draw the atomic structure of 10 elements and show Electronic configuration.......​

Answers

Answer 1

Answer:

Explanation:

ूअूिkzkzkksksosawwhsusisisisisisiisisisisisisiisisisis


Related Questions

Which chapter is bulk properties of matter?

Answers

The list which includes only bulk properties of matter is boiling point, surface tension and vapor pressure.

Definition of matter

Something that has mass and occupies space is defined as a matter.

Hence, all the physical objects or substances that are found on the planet Earth are typically composed of matter.

Matter are classified into three (3) states:

Gas

Solid

Liquid

The property of the matter that affects matter as a whole is known as bulk property of matter and they are listed as follows:

Boiling pointElasticityStrainStressSurface tensionVapor pressure

Hence, boiling point, vapor pressure and surface tension are considered as a bulk properties of matter.

Learn more about bulk properties of matter from the link given below.

https://brainly.com/question/29546212

#SPJ4

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Decreasing order of C-C bond length is 1) ethene 2)ethyne 3) benzene 4) ethane

Answers

Answer:

4>3>1>2.

That is, the C-C bond length in ethane > benzene > ethene > ethyne.

Explanation:

The C-C bond in ethane is single, the C-C bond in ethene is double and the C-C bond in ethyne is triple. As the number of bonds between a C-C increases, the length of the bond decreases with an increase in strength. This explains why the C-C bond length in ethane > ethene > ethyne. For benzene, all the C-C bonds in the aromatic compound has been found to have an identical length of 1.40 Å, compared to ethane (1.54Å), ethene (1.34Å) and ethyne (1.20Å). Hence the trend in bond lengths: ethane > benzene > ethene > ethyne.

1. How do organisms maintain homeostasis?

Answers

Answer:

Maintenance of homeostasis usually involves negative feedback loops. These loops act to oppose the stimulus, or cue, that triggers them.

Which of the following is an element located in group 17?
a) Ne
b) Li
c) Mn
d) Br

Answers

Answer:

D- Br

Explanation:

Please help I will give brainiest

Please help I will give brainiest

Answers

Answer:

Answer

Answer is option B coz da negative charge r more thn positive

Answer:

B.

Explanation:

On the hand in the option B there are 3 positive and 5 negative signs so the answer is B.

Explain Explain why hard water flowing in tead Safer for drinking than soft water pipe. pipes may be flowing in the same​

Answers

Hard water contains higher levels of minerals such as calcium and magnesium, while soft water has low levels of these minerals. While both hard and soft water can be safe for drinking, hard water is generally considered safer due to the minerals it contains.

Why is hard water considered safer to soft water?

The minerals in hard water can actually be beneficial to human health, as they are important for strong bones and teeth. In addition, the minerals in hard water can help to balance the body's electrolytes and may have other health benefits.

Soft water, on the other hand, may contain higher levels of sodium or other chemicals used in the softening process. While these levels are generally considered safe, some people with certain health conditions may need to avoid drinking water with higher sodium levels.

Learn about Hard water here https://brainly.com/question/28178305

#SPJ1

Which of the following best describes the structure of a nucleic acid?

a
Carbon ring(s)
b
Globular or fibrous
c
Single or double helix
d
Hydrocarbon(s)

Answers

it’s definitely C! brainlest please i need points so sorry if it’s wrong i guessed A

In the reaction of ammonia (NH3) with oxygen (O) to produce water and nitric oxide (NO), how many moles of water are produced when 4.3 moles of ammonia are
reacted?

Answers

4.3 moles of water are produced when 4.3 moles of ammonia are reacted.

What are Moles?

Moles are a unit of measurement used in chemistry to measure the number of atoms or molecules in a given sample of a substance. The mole is defined as the amount of a substance that contains 6.02 x 10^23 of molecules or atoms. This number is known as Avogadro's number.

