find the area of the figure

Find The Area Of The Figure

Answers

Answer 1

Answer:

[See Below]

Step-by-step explanation:

✦ In this figure there are two shapes; A triangle and a square. So you'll need to know the area formula for both:

  ✧ Square ∼ s² (Side Squared)

  ✧ Triangle ∼ ½ × b × h

✦ So now just solve for each area:

  ✧ Square ∼ 15² = 225

  ✧ Triangle ∼  ½ × 15 × 3 = 22.5

✦ Now add each area together to get the total area:

  ✧ 225 + 22.5 = 247.5

~Hope this helps Mate. If you need anything else feel free to message me.


Related Questions

Two opposite angles of a parallelogram are 3x+4 and 5x-2 find measure of all angles of parallelogram

Answers

Answer:

=The opposite angles of a parallelogram are equal

=(3x+4)

=(5x-2)

=-2x=-6

=x=6+2

=x=3=

1st angle=3x+4=13

3rd angle=5x-2=13

=sum of adjacent side of angle is 180°

=Let the adjacent (2nd angle ) be y=

y+13°=180°

=y=180°-13°

=y=167°=

2nd angle=4th angle

=2nd angle=167° 

=4th angle=167°

Step-by-step explanation:

This might be confusing, but I hope it helps <3

Jenny went to the nail salon and got a manicure. She left a tip of $9.00, which was 15% of the total bill. How much was her total bill at the nail salon? ​

Answers

Answer:

$60 + $9 = $69

Step-by-step explanation:

Answer:

Total bill = $60.00

Step-by-step explanation:

Tip = $9.00

Percentage = 15%

15% of x = 9

15/100 x = 9

x = 9 x 100/ 15 = 60

Total bill = $60.00

I hope im right!!

solve the given differential equation by undetermined coefficients. y''' − 6y'' = 4 − cos(x)

Answers

The particular solution to the given differential equation is y_p = A + Bx + Cx^2 + D cos(x)

To solve the differential equation by undetermined coefficients, we assume a particular solution of the form:

y_p = A + Bx + Cx^2 + D cos(x) + E sin(x)

where A, B, C, D, and E are constants to be determined.

Now, let's find the derivatives of y_p:

y_p' = B + 2Cx - D sin(x) + E cos(x)

y_p'' = 2C - D cos(x) - E sin(x)

y_p''' = D sin(x) - E cos(x)

Substituting these derivatives into the differential equation:

(D sin(x) - E cos(x)) - 6(2C - D cos(x) - E sin(x)) = 4 - cos(x)

Now, let's collect like terms:

(-12C + 5D + cos(x)) + (5E + sin(x)) = 4

To satisfy this equation, the coefficients of each term on the left side must equal the corresponding term on the right side:

-12C + 5D = 4 (1)

5E = 0 (2)

cos(x) + sin(x) = 0 (3)

From equation (2), we get E = 0.

From equation (3), we have:

cos(x) + sin(x) = 0

Solving for cos(x), we get:

cos(x) = -sin(x)

Substituting this back into equation (1), we have:

-12C + 5D = 4

To solve for C and D, we need additional information or boundary conditions. Without additional information, we cannot determine the exact values of C and D.

Therefore, the particular solution to the given differential equation is:

y_p = A + Bx + Cx^2 + D cos(x)

where A, B, C, and D are constants.

To learn more about differential equation, refer to the link:

brainly.com/question/18760518

#SPJ11

When a problem is said to be decidable or undecidable give an example of an undecidable problem?

Answers

Example of an undecidable problem is given by the problems in the system created by computer viruses.

What is decidable and undecidable problems?

According to the computability theory, the problems that needs either yes or no answer, but it is not possible by any computer programming languages to create exact answer then this computational problem is termed as undecidable problems.

A decidable problem is a decision problem in the computer system that can be solved by an algorithm correctly.

