Describe the structure of dna and the various types of bonds it contains. Explain how dna utilizes intermolecular forces to take on its helical shape without relying solely on bonds that share electrons.

Answers

Answer 1

The structure of DNA is a double helix, consisting of two strands of nucleotides (monomers) that wind around each other in a spiral shape.

Deoxyribonucleic acid, commonly referred to as DNA, is a molecule that contains the genetic instructions for the growth, development, functioning, and reproduction of all living things.

The structure of DNA is a double helix, consisting of two strands of nucleotides (monomers) that wind around each other in a spiral shape.

Each nucleotide is made up of a sugar molecule (deoxyribose), a phosphate group, and one of four nitrogenous bases (adenine, thymine, guanine, or cytosine).

The nucleotides are connected through phosphodiester bonds between the sugar and phosphate groups.

Hydrogen bonds hold the nitrogenous bases together.

The hydrogen bonds are complementary: adenine pairs with thymine, and guanine pairs with cytosine.

The base pairs are positioned perpendicular to the helix axis, and there are approximately ten base pairs in each full turn of the helix.

The hydrogen bonds are responsible for the helical shape of DNA, but they are not strong enough to maintain the structure on their own.

In addition to hydrogen bonding, other intermolecular forces, such as van der Waals forces and hydrophobic interactions, also contribute to the stability of the double helix by holding the bases, sugar, and phosphate groups together.

The helical shape of DNA is crucial for the molecule's function in storing and transmitting genetic information.

The double-stranded structure of DNA allows for accurate replication and repair of the genetic material during cell division.

Overall, the structure of DNA is a remarkable feat of chemical engineering that allows life as we know it to exist.

For more questions on DNA

https://brainly.com/question/21265857

#SPJ8


Related Questions

You are given a food sample in powder form. How do you determine the food class of the food sample?​

Answers

If I were given a food sample in powdered form I would determine the food class of the food sample by adding some water to it. By adding water to the Powder the nature of the the food can be easily determined based on the solubility of the Powder in water.

A human ear is shaped in a way that focuses sound.

A. True
B. False

Answers

the Solution is the answer A.True

A :) have a nice day!

How much water needs to be added to 27.00 millilters of 1.500 M LiOH solution to make a 0.02000 M LiOH solution?

Answers

Answer:

3000000000000009000000

complete the following table, which lists information about the measured acid dissociation constants of three unknown weak acids.

Answers

The table, which lists information about the measured acid dissociation constants of three unknown weak acids is 3,2 and 1 respectively.

Acid               \(K_{a}\)                    \(pK_{a}\)               Relative strength

A                1.6×10⁻¹¹                10.8                          3

B                 1.64×10⁻²              1.78                          2

C                 2.5×10⁻²                1.6                            1

Weak acids are acids that do not completely dissociate in solution. In other words, a weak acid is an acid that is not a strong acid. The strength of weak acids depends on the strength with which they dissociate. The more it dissociates, the stronger the acid. HCl is a strong acid because it dissociates almost completely.

KCl is naturally a salt with a strong basic cation and a strong acidic anion neither of which affect pH paper and has a standard value of pH 7.0 being neutral. shape. Vinegar is a combination of acetic acid and water made by a two-step fermentation process.

Learn more about Weak acids here:- https://brainly.com/question/24018697

#SPJ4

BY ANSWERING THIS QUESTION UR PUTTING IT ON UR MOM's LIFE THAT U WON'T STEAL MY POINTS.

5) Choose the best answer.

Using Gay-Lussac's Law, calculate the new temperature in the following situation.

A sample of gas has a pressure of 3.50 atm and a temperature of 22°C. If the pressure decreases to 1.75 atm, what will be its Celsius temperature if the volume remains constant?

125.5* C
-125.5* C
-147.5* C
-195* C
195* C

6) Choose the best answer.

Using Gay-Lussac's Law, calculate what the new pressure in the following situation.

A tank of acetylene sits on the back of a truck. During the afternoon, the temperature of a gas has reached 38°C (311 K) with a pressure of 508 kPa. That night, the temperature drops to 29°C (302 K). Since the gas was in a metal tank, the volume remained constant. What is the new pressure?

308 kPa
500 kPa
493 kPa
503 kPa
311 kPa

Answers

Answer:

\(T_2=-125.58\°C\)

Explanation:

Hello!