The reaction for the production of water and nitric oxide from ammonia and oxygen is as follows:

NH3 + O2 → H2O + NO

In order to calculate the number of moles of water produced when 4.3 moles of ammonia are reacted, we need to use the mole ratio between the reactants and the products. The mole ratio for this reaction is 1:1:1, meaning that one mole of ammonia reacts with one mole of oxygen to produce one mole of water and one mole of nitric oxide.

Therefore, 4.3 moles of ammonia will react with 4.3 moles of oxygen to produce 4.3 moles of water and 4.3 moles of nitric oxide.

Hence, 4.3 moles of water are produced when 4.3 moles of ammonia are reacted.

To know more about moles,

https://brainly.com/question/29367909

#SPJ1

If silver crystallizes in a FCC unit cell and has a density of 10.6 g/cm3 what is the atomic radius of Silver?

Answers

As a result, the silver atomic radius in an FCC crystal lattice is roughly 1.44 angstroms.

What is the FCC crystal structure's atom count per unit cell?

There are 6 atoms in each unit cell of the hexagonal closest packed (HCP), which has a coordination number of 12. Four atoms make up each unit cell of the face-centered cubic (FCC), which has a coordination number of 12.

The following equation can be used to connect the silver crystal's density to its atomic radius (r) and molar mass (M):

density = (4 x M) / [(a)³ x Avogadro's number]

For FCC unit cells, the length of one edge (a) is related to the atomic radius (r) by the following equation: a = 2^(1/2) * r

Substituting this expression for a into the density equation and solving for r, we get:

r = [(3 x M) / (32 x density x pi)]^(1/3)

where pi is the mathematical constant, pi.

The molar mass of silver is approximately 107.87 g/mol.

Substituting the given values into the equation, we get:

r = [(3 x 107.87 g/mol) / (32 x 10.6 g/cm³ x pi)]^(1/3)

= 1.44 angstroms (rounded to two significant figures)

To know more about crystal lattice visit:-

https://brainly.com/question/10281663

#SPJ1

28. Describe the molecular geometry and hybridization of the N, P, or S atoms in each of the following compounds. (a) H3PO4, phosphoric acid, used in cola soft drinks (b) NH4NO3, ammonium nitrate, a fertilizer and explosive (c) S2Cl2, disulfur dichloride, used in vulcanizing rubber (d) K4[O3POPO3], potassium pyrophosphate, an ingredient in some toothpastes

Answers

Answer:

See explanation

Explanation:

The molecular geometry of an atom is connected to the number of electron pairs that surround it(whether lone pairs or bonding pairs) as well as its hybridization state. We shall now examine the N, P, or S atoms in each of the following compounds.

a)

In H3PO4, P has a tetrahedral molecular geometry and is sp3 hybridized.

b) In NH4NO3

N is sp3 hybridized in NH4^+ and sp2 hybridized in NO3^-. Also, N is tetrahedral in NH4^+ but trigonal planar in NO3^-.

c) In S2Cl2, we expect a tetrahedral geometry but as a result of the presence of two lone pairs on each sulphur atom, the molecular geometry is bent. The sulphur is sp3 hybridized.

d) In K4[O3POPO3], each phosphorus atom is in a tetrahedral molecular geometry and is sp3 hybridized.

0.2g of sand in two-third in liter of ethanol . What is the concentration in g per dm cube​

Answers

The mass concentration of sand in the ethanol solution is 0.299 g/dm³.

What is the concentration in grams per dm³?

To find the concentration in grams per cubic decimeter (g/dm³), we first need to convert the volume from liters to cubic decimeters (dm³). Since 1 liter is equal to 1 cubic decimeter, we can directly convert the volume.

Given:

Mass of sand = 0.2 g

Volume of ethanol = two-thirds liter

Converting volume to dm³:

1 liter = 1 cubic decimeter

two-thirds liter = (2/3) cubic decimeter = 0.67 dm³ (rounded to two decimal places)

Now we can calculate the concentration in g/dm³ by dividing the mass of sand by the volume in dm³:

Concentration = Mass / Volume

Concentration = 0.2 g / 0.67 dm³

Concentration ≈ 0.299 g/dm³ (rounded to three decimal places)

Learn more about mass concentration at: https://brainly.com/question/23437000

#SPJ1

1.1
A sample of oxygen occupies 47.2 L under a pressure of 1240 torr at 25 °C. What
volume would it occupy at 25 °C if the pressure were decreased to 730 torr?​

Answers

Answer:

80.2L

Explanation:

Given parameters:

Initial volume of oxygen = 47.2L

Initial pressure of oxygen = 1240torr

Final pressure  = 730torr

Unknown:

Final volume  = ?

