The products of the hydrolysis reaction is Carboxylic acid + Alcohol.
What are the products of the hydrolysis reaction?A hydrolysis process occurs when a larger molecule splits into many smaller ones. An alcohol and a carboxylic acid are created when an ester is hydrolyzed by an acid. When an ester experiences basic hydrolysis, two products are created: an alcohol and a carboxylate salt (saponification).
What is the product of hydrolysis carboxylic acid?The hydrolysis (a cleavage reaction with water) that all carboxylic acid derivatives go through to produce carboxylic acids unites them all. with the hydroxide ion to produce an alcohol and a carboxylate salt. When a powerful acid is then added to the reaction mixture, the carboxylic acid itself is created.
To know more about hydrolysis visit:-
https://brainly.com/question/24213349
#SPJ1
In what way is cellular respiration like breathing?
Answer:Cellular respiration is not the same as breathing, but they are closely related
Explanation: When you breathe in, you take in the oxygen your cells need for cellular respiration. When you breathe out, you get rid of carbon dioxide that your cells produce during cellular respiration.
How many total ions are there in 5.00 moles of cobalt (II) bromide?
Can somebody please help me understand this? I don't understand what I need to do to solve any of the parts.
This technique has been used to identify the presence of gases such as oxygen, methane, and carbon dioxide in the atmospheres of exoplanets.
i) To estimate the frequency of the violet (leftmost) emission, we can use the equation v = c/λ, where v is frequency, c is the speed of light (3.00 x 10^8 m/s), and λ is the wavelength of the emission in meters. The wavelength of the violet emission is 400 nm or 400 x 10^-9 m, so the frequency can be calculated as v = (3.00 x 10^8 m/s) / (400 x 10^-9 m) = 7.50 x 10^14 Hz.
ii) To estimate the energy of the violet emission, we can use the equation E = hv, where E is energy, h is Planck's constant (6.63 x 10^-34 Js), and v is frequency in Hz. Substituting the frequency calculated in part (i), we get E = (6.63 x 10^-34 Js) x (7.50 x 10^14 Hz) = 4.97 x 10^-19 J.
b. The spectral lines are produced by the electrons within the atoms of this element, which can absorb or emit specific amounts of energy to move between different energy levels. These energy transitions result in the emission or absorption of photons with specific wavelengths and frequencies, giving rise to the observed emission spectrum.
c. The violet emission line represents the photon with the most energy since it has the shortest wavelength (400 nm) and highest frequency (7.50 x 10^14 Hz) among the lines shown. This highest energy does not necessarily represent the energy of the valence electrons, but rather corresponds to the specific energy transitions occurring within the atoms of the element.
d. Emission spectra can be used to determine the gases present in the atmosphere of a far-away planet by analyzing the specific wavelengths of the emitted or absorbed light from the planet. Each gas has a unique emission or absorption spectrum, allowing scientists to identify the gases present in the planet's atmosphere.
To know more about Wavelength , visit :
https://brainly.com/question/13533093
#SPJ1
Please help! Chemistry and I don’t get along.
A compound is named by combining the names of its cation and anion.
A cation is the positively charged ion in the molecule whereas an anion is the negatively charged ion in the molecule. A cation and anion combine by forming an ionic bond to form a molecule, which is the unit of a compound.
Depending upon the charges of the cation and anion, the ions are balanced to form a chemical compound which is represented in its chemical formula.
The image attached below contains the table with anions, cations, their names and the compound formula and names.
Learn more about compounds in:
https://brainly.com/question/5526339
#SPJ1
HELP PLS Asap Why do slimmer objects go faster than things with more structure (use scientific terminology)
There are several factors that can contribute to the speed of an object, including its mass, shape, and the surface it is moving on. In general, slimmer objects tend to go faster than objects with more structure because they offer less resistance to movement, which allows them to accelerate more quickly and reach higher speeds.
