Describe and explain the relationship between boiling point of a hydrocarbon and the size of its molecules?

Answers

Answer 1

Answer:

As you go up the fractionating column, the hydrocarbons have: lower boiling points lower viscosity (they flow more easily) higher flammability (they ignite more easily) This means that in general hydrocarbons with small molecules make better fuels than hydrocarbons with large molecules.


Related Questions

Two descriptions about physical quantities are given below:
Quantity A: It remains constant.
Quantity B: It depends on gravitational pull.
What quantities are these most likely describing?
a Both Quantity A and Quantity B are mass.

b Both Quantity A and Quantity B are weight.

c Quantity A is weight and Quantity B is mass.

d Quantity A is mass and Quantity B is weight.

Answers

Answer:

quantity A is mass and quantity B is wieght

Answer:

D. is correct, like the first person said

Explanation:

True or False: The periodic table has changed very little since it was originally developed by Mendeleev and Meyer.

Answers

The periodic table has changed very little since it was originally developed by Mendeleev and Meyer is referred to as a false statement.

What is a Periodic table?

This is defined as the arrangement of elements based on their atomic number in a tabular form. It consists of 18 vertical columns which re referred to as groups and seven horizontal rows called period.

Henry Moseley in 1913 organized Mendeleev's periodic table based on physical properties.This took into consideration their atomic number rather than atomic mass and other missing elements.

This is the periodic table which is used currently and therefore hasn't changed much which is why false was chosen.

Read more about Periodic table here https://brainly.com/question/15987580

#SPJ1

HELP ME PLEASE WILL GIVE BRAINLY NO BAD ANSWERS

HELP ME PLEASE WILL GIVE BRAINLY NO BAD ANSWERS

Answers

Answer:

7.17

Explanation:

convert 5.50g to moles of salicylic acid. Then use mole ratios and convert the moles of salicylic acid to moles of Asprin(mole ratio is 1:1). Then convert the moles to grams using the molar mass of asprin.

The following reaction for conversion of butyrate ions to acetate ions plays a central role in the anaerobic degradation of organic wastes. The standard Gibbs energy of formation of butyrate is -352.6 kJ/mol. (Assume temperature is 25°C).C4H7O2- + 2H2O -> 2C2H3O2- + 2H2(g) + H+a) Determine the molar Gibbs energy of the reaction in a solution at pH 7 in which the acetate and butyrate concentrations are both 0.01M, if PH2(g) is 5x10-6 atm.b) Calculate the partial pressure of H2(g), in atm, that would be required for the reaction to be in equilibrium for the solution conditions described in part a.

Answers

The partial pressure of H2(g) that would be required for the reaction to be in equilibrium is 1.3x10^16 atm.

a) To determine the molar Gibbs energy of the reaction, we first need to calculate the standard Gibbs energy of the reaction (ΔG°) using the standard Gibbs energy of formation of butyrate (ΔGf°):

ΔG° = ΔGf°(products) - ΔGf°(reactants)
ΔG° = (2 x ΔGf°(C2H3O2-) + 2 x ΔGf°(H2) + ΔGf°(H+)) - (ΔGf°(C4H7O2-) + 2 x ΔGf°(H2O))
ΔG° = (2 x -485.8 kJ/mol + 2 x 0 kJ/mol + 0 kJ/mol) - (-352.6 kJ/mol + 2 x -237.1 kJ/mol)
ΔG° = -619.0 kJ/mol

Next, we use the equation for the Gibbs energy of a reaction at non-standard conditions (ΔG):

ΔG = ΔG° + RT ln(Q)

Where R is the gas constant (8.314 J/mol·K), T is the temperature in Kelvin (298 K), and Q is the reaction quotient:

Q = ([C2H3O2-]^2 [H2]^2 [H+]) / ([C4H7O2-] [H2O]^2)
Q = (0.01^2 x 5x10^-6^2 x 10^-7) / (0.01 x 1^2)
Q = 2.5x10^-18

Plugging in the values for ΔG°, R, T, and Q into the equation for ΔG:

ΔG = -619000 J/mol + (8.314 J/mol·K)(298 K) ln(2.5x10^-18)
ΔG = -619000 J/mol + (-95.3 J/mol)
ΔG = -619095.3 J/mol

