Double displacement reactions occur when two compounds in a solution react to produce two new compounds by the exchange of their respective radicals. The term "double decomposition reaction" also applies to this kind of reaction.
When a more active ingredient pushes a less active element out of a molecule, this is known as a displacement reaction. A double displacement reaction is one in which the reactants swap ions, as the name implies. The common response is A + B - C A - C + B.
Learn more about the ingredient
https://brainly.com/question/25057477
#SPJ4
How much of 80g of sodium- 23 (Na) is left after 4 half-lives if each half-life is 2.6 years?
Answer:1
Explanation:
1
Type the correct answer in the box. Express your answer to three significant figures.
A balloon is filled with 0.250 mole of air at 35°C. If the volume of the balloon is 6.23 liters, what is the absolute pressure of the air in the balloon?
Answer:
102.807 kPa
Explanation:
There are some assumptions to be made in the answer. The air inside the balloon acts as an ideal gas at a given temperature conditions.
Using the combined ideal gas equation.
P= absolute pressure of the air inside the balloon.
V= volume of air inside the balloon (6.23 L= 6.23 * 10⁻³ m³)
n= moles of gas(air). (0.250 mol)
R= Universal gas constant ( 8.314 J / mol·K)
T= Temperature in Kelvin
T= 35 + 273.15 = 308.15 K
P= 102.807 * 10³ Pa
P= 102.807 kPa
Which of these observations are not explained by kinetic-molecular theory?
X When a gas is heated, it expands.
o At very low temperatures, gases expand less for a given pressure change than they do at high
temperatures.
If the volume of a gas decreases, its pressure increases at constant temperature,
When gas is added to a rigid container, the pressure inside the container increases
RETRY
Intra
Answer: At very low temperatures, gases expand less for a given pressure change than they do at high temperatures.
Explanation:
Answer:
above me is righttttttt
Identify the limiting reactant in the reaction of methane (CH4) and carbon tetrachloride to form CH2Cl2, if 2.96 g of CH4 and 32.0 g of CCl4 are combined. Determine the amount (in grams) of excess reactant that remains after the reaction is complete.
Answer:
d
Explanation:
yes
What are Cell Adhesion Molecules?
Answer:
it is a membrane-linked glycoproteins that connects with other cells which are also called transmembrane
Hope This Helped
Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K
At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
1: Write the balanced chemical equation:
\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)
2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.
Initial:
\(C_O\)(g) = 0.3500 mol
\(Cl_2\)(g) = 0.05500 mol
\(C_OCl_2\)(g) = 0 mol
Change:
\(C_O\)(g) = -x
\(Cl_2\)(g) = -x
\(C_OCl_2\)(g) = +x
Equilibrium:
\(C_O\)(g) = 0.3500 - x mol
\(Cl_2\)(g) = 0.05500 - x mol
\(C_OCl_2\)(g) = x mol
3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:
Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]
4: Substitute the given equilibrium constant (Kc) value into the expression:
1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)
5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:
1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x
6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.
7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.
8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):
\(Cl_2\)(g) = 0.05500 - x
9: Calculate the value of \(Cl_2\)(g) at equilibrium:
\(Cl_2\)(g) = 0.05500 - x
\(Cl_2\)(g) = 0.05500 - (positive value of x)
10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.
Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
For more such questions on equilibrium, click on:
https://brainly.com/question/517289
#SPJ8
atomic mass of an element is mass of an atom of the element but this quantity is an average mass only.why?
Answer:
atoms are the smallest building blocks of elements, the reason why its an average mass is because its so so light to have an 'accurate' and straight forward mass.
AlCl3 + Na2SO4
Na +
Al2(SOA)
+ NaCl
what type of reaction
In Chemistry we look at the composition and the_
change Y
of matter
Explanation:
A pure substance is a form of matter that has a constant composition and properties that are constant throughout the sample. Mixtures are physical combinations of two or more elements and/or compounds
true or false
Newton's first law of inertia says that an object at rest will stay at rest and an object in motion will stay in motion unless acted on by a force.
Newton's first law of inertia says that an object at rest will stay at rest and an object in motion will stay in motion unless acted on by a force; thus the statement is True
What is the law of inertia?The law of inertia is also known as Newton's first law of motion.
The law of inertia states that a body at rest or that is moving at constant or uniform motion along a straight line will remain in its state of rest or motion or uniform motion along a straight line unless acted upon by an external force.
The law of inertia explains why it s difficult to start an object moving or to stop a moving object.