One factor that can affect the speed of an object is its mass, or the amount of matter it contains. All other things being equal, an object with a lower mass will tend to be faster than an object with a higher mass, because it has less matter to move and therefore requires less energy to accelerate.
Another factor that can affect the speed of an object is its shape, or the way it is structured. Slimmer objects tend to be more streamlined, meaning they have a shape that allows them to move through the air or water with less resistance. This can allow them to go faster than more structured objects, which may have a shape that creates more drag or resistance to movement.
Finally, the surface an object is moving on can also affect its speed. For example, an object moving on a smooth, flat surface may be able to go faster than an object moving on a rough or uneven surface, because the smooth surface offers less resistance to movement.
Overall, the speed of an object is determined by a combination of these and other factors, including the force applied to the object and the level of resistance it encounters. Slimmer objects tend to go faster than objects with more structure because they offer less resistance to movement, which allows them to accelerate more quickly and reach higher speeds.
The amount of matter in an object
A Mass
B weight
C non contact force
D friction
E net force
Answer:
A)Mass
Explanation:
Mass measure the amount of matter
Give the molecular formulas for the first three of the alkone series?
BRANLIEST AND 100 POINTS.
Compare and contrast the structure of yeast and algae.
Algae is a member of the Protista kingdom, a group of mostly aquatic photosynthetic organisms. Yeast, any one of roughly 1,500 species of single-celled fungi, the majority of which belong to the phylum Ascomycota with just a few Basidiomycota species.
What are characteristics of algae and yeast ?
Algae have a variety of life cycles and range in size from tiny micro species to giant kelps with lengths of up to 60 meters (200 feet).Their cells have characteristics that are unique to animals and plants, and their photosynthetic pigments are more diverse than those of plants. Algae are economically significant as a source of crude oil, a source of food, and a source of a number of pharmaceutical and industrial products for humans. In addition to their ecological roles as oxygen producers and the food base for almost all aquatic life, algae are also important economically. Algae's taxonomy is contentious and subject to rapid revision as new molecular data emerge. A phycologist is someone who studies algae, and the field of study is known as phycology.Yeast, any one of roughly 1,500 species of single-celled fungi, the majority of which belong to the phylum Ascomycota with just a few Basidiomycota species. Yeasts can be found in soils and on plant surfaces all over the world. They are especially common in sugary mediums like fruit nectar and flower nectar. There are hundreds of ascomycete yeast varieties with significant economic value. Select strains of Saccharomyces cerevisiae are the ones that are commonly used to make beer, wine, and bread. Some yeasts, like Candida albicans, Histoplasma, and Blastomyces, can be mild to dangerous to humans and other animals.To know more about algae and yeast check this:
brainly.com/question/4289110
#SPJ2
What natural force helps sedimentary rock form over many years?
electricity
gravity
friction
magnetism
Answer:
Gravity
Explanation:
Sorry If i was late lol
Gravity is the natural force helps sedimentary rock form over many years. Hence option 3 is correct.
What are natural force?Natural force is defined as those in nature that arise as a result of natural events and not because of any outside forces. Weak nuclear force, electromagnetic force, nuclear force, and gravitational force are the four fundamental forces of nature. The weak and strong forces are dominant only at the level of subatomic particles and are only effective across very small distances.
Sedimentary rock production is primarily a result of weathering, dissolution, precipitation, and lithification in the earth's crust. Erosion and weathering include the effects of wind and rain, which progressively break large stones into smaller ones.
Thus, gravity is the natural force helps sedimentary rock form over many years. Hence option 3 is correct.
To learn more about natural force, refer to the link below:
https://brainly.com/question/13191643
#SPJ2
what type of chemical reaction is represented
Answer:
1) Oxidation-Reduction (Redox) Reaction
2) Combustion Reaction
3) Decomposition Reaction
4) Synthesis Reaction
5) Single Displacement (Substitution) Reaction
6) Double Displacement (Metathesis) Reaction
7) Acid-Base Neutralization Reaction
8) Precipitation Reaction
Here are the Answer:
1. Oxidation-Reduction (Redox) Reaction
2. Combustion Reaction
3. Decomposition Reaction
4. Synthesis Reaction
5. Single Displacement (Substitution) Reaction
6. Double Displacement (Metathesis) Reaction
7. Acid-Base Neutralization Reaction
8. Precipitation Reaction
Hope this Helped! Don't have a good day, have a GREAT DAY!