Therefore, the molar Gibbs energy of the reaction is -619095.3 J/mol or -619.1 kJ/mol.

b) To calculate the partial pressure of H2(g) that would be required for the reaction to be in equilibrium, we need to use the equation for the Gibbs energy of a reaction at equilibrium (ΔG = 0):

0 = ΔG° + RT ln(Q)

Rearranging the equation to solve for Q:

Q = e^(-ΔG°/RT)

Plugging in the values for ΔG°, R, and T:

Q = e^(-(-619000 J/mol)/(8.314 J/mol·K)(298 K))
Q = 1.8x10^32

Since Q is the reaction quotient:

Q = ([C2H3O2-]^2 [H2]^2 [H+]) / ([C4H7O2-] [H2O]^2)

We can rearrange the equation to solve for the partial pressure of H2(g):

[H2]^2 = (Q [C4H7O2-] [H2O]^2) / ([C2H3O2-]^2 [H+])
[H2] = sqrt((Q [C4H7O2-] [H2O]^2) / ([C2H3O2-]^2 [H+]))

Plugging in the values for Q, [C4H7O2-], [H2O], [C2H3O2-], and [H+]:

[H2] = sqrt((1.8x10^32 x 0.01 x 1^2) / (0.01^2 x 10^-7))
[H2] = 1.3x10^16
To learn more about equilibrium here:

https://brainly.com/question/517289#

#SPJ11

Clara, while vacationing in Italy, decided to go swimming. When she asked at what temperature the pool was kept, she was told that it had a constant temperature of 35.8°C. What temperature is the pool in °F, to the nearest tenth? a. 53.6°F b. 96.4°F c. 122.0°F d. 129.1°F Please select the best answer from the choices provided A B C D

Answers

When you convert the temperature you would get 96.44 which makes the answer b

1. How many moles of nitrogen gas are in 1.54x10^26 molecules? How many atoms?
2. How many molecules of water are in 3.45 moles of water?
3. How many atoms of C are in 2.00 moles of Cv6Hv12Ov6? (v means the number is below)

Answers

Answer:

Try everything

1. How many moles of nitrogen gas are in 1.54x10^26 molecules? How many atoms?

2. How many molecules of water are in 3.45 moles of water?

3. How many atoms of C are in 2.00 moles of Cv6Hv12Ov6? (v means the number is below)

Explanation:

how many chiral carbon atoms does this molecule contain? structure of 2-chloro-4,5-dimethyl-3-hexone

Answers

The molecule contains two chiral carbon atoms.

To determine the number of chiral carbon atoms in a molecule, we need to identify the carbon atoms that are bonded to four different substituents.

The structure of 2-chloro-4,5-dimethyl-3-hexone is:

    Cl

     |

CH3-C-CH2-C(CH3)2-CH(CH3)-CO

     |

    CH3

There are two carbon atoms that have four different substituents: the second carbon (C2) and the fifth carbon (C5). These two carbon atoms are chiral centers.

Therefore, the molecule contains two chiral carbon atoms.

To know more about substituents refer here

brainly.com/question/30779133#

#SPJ11

in the electrolysis of water, how long will it take to produce 250.0 l of h2 at 1.0 atm and 273 k using an electrolytic cell through which the current is 113.0 ma?

Answers

The required Correct answer is it will take 1.96 hours or 118 minutes to produce 150 L of H2 at 1.0 atm and 273 K using an electrolytic cell through which the current is 113.0 mA.

Given,Volume of hydrogen = 250.0 l

Pressure of hydrogen = 1.0 atm

Temperature of hydrogen = 273 K

Electrical current = 113.0 mA

We have to calculate the time required to produce 150 L of H2.

Explanation: In the electrolysis of water, the volume of H2 produced is directly proportional to the amount of electricity passed through the cell. The amount of electricity is usually measured in coulombs and can be calculated by multiplying the current by the time in seconds (Q = It).