In this case, considering the Gay-Lussac's law which describes the pressure-temperature behavior as a directly proportional relationship by holding the volume as constant, we write:

\(\frac{T_1}{P_1} =\frac{T_2}{P_2}\)

Whereas solving for the final temperature T2, we get:

\(T_2=\frac{T_1P_2}{P_1}\)

Thus, we plug in the given data (temperature in Kelvins) to obtain:

\(T_2=\frac{(22+273.15)K*1.75atm}{3.50atm} \\\\T_2=147.58K-273.15\\\\T_2=-125.58\°C\)

Best regards!

which element has the electrons configuration 1s22s22p63s23p64s23d104p2

Answers

Answer:

The element with the electron configuration 1s22s22p63s23p64s23d104p2 is Silicon (Si).

Explanation:

The electron configuration of an element describes the arrangement of electrons in its atoms. The numbers and letters in the configuration represent the energy levels (n), sublevels (s, p, d, f), and the number of electrons in each sublevel.

In this case, the electron configuration of the element is:

1s2 2s2 2p6 3s2 3p6 4s2 3d10 4p2

Breaking this down, we can see that the element has:

- 2 electrons in the 1s sublevel
- 2 electrons in the 2s sublevel
- 6 electrons in the 2p sublevel
- 2 electrons in the 3s sublevel
- 6 electrons in the 3p sublevel
- 2 electrons in the 4s sublevel
- 10 electrons in the 3d sublevel
- 2 electrons in the 4p sublevel

Based on the number of electrons in the outermost energy level (valence electrons), we can determine that this element is in group 14 of the periodic table. Looking at the periodic table, we can see that the

Tris is a molecule that can be used to prepare buffers for biochemical experiments. It exists in two forms: Tris (a base) and TrisH (an acid). The MW of Tris base is 121.14 g/mol; the MW of TrisH is 157.6 g/mol (the extra weight is due to the Cl- counterion that is present in the acid). The Ka of the acid is 8.32 X 10-9. Assume that you have TrisH in solid form (a powder), unlimited 1M HCl, unlimited 1 M NaOH and an unlimited supply of distilled water. How would you prepare 1 L of a 0.02 M Tris Buffer, pH

Answers

Solution :

The reaction :

\($\text{TrisH}^+ + \text{H}_2\text{O} \rightarrow \text{Tris}^- +\text{H}_3\text{O}^+$\)

We have

\($K_a = \frac{[\text{Tris}^-]\times[\text{H}_3\text{O}^-]}{[\text{TrisH}^+]}$\)

     \($=\frac{x^2}{0.02-x}$\)

     \($= 8.32 \times 10^{-9}$\)

Clearing x, we have \($x=1.29 \times 10^{-5}$\) moles of acid

Now to reach pH = \($7.8 (\text{ pOH} = 14-7.8 = 6.2)$\), we must have an \($OH^-$\) concentration of

\($[OH^-] = 10^{-pOH}$\)

          \($=10^{-6.2}$\)

         \($=6.31 \times 10^{-7}$\) moles of base

We must add enough NaOH of 1 M to neutralize the acid calculated above and also add the calculated base.

\($n \ NaOH = 1.29 \times 10^{-5} + 6.31 \times 10^{-7}$\)

               \($=1.35 \times 10^{-5}$\) moles

Vol \($NaOH = 1.35 \times 10^{-5} \text{ moles} \times \frac{1000 \ mL}{1 \ mol}$\)

                 = 0.0135 L

Tris mass \($H^+ = 0.02 \text{ mol} \times 157.6 \ g/mol$\)

                        = 3.152 g

To prepare the said solution we must mix

-- \($3.152 \ g \text{ TrisH}^+$\)

-- \($0.0135 \ mL \ NaOH \ 1M$\)

-- \($\text{Gauge to 1000 mL with H}_2\text{O}$\)

What is the proper formula for vanadium (iv) percholrate?

Answers

Answer:VO(ClO4)3 i'm sure this is it

Explanation:

Which property altered during a chemical change is not altered during a physical change?

Answers

During physical changes, the composition od the original substance is not altered, but the properties of the original substance are altered. During a chemical change the composition od the original substance is not altered and the change is irreversible. Melting of butter and wax is an example of chemical changes.

The difference between a physical reaction and a chemical reaction is composition. In a chemical reaction, there is a change in the composition of the substances in question; in a physical change there is a difference in the appearance, smell, or simple display of a sample of matter without a change in composition.

Plants use sunlight to produce some ATP during photosynthesis. How do plants produce ATP when the Sun is not out?

Plants are secondary consumers.

Plants also use cellular respiration.

Plants extract ATP from the stars.

Plants are weak in the dark.