When is a problem said to be decidable or undecidable?

whenever we find a problem for which there is no algorithm available for solve and we are also unable to create any program that can solve the problem exactly in finite time are declared as undecidable problems.

If we find a problem that ask yes or no question about some input and there is programming language available for responding correctly then this particular problem is declared as decidable.

To learn more about decidable and undecidable problem visit:

https://brainly.com/question/27345304

#SPJ4

2(-5x+4)+4x-5= -3

SOLVE FOR X please

Answers

\(\huge\text{Hey there!}\)

\(\huge\textbf{Equation:}\)

\(\mathbf{2(-5x + 4) + 4x - 5 = -3}\)

\(\huge\textbf{Solving for it:}\)

\(\mathbf{2(-5x) + 2(4) + 4x - 5 = -3}\)

\(\mathbf{-10x + 4 + 4x - 5 = -3}\)

\(\huge\textbf{Combine the like terms:}\)

\(\mathbf{(-10x + 4x) + (8 - 5) = -3}\)

\(\mathbf{-10x + 4x + 8 - 5 = -3}\)

\(\mathbf{-6x + 3 = -3}\)

\(\huge\textbf{Subtract \boxed{\bf 3} to both sides:}\)

\(\mathbf{-6x + 3 - 3= -3 - 3}\)

\(\huge\textbf{Simplify it:}\)

\(\mathbf{-6x = -3 - 3}\)

\(\mathbf{-6x = -6}\)

\(\huge\textbf{Divide \boxed{\bf -6} to both sides:}\)

\(\mathbf{\dfrac{-6x}{-6} = \dfrac{-6}{-6}}\)

\(\huge\textbf{Simplify it:}\)

\(\mathbf{x = \dfrac{-6}{-6}}\)

\(\mathbf{x = -6\div-6}\)

\(\mathbf{x = 1}\)

\(\huge\textbf{Therefore, your answer should be:}\)

\(\huge\boxed{\mathsf x =\frak{1}}\huge\checkmark\)

\(\huge\text{Good luck on your assignment \& enjoy your day!}\)

~\(\frak{Amphitrite1040:)}\)

Use substitution to solve the system of equations​



y=x+1.75 4x-2y = 4

Answers

Answer:

y=x+1.75

4x-2y = 4

The answer is (3. 75, 5.5)

Step-by-step explanation:

If you plot the two equations on Desmos' Graphing Calculator, you will see that the solution is intersected at (3.75, 5.5).

Solve the following inequality. Write the solution set using interval notation. 8(2x+1)>8 Select the correct choice below and, if necessary, fill in the answer box to complete your choice. A. The solution set is ----------. (Type your answer in interval notation. Use integers or fractions for any numbers in the expression. Simplify your answer.) B. The solution set is ∅.

Answers

Solving the inequality 8(2x + 1) > 8, gives the solution set (0, ∞).

The given inequality is 8(2x + 1) > 8. To solve this inequality, we simplify the expression by distributing 8 to the terms inside the parentheses:

16x + 8 > 8.

Next, we isolate the variable by subtracting 8 from both sides, resulting in 16x > 0.

To find the solution set, we divide both sides by 16, giving us x > 0. This means that any value of x greater than 0 satisfies the original inequality.

In interval notation, the solution set can be expressed as (0, ∞), indicating that x is greater than 0 and has no upper bound. Therefore, the solution set is (0, ∞).

You can learn more about inequality at

https://brainly.com/question/30238989

#SPJ11

pleasee helpp mee asap

pleasee helpp mee asap

Answers

Answer:

a. Ans;

\((4a {b}^{5} )^{4} = ({4})^{4} ( {a})^{4} ({b}^{5} )^{4} = 256 {a}^{4} {b}^{20} \)

__o__o__

b. Ans;

\(2 {p}^{ \frac{1}{3} } = 6 \\ 2 \sqrt[3]{p} = 6 \\ \\ \sqrt[3]{p} = \frac{6}{2} \\ \\ \sqrt[3]{p} = 3 \\ \\( {p}^{ \frac{1}{3} }) ^{3} = {(3)}^{3} \\ \\ p = {3}^{3} \\ \\ p = 27\)

I hope I helped you^_^

Select each expression that is equivalent to 3/16 if x=34 . 2x+116 x2−616 (38)2÷x x−14 2x−x2−34 HELPPPP

Answers

Given statement solution:- None of the expressions evaluated are equivalent to 3/16 when x=34.