The number of moles of hydrogen gas produced can be calculated using the ideal gas law equation:P.V = n.R.TwhereP = pressure of hydrogen gas in atmV = volume of hydrogen gas in Ln = number of moles of hydrogen gasR = gas constantT = temperature of hydrogen gas in Kelvins R = 0.0821 atm L mol¯¹K¯¹n = PV/RT

The number of moles of hydrogen gas produced is proportional to the amount of electricity passed through the cell.n = (zF)/2wherez = the number of electrons per hydrogen molecule that is oxidized or reduced in the cellz = 2F = Faraday constant = 96500 C mol¯¹n = (zF/2) = (1 mol e¯ / 96500 C)(Q)

The time required to produce a given volume of H2 can be calculated using the following formula:t = (150 L) (96500 C/mol e¯ )/ (2 F × 1 A × 3600 s/h × 1.0 L) = 1.96 h or 118 min.

Therefore, it will take 1.96 hours or 118 minutes to produce 150 L of H2 at 1.0 atm and 273 K using an electrolytic cell through which the current is 113.0 mA.

Learn more about electrolysis of water here  https://brainly.in/question/20831057

#SPJ11

What is the volume, in cubic centimeters of a sample of cough syrup that has a mass of 50.0g? The density of cough syrup is 0.950 g/cm^3. Explain your answer

Answers

Answer:

I don't have any answer sorryyyy!!

Explanation:

lol say to your mom what is the answer it's good to say :)) lollllll

ll

Chemical substances that alter perceptions and moods are called?

Answers

Chemical substances that alter perceptions and moods are called psychoactive drugs or psychoactive substances.

Psychoactive drugs or psychoactive substances refer to chemicals that alter brain function and result in changes in perception, mood, consciousness, and behavior.

They can be naturally occurring, such as the psychoactive compounds found in plants, or they can be synthetic, such as man-made chemicals.

Examples of psychoactive drugs or psychoactive substances include alcohol, caffeine, nicotine, marijuana, cocaine, ecstasy, and prescription drugs like opioids and benzodiazepines.

Some psychoactive drugs have medicinal uses and are prescribed by doctors to treat certain conditions, while others are abused recreationally for their mind-altering effects.

Learn more about psychoactive substances here: https://brainly.com/question/16151334

#SPJ4

True or false: Sometimes older rocks end up on top of younger rocks.

Answers

Answer:

true

downstream to the riverbed. However, the most common mechanism to produce older rocks on top of younger is by thrust faulting. Thrust faults form where rocks are being compressed, usually by plate tectonic mechanisms. Thrust faults rip up older strata and pile it on top of younger rocks.

Explanation:

true you’re welcome

How many grams of He are necessary to fill a balloon having a volume of 4.50 × 10^{3} mL to a pressure of 1.14 × 10^{3} torr at 25.0ºC?

Answers

The mass in grams of He are necessary to fill a balloon having a volume of 4.50×10³ mL to a pressure of 1.14×10³ torr at 25.0ºC is 1.104 grams.

How do we calculate the grams from moles?

Mass (W) in grams from moles (n) will be calculated by using the below equation:
n = W/M, where

M = molar mass

Moles of helium gas will be calculated by using the ideal gas equation:

PV = nRT, where

R = universal gas constant = 62.363 L.torr / K.mol

P = pressure of gas = 1.14×10³ torr

V = volume of gas = 4.50×10³ mL = 4.50 L

n = moles of gas = ?

T = temperature = 25.0ºC = 298 K

On putting these values on the ideal gas equation, we get

n = (1140)(4.5) / (62.363)(298) = 5130 / 18584

n = 0.276 moles

Now we convert this moles into mass by using the first equation as:

W = (0.276mol)(4g/mol) = 1.104 g

Hence required mass of helium gas is 1.104 grams.

To know more about ideal gas equation, visit the below link:

https://brainly.com/question/12873752

#SPJ1

Questions 1-10: Complete the Bohr
Mode for each following elements.

Questions 1-10: Complete the BohrMode for each following elements.

Answers

Answer:

proposed an early model of the atom as a central nucleus containing protons and neutrons being orbited by electrons in shells. As previously discussed, there is a connection between the number of protons in an element, the atomic number that distinguishes one element from another, and the number of electrons it has. In all electrically-neutral atoms, the number of electrons is the same as the number of protons. Each element, when electrically neutral, has a number of electrons equal to its atomic number.