Becca is a forensic technician analyzing the fragments of a window. She sees that there is a hole in the window, and that the outside hole is smaller than the inside hole. What might she deduce from this information?
The observation of a smaller outside hole than inside leads Becca to infer that an impact from the outside caused the hole, with a larger object striking and passing through the window from the inside.
From the observation that the hole in the window is smaller on the outside than on the inside, Becca, as a forensic technician, might deduce the following:
The hole was caused by an impact from the outside: The smaller outside hole suggests that the force that created the hole originated from the outside and exerted more pressure on the window surface facing inward.
The object causing the hole was larger on the inside: The discrepancy in hole sizes implies that the object that struck the window had a larger size or diameter on the inside, and as it penetrated the glass, it compressed or fragmented the glass, resulting in a larger hole on the inside.
The object may have passed through the window: The difference in hole sizes indicates that the object may have penetrated the window, potentially passing through to the inside. This could suggest a break-in or an incident involving the window being struck from the outside.
Overall, the observation of a smaller outside hole than inside leads Becca to infer that an impact from the outside caused the hole, with a larger object striking and passing through the window from the inside.
For more question on observation
https://brainly.com/question/29521469
#SPJ8
of nitrogen gas)?
How many grams of H2 are needed to produce 71.1 g of ammonia (NH3) (assuming unlimited availability
3 H2+ N2 + 2NH3
Provide the answer with 3 or more significant figures.
Answer:
\(m_{H_2}=12.6gH_2\)
Explanation:
Hello there!
In this case, given the reaction:
\(3 H_2+ N_2 \rightarrow 2NH_3\)
It is possible to compute the necessary grams of hydrogen which produce 71.1 g of ammonia, given the 3:2 mole ratio and their molar mass as shown below:
\(m_{H_2}=71.1gNH_3*\frac{1molNH_3}{17.04gNH_3}*\frac{3molH_2}{2molNH_3} *\frac{2.02gH_2}{1molH_2}\\\\m_{H_2}=12.6gH_2\)
Best regards!
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
How many grams are in 4.25 moles of NiS?
Answer:
386.75 grams
Explanation:
You can use dimensional analysis to help you solve for this question
1. set up a proportion
x grams
4.25 mol x x mole
2. to find the amount of grams/mol that are in NiS we find the gram formula mass (mass of all the atomic masses of each element)
Ni- 59 grams
S- 32 grams
add these together and you get 91 g/mol
3. now plug in the values and multiply across
91 grams
4.25 mol x 1 mole
when you multiply across this is equal to 386.75 grams
How many kilometers can the car travel on the amount of gasoline that would fit in a soda can? The volume of a soda can is 355 mL . Express your answer using two significant figures.
Based on the assumptions made about the type of car, the distance Honda Insight with EPA gas mileage rating of 57mi/gal will travel on 355 mL of gasoline is 8.6 km
What is the distance in kilometres a car can travel on 355 mL of gasoline?The distance a car will travel on gasoline will depend on mileage rating of the car.
Assuming that the car is a Honda Insight with EPA gas mileage rating of 57mi/gal.The units are converted to convert Km/mL as follows:
1 mile = 1.609344 Km1 gallon = 3785.411 mLThen;
57 mi/gal = 57 × 1.609344 km/3785.411 mL
57 mi/gal = 0.0242 km/mL
Then;
Distance travelled on 355 mL = 0.0242 × 355
Distance travelled = 8.59 km
Therefore, the distance Honda Insight with EPA gas mileage rating of 57mi/gal will travel on 355 mL of gasoline is 8.6 km
Learn more about distance and car mileage at: https://brainly.com/question/17146782
Calculate the vapor pressure (in torr) at 298 K in a solution prepared by dissolving 38.5 g of the non-volatile non-electrolye urea {CO(NH2)2} in 142 g of methanol. The vapor pressure of methanol at 298 K is 122.7 torr. Give your answer to 2 decimal places.