Learn more about the law of inertia at: https://brainly.com/question/1830739
#SPJ1
What is eutectic temperature
The eutectic point is the lowest temperature at which the liquid phase is constant at a particular pressure.
What does the word "eutectic" mean?A melting composition known as a eutectic consists of at least two components that melt and freeze at the same rates. The components combine during the crystallisation phase, operating as a single component as a result.
What are eutectic pressure and temperature?The eutectic is the system's lowest melting point under its own pressure; it has a matching temperature called the eutectic temperature and produces the eutectic liquid as a result. In terms of composition, eutectic liquids are located between the system's solid phases.
To know more about eutectic visit:-
https://brainly.com/question/27886492
#SPJ1
If the NaOH is added to 35.0 mL of 0.167 M Cu(NO3)2 and the precipitate isolated by filtration, what is the theoretical yield of the reaction?
Answer:
The correct answer is - 0.570 grams
Explanation:
The balanced chemical reaction is given by
Cu(NO3)2(aq) + 2NaOH(aq) --------> Cu(OH)2(s) + 2NaNO3(aq)
1.0 mole 2.0 mole 1.0 mole 2.0 mole
number of mol of Cu(OH)2,
n = Molarity * Volume
= \(35.0*0.167 = 5.845\) millimoles
As clear in the equation, 1 mole of Cu(NO3)2 gives 1 mole of Cu(OH)2 , So, 5.845 millimoles of Cu(NO3)2 will produce 5.845 millimoles of Cu(OH)2
Mass of Cu(OH)2 = number of mol * molar mass
= \(97.5*5.845*10^-3\)
= 0.570 grams
Thus, the correct answer is - 0.570 grams
How does a phase change affect a thermochemical equation?
O It alters the products.
O It alters the moles of reactants.
O It affects the balance of the equation.
O It can affect the AH value.
The correct answer is option D, It can affect the AH value.
What is a phase change?A phase change is a physical change in a substance in which the substance's state of matter is changed, such as from a gas to a liquid or from a liquid to a solid. It is also known as a phase transition.
Phase changes also involve changes in energy, temperature, and pressure. For example, when a solid melts to become a liquid, it absorbs energy and the temperature rises. When a liquid boils to become a gas, energy is released and the temperature decreases. Similarly, when a gas condenses to become a liquid, energy is released and the pressure increases.
Learn more about phase change here:
https://brainly.com/question/25664350
#SPJ1
c) If nitrogen diffuses at a rate of 0.0069 m/s, how fast does carbon dioxide diffuse?
Answer:
it defuse at a rate of 0.0002 m/s
3. How much white soft paraffin and zinc oxide is required to make 300g of the product? Rx Zinc oxide...12% Salicylic acid...1% Starch...15% White soft paraffin q.s to 100%
White soft paraffin is used as a barrier cream, forming an oil layer on the skin's surface to prevent water from evaporating.
Define zinc oxide?
Zinc oxide is a topical medication used to treat or prevent minor skin irritations such as burns, cuts, and diaper rash. Some items can be used as sunscreen.
Zinc Oxide which is also known as Calamine or Zinc White is an inorganic compound. It basically occurs naturally as the mineral zincite. It is mostly manufactured synthetically.
Zinc oxide powders are commonly found in foot powders and makeup. It is also used as an ointment in diaper rash and sun protection products.
Zinc oxide is a sunscreen ingredient derived from minerals. Zinc oxide is ideal for both daily and intense sun exposure due to its ability to block the broadest spectrum of UV light. It protects against both UVA and UVB rays.
To learn more about Zinc oxide refers to:
https://brainly.com/question/28566822
#SPJ1
what is the effect of temperature and pressure on crystal structure ?
ty! :)
Answer:
Increase of pressure increases the coordination number during crystallization e.g. by applying pressure the NaCl type crystal structure having 6:6 coordination number changes to CsCl type crystal having coordination number 8:8.
welc!! you Σ=)
An ammonia solution has a pH of 8.25. What is its [OH-]?
pH + pOH = 14
If pH=8.25, then:
pOH = 14 - 8.25 = 5.75
pOH = -log[OH-]
5.75 = -log[OH-]
-5.75 = log[OH-]
10^(-5.75) = [OH-]
[OH-] = 0,0000017783
[OH-] = 1,78×10^(-6) mol/dm³
A solution of the primary standard potassium hydrogen phthalate (KHP), KHC8H4O4 , was prepared by dissolving 0.4877 g of KHP in about 50 mL of water. Titration of the KHP solution with a KOH solution of unknown concentration required 21.66 mL to reach a phenolphthalein end point. What is the concentration of the KOH solution
Answer:
The impact of dinosaurs caused Dwayne Johnson to beat paper in rock paper scissors as the weak strength of the plants on the moon are diabolical in the atmosphere.