THANKS

3

Explanation:

Starch is a carbohydrate consisting of glucose polymers. The caloric value for glucose is3.9 kcal/g. You eat a potato that weighs 174 g. Assume that 92% of the total mass of apotato is starch. Determine (a) how many kcal, and how many kJ of energy were in thepotato you ate. 1 cal (gram calorie) = 4.184 joules. Show all your work

Starch is a carbohydrate consisting of glucose polymers. The caloric value for glucose is3.9 kcal/g.

Answers

We are told that starch consists of glucose polymer, so we can assume that the caloric value of starch will be equal to the caloric value of glucose, that is, 3.9kcal/g.

Now to determine the kcal and kJ there were in the potato we must calculate the mass of starch present in that potato. We are told that it is 92% starch, therefore the mass of starch in the potato will be:

\(gStarch=174g\times\frac{92\%}{100\%}=160.gStarch\)

We have that in the potato there are 160.08 grams of starch. By multiplying it by the caloric value we will have the kcal that were in the potato, assuming that the rest of the ingredients do not contribute caloric value, or it is insignificant.

\(\text{kcal of potato}=160g\times3.9\frac{kcal}{g}=624\text{kcal}\)

To calculate the kJ we must make the conversion using the relationship that 1 cal is equal to 4.184 joules:

\(\text{kJ of potato}=624kcal\times\frac{1000cal}{kcal}\times\frac{4.184J}{1cal}\times\frac{1kJ}{1000J}=2612kJ\)

In the potato, there were 624 kcal of energy or 2612kJ of energy.

what does the term "Exo" mean in science ?​

Answers

Answer:

Outside or External

Explanation:

Take for example, an Exothermic reaction. This just means that the reaction releases heat to the outside.

Answer:

It means out of, away from, outer, external, outside, or exterior.

Explanation:

Hope this helps!

Brainliest if correct pls

Refrigerant-134a is used as the working fluid in a simple ideal Rankine cycle which operates the boiler at 2000 kPa and the condenser at 24

C. The mixture at the exit of the turbine has a quality of 93 percent. Determine the turbine inlet temperature, the cycle thermal efficiency.

Answers

The turbine inlet temperature of the Rankine cycle using 134a as the working fluid will be approximately 175°C. The thermal efficiency of the cycle can be calculated using the Carnot efficiency equation, which is equal to 1 - (condenser temperature/boiler temperature). In this case, the thermal efficiency is approximately 0.912, or 91.2 percent.

Here, correct answer will be

This means that 91.2 percent of the energy supplied to the boiler is converted to work by the turbine, while the remaining 8.8 percent is lost due to the irreversibility's of the cycle. This is relatively high efficiency for a simple Rankine cycle, as the efficiency of the turbine and the condenser are assumed to be equal to 100 percent.

The quality of the mixture at the turbine exit indicates that most of the vapor has already been condensed, meaning that the cycle is operating at a higher efficiency than a similar cycle operating with a lower quality mixture.

Know more about Rankine cycle :-

https://brainly.com/question/28878476#

#SPJ11

Which element has chemical properties that are most similar to potassium?

Answers

Answer: Elements found in group 1 (Alkaline Metals)

Explanation: Any element found in group 1, such as Lithium, Sodium, Caesium, or Francium, have similar properties as potassium. Atoms that are found in the same group on the periodic table have similar chemical properties.

A 25.00 cm° sample of 0.020 mol.dm-3 Sr(OH)2 is titrated with a hydrochloric acid,
HCI (aq) solution of unknown concentration. 20.0 cm° of the HCI solution had been added for complete neutralization.
1.0 M = 1.0 mol•L-1 = 1.0 moldm-3
2HC/(ag) + Sr(OH)2(ag) - SrC/2(ag)
+ 2H20(8)
What is the molar concentration (molarity) of the HCIaq) solution?

Answers

The molar concentration of the hydrochloric acid (HCI) solution is 0.500 mol/dm³.

How do we calculate?

The balanced chemical equation for the reaction between hydrochloric acid (HCI) and strontium hydroxide (Sr(OH)2) is shown below:

2HCl(aq) + Sr(OH)2(aq) → SrCl2(aq) + 2H2O(l)

2 moles of HCl react with 1 mole of Sr(OH)2 to produce 1 mole of SrCl2 and 2 moles of water.

We find the  number of moles of Sr(OH)2 in the sample:

moles of Sr(OH)2 = concentration of Sr(OH)2 × volume of Sr(OH)2 solution

= 0.020 mol/dm³ × 0.2500 dm³

= 0.005 mol

The number of moles of HCl used in the titration can be calculated as:

moles of HCl = 2 × moles of Sr(OH)2

= 2 × 0.005 mol

= 0.010 mol

Calculating the molar concentration (molarity) of the HCl solution taking into account the volume of the HCl solution used in the titration is 20.0 cm³

molarity of HCl = moles of HCl / volume of HCl solution

= 0.010 mol / 0.0200 dm³

= 0.500 mol/dm³

Learn more about molar concentration  at: https://brainly.com/question/30404105

#SPJ1

Use the drop Dow menus to select the names of the labeled structures

Answers

Answer:

theres no picture

Explanation:

a halogen forms an anion with 54 electrons and 74 neutrons. what is the symbol for this element?

Answers

Answer:

The number of electrons in a neutral atom of an element is equal to the atomic number of that element.

The atomic number of the element in the question is 54 because the anion has 54 electrons.

The number of protons in an element is equal to its atomic number, so the element with 54 protons is Xenon (Xe).

However, the question says that the anion has 74 neutrons, which means it has a mass number of 128 (since the mass number of an element is equal to the sum of its protons and neutrons).

Therefore, the symbol for this element would be Xe-128.

Explanation:

The number of electrons in a neutral atom of an element is equal to the atomic number of that element.

The atomic number of the element in the question is 54 because the anion has 54 electrons.

The number of protons in an element is equal to its atomic number, so the element with 54 protons is Xenon (Xe).

However, the question says that the anion has 74 neutrons, which means it has a mass number of 128 (since the mass number of an element is equal to the sum of its protons and neutrons).

Therefore, the symbol for this element would be Xe-128.

The symbol of this element is Br (Bromine).

The given information states that there is an anion containing 54 electrons and 74 neutrons. We need to determine the symbol for this element.

The symbol for an element typically consists of one or two letters, with the first letter being capitalized. Finding the symbol, we can refer to the periodic table.

From the information given, we know that the number of electrons in a neutral atom is equal to the number of protons, and the number of protons determines the element's identity. The atomic number of an element is equal to the number of protons in its nucleus.

Since the anion contains 54 electrons, the neutral atom of this element must have 54 protons. By referring to the periodic table, we find that the element with 54 protons is Xenon.

Therefore, the symbol for this element is Xe.

The element with an anion containing 54 electrons and 74 neutrons is represented by the symbol Xe.

To know more about Bromine here: https://brainly.com/question/1398857

#SPJ11

the ph of a 0.060-m solution of hypobromous acid is 4.96. calculate .

Answers

The Ka value for hypobromous acid (HBrO) is approximately 2.8 x 10^-9.

The pH of a solution can be used to calculate the concentration of H3O+ ions, which can then be used to determine the concentration of the acid (in this case, HBrO). The formula to calculate pH is pH = -log[H3O+].

Given that the pH of the solution is 4.96, we can calculate the concentration of H3O+ ions using the equation 10^(-pH) = [H3O+]. Substituting the given pH value, we have 10^(-4.96) = [H3O+].

Calculating this, we find that the concentration of H3O+ ions is approximately 1.07 x 10^(-5) M.

Since HBrO is a weak acid, we can assume that the concentration of H3O+ ions is equal to the concentration of HBrO. Therefore, the concentration of HBrO is also approximately 1.07 x 10^(-5) M.

The equilibrium expression for the dissociation of HBrO is: Ka = [H3O+][BrO-]/[HBrO]. We can substitute the calculated concentration values to obtain Ka = (1.07 x 10^(-5))^2 / (1.07 x 10^(-5)) = 1.07 x 10^(-5) M.

Therefore, the Ka value for hypobromous acid is approximately 2.8 x 10^-9.