Solution:

To solve this problem, we apply the Boyle's law proposed by Robert Boyle. It states that "the volume of a fixed mass of a gas varies inversely as the pressure changes if the temperature is constant".

Mathematically;

             P₁V₁ = P₂V₂

P and V are pressure and volume

1 and 2 are initial and final states

              1240 x 47.2  = 730 x V₂  

                  V₂  = 80.2L

Slate one use of ethanol based on its volatile nature​

Answers

We can see here that one use of ethanol based on its volatile nature is as a fuel additive.

What is ethanol?

Ethanol, also known as ethyl alcohol or grain alcohol, is a volatile, colorless liquid that belongs to the alcohol chemical group. It is produced through the fermentation of sugars by yeast or other microorganisms. Ethanol has a wide range of applications, including industrial, fuel, and recreational uses.


Ethanol is a renewable resource that can be used to replace gasoline in some applications. It is also less polluting than gasoline, and it can help to reduce greenhouse gas emissions.

Learn more about ethanol on https://brainly.com/question/30781447

#SPJ1

compared to a phosphorus atom, a P-3 ion has

Answers

Answer:

3 electrons more

explanation

minus sign in chemistry means more

homeworkstudycom

equilibrium between two isomers a and b (a and b have the same mol. wt) is attained when there is 5% by weight A and by difference, 95% by weight of B. What is the equilibrium constant

Answers

The equili constant assuming reaction is from isomer A to isomer B; 19

i.e. A ⇄ B = 19

Given data :

% wt of A = 5

% wt of B = 95

assume the mass of mixture = 100 g

wt of A = 5% of 100 = 5 g

wt of B = 95% of 100 = 95 g

∴ mole of A = 5/M mol,  mole of B = 95/M  mol   ( where M = molar mass )

expressing the equilibrium constant

A ⇄ B  

equilibrium constant = \(\frac{[B]}{[A]}\) = \(\frac{ (95/M) /V}{(5/M)/V}\)  where V = volume

∴ Equilibrium constant = 19 assuming process is from A to B

hence the equilibrium constant = 19 assuming reaction process is from A to B

learn more : https://brainly.com/question/3159758

How does the burning of fossil fuels contribute to global warming?

Answers

Answer: The burning of fossil fuels releases carbon dioxide, methane and other greenhouse gases into the atmosphere. These gases trap heat in the atmosphere, leading to a gradual increase in global average temperatures, known as global warming. This phenomenon has serious impacts on our environment and ecosystems, including extreme weather events and rising sea levels.

Describe the trend of the reactivity of the elements in group VII

Answers

The non-metal elements in Group 7 – known as the halogens – get less reactive as you go down the group

Answer & Explanation:

The reactivity of elements in Group VII, also known as Group 17, decreases with increasing atomic radius. This is because halogens have high electronegativities and a proclivity to gain electrons in noble gas configurations. Myths are traditional stories or beliefs that explain cultural or societal beliefs, customs, or natural phenomena. They can be passed down through generations and can be based on true or fictitious events. Mythology, on the other hand, is the collection of myths associated with a specific culture or religion. Mythology can be amplified through retelling, incorporation into religious practices; association with significant events or figures, and adaptation into other media forms such as literature, film, or art.

Wine goes bad soon after opening because the ethanol (CH3CH2OH) dissolved in it reacts with oxygen (O2) gas to form water and aqueous acetic acid (CH3COOH), the main ingredient in vinegar. Calculate the moles of oxygen needed to produce 0.080 mol of water. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits.

Answers

The number of mole of oxygen needed is of 0.080 mole.

To solve this question, we'll begin by writing the balanced equation for the reaction. This is illustrated below:

CH₃COOH + 2O₂ —> CO₂ + 2H₂O

From the balanced equation above,

2 moles of O₂ reacted to produce 2 moles of H₂O.

Finally, we shall determine the number of mole of O₂ needed to produce 0.080 mole of H₂O. This can be obtained as follow:

From the balanced equation above,

2 moles of O₂ reacted to produce 2 moles of H₂O.

Therefore,

0.080 mole of O₂ will also react to produce 0.080 mole of H₂O.

Thus, 0.080 mole of oxygen, O₂, is needed for the reaction.

Learn more: https://brainly.com/question/1563415

I
Based on the information below, which of the following are atoms of the same element? (mark all that apply)
Atom A
Atom B
Atom C
8 protons
8 neutrons
8 electrons
10 protons
10 neutrons
10 electrons
8 protons
10 neutrons
8 electrons
end

IBased on the information below, which of the following are atoms of the same element? (mark all that

Answers

Based on the information below . The atoms of the same element are Atom A and Atom C .

Atoms of same element have the same atomic number. so the number of protons and electron are same but they have different atomic masses called as Isotopes.  so, the atoms having different number of neutron will have different masses.

In the given case ,

Atom A               Atom B             Atom C

8 protons           10 protons        8 protons

8 neutrons         10 neutrons       10 neutrons

8 electrons         10 electrons      8 electrons

so, In Atom A  and Atom C , the number of protons and electrons are same but  the have different atomic masses means having different no. of neutrons. so Atom A and Atom C are the atoms of same elements.

Hence,Based on the information below . The atoms of the same element are Atom A and Atom C.

To learn more about Atoms and Elements here

https://brainly.com/question/15173445

#SPJ1

Answer question number 8. The question is in the image.

Answer question number 8. The question is in the image.

Answers

Answer

(4) C₃H₈

Explanation

Saturated hydrocarbons are hydrocarbons that contain only single bonds between carbon atoms. As a result, each carbon atom is bonded to as many hydrogen atoms as possible. Saturated hydrocarbons are given the general name of alkanes. The general formula for a straight-chain saturated hydrocarbon is CnH2n+2 where n is the number of carbon.

When n = 2

C2H(2 x 2) + 2 = C2H6

When n = 3

C3H(2 x 3) + 2 = C₃H₈

Hence, the formula that represents a saturated hydrocarbon in the options is:

(4) C₃H₈

Which compound has the highest melting point?
Al2(CO3)3
C12H22O11
C8H18
H2O

Answers

Answer:

Al2(CO3)3 (A)

Explanation:

i think thats the answer

Aluminum carbonate is indeed a carbonate solution of aluminum that is intended for oral intake. It should be the carbonate salt type of aluminum that's also intended for oral consumption.

It is used to alleviate the symptoms of excess stomach acid in situations like heartburn, acid reflux, acid indigestion, upset stomach, or stomach ulcers.It is a water-insoluble Aluminum source that, when heated, rapidly converts to other Aluminum complexes like oxide.

Therefore, the answer is "\(\bold{Al_2(CO_3)_3}\) ".

Learn more:

brainly.com/question/12232746

The average weather conditions over a long period of time is known as

Answers

Answer: it’s climate

Explanation:

6. How many moles are in 8.30 x 1023 molecules of CO₂?
a.
b.
C.
d.
1.37
2.8
55.5
100

Answers

the answer should be 1.38 molecules

How many kilograms of HF are needed to completely react with 7.01 kg of UO2?