Explanation:
Thats why me and Selena Gomez share the same light bulb.
What is N for silicon tetrachloride, SiCl4?
Which diagram represents an element that is likely to form covalent bonds? A purple circle with 2 concentric circles around it. The inner circle has 2 small green spheres. The outer circle has 1 small green sphere. A purple circle with 3 concentric circles around it. The inner circle has 2 small green spheres. The middle circle has 8 small green spheres. The outer circle has 5 small green spheres. A purple circle with 3 concentric circles around it. The inner circle has 2 small green spheres. The middle circle has 8 small green spheres. The outer circle has 8 small green spheres.
Diagram represents an element that is likely to form covalent bonds is a purple circle with 3 concentric circles around it
Covalent bond means it consist of mutual sharing of one or more pair of electron between two atom and covalent bond diagram consist of in the middle the small circle which is purple color and three concentric circles around the purple circle and covalent bond diagram show the electron dot formulas and they often reffred to as lewis structure and are little different than electron dot formula used to represent the ionic bond
Know more about covalent bond diagram
https://brainly.com/question/16213924
#SPJ1
Write balanced equation for:
the incomplete combustion of pentane
The complete combustion of heptane
The incomplete combustion of heptane
Answer:
hmmm good luck
Explanation:
Question 3(Multiple Choice Worth 3 points)
(01.02 LC)
What is the metric unit for mass?
O Meters
O Kilograms
O Pounds
O Matter
Answer:
kilograms
Explanation:
Answer:B) Kilograms
Explanation:I took the test and got it right!
The rate constant for this first-order reaction is 0.0459 s¹ at 300 °C.
A → products
If the initial mass of A is 15.49 g, calculate the mass of A remaining after 0.731 min.
The concept half life is used here to determine the mass of 'A' remaining after 0.731 min. The rate constant of a reaction is defined as the rate of the reaction when the molar concentration of each of the reactants is unity. The mass of A remaining is 5.163 g.
What is half life?The half life period of a reaction is defined as the time in which the concentration of a reactant is reduced to half of its initial concentration. The expression for half life period of a first order reaction is:
\(t _{1} /_{2} = 0.693 / k\)
k - rate constant
k = 0.693 / 0.0459 = 15.098 s
Divide by 60 to convert half life into minutes.
15.098 s = 0.251 minutes
The number of half lives that have past is:
0.731 min / 0.251 min = 2.912 ≈ 3
Initial mass / number of half lives = 15.49 / 3 = 5.163 g
Thus the mass of A remaining after 0.731 min is 5.163 g.
To know more about half life, visit;
https://brainly.com/question/29388424
#SPJ9
how likely do you think it is that life exists on other planets
Answer:
not very likely
Explanation:
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
what is the reaction?
Answer:
A chemical reaction is a process in which one or more substances, also called reactants, are converted to one or more different substances, known as products. ... A chemical reaction rearranges the constituent atoms of the reactants to create different substances as products.
Explanation:
Hopefully this is what you needed
Which of the following is a correctly written chemical equation that demonstrates the conservation of mass?
Mg + HC1
→
H
2
+
MgC
1
2
Mg + HC1 → H 2 + MgC 1 2
H
2
O
+
C
O
2
→
H
2
C
O
3
H 2 O + C O 2 → H 2 C O 3
KC
1
O
3
→
KC1 +
O
2
KC 1 O 3 → KC1 + O 2
H
2
+
O
2
→
H
2
O
H 2 + O 2 → H 2 O
if I'm not mistaking it would be the second option
3 Cu + 8HNO3-3 Cu(NO3)2 + 2 NO + 4H₂O
In the above equation, how many grams of water can be made when 12.1 moles of HNO3 are
consumed?
Round your answer to the nearest tenth. If you answer is a whole number like 4, report the answer
as 4.0
Use the following molar masses. If you do not use these masses, the computer will mark your
answer incorrect.:
Molar
Mass
Element
Hydrogen 1
Nitrogen 14
Copper 63.5
Oxygen 16
Intermolecular forces exist between what?
Answer:
Intramolecular forces are the forces that hold atoms together within a molecule. Intermolecular forces are forces that exist between molecules.
Explanation:
Oxidation state of Nitrogen in NO ?
Explanation:
Oxidation state of Nitrogen in NO is +2
Answer:
+2
Explanation: