g which of the following statements about atoms are true? group of answer choices electrons are found in the nucleus of atoms. protons are found in the shells of atoms. orbitals are occupied by electrons. neutrons are positively charged subatomic particles.

Answers

Answer 1

Only the following statement about the atoms is true:

Orbitals are occupied by electrons.

Electrons are NOT found in the nucleus of atoms,Protons are NOT found in the shells of atoms, neutrons are neutral.

This is the only correct option among all the given options.

The other statements are false:

Electrons are NOT found in the nucleus of atoms, they are found in the shells surrounding the nucleus.

Protons are NOT found in the shells of atoms, they are found in the nucleus.

Neutrons are NOT positively charged, they are neutral.

Learn more about neutral here:

https://brainly.com/question/12498769

#SPJ4


Related Questions

Jason shot a bb straight up in the air with a velocity of 105 m/s.what will the velocity of the bb when it is at a height of 203 m?

Answers

Answer:

The velocity of the bb when it reaches a height of 203 m can be determined using the laws of projectile motion. Since the bb is moving vertically upwards, its velocity at that height will be zero.

brainlest?

Answer: v = 83.96 m/s

Assuming the acceleration due to gravity is approximately 9.8 m/s^2, we can use the principles of projectile motion and energy conservation.

Using the equation for the vertical displacement of an object in free fall:

Δy = (v₀² - v²) / (2g)

Δy = vertical displacement (203m)

v₀ = initial velocity (105 m/s)

v = final velocity (not known yet)

g = accerlation due to gravity (9.8 m/s^2)

Lets rearrange the equation to solve for the final velocity:

v = v = √(v₀² - 2gΔy)

Substituting the given values:

v = √(105² - 2 * 9.8 * 203)

v ≈ √(11025 - 3979.6)

v ≈ √(7054.4)

v ≈ 83.96 m/s

Therefore, when the BB pellet is at the height of 203m, its velocity will be approximately 83.96 m/s.

Select all that apply.

A beta particle:

1.) is electromagnetic energy
2.) is an electron
3.) has zero charge
4.) is emitted from the nucleus
5.) has a +2 charge
6.)has a -1 charge

Answers

Answer: 2, 4, 6

Explanation: A beta particle is a high energy electron, emitted from the radioactive disintegration of an atomic nucleus. It has a -1 charge.

Which of the following represents gamma emission?
A. 16 Eu+ge ¹62 Sm
B. Tc→ Tc+y
O C. 14Gd 1442 Sm+ He
O D. 180Gd→ 160Tb + je
SUBMIT

Answers

Answer:c

Explanation:

A 2.5 g sample of a hydrate of Ca(NOs) was heated, and only 1.7 g of the anhydrous salt remained. What percentage of water is in the hydrate?

Answers

Answer:

32%

Explanation:

To determine the percentage of water in the hydrate, we need to know the original amount of water that was present in the hydrate. We can calculate this by subtracting the amount of anhydrous salt remaining (1.7 g) from the original weight of the hydrate (2.5 g).

(2.5 g - 1.7 g) = 0.8 g

This tells us that 0.8 g of water was present in the original 2.5 g hydrate sample. To find the percentage of water, we divide the weight of the water by the weight of the original hydrate and multiply by 100.

(0.8 g / 2.5 g) * 100 = 32 %

So, 32% of the original 2.5 g hydrate sample was water.

How is bleaching powder prepared???

no copied answer!!​

Answers

Hi there!..

Your answer↓

\( \: \)

How is bleaching powder prepared?

It is prepared by the action of chlorine gas on dry slaked lime Ca(OH)²

\( \: \)

\( \dag \boxed{\red{\sf{Ca(OH) {}^{2} +cl {}^{2} →CaOCl {}^{2} +H {}^{2} O}}}\)

determine the percent ionization of a 0.250 m solution of benzoic acid.

Answers

The percent ionization of a 0.250 m solution of benzoic acid is approximately 2.04%.

For benzoic acid (C6H5COOH), the ionization reaction is:

C6H5COOH + H2O ↔ C6H5COO- + H3O+

The equilibrium constant for this reaction is denoted as Ka.

Ka = [C6H5COO-][H3O+]/[C6H5COOH]

Ka = x^2 / (C - x)

Solving for x, we get:

x = sqrt(Ka * (C - x))

x = sqrt(6.46 × 10^-5 * 0.250) = 0.0051 M

% ionization = (x / C) * 100% = (0.0051 / 0.250) * 100% ≈ 2.04%

Ionization is a process in which an atom, molecule or ion loses or gains one or more electrons, resulting in the formation of an ion. This can occur through various mechanisms, such as through collisions with other particles, exposure to radiation, or chemical reactions.