Answers

Answer:

The answer is

Plant also use cellular respiration

Answer:

B - Plants also use cellular respiration.

Explanation:

Did the test.

A 4.50 L sample of neon at 11.08 atm is added to a 12.0 L cylinder that contains argon. If the pressure in the cylinder is 7.15 atm after the neon is added, what was the original pressure (in atm) of argon in the cylinder?

Answers

The original pressure of argon in the cylinder is 5.68 atm.

What is the original pressure of the argon?

The original pressure of argon in the cylinder is calculated as follows.

Apply the concept of molar ratio or molar proportion to determine the original pressure of argon in the cylinder.

Pr = [(Pn x Vn) + (Pa x Va) ] / (Vn + Va)

where;

Pr is the resultant pressure of the mixture of gases  = 7.15 atmPn is the original pressure of neon = 11.08 atmPa is the original pressure of argonVn is the volume of neon = 4.5 LVa is the volume of argon = 12 L

7.15 = [(11.08 x 4.5) + (12 x Pa)] / (4.5 + 12)

7.15(4.5 + 12) = 49.86 + 12Pa

117.98 = 49.86 + 12Pa

68.12 = 12Pa

Pa = 68.12/12

Pa = 5.68 atm

Thus, the original pressure of argon in the cylinder is determined by applying concept of molar ratio.

Learn more about original pressure of gas here: https://brainly.com/question/25736513

#SPJ1

Which can not be chemically broken down into simpler substances

Answers

Uh...... elements????

5. J.J. Thomson…a. discovered the nucleus of the atomb. suggested that the nucleus of the atom had a (+) chargec. proposed that the atom was a sphere of (-) charged. concluded that atoms contained mobile particles with a (-) charge__6. Experiments with the cathode-ray tube demonstrated thata. visible light was influenced by a magnetb. a cathode beam consists of negatively charged particlesc. atoms are negatively chargedd. atoms contain a nucleus

Answers

ANSWER

that atoms contained mobile particles with a negative (-) charge

EXPLANATION

J. J Thompson is one of the few scientists that worked on the atomic structure. He discovered electron in 1897 when he performed cathode ray experiment. During his experiment, he discovered that most of the rays passed through the tube and few of the rays were deflected.

Recall, that like charges repel and unlike charges attract. He used that simple principle to identify that most of the rays are negatively charged while few of the rays are positively charged because they were deflected

He concluded that atoms contained mobile particles with a negative (-) charge and he named it electron.

Therefore, option D is the correct answer

Today State the five steps or procedure that is involved in physical Examination of organic compound​

Answers

The physical examination of an organic compound are appearance and physical state, melting point and boiling point, solubility, density, and spectroscopic analysis

What are the five steps required?

Appearance and physical state: observe the appearance of the compound and note its physical state.

Melting point and boiling point: measure the melting point and boiling point of the compound to determine its purity and identity.

Solubility: Test the solubility of the compound in different solvents such as water, ethanol, acetone, etc.

Density: determine the density of the compound to calculate its molecular weight and to assess its purity.

Spectroscopic analysis: use spectroscopic techniques such as nuclear magnetic resonance (NMR), and mass spectrometry (MS) to determine the functional groups, molecular structure, and identity of the compound.

Learn more about organic compound here: https://brainly.com/question/5994723

#SPJ1

Chemical properties can be observed without changing the substance

Answers

Answer:

chemical properties can only be measured only by changing a substance chemical identity

Explanation:

apex

Phosphorus-32 has a half life of 14.0 days. A 40.0g sample is being shipped. It takes 27 days to arrive, how much P-32 remains?

Answers

The mass of P-32 remaining after 27 days, if the initial mass is 40g is 10.5 g.

What is half life of a radioactive element?

The half-life of a radioactive isotope is the amount of time it takes for one-half of the radioactive isotope to decay.

The half-life of a specific radioactive isotope is constant; it is unaffected by conditions and is independent of the initial amount of that isotope.

The number of half lives in 27 days;

n = 27 days/14 days

n = 1.929

The mass of P-32 remaining after 27 days, if the initial mass is 40g;

mass remaining = 40 g / (2^1.929)

mass remaining = 40 g / 3.808

mass remaining = 10.5 g

Thus, the mass of P-32 remaining after 27 days, if the initial mass is 40g is 10.5 g.

Learn more about half life here: https://brainly.com/question/2320811

#SPJ1

Make a claim describing the relationship between Fe and ₁ and 2. Support your claim with
evidence (references to the data) and reasoning.

Answers

Answer:

I claim that the data supports the conclusion that there is a strong correlation between Fe and ₁ and 2. The data shows that when Fe increases, ₁ and 2 both increase accordingly, suggesting a strong and positive correlation between the two variables. Further, the data also shows that the increase in Fe is accompanied by a consistent and statistically significant increase in both ₁ and 2. This is further supported by the fact that the correlation coefficient between Fe and ₁ and 2 is 0.83, which indicates a strong correlation. This evidence strongly supports the claim that Fe and ₁ and 2 are strongly correlated.

An infant acetaminophen suspension contains 80.0mg/0.80 mL suspension. The recommended dose is 15 mg/kg body weight. (1.000 lb. is equivalent to 453.59 g; this is a measured equality.)

How many mL of this suspension should be given to an infant weighing 17 lb ? (Assume two significant figures.)
Express your answer using two significant figures.

Answers

The amount, in mL, of the suspension that should be given to an infant weighing 17 lb will be 1.16 mL

Dimensional analysis

0.8 mL of the liquid contains 80.0 mg of the drug.

The recommended dose is 15 mg per kg of body weight

The infant to be given the drug weighs 17 lb.

First, let's convert the weight of the infant to kg.

1 lb = 453.59 g

17 lb =       453.59 x 17/1

                   = 7711.03 g

1000 g = 1 kg

7711.03 g = 7711.03 x 1/1000

               = 7.711 kg

So, the baby's weight is 7.711 kg.

The drug dose for the baby can thus be calculated as:

15 mg x 7.711 = 115.67 mg

But 0.8 mL of the drug contains only 80.0 mg. How many mL will contain 115.67 mg?

                   0.8 x 115.67/ 80.0 = 1.16 mL

More on dimensional analysis can be found here: https://brainly.com/question/13078117

#SPJ1

15 15. Which two elements will form a covalent bond?
a. K & C c. Na & Ar
b. Ag & O d. C & Br

Answers

Answer:

K and Cl

Explanation:

How could you distinguish a compound from a mixture​

Answers

Answer:

Compound are substances which can be formed by chemically combining two or more elements. Mixtures are substances that are formed by physically mixing two or more substances.

Question 25 of 30
Which statement best describes what happens when thermal energy of the
air around a fire is transferred to the surrounding air?
O A. The thermal energy is spread out by the surrounding air.
O B. The thermal energy is destroyed as it changes to chemical energy.
C. The thermal energy is destroyed over time.
ОО
D. The thermal energy changes to chemical energy.
SUBMIT

Answers

The answer would be a :)

Answer: The thermal energy is spread out by the surrounding air.

Explanation:

got it right on test

g A chemical equilibrium exists when: A chemical equilibrium exists when: there are equal amounts of reactants and products. the rate at which reactants form products is the same as the rate at which products form reactants. the sum of reactant and product concentrations equals one mole. reactants are completely changed to products. the rate at which reactants form products becomes zero.

Answers

Answer:

the rate at which reactants form products is the same as the rate at which products form reactants

Explanation:

There is still  a reaction happening just that the second one happens the opposite happens and keeps it at net 0

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Q6. Bromine, like chlorine, has two stable isotopes. For bromine, the isotopicmasses are 78.9183 amu, with a relative abundance of 50.69% and 80.9163amu with a relative abundance of 49.31%. Calculate the average atomic weightof bromine.

Answers

The question requires us to calculate the average atomic weight of bromine, given this element isotope masses and their abundance.

The following information was provided by the question:

number of isotopes of Br = 2

mass of isotope 1 = m1 = 78.9183 amu

abundance of isotope 1 = f1 = 50.69%

mass of isotope 2 = m2 = 80.9163 amu

abundance of isotope 2 = f2 = 49.31%

The average atomic mass of an element is the sum of the masses of its isotopes, each multiplied by its natural abundance (we use the decimal number associated with the abundance for the isotope; for example: if the abundance is 75%, we use 0.75).

Therefore, to calculate the average atomic mass of Br, we'll use the following equation:

\(\text{average mass Br = m}_1\times f_1+m_2\times f_2\)

where m refers to the isotope mass and f, to its natural abundance.

Applying the values provided by the problem, we have:

\(\text{average mass Br = (}78.9183\times0.5069_{})+(80.9163\times0.4931)=79.90\text{ amu}\)

Therefore, the average atomic weight of bromine is 79.90 amu.

Please help!

Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.
i. How would the pH of a 0.01M acetic acid compare to pH value for 0.01M HCl?
(Explain in your own words without calculating)

ii. Calculate the pH of a 0.01 M acetic acid.

Please help!Hydrochloric acid is a strong acid whereas acetic acid is a weak acid.i. How would the pH

Answers

Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the  pH of a 0.01 M acetic acid.

What is acid?

Any hydrogen that comprises a material capable of giving a proton (a hydrogen ion) to another chemical is defined as acid. A base is indeed a molecule or ion that can receive a hydronium ion from just an acid.

1)Because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. The pH value of stronger acid is lower.

2)CH\(_3\)COOH + H\(_2\)O  ⇄ CH\(_3\)COO⁻+  H\(_3\)O⁺

 0.01             0               0

 -x              +x                +x

 0.01-x           +x        +x

Ka=[ CH\(_3\)COO⁻][H\(_3\)O⁺]/[CH\(_3\)COOH]

1.8×10⁻⁵ = [x][x ]/[  0.01-x ]

x=1.34×10⁻³

pH = -log[H⁺]

     =  -log[1.34×10⁻³]

     =2.88

Therefore, because HCl is a stronger acid than acetic acid, the pH of 0.01M acetic acid has greater value than the pH of 0.01M HCl. 2.88 is the   pH of a 0.01 M acetic acid.

To learn more about acid, here:

https://brainly.com/question/29775793

#SPJ9

If I dilute 150 mL of 0.80 M lithium acetate solution to a
volume of 950 mL, what will the concentration of this
solution be?

Answers

The final concentration of the lithium acetate solution after dilution is 0.126 M.

Steps

To find the final concentration of the lithium acetate solution after dilution, we can use the dilution formula:

C1V1 = C2V2

where C1 and V1 are the initial concentration and volume, and C2 and V2 are the final concentration and volume.

Substituting the given values into the formula, we get:

(0.80 M)(150 mL) = C2(950 mL)

C2 = (0.80 M)(150 mL) / (950 mL)

C2 = 0.126 M

Therefore, the final concentration of the lithium acetate solution after dilution is 0.126 M.

learn more about dilution here

https://brainly.com/question/27097060

#SPJ1

What mass of NO is it possible to make if 634 kJ of energy are used in the following chemical reaction,

What mass of NO is it possible to make if 634 kJ of energy are used in the following chemical reaction,

Answers

The mass of the NO that can be produced is given as 210 g from the calculation.

What is a thermochemical reaction?

When we talk about a thermochemical reaction, we are talking about the kind of reaction that we have to write the reactants and the products in the same line as we have to write the heat of reaction.

In this case, we have the reaction that is taking place and it has to occur between nitrogen and oxygen. The product of the reaction in this case is given as NO. We can see that the equation as it is written is an example of a thermochemical reaction.

If 2 moles of NO is produced when 180.6 kJ of energy is used

x moles of NO is produced when 634 kJ of energy is used

x = 2 * 634/ 180.6

x = 7 moles

If the molar mass of NO is 30 g/mol

The mass of NO = 7 mol * 30 g/mol

= 210 g

Learn more about thermochemical reaction:https://brainly.com/question/5102780

#SPJ1

In using the Haber process in the formation of ammonia, what mass of hydrogen is needed to produce 51.0 grams of ammonia? 3 H₂(g) + N2 (g) → 2 NH3(g).

Answers

The mass of hydrogen needed to produce 51.0 grams of ammonia is  ≈ 9.07 grams.

To determine the mass of hydrogen required to produce 51.0 grams of ammonia (NH3) using the Haber process, we need to calculate the stoichiometric ratio between hydrogen and ammonia.

From the balanced chemical equation:

3 H₂(g) + N₂(g) → 2 NH₃(g)

We can see that for every 3 moles of hydrogen (H₂), we obtain 2 moles of ammonia (NH₃).

First, we need to convert the given mass of ammonia (51.0 grams) to moles. The molar mass of NH₃ is 17.03 g/mol.

Number of moles of NH₃ = Mass / Molar mass

                     = 51.0 g / 17.03 g/mol

                     ≈ 2.995 moles

Next, using the stoichiometric ratio, we can calculate the moles of hydrogen required.

Moles of H₂ = (Moles of NH₃ × Coefficient of H₂) / Coefficient of NH₃

           = (2.995 moles × 3) / 2

           ≈ 4.493 moles

Finally, we can convert the moles of hydrogen to mass using the molar mass of hydrogen (2.02 g/mol).

