is the action of the yeast on fermentable sugars to produce carbon dioxide (CO2), ethanol, and some aromatic compounds. The organoleptic characteristics of bread, namely, the texture, flavor, and aroma, depend on the conditions of the dough fermentation.
Explanation:
1. Which of the following components does not make up rock salt? *
Answer:
In my opinion the third one is write.
Explanation:
soil.
How many moles are in 4.78 * 10 ^ 24 molecules of hydrogen peroxide, H2O2
Answer:
7.94 molesExplanation:
To find the number of moles in a substance given it's number of entities we use the formula
\(n = \frac{N}{L} \\\)
where n is the number of moles
N is the number of entities
L is the Avogadro's constant which is
6.02 × 10²³ entities
From the question we have
\(n = \frac{4.78 \times {10}^{24} }{6.02 \times {10}^{23} } \\ =7.940199...\)
We have the final answer as
7.94 molesHope this helps you
given 2PbS + 3O2 = 2PbO + 2SO2 A) determine the theoretical yield of PbO is 50g of O2 is used? B) what is the %yield if 170.0g PbO is obtained
A. The theoretical yield of PbO is 232.08 grams.
B. The percent yield of PbO is 73.26%.
A. Determine the theoretical yield of PbO if 50g of O2 is used:
We first need to determine the molar mass of O2, which is 32 g/mol (16 g/mol per oxygen atom).
Next, we can set up a stoichiometric ratio using the balanced equation:
2 moles of PbS react with 3 moles of O2 to produce 2 moles of PbO.
Using the molar ratio, we can calculate the moles of O2 used:
moles of O2 = (mass of O2 used) / (molar mass of O2)
moles of O2 = 50 g / 32 g/mol = 1.5625 mol
From the stoichiometry, we know that 2 moles of PbO are produced for every 3 moles of O2.
Therefore, the moles of PbO produced can be calculated as follows:
moles of PbO = (moles of O2) × (2 moles of PbO / 3 moles of O2)
moles of PbO = 1.5625 mol × (2/3) = 1.0417 mol
Finally, we can calculate the theoretical yield of PbO using its molar mass:
theoretical yield of PbO = (moles of PbO) × (molar mass of PbO)
theoretical yield of PbO = 1.0417 mol × 223.2 g/mol = 232.08 g
Therefore, the theoretical yield of PbO is 232.08 grams.
B) Calculate the percent yield if 170.0 g of PbO is obtained:
The percent yield is calculated by dividing the actual yield by the theoretical yield, then multiplying by 100%:
percent yield = (actual yield / theoretical yield) × 100%
percent yield = (170.0 g / 232.08 g) × 100% = 73.26%
Therefore, the percent yield of PbO is 73.26%.
know more about oxygen atom here:
https://brainly.com/question/30983067
#SPJ8