Answers

Kilograms of HF are needed to completely react with 7.01 kg 0f UO₂ is 2.077 kg.

it is given that ,

mass of UO₂ = 7.01 kg = 7010 g

molar mass of UO₂ = 270.03 g/mol

molar mass of HF = 20.01 g/mol

mass of HF = ?

the balanced chemical equation is given as:

UO₂  +  4HF ------->   UF₄   +   2H₂O

NOW,

no. of moles of  UO₂ =  mass / molar mass

                         = 7010 g /270.03 g/mol

                         = 25.96 moles

from equation it is clear that 1 mole of UO₂ react with 4 moles of HF

25.96 moles of UO₂ = 4 × 25.96 moles of HF

                                  103.84 mol of HF

therefore,

mass of HF = no. of moles × molar mass

                   =   103.84 mol × 20.01 g/mol

                   =  2077.83 g

in kg , 2077,83 g = 2.077 kg

Thus, Kilograms of HF are needed to completely react with 7.01 kg 0f UO₂ is 2.077 kg.

To learn more about no. of moles here

https://brainly.com/question/20714721

#SPJ1

                                 

experimental evidence indicates that the nucleus of an atom

Answers

The nucleus of an atom is positively charged and contains most of the mass if the atom.

What is an atom?

An atom is the smallest particle of a an element that can take part in a chemical reaction.

Atoms are made up of other smaller sub-particles which are:

neutrons which are neutral protons which are positively charged electrons which are negatively charged

The protons and neutrons are found in the nucleus of an atom

The electrons are found regions around the nucleus.

Due to the positive charge of the protons, the nucleus of an atom are positively charged and is massive.

Learn more about atoms and nucleus at: https://brainly.com/question/867047

What type of compound is probably formed if it contains a metallic element?positively chargedcovalentionicnegatively charged

Answers

The most probably compound to be formed if it contains a metallic element is a ionic compound.

It is common that metals form ionic bonds with no metals. It is not normal that they form covalent compounds.

Regarding charged compounds it is not normal for them to be formed unless the presence of an external factor.

A patient provides you a prescription for Percocet, a medication he has never taken before and his insurance company is requiring prior authorization. What steps should be taken?

Answers

To ensure insurance coverage for Percocet, it is essential to verify the patient's insurance coverage and check if prior authorization is required. If prior authorization is necessary, gather the required information, complete the authorization form, and submit it to the insurance company.

When a patient presents a prescription for a medication like Percocet, which requires prior authorization from the insurance company, several steps should be taken:

Verify Insurance Coverage: Check the patient's insurance coverage and confirm if prior authorization is required for Percocet. This can be done by contacting the insurance company or using an online portal provided by the insurer.

Review Prior Authorization Criteria: Understand the specific requirements set by the insurance company for obtaining prior authorization for Percocet. This may include documentation, medical history, and supporting evidence to justify the need for the medication.

Gather Patient Information: Collect relevant patient information, including medical records, diagnosis, and any previous treatments. This information will be used to support the prior authorization request.

Complete Prior Authorization Form: Fill out the necessary prior authorization form provided by the insurance company. Ensure that all required information is accurately entered, including the patient's details, prescriber information, and supporting documentation.

Submit the Request: Send the completed prior authorization form along with any supporting documents to the insurance company. This can be done electronically through their designated channels or by fax/mail, following their specified process.

Follow Up: Monitor the progress of the prior authorization request. Follow up with the insurance company to confirm receipt, inquire about any additional information needed, and track the status of the request.

Inform the Patient: Keep the patient informed about the prior authorization process, estimated timelines, and any potential out-of-pocket costs they may incur.

For more question on Percocet

https://brainly.com/question/28649445

#SPJ8

ZSM-5, a catalyst material, has a surface area of 581 m²/g. What is the surface
area of this material in cm²/mg?

ZSM-5, a catalyst material, has a surface area of 581 m/g. What is the surfacearea of this material in

Answers

ZSM-5 is a catalyst material, which has a surface area of 581 m²/g. This is equivalent to a surface area of 5810 cm²/mg.

What is a catalyst?

A catalyst is a substance that increases the rate of a chemical reaction without itself undergoing any permanent chemical change. Catalysts have large surface areas to increase the reaction rate.

Biological catalysts are known as enzymes.

ZSM-5 is a catalyst material, which has a surface area of 581 m²/g. We want to convert this value to cm²/mg.

Step 1: Convert 581 m²/g to cm²/g.

We will use the conversion factor 1 m = 100 cm.

581 m²/g × (100 cm/1 m)² = 5.81 × 10⁶ cm²/g

Step 2: Convert 5.81 × 10⁶ cm²/g to cm²/mg.

We will use the conversion factor 1 g = 1000 mg.

5.81 × 10⁶ cm²/g × (1 g/1000 mg) = 5810 cm²/mg

ZSM-5 is a catalyst material, which has a surface area of 581 m²/g. This is equivalent to a surface area of 5810 cm²/mg.

Learn more about catalysts here: https://brainly.com/question/12507566

(PLEASE HELP)"The most abundant isotope of Hydrogen has a mass of 1 amu. Therefore, the average atomic mass on the periodic table for Hydrogen will be 1 amu." Using the terms isotopes, abundance, average atomic mass and weighted mass to explain why this misconception is incorrect and why the abundance(amount) of each isotope of the element affect the average atomic mass.

Answers

The statement the most abundant isotope of Hydrogen has a mass of 1 amu is wrong.

What is the average atomic mass?

The average atomic mass could be obtained as the sum of the products of the percentage abundance of each of the hydrogen isotopes and the mass of the isotope.

We know that every element has isotopes. In every sample of the atom, there are various isotopes of the element. Thus the average atomic mass must take into account the masses of all these isotopes.

As such, the statement the most abundant isotope of Hydrogen has a mass of 1 amu is wrong.

Learn ore about atomic mass:https://brainly.com/question/17067547

#SPJ1

Other Questions
Is it suitable to improve cash flow by renting out part of premises or is there any other way? Justify your answerWill mark brainliest You've observed the following returns on Crash-n-Burn Computer's stock over the past five years: 3 percent, -9 percent, 29 percent, 18 percent, and 15 percent. What was the arithmetic average return on the company's stock over this five-year period? 11.20% What was the variance of the company's returns over this period? 0.02230 Mohan is standing at a distance of 4 units from the origin in the negative direction of the x- axis. His friend Sohan is standing at a distance of 7 units from the origin in the negative direction of the y- axis. Find the distance between them Rhea, with a radius of , is the second-largest moon of the planet Saturn. If the mass of Rhea is , what is the acceleration due to gravity on the surface of this moon? rearrange "has parts body the main three" can somebody help me with this worksheet please!? Janices family grows tomato plants on a rectangular plot of land. The total area of the garden is square meters, and the length of the rectangle representing this piece of land is meters. What is the width of the garden? Why do recruiters use virtual interviews?Multiple ChoiceO to reduce problems associated with implicit cognitionO solely to save on travel expensesO to better judge leadership qualitiesO to accurately assess if the applicant will "fit in"O to evaluate work that does not produce objective outcomes what is the general purpose of feedback inhibition? what is the problem if feedback inhibition happens when it isn't supposed to? What kind of variable will be created by a line of code that reads num1 = int(input("Please enter your favorite number."))a stringa floatan integera generic Qu problema tienen los empresarios encuesta-dos en el estudio que se discute? What is the end behavior of the graph of the polynomial function y 10x9 4x? Which medication comes in an intramuscular solution? Bumetanide Chlorthalidone Spironolactone Torsemide Using the expanded accounting equation, solve for the missing amount Assets = $84,325 Liabilities = $2,560 Common Stock = ? Dividends = $13,450 Revenues = $54,780 Expenses = $28,125 arton of milk contains 1.89 liters. Toe nearest whole number, how many0-milliliter servings are in thetainer? Shakespeare adapted works by Greek and Roman writers. His works were enriched by (select 3) A) American poems and myths B) historical works about England, Scotland, and Ireland C) European poems and legends D) elements from English folk tales E) historical works about America Any help would be appreciated 5 little indians quotes solve the equation by completing the square. show all the solutions x^2 + 6x + 8 = 0 what substances must a plant take substances come from Write an equation in point-slope form of the line that passes through the given point and has the given slope. (-6, 2); m = 3