Answer: The vapor pressure of methanol solution at 298K is 107.12 torr
Explanation:
As the relative lowering of vapor pressure is directly proportional to the amount of dissolved solute.
The formula for relative lowering of vapor pressure will be,
\(\frac{p^o-p_s}{p^o}=i\times x_2\)
where,
\(\frac{p^o-p_s}{p^o}\)= relative lowering in vapor pressure
i = Van'T Hoff factor = 1 (for non electrolytes)
\(x_2\) = mole fraction of solute =\(\frac{\text {moles of solute}}{\text {total moles}}\)
Given : 38.5 g of urea is present in 142 g of methanol
moles of solute (urea) = \(\frac{\text{Given mass}}{\text {Molar mass}}=\frac{38.5g}{60g/mol}=0.64moles\)
moles of solvent (methanol) = \(\frac{\text{Given mass}}{\text {Molar mass}}=\frac{142g}{32g/mol}=4.4moles\)
Total moles = moles of solute + moles of solvent = 0.64 + 4.4 = 5.04
\(x_2\) = mole fraction of solute =\(\frac{0.64}{5.04}=0.127\)
\(\frac{122.7-p_s}{122.7}=1\times 0.127\)
\(p_s=107.12torr\)
Thus the vapor pressure of methanol solution at 298K is 107.12 torr
Question
The melting points of canola oil, corn oil, sunflower oil, and peanut oil are 10°C, -11°C, -17°C, and -2°C respectively.
You cool a mixture of these oils to 5°C.
Which oil can be separated easily?
Responses
peanut oil
sunflower oil
canola oil
corn oil
The oil that can be separated at this temperature is canola oil.
What is the melting point?The term melting point has to do with the temperature in which a solid can be converted to liquid. This is the temperature at which the various bonds that holds the molecules of the substance can be broken off.
We are told in the question that; the melting points of canola oil, corn oil, sunflower oil, and peanut oil are 10°C, -11°C, -17°C, and -2°C respectively. We want to know the oil that can be separated easily at 5°C.
Learn more about melting point:https://brainly.com/question/28902417
#SPJ1
You are given 1.091 grams of a white powder and told that it is a mixture of potassium carbonate and sodium carbonate. You are asked to determine the percent composition by mass of the sample. You add some of the sample to 10.00 mL of 0.8903 M nitric acid until you reach the equivalence point. When you have added enough carbonate to completely react with the acid, you reweigh your sample and find that the mass is 0.573 g. Calculate the mass of the sample that reacted with the nitric acid. Calculate the moles of nitric acid that reacted with the sample.
The sample of white powder contains 47.1% K2CO3 and 0.39% Na2CO3.
Molar mass of sodium carbonate = 106 g/mol
Molar mass of potassium carbonate = 138 g/mol
Number of moles of HNO3 = 10/1000 L × 0.8903 M = 0.008903 moles
Mass of HNO3 = 0.008903 moles × 63 g/mol = 0.56 g
Mass of sample added = 1.091 g
Mass of sample left over = 0.573 g
Mass of sample reacted = 1.091 g - 0.573 g = 0.518 g
The reacted sample contains xg of Na2CO3 and (0.518 - x) g K2CO3.