Learn more about molarity visit:

brainly.com/question/30404105

#SPJ11

What do you think causes a lunar eclipse? (Use your knowledge of solar eclipses and feel free to run the Gizmo to help you.)

Answers

Moon reflects the light frim the sun, thats why we are able to see it and it shines in the night. But, we know that Earth revolves around Sun and Moon revolves around Earth. During this revolution, Earth and Moon comes in a position when Earth is in the middle of the Moon and Sun. So, it blocks the light of Sun frim reaching Moon. Hence, we see no reflection and it causes Lunar eclipse.

Answer:

A total lunar eclipse occurs when the moon and the sun are on exact opposite sides of Earth. Although the moon is in Earth's shadow, some sunlight reaches the moon. The sunlight passes through Earth's atmosphere, which causes Earth's atmosphere to filter out most of the blue light.

Explanation:

with carbon dioxide what phase change takes place when the temperature increases from -40°c to 0°c at 10 atm

Answers

The phase change that takes place when the temperature increases from -40°C to 0°C at 10 atm with carbon dioxide is from solid to gas.

When carbon dioxide is cooled down, it becomes solid which is also known as dry ice. Dry ice has a temperature of -78.5 °C. When we increase the temperature of dry ice to -40 °C, it will remain in the solid phase. If we continue to increase the temperature of dry ice to 0 °C, it will start sublimating and convert to the gas phase without passing through the liquid phase. This process is called sublimation.

At a pressure of 10 atm, CO2 will sublimate at a temperature of -56.6°C.Sublimation is a phase transition from a solid directly to a gas. This change happens because the solid's vapor pressure exceeds the ambient atmospheric pressure. Dry ice, for instance, is a substance that undergoes sublimation when heated. When solid carbon dioxide is heated, it transitions directly from a solid to a gas without going through a liquid stage.

To know more about carbon dioxide visit:

https://brainly.com/question/3049557

#SPJ11

calculate the volume of 0.0315 m bromocresol green (hbcg) standard stock solution needed to make 10.00 ml of the three standards. standard 1: 0.00630 m hbcg what volume (in ml) of the 0.0315 m bromocresol green stock solution is necessary to make 10.00 ml of 0.00630 m bromocresol green? ml standard 2: 0.0126 m hbcg

Answers

For standard 1, the volume of stock solution required is 2.00 mL, while for standard 2, it is 4.00 mL.

In order to calculate the volume of 0.0315 m Bromocresol green (HBCG) standard stock solution required to make 10.00 ml of the three standards, we need to use the formula:

M1V1 = M2V2

Where M1 is the concentration of the stock solution,

V1 is the volume of the stock solution required,

M2 is the concentration of the final solution, and

V2 is the final volume of the solution.

To calculate the volume of 0.0315 m Bromocresol green (HBCG) stock solution required to make 10.00 ml of 0.00630 m Bromocresol green (HBCG) standard 1, we can plug in the values into the formula as:

M1V1 = M2V2V1 = (M2V2)/M1= (0.00630 mol/L x 0.01000 L)/0.0315 mol/L= 0.00200 L = 2.00 mL

Therefore, the volume of 0.0315 m Bromocresol green (HBCG) stock solution required to make 10.00 ml of 0.00630 m Bromocresol green (HBCG) standard 1 is 2.00 mL.

To calculate the volume of 0.0315 m Bromocresol green (HBCG) stock solution required to make 10.00 ml of 0.0126 m Bromocresol green (HBCG) standard 2, we can use the same formula as above:

M1V1 = M2V2V1 = (M2V2)/M1= (0.0126 mol/L x 0.01000 L)/0.0315 mol/L= 0.00400 L = 4.00 mL

Therefore, the volume of 0.0315 m Bromocresol green (HBCG) stock solution required to make 10.00 ml of 0.0126 m Bromocresol green (HBCG) standard 2 is 4.00 mL.

In conclusion, we can use the formula M1V1 = M2V2 to calculate the volume of 0.0315 m Bromocresol green (HBCG) stock solution required to make different standards.

To know more about stock solution here

https://brainly.com/question/25256765

#SPJ11

The combined forces acting on an object make up the ___ force

Answers

Answer:

net force

Explanation:

The net force acting on an object is the combination of all of the individual forces acting on it. ... If two forces act on an object in the same direction, the net force is the sum of the two forces.

Needing help please help me

Needing help please help me

Answers

Answer:

18. E. 0%

19. D. 25%

Explanation:

Question 18:

Let's use "B" to represent the dominant allele of "light blue skin", and

"b" for recessive "light green skin".

Squidward => BB - light blue skin

Squidward's bride => bb - light green skin

When they cross, they will have the following offsprings:

(BB) × (bb) - Parent

(Bb) (Bb) (Bb) (Bb) - Offspring

All the offspring would be light green skin. The dominant allele of light green skin will express itself over the recessive allele.

Therefore, the chances of Squidward and his bride having light green skin is 0%

Question 19:

Squidward's son => Bb - light blue skin

Squidward's son's bride => Bb - light blue skin

(Bb) × (Bb) - parent

(BB) (Bb) (Bb) (bb) - offspring

They will have the following offspring:

BB and Bb - light blue - 75%

bb - light green - 25%

Chance of having offspring with light green skin is 25%

How many grams does 4.3 x 10^24 molecules of H2O weigh?

Answers

To get the mass for these molecules, we will need to do three steps:

1 - convert from number of molecules to number of moles.

2 - calculate the molar mass for H₂O.

3 - use it to convert from number of moles to mass.

To convert from number of molecules to number of moles, we need to divide the number of molecules by the Avogadro's number:

\(\begin{gathered} N_A\approx6.02\times10^{23}mol^{-1} \\ n_{H_2O}=\frac{N_{H_2O}}{N_A}=\frac{4.3\times10^{24}}{6.02\times10^{23}mol^{-1}}=0.71428\ldots\times10^1mol=7.1428\ldots mol \end{gathered}\)

Now, to calculate the molar mass of H₂O, we need the molar masses of H and O, which we can get on a periodic table:

\(\begin{gathered} M_H=1.00794g\/mol \\ M_O=15.9994g\/mol \\ M_{H_2O}=2\cdot M_H+1\cdot M_O \\ M_{H_2O}=(2\cdot1.00794+1\cdot15.9994)g\/mol \\ M_{H_2O}=(2.01588+1\cdot15.9994)g\/mol \\ M_{H_2O}=18.01528g\/mol \end{gathered}\)

Using it, we can convert the number of moles to mass:

\(\begin{gathered} M_{H_{2}O}=\frac{m_{H_2O}}{n_{H_{2}O}} \\ m_{H_2O}=n_{H_2O}\cdot M_{H_{2}O} \\ m_{H_2O}=7.1428\ldots mol\cdot18.01528g\/mol \\ m_{H_2O}=128.680\ldots g \end{gathered}\)

Now, the proper way of approximating this value is to maintain the same number of significant figures as the number of molecules, because we used multiplications and divisions. It has two significant figure, so we need to approximate accourdingly:

\(m_{H_{2}O}\approx130g\)

So, there is 128.680... grams or, approximately, 130 grams of water.

A skier is traveling fast down a mountain slope. The table shows data collected on the skier at a particular instant. Which data are needed to determine the reaction force of the snow pushing

on the skier?

Answers

The skier's speed, height, and time, are not directly related to the determination of the reaction force of the snow pushing on the skier.

Chemical reactions are fundamental processes in which atoms are rearranged to form new substances with different properties than the original ones. A chemical reaction occurs when reactants come together in a specific way to form products. Reactants are the starting materials, while products are the new substances formed by the reaction.

Chemical reactions are governed by the laws of thermodynamics and kinetics. The law of conservation of mass dictates that the total mass of the reactants must be equal to the total mass of the products. The law of conservation of energy states that energy cannot be created or destroyed, only transformed from one form to another. Therefore, chemical reactions must either absorb or release energy, depending on the nature of the reaction. Chemical reactions can be classified as exothermic or endothermic. Exothermic reactions release energy, usually in the form of heat, while endothermic reactions absorb energy.

To learn more about Reaction visit here:

brainly.com/question/17434463

#SPJ4

What does it mean for something to be radioactive?
A. It has an emission spectrum.
B. It is in a stable condition.
C. It generates radio waves.
D. Its nuclei can split apart.