Let's evaluate each expression to determine if it is equivalent to 3/16 when x=34:

2x+116:

Substituting x=34, we have: 2(34) + 116 = 68 + 116 = 184

184 is not equal to 3/16.

\(x^2\) - 616:

Substituting x=34, we have: \((34)^2\) - 616 = 1156 - 616 = 540

540 is not equal to 3/16.

\((38)^2\)÷ x:

Substituting x=34, we have:\((38)^2\) ÷ 34 = 1444 ÷ 34 = 42.47 (approx.)

42.47 is not equal to 3/16.

x - 14:

Substituting x=34, we have: 34 - 14 = 20

20 is not equal to 3/16.

2x -\(x^2\)- 34:

Substituting x=34, we have: 2(34) - \((34)^2\) - 34 = 68 - 1156 - 34 = -1122

-1122 is not equal to 3/16.

None of the expressions evaluated are equivalent to 3/16 when x=34.

For such more questions on Equivalent Expressions

https://brainly.com/question/15775046

#SPJ11

(PLEASE HELP)
What is the sum of the values of luann’s three cards?

(PLEASE HELP)What is the sum of the values of luanns three cards?

Answers

Answer:

the sum of the values should be -14

Step-by-step explanation:

-12+3-5=-14

Solve the equation 5(3x+7)

Answers

Answer:

I gotchu

Step-by-step explanation:

15x+35

yw then n u just add those togwther

What is: -(-8)+6-(-5) equal?​

Answers

The answer would be 19, I hope this helps!!

53, 13, 34, 41, 26,61, 34, 13,69 mean median mode and range

Answers

Answer:

mean 38.22

median 34

mode 13 & 34

range 56

Step-by-step explanation:

mean- add all values together and divide by number of values

median- order from least to greatest find the middle value

mode- the value that appears most often, can be more than one value

range- smallest value subtracted from the largest

Can someone explain (d) and (e) please? ​

Can someone explain (d) and (e) please?

Answers

Part (d)

Answer: 180 degrees

----------------------

Explanation:

QS is a diameter, which makes angle SPQ to be 180 degrees (ie a straight angle). Arc QTS is also going to be 180 degrees, because all semicircles are half of the full circle of 360 degrees. So (1/2)*360 = 180.

==================================================

Part (e)

Answer: 50 degrees

----------------------

Explanation:

Angle QPR is a central angle that subtends (cuts off) the minor arc RQ, which is shown to be 50 degrees. The central angle is equal to this arc measure, so angle QPR is also 50 degrees

A homeowner bought a dryer from a discount appliance store for $698.27 and makes 12 monthly payments of $63.29 with a credit card. The store charges $1.25 for every purchase made with a credit card. The homeowner also had to pay late fees in the amount of $35 four different times. What is the total cost of the dryer?

$713.27
$809.48
$900.73
$914.48

Answers

If the homeowner also had to pay late fees in the amount of $35 four different times, the total cost of the dryer is $809.48. So, correct option is A.

To calculate the total cost of the dryer, we need to add the initial cost of the dryer, the monthly payments, the credit card fees, and the late fees.

The total cost of the dryer can be calculated as follows:

Cost of dryer = $698.27

Total credit card charges = 12 x $1.25 = $15

Total late fees = 4 x $35 = $140

Total cost of the dryer = Cost of dryer + Total credit card charges + Total late fees

= $698.27 + $15 + $140

= $809.27

Therefore, the total cost of the dryer is $809.48, which is the closest option to the calculated answer.