Na2CO3 + 2HNO3 --> 2NaNO3 + CO2 + H2O
106g of Na2CO3 reacts with 126g of HNO3
x g of Na2CO3 reacts with (126 × x/106)g of HNO3
K2CO3 + 2HNO3 --> 2KNO3 + CO2 + H2O
138 g of K2CO3 reacts with 126 g of HNO3
(0.518 - x) g of K2CO3 reacts with [(0.518 - x) × 126/138] g
Total mass of HNO3 used;
1.19x + 0.47 + 0.91x = 0.56
2.1x + 0.47 = 0.56
2.1x = 0.56 - 0.47
2.1x = 0.09
x = 0.09/2.1
x = 0.0043 g
Mass of K2CO3 = (0.518 - x) g = 0.518 - 0.0043 = 0.5137 g
Mass percent of K2CO3 = 0.5137 g/ 1.091 g × 100/1 = 47.1%
Mass percent of Na2CO3 = 0.0043/1.091 g × 100/1 = 0.39%
Learn more: https://brainly.com/question/9743981
2. The air in a 51 L balloon is heated from 310 K to 450 K at a constant pressure of 1 atm. Calculate the new volume of the balloon.
Answer: 74 L
Explanation:
Consider the combined gas law.
\(\frac{P_{1}V_{1} }{T_{1}} = \frac{P_{2}V_{2} }{T_{2}}\)
its amazing... isnt it? i hope you like it...
P stands for pressure. V stands for volume. T stands for temperature.
Notice that the left side has subscript 1 and the right side has subscript 2.
1 means that this is the FIRST version... before any changes have been made.... so notice that the figure 310 K would be on the left side here.. and 450 K would be on the right side of this equation. so far so good.
notice that the pressure is constant. so who cares about P??? lets throw it out... its just gonna multiply stuff by 1 anyways which DOES NOTHING...
\(\frac{V_{1} }{T_{1}} = \frac{V_{2} }{T_{2}}\)
this is cool...
lets do some replacing...
\(\frac{51 L}{310 K} = \frac{V_{2} }{450 K}\)
we basically just do normal algebra now. what is 51 divided by 310?
0.164516. okay... now multiply by 450... and the new volume of the balloon is 74 L rounded to two significant figures since the smallest figure in your question is two sig figs.
How many drops of water can you pile on a penny before it overflows?
Answer:
about 75 drops (in my ex.)
Without SALT or SUGAR, does the water conduct electricity?
Explain which species is reduced in the reaction between magnesium and iron chloride. 3 Mg + 2 FeCl3 → 2 Fe + 3 MgCl₂ Your answer should include the half equation for the reduction.
ANSWER
Fe³⁺ is being reduced
Fe³⁺ + 3e⁻ → Fe
EXPLANATION
Fe³⁺ is reduced as in the reaction, Fe goes from +3 to 0 which indicates the gain of electrons.
A student pushes a textbook across a desk with a force of 6.0 N a distance of 0.3 m. How much work is done on the textbook? Also need the formula and how to do it. Please help
Explanation:
Work done = Force * Diatance
By applying this equation,
We have Work Done = (6.0N)(0.3m) = 1.8J.
Answer:
1.8 J is the right answer.Explanation:
Formula used : Work = Force × Displacement
Work done = 6.0 Newton×0.3 meters = 1.8 joules
Which solution conducts electricity?
O Salt Solution
O Sugar Solution
O Both
O Neither
How many moles are in 87.62 grams of strontium?
Explanation:
it's one mole because the atomic mass is treated as molar mass and the atomic mass of strontium is 87.62 grams/mol
A template of a Venn diagram representing common and differentiating characteristics of covalent and ionic bonds is shown. Which of the following characteristics can be written only in space C?
Covalent and ionic bonds refer to atoms joined by their electrons. In covalent bonds, electrons are shared by the involved non-metal atoms. Option 2 is correct. Occurs due to the sharing of electrons between two non-metal atoms.
What are covalent and ionic bonds?
Both of them, covalent and ionic bonds, are chemical bonds that can form between atoms.
Ionic bonds occur between atoms with different electronegativity. When they bind, they transfer electrons from one atom to the other creating ions with opposite charges that attract each other.
Ionic compounds are formed by anions and cations.
• Cations are positive ions derivated from metals.