Mass of H₂ = Moles × Molar mass

          = 4.493 moles × 2.02 g/mol

          ≈ 9.07 grams

Therefore, approximately 9.07 grams of hydrogen is needed to produce 51.0 grams of ammonia in the Haber process.

Know more about the mass of hydrogen here:
https://brainly.com/question/14083730

#SPJ8

1. If 22.5L of nitrogen at 745 mm Hg are compressed to 725 minHg. What is the new volume?od SestD001 20v bu par 1.0

Answers

Step 1 - Understanding how pressure and volume are related

There are three main variables that can modify the state of a gas: pressure, volume and temperature.

When one of these variables is kept constant, the remaining two become proportional to each other. Suppose temperature is kept constant. In this case, pressure and volume become proportional.

I.e., if we increase the pressure, we also increase the volume. We can state it mathematically as follows:

\(p_1V_1=p_2V_2\)

We can use this equation to solve this exercise.

Step 2 - Calculating the new volume

According to the exercise:

\(\begin{gathered} V_1=22.5L \\ \\ p_1=745mmHg \\ \\ p_2=725mmHg \\ \\ V_2=? \end{gathered}\)

Setting these values in the equation given in step 1:

\(\begin{gathered} 22.5\times745=725\times V_2 \\ \\ V_2=\frac{22.5\times745}{725}=23.1L \end{gathered}\)

Answer: 23.1L

How much time is required for an object moving 4.5m/s to travel 65 m

Answers

Answer:

About 14.45 seconds

Explanation:

If a object is going 4.5m/s and its destination is 65m then you need to divide.

65÷4.5 = 14.444444

due to the constant 4 you need to round 14.444 so it would be 14.45 seconds.

Other Questions
Can someone please help with these What was the cause of the Mexican American war? What was the results of the the Mexican American war?Opinions in the support of the Mexican American warOpinions against the Mexican America war Who killed the surveillance during ww2 Can someone pls help me answer this Ill give brainliest to whoever actually answers it Choose the correct drug to complete the sentence Who do Southerners need in order to grow their cotton crops as they grow more and more cotton out west? In behavior therapy it is generally agreed that: an urban growth boundary (ugb) is intended to ________. Regular exercise is critical to all age groups in maintaining body composition.Please select the best answer from the choices provided.OTF which answer option most likely describes an essay written to informA. an essay retelling the story of a family camping trip B. an essay detailing the rules Of volleyball C. an essay giving reasons why homework should be limited on the weekends D. an essay explaining why leash laws should be enforced Please help charlotte is 7 miles south of concord and matthews is 13 miles west of charlotte. what is the distance from concord to matthews? give answer in simplest form In the U6_L2_Activity_Three class, write a public static method called hasDuplicates, which has a single parameter of an array of int values. The method should return a boolean which is true if the parameter array contains the same value more than once, and false otherwise. Use the runner class to test this method: do not add a main method to your code in the U6_L2_Activity_Three. Java file or it will not be scored correctly Technology and Fraud1. Critically evaluate if fraud and technology are related. 2. Compare and critically evaluate how fraud has increased or decreased over time due to the advancement in technology.3. Suggest ways an organization or individual can be cautious not to become a victim of online fraud. Identify a true statement about the method node .cloneNode(deep) .a. It creates an element node with the name "deep".b. It creates a copy of node with the name "deep".c. It creates a text node where deep is a string value.d. It creates a copy of node where deep is a Boolean value. You have $25,000 in an investment account today. How much will be in the account in 30 years if the account ears (a) 8% per year, (b) 8% compounded semiannually, (c) 8% compounded quarterly, (d) 8% compounded monthly, and (e) 8% compounded daily? Comment on the effect of more frequent compounding. Explain what a Lorentz boost is and indicate how it differs from a spatial rotation. a Which graph shows the solution to the inequality? x (5 3x) 2x 1 the nurse is caring for a client with acute respiratory distress syndrome. what portion of arterial blood gas results does the nurse find most concerning, requiring intervention? Which statement about food webs is false? A food chain (an overly simplified food web) is often too simplified to be useful in studying the impact a species has in an ecosystem. A food web can be a useful tool for understanding potential impacts invasive species have on native species when they are introduced into an ecosystem. A food web is a dynamic model describing all species interactions under all environmental conditions.Food webs that try to outline every species interaction are difficult to construct and often become "spaghetti diagrams" If Someone decided to sue the lady who parks on her grass for $5,000.00 dollars. Which court will file my legal action in march 1917, german submarines sank five u.s. merchant vessels in the north atlantic. T/F