So, correct option is A.

To learn more about cost click on,

https://brainly.com/question/31471609

#SPJ1

More points for an answer

More points for an answer

Answers

Answer:

23 because i had this test before

How many solutions are there to the inequality x1 + x2 + x3 ≤ 11, where x1, x2, and x3 are nonnegative integers? [Hint: Introduce an auxiliary variable x4 such that x1 + x2 + x3 + x4 = 11.]

Answers

The number of nonnegative integer solutions to the inequality x1 + x2 + x3 ≤ 11 is C(14,3) = 364.

We can solve this inequality by introducing an auxiliary variable x4, such that x1 + x2 + x3 + x4 = 11. Here, x1, x2, x3, and x4 are all nonnegative integers.

We can interpret this equation as follows: imagine we have 11 identical objects and we want to distribute them among four boxes (x1, x2, x3, and x4). Each box can contain any number of objects, including zero. The number of solutions to this equation will give us the number of nonnegative integer solutions to the original inequality.

We can use a technique known as stars and bars to count the number of solutions to this equation. Imagine we represent the 11 objects as stars: ***********.

We can then place three bars to divide the stars into four groups, each group representing one of the variables x1, x2, x3, and x4. For example, if we place the first bar after the first star, the second bar after the third star, and the third bar after the fifth star, we get the following arrangement:

| ** | * | ****

This arrangement corresponds to the solution x1=1, x2=2, x3=1, and x4=7. Notice that the number of stars to the left of the first bar gives the value of x1, the number of stars between the first and second bars gives the value of x2, and so on.

We can place the bars in any order, so we need to count the number of ways to arrange three bars among 14 positions (11 stars and 3 bars). This is equivalent to choosing 3 positions out of 14 to place the bars, which can be done in C(14,3) ways.

Therefore, the number of nonnegative integer solutions to the inequality x1 + x2 + x3 ≤ 11 is C(14,3) = 364.

Click the below link, to learn more about  solutions of the inequality :

https://brainly.com/question/22010462

#SPJ11

Find the sum of the geometric sequence -3,15,-75,375,... when there are 9 terms

Answers

Answer:

-976,563.

Step-by-step explanation:

The common ratio is 15/-3 = -75/15 = 375/-75 = -5.

Sum of n terms = a1. (r^n - 1) / (r - 1)

so S9 = -3 * ((-5)^9 - 1)) /  (-5 - 1)

= -976,563.

Detamine which pair of functions are not inverse
A.g(x)=2+9
h(x) =1/2x-9
B. g(x)=x-1
h(x)=x+1
C. g(x)=3x-6
h(x)=1/3x+2
D. g(x)=3x+4
h(x)=x-4/3

Answers

The pair of functions that are not inverses of each other is (A).

Which of the pair of functions are not inverse

To determine if two functions, g(x) and h(x), are inverses of each other, we need to check if the composition of the two functions, g(h(x)) and h(g(x)), both result in x.

A. g(x) = 2 + 9 = 11, h(x) = 1/2x - 9

g(h(x)) = g(1/2x - 9) = 2 + 9 = 11

h(g(x)) = h(11) = 1/2(11) - 9 = -3/2

Since g(h(x)) ≠ x and h(g(x)) ≠ x, the functions g(x) and h(x) are not inverses of each other.

B. g(x) = x - 1, h(x) = x + 1

g(h(x)) = g(x + 1) = (x + 1) - 1 = x

h(g(x)) = h(x - 1) = (x - 1) + 1 = x

Since g(h(x)) = x and h(g(x)) = x, the functions g(x) and h(x) are inverses of each other.

C. g(x) = 3x - 6, h(x) = 1/3x + 2

g(h(x)) = g(1/3x + 2) = 3(1/3x + 2) - 6 = x

h(g(x)) = h(3x - 6) = 1/3(3x - 6) + 2 = x

Since g(h(x)) = x and h(g(x)) = x, the functions g(x) and h(x) are inverses of each other.