• Anions are negative ions derivated from non-metals.
The metal atoms share its electrons with the non-metal ones, creating stable configurations. Ionic bonds do not create molecules.
Covalent bonds are formed between atoms share electrons to be more stable. Atoms involved share electrons equally, creating a strong bond between them.
Covalent bonds are usually formed between non-metal atoms.
Option 2 is correct. Occurs due to the sharing of electrons between two non-metal atoms
You can learn more about covalent and ionic bonds at
https://brainly.com/question/19739192
#SPJ1
Complete question
A template of a Venn diagram representing common and differentiating characteristics of covalent and ionic bonds is shown.
Which of the following characteristics can be written only in space C?
On the diagram,
The non-overlapping space on the left is marked A, and belongs to the IONIC BOND side of the diagram.The overlapping space is marked B The non-overlapping space on the right is marked C, and belongs to the COVALENT BOND side of the diagram.Options,
Formed between positively and negatively charged ionsOccurs due to the sharing of electrons between two non-metal atomsOccurs in substances that are mostly solids at normal temperature and pressureFormed between an atom with very high electronegativity and an atom with very low electronegativityA construction company is building a house. After a truck delivers the materials, workers build a wooden frame, cover
the exterior with bricks, and spread gravel for the driveway.
Which resource used in the scenario is nonrenewable?
the wooden frame of the house
the gravel rocks in the driveway
the diesel fuel in the delivery truck
the clay bricks on the outside of the houses
Answer:
The diesel fuel in the delivery truck
Explanation:
Answer:
The answer is c
Explanation:
The diesels fuel in the delivery truck
What will happen to the temperature of an object if the kinetic energy of the particles increases?
The temperature of an object will increase if the kinetic energy of the particle increases.
Kinetic energy is an energy that is said to be in motion. According to the kinetic molecular theory of ideal gas, the particles of the gas are usually moving in constant random motion and they exert no force on each other.
Also, the temperature varies directly proportional to the average kinetic energy of the gas particles. As a result, when the kinetic energy of the particles increases, the temperature will also increase.
Learn more about the kinetic theory of gas here:
https://brainly.com/question/9949658?referrer=searchResults
identify the following Lewis dot structure:
S₈H₂
H₂S
The compound that have been shown in the dot structure is H₂S.
What compound has the dot structure?We know that the dot structure is the structure of the compound that can be written by the inclusion of dots We know that the dots that can be found in structure are used to show the electrons in the compound.
We can see that the compound is made of two atoms of hydrogen and one atom of sulfur and these atoms of hydrogen each share two electrons with the sulfur atom as we can see from the dot structure that is represented here.
Learn more about dot structure:https://brainly.com/question/20300458
#SPJ4
if the metal was not heated long enough, how would the value for the calculated specific heat of the metal be affected?
If the metal was not heated long enough, the calculated specific heat of the metal will be different from then measured specific heat capacity of the metal, and there will be error in measurement of the specific heat capacity of the metal
What is specific heat capacity of a metal?The specific heat capacity of a metal is the quantity of heat required to raise the temperature of a unit mass of the metal by 1 kelvin.
The heat capacity of a metal and its specific heat capacity is given by the following formula.
Q = mcΔθ
c = Q/mΔθ
where;
Q is the heat capacity of the metalΔθ is the change in temperature of the metalc is specific heat capacity of the metalWhen a metal is heated for a long period of time, it acquires thermal energy which causes its temperature to increase.
As the temperature of the metal increases, the difference in temperature of the metal increases as well. The increase in the temperature difference of the metal causes a decrease in the specific heat capacity of the metal.
However, if the metal was not heated long enough, the difference in temperature of the metal will be small and the value of the specific heat capacity will increase.
When the value of the specific heat capacity increases, it will be different from the calculated specific heat of the metal and cause error in measurement of specific heat capacity of the metal.
Learn more about specific heat capacity here: https://brainly.com/question/16559442
#SPJ1