Answers

Answer:

D

Explanation:

Radioactivity means

the emission of ionizing radiation or particles caused by the spontaneous disintegration of atomic nuclei

hope this helps please like and mark as brainliest

Can human actions lead to a decrease in earth’s temperature

Answers

Answer:

Since the Industrial Revolution, human activities have released large amounts of carbon dioxide and other greenhouse gases into the atmosphere, which has changed the earth's climate.

Explanation:

Other Questions
kristen opened a charming bookstore in a shopping plaza. business in other shops in the plaza has increased because of the customers whom kristen's bookshop has attracted. given the external benefits that her bookshop generates, if kristen is selling her books at the market equilibrium price for books, she: please choose the correct answer from the following choices, and then select the submit answer button. answer choices could sell fewer books at a higher price if she sold books at the efficient equilibrium price and quantity. would eliminate a deadweight loss in the market for her books if she sold books at the efficient equilibrium price and quantity. should be subject to a pigouvian tax unless she starts selling at the efficient market price and quantity. would decrease her revenues if she sold books at the efficient equilibrium price and quantity. Show that x^2-8x+20 can be written in the form (x-a)^2+a where a is an integer Click and drag the labels into the appropriate box to identify whether the function of the connective tissue component of a muscle is definite or theorized. the muscle to a Aids in elastic recoil of bone Helps the muscle function more efficienty Prevents the muscle Attaches from over stretching muscle 53.18 Surrounds the muscle Forms the calcaneal tendon Surrounds a single muscle fiber Creates extra thrust in jumping humans together Definite Function of Connective Tissue Theorized Function of Connective Tissue Prey 35 of 50 Marya plans to participate in a 20 km walk-a-thon. To prepare, she walked 4 km on Monday. She plans to increase her walk by 2 km each week until she reaches 20 km. Maryas calculations: 4 2 = 6. 6 2 = 8. 8 2 = 10. 10 2 = 12. 12 2 = 14. 14 2 = 16. 16 2 = 18. 18 2 = 20. The equation representing Maryas calculations is 4 2 w 20. How many weeks will it take Marya to reach her goal of a 20 kilometer walk? 8 9 10 12. write the integral as a sum of integrals without absolute values and evaluate: (cos x) dx = ____/6 A man borrowed $300,000 from the bank, the bank charges 18% interest for the entire period of the loan. If repayments are 36 monthly installments. Calculate rhe amount of each installments. Jeremy is pushing his two children on a set of swings. He gives his daughter a push and she swingsJeremy gives his son the same push, but he only swings about two feet high. What could account fthe kids got?Jeremy's daughter has more mass, so it takes less force to get her into the air.Jeremy's son has more mass, so it would take more force to reach the same height as his daOJeremy's son has less mass, so it would take more force to reach the same height as his daOJeremy's daughter has more mass, so she accelerates faster than his son. The government wants to impose a $2 per unit tax on sugar to reduce sugar consumption. It is known that taxes will result in a deadweight loss. Given that the supply function is q = P, which of the following inverse demand function will result in the smallest deadweight loss? a. P = 450 - 2q b. p = 600 - 3q c. Insufficient information to conclude d. p = 300 - q assume that y varies directly with x. if y =2/5 when x =1/3, find y when x=1/4 Which of the following is incorrect regarding So2?-it is a respiratory irritant-it can adversely affect plant tissue-it has only anthropogenic sources-it results from the combustion of coal and oil-it is a corrosive gas which line on the graph below has a slope of 0? How is the graph of the parent function y = x squared transformed to produce the graph of y = 3 (x + 1) squared? Proteins function to provide structure for tissues and organs. Which of the following are the building blocks of proteins? Why 2 Give an example of a relation which is symmetric but neither reflexive nor transitive? if this paper takes 2 hours and there are 100 questions in all, what is the average time you should spend on each question? The amount of time needed for the cash flows from an investment to pay for its initial cost is the _____ period. Three inches of mulch need to be applied to a rectangular flower bed that is 8 ft by 22 ft between ahouse and a walkway. How many cubic feet of mulch are needed? (1 ft 12 in) biological indicators include which group of ectothermic vertebrates Please help ASAP!!!!! Where do missense mutations occur?