D. g(x) = 3x + 4, h(x) = x - 4/3

g(h(x)) = g(x - 4/3) = 3(x - 4/3) + 4 = 3x - 4

h(g(x)) = h(3x + 4) = (3x + 4) - 4/3 = 3x + 8/3

Since g(h(x)) ≠ x and h(g(x)) ≠ x, the functions g(x) and h(x) are not inverses of each other.

Learn more on inverse of a function here;

https://brainly.com/question/3831584

#SPJ1

Igor has not been skiing in 10 years. however, when he gets on his skis, his body remembers exactly how to ski. the kind of memory that makes it possible for him to remember how to ski is:__________

Answers

Igor has not been skiing in 10 years. however, when he gets on his skis, his body remembers exactly how to ski. the kind of memory that makes it possible for him to remember how to ski is procedural.

What is procedural memory?Procedure memory exists a kind of implicit memory (unconscious, long-term memory) that helps people carry out particular tasks without thinking about their previous experiences.

It frequently resides below the consciousness level and controls the actions we take.

The automatic retrieval and use of procedural memories, which are relied upon when appropriate, is necessary for the execution of integrated motor and cognitive functions, such as tying shoes, reading, and flying an airplane.

Procedural memories are recovered and used without any conscious control or attention being needed.

Procedural learning, or repeatedly completing a challenging activity until all required brain networks are able to coordinate to complete the job automatically, is how procedural memory is established.

To learn more about procedural memory, refer to:

https://brainly.com/question/15170911

#SPJ4

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB


find cos(A-B)

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant

Answers

Using trigonometric identity, cos(A-B) is:

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

How to find cos(A-B) using the trigonometric identity?

Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.

If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1  are positive

sin A = 1/3 (sine = opposite/hypotenuse)

adjacent = √(3² - 1²)

               = √8 units

cosine = adjacent/hypotenuse. Thus,

\(cos A = \frac{\sqrt{8} }{3}\)

If cos B = 2/3 and B terminates in Quadrant 4.

opposite = √(3² - 2²)

                = √5

In  Quadrant 4, sine is negative. Thus:

\(sin B = \frac{\sqrt{5} }{3}\)

We have:

cos(A-B) = cosA CosB + sinA sinB

\(cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}\)

\(cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}\)

\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)

Learn more about Trigonometry on:

brainly.com/question/11967894

#SPJ1

Consider a projectile launched at a height h feet above the ground and at an angle θ with the horizontal. If the initial velocity is v0 feet per second, the path of the projectile is modeled by the parametric equations x = t(v0 cos(θ)) and y = h + (vo sin θ)t - 16t^2. A rectangular equation for the path of this projectile is y = 6 + x -0.008x^2
(a) Eliminating the parameter t from the position function for the motion of a projectile to shows that the rectangular equation is as follows.
(b) Find h, v0, and θ. (Round your answers to two decimal places.)
(c) Use a graphing utility to graph the rectangular equation for the path of the projectile. Confirm your answer in part (b) by sketching the curve represented by the parametric equations.
(d) Use a graphing utility to approximate the maximum height of the projectile. (Round your answers to two decimal places.)(c) Use a graphing utility to graph the rectangular equation for the path of the projectile. Confirm your answer in part (b) by sketching the curve represented by the parametric equations.
What is the approximate range of the projectile?

Answers

A) The rectangular equation for the path of the projectile is

y = 6 + x - 0.008x².

B) To find h, v0, and θ, we can compare the given rectangular equation with the parametric equations. By equating the coefficients of x², x, and the constant term, we can derive the values.

C) Using a graphing utility, we can plot the rectangular equation

y = 6 + x - 0.008x² and confirm the shape of the projectile's path. Additionally, we can sketch the curve represented by the parametric equations x = t(v0 cos(θ)) and y = h + (v0 sin θ)t - 16t² to visually verify the result.

In the given problem, the parametric equations describe the motion of a projectile launched at height h and angle θ with an initial velocity of v0. By eliminating the parameter t, we obtain the rectangular equation y = 6 + x - 0.008x², which represents the path of the projectile. To find the values of h, v0, and θ, we compare the coefficients of x², x, and the constant term between the rectangular equation and the parametric equations. By solving these equations, we can determine the values of h, v0, and θ.

To confirm the obtained values, we can use a graphing utility to plot the rectangular equation y = 6 + x - 0.008x². The graph will show the shape of the projectile's path. Additionally, we can sketch the curve represented by the parametric equations x = t(v0 cos(θ)) and y = h + (v0 sin θ)t - 16t² to compare it with the graph of the rectangular equation. This visual confirmation will ensure the accuracy of the calculated values.

Learn more about parametric equation

brainly.com/question/29275326

#SPJ11

The volume of a soup can is 324x cubic inches with a
radius of 6 square inches. What is the height of the soup
can?

Answers

Answer:

height of can is 2.86 inches if the soap can ..

Step-by-step explanation:

by using the formula of volume of cylinder....= π r²h = 324

22/7 × 6×6×h = 324

h = 2.86 inches

plz mark my answer as brainlist plzzzz and vote me

A solid with surface area 50units^2 is dilated by a scale factor of K to obtain a solid surface area 200units^2. Find the value of K.

Answers

The value of K is 2.

Let's denote the scale factor as K. The surface area of a solid after dilation is directly proportional to the square of the scale factor.

We are given that the initial surface area of the solid is 50 units^2, and after dilation, the surface area becomes 200 units^2.

Using the formula for the surface area, we have:

Initial surface area * (scale factor)^2 = Final surface area

50 * K^2 = 200

Dividing both sides of the equation by 50:

K^2 = 200/50

K^2 = 4

Taking the square root of both sides:

K = √4

K = 2

Therefore, the value of K is 2.

for such more question on scale factor

https://brainly.com/question/3381225

#SPJ8

Stocks trade on the New York Stock Exchange from 9:30 AM to 4:00 PM. The price of a
certain stock was at or above its opening price all day during a particular trading day.
The number of dollars, d (x), the stock was above its opening price during the day can
be modeled by the function d (x)=1/12x^4-x^3 + 3x², where x represents the number of
hours since the open. Was the stock at its opening price at any time during the day
other than the open? If so, what time? Explain how you got your answer.

Answers

The equation d(x) = 0 has no solutions, indicating that the stock price did not equal its opening price at any point after the market opened.

To determine whether the stock was at its opening price at any time during the day other than the open, we need to find if there are any solutions for which the value of d(x) equals zero. In other words, we need to solve the equation d(x) = 0.

The given function is d(x) = (1/12)x^4 - x^3 + 3x^2. We can solve this equation by factoring, if possible, or by using numerical methods.

To start, let's factor out an x^2 from each term: d(x) = x^2((1/12)x^2 - x + 3).

Now we have a quadratic equation within the parentheses. We can attempt to factor it further or use the quadratic formula to find its roots. However, upon examining the quadratic, (1/12)x^2 - x + 3, we notice that its discriminant, b^2 - 4ac, is negative. This indicates that the quadratic does not have real roots. Therefore, the stock did not reach its opening price at any time during the day other than the open.

In simple terms, this means that according to the given model, the stock remained above its opening price for the entire trading day. The equation d(x) = 0 has no solutions, indicating that the stock price did not equal its opening price at any point after the market opened.

For more such questions on stock price , Visit:

https://brainly.com/question/29362234

#SPJ11

Given 3 and one-tenth times negative 6 times seven-twelfths, determine the product.

eighteen and one sixtieth
negative eighteen and 7 over 120
ten and 17 over 20
negative 10 and 17 over 20

Answers

The given statement expression is equivalent to -2 \(\frac{1}{10}\).

What is a expression? What is a mathematical equation? What is Equation Modelling? What are complex numbers?

A mathematical expression is made up of terms (constants and variables) separated by mathematical operators. A mathematical equation is used to equate two expressions. Equation modelling is the process of writing a mathematical verbal expression in the form of a mathematical expression for correct analysis, observations and results of the given problem. In mathematics, a complex number is an element of a number system that extends the real numbers with a specific element denoted [i], called the imaginary unit and satisfying the equation -

\({\displaystyle i^{2}=-1}\)

Every complex number can be expressed in the form a + bi, where [a] and [b] are real numbers

We have the following statement -

3 and one-tenth times negative 6 times seven-twelfths

We can write -

3 (1/10 x - 6) × 7/12

- 3 \(\frac{3}{5}\) × 7/12

-18/5 × 7/12

-3/5 x 7/2

- 21/10

- 2 \(\frac{1}{10}\)

Therefore, the given statement expression is equivalent to -2 \(\frac{1}{10}\).

To solve more questions on Equations, Equation Modelling and Expressions visit the link below -

brainly.com/question/14441381

#SPJ1

help pls

Write the equation of the line in slope-intercept form that is perpendicular to
y = -x – 18 and passes through (-6, 11).

Answers

Hence, the slope which is perpendicular to the line to \(y = -x - 18\) and passes through \((-6, 11)\) is \(y=x+17\).

What is the equation?

The definition of an equation is a mathematical statement that shows that two mathematical expressions are equal.

Here given that,

The line in slope-intercept form that is perpendicular to \(y = -x - 18\) and passes through \((-6, 11)\).

As we know the slope of line is

\(y=mx+c\)

where \(m\) is the slope and \(c\) is the y intercept.

Given points are \((-6,11)\).

If we want to describe the perpendicular line to the original line then the slope of line is

\(m_2=-\frac{1}{m_1}\)

In our given slope of line

\(y = -x -18\)

where \(m_1=-1\)

So,

\(m_2=-\frac{1}{m_1}\\\\m_2=-\frac{1}{-1}\\\\m_2=1\)

Now for the slope of second line we use the point slope from the construct equation then,

\(y-y_1=m_2(x-x_1)\\\\y-11=1(x-(-6))\\\\y-11=x+6\\\\y=x+6+11\\\\y=x+17\)

Hence, the slope which is perpendicular to the line to \(y = -x - 18\) and passes through \((-6, 11)\) is \(y=x+17\).

To know more about the equation

https://brainly.com/question/12788590

#SPJ1

4. How many solutions does
this linear equation have?
4x - 2x + x - 5 = 3x+2
C

4. How many solutions doesthis linear equation have?4x - 2x + x - 5 = 3x+2C

Answers

Answer:The equation 4x +2(x-5) = 3(2x-4) don't have any solution.Step-by-step explanation: Equations with one solution If a linear equation has a variable term alone on one side and a constant term alone on the other side, it has one solution.  And I hope this helps you!!

CAN SOMEONE DO ALL OF THE FIRST LONG BOX? ILL GIVE BRAINLIEST PLEASE IM RUSHING AND CRYING

CAN SOMEONE DO ALL OF THE FIRST LONG BOX? ILL GIVE BRAINLIEST PLEASE IM RUSHING AND CRYING

Answers

Answer:

1). 2/8, 2/5, 2/4, 2/3

2). Fill in 2 of the boxes

3). C

4). Shade all of the first 2 boxes and half (2) of the 3rd

5). D

6). 43/56

Step-by-step explanation:

Solve.

−5/6 = −1/4 − 7/10x

Enter your answer as a fraction in simplest form.

I don't know how brainly works :b

Answers

Answer:

\(\boxed{\sf x=\cfrac{5}{6}}\)

Step-by-step explanation:

\(\sf -\cfrac{5}{6}=-\cfrac{1}{4}-\cfrac{7}{10}x\)

\(\sf -\cfrac{1}{4}-\cfrac{7}{10} \; x=-\cfrac{5}{6}\)

Add 1/4 to both sides:-

\(\sf -\cfrac{1}{4}-\cfrac{7}{10}x+\cfrac{1}{4}=-\cfrac{5}{6}+\cfrac{1}{4}\)

Simplify:-

\(\sf -\cfrac{7}{10}x=-\cfrac{7}{12}\)

Multiply both sides by 10:-

\(\sf 10\left(-\cfrac{7}{10}x\right)=10\left(-\cfrac{7}{12}\right)\)

Simplify:-

\(\sf -7x=-\cfrac{35}{6}\)

Divide both sides by -7:-

\(\sf \cfrac{-7x}{-7}=\cfrac{-\cfrac{35}{6}}{-7}\)

Simplify:-

\(\sf x=\cfrac{5}{6}\)

____________________

Hope this helps!

Have a great day! :)

Answer:

x = 5/6

Step-by-step explanation:

Given equation,

→ (-5/6) = (-1/4) - (7/10)x

Now the value of x will be,

→ (-5/6) = (-1/4) - (7/10)x

→ (-7/10)x = (-5/6) + (1/4)

→ (-7/10)x = (-10 + 3)/12

→ x = (-7/12) × (-10/7)

→ x = 10/12

→ [ x = 5/6 ]

Hence, the answer is 5/6.

Other Questions
Pleaseeeee helpppppppp meeeeeeee pleaseeeee Solve for X and Y with work Guys how do I get a little fat? I eat all the time but I feel like Im not growing Below, the two-way table is given for aclass of students.SophomoreMale2 2FreshmenJuniorsSeniorsTotal42Female3463TotalIf a student is selected at random, find theprobability the student is a junior given that it'smale. Round to the nearest whole percent.[?]% TRUE / FALSE.The map of the states under the Articles of Confederation is very similar to the modern map of the "states along the eastern seaboard." 1/5 of 45 is what number?hurry! Q: Predict the product, if any, of reaction between methyl propanoate and Li(Ph)2Cu in ether.* Draw only the product derived from the acyl portion of methyl propanoate.* You do not have to consider stereochemistry.* If no reaction occurs, draw the organic starting material. Write an algebraic expression for the following word phrase 9.94 less than the product of 26 and x "Concrete jungle where dreams are made of". Not taking into account the poetics of the song, is this sentence grammatically correct? Shouldn't we say "concrete jungle where dreams are made"? scheduling involves selecting and staffing the project team and assigning specific tasks to team members. T/F determined by the type of protein found on the surface of red blood cells A. diabetes B. hemophilia C. blood type D sex-linked genes what are civil rights? Amo has three times as many marbles asEffah. Amo gives Effah 15 marbles, andThen Effah has twice as many as Amo.How many had each as first? if g(x)=x^2-x then what is g(2)-2 Suppose thirty-two students signed up for classes during an orientation session. Ifexactly twenty of them signed up for Chemistry and exactly sixteen of them signedup for English, how many of them signed up for both Chemistry and English? The maya obtain their food byA. FishingB. TradingC. HuntingD. Farming Two agencies that look out for the best interests of customers are ______ AFT and EEOC FDA and CPSC SEC and EPA OSHA and EEOCtwo agencies that focus on protecting employees are _____ AFT and EEOC FDA and CPSC SEC and EPA OSHA and EEOC find the equation of the line below (1,-2) (2,-4) *20 brainliest points* *pls help* PLEASE HELPIdentify the italicized phrase in the following sentence. Running out of gas, the car came to a stop. It is used as a(n) _____. adverb noun gerund phrase participial phrase adjective infinitive phrase a typical wavelength of infrared radiation emitted by your body is 27 mm (2.7102 m ).