When an atom loses an electron, it becomes positively charged and is called a cation. Conversely, when an atom gains an electron, it becomes negatively charged and is called an anion. The resulting ions may have different chemical and physical properties compared to the neutral atom or molecule. Ionization plays a crucial role in various chemical and biological processes, including the formation of chemical bonds, the functioning of enzymes, and the transmission of nerve impulses.

To learn more about Ionization visit here:

brainly.com/question/28385102

#SPJ4

NO LINKS PLEASE! Why does dye dropped into a cup of water eventually spread throughout the water?
A. The water has lattice vectors.
B. The water undergoes a phase transition.
C. The water particles and dye particles exhibit Brownian motion.
D. The water exerts pressure on the container.

Answers

Answer:

C

Explanation:

okay, you need to look at the structures of the particles of matter in the solid, liquid and gas.

particles in a solid are in fixed positions, where they can only vibrate in those positions ( take a look at ice, or rather, a brick)liquids have very small or rather, no spaces between them, but they can slide or rub against each other, like people in a really tight crowd I guessgas particles have very large spaces between them and they move randomly. these exibit what's called brownian motion.since water particles (and all other liquid particles) have negligible spacings and limited movement, that allows the dye particles to move from a region of high concentration to that of a low concentration. the aim for this is for the mixture/solution to reach an equilibrium, that  is the mixture must get to a point where all regions have the same concentration of the dye.

you can refer to your coursebooks :)

correct where wrong please:)

When an object is acted on by unbalanced forces, the object will -

Answers

Answer:

hope it helps and thank you for the points

When an object is acted on by unbalanced forces, the object will -

Under which conditions will the forward rate of a chemical reaction most often decrease? (1) The concentration of the reactants decreases, and the temperature decreases. (2) The concentration of the reactants decreases, and the temperature increases. (3) The concentration of the reactants increases, and the temperature decreases. (4) The concentration of the reactants increases, and the temperature increases.

Answers

The forward rate of a chemical reaction refers to the speed at which reactants are converted into products. The rate can be affected by various factors including temperature and concentration. The correct answer to the question is (1)

The concentration of the reactants decreases, and the temperature decreases. When the concentration of the reactants decreases, there are fewer reactant particles to react with each other, which leads to a decrease in the forward rate of the reaction. Similarly, when the temperature decreases, the  of the reactant particles decreases, which leads to a decrease in the number of successful collisions and a decrease in the forward rate of the reaction.

Overall, it is important to note that the forward rate of a chemical reaction can be affected by a variety of factors and conditions, and it is important to carefully consider each one in order to understand how they impact the reaction.

To know more about forward rate visit:

https://brainly.com/question/28586871

#SPJ11

4K2CO3
Subscript for K:
Subscript for C:
Subscript for O:

Answers

Answer:

bjbjbjbjbhjhgytuvbgtbgygutf

Explanation:

what is the relationship between how readily they are reduced and the standard reduction potential (be specific and clear about how and whether the sign of the standard reduction potential plays in)?

Answers

The relationship between how readily a substance is reduced and the standard reduction potential is inverse. The higher the standard reduction potential, the less readily the substance is reduced.

This is because the standard reduction potential is a measure of the tendency of a substance to gain electrons and be reduced. A more positive standard reduction potential indicates a greater tendency to gain electrons and be reduced, while a more negative standard reduction potential indicates a lesser tendency. Therefore, a substance with a higher standard reduction potential is less likely to be reduced because it already has a greater tendency to gain electrons, while a substance with a lower standard reduction potential is more likely to be reduced because it has a lesser tendency to gain electrons.


The relationship between how readily a substance is reduced and its standard reduction potential is that a higher (more positive) standard reduction potential indicates that the substance is more easily reduced. The standard reduction potential is a measure of the tendency of a chemical species to accept electrons and undergo reduction. The sign of the standard reduction potential plays a crucial role, as a positive value indicates a higher tendency for the species to be reduced, while a negative value suggests that the species is less likely to undergo reduction. In summary, the more positive the standard reduction potential, the more readily the substance is reduced.

To learn more about  potential, click here:

brainly.com/question/25006076

#SPJ11

1. You are given the number of moles of carbon and must convert it to an equivalent mass using the molar mass from the periodic table. The carbon sample is 0.045 moles.

2.  How many moles of potassium are in 525.0 g of pure potassium? Explain

Answers

0.54g is the mass of carbon in  0.045 moles of carbon. Elementary particles shared the same quantity of matter.

What is mass?

A body's mass is an inherent attribute. Until the discoveries of the atom as well as particle physics, it was thought to be tied to the amount of matter inside a physical body. It was discovered that various atoms and elementary particles shared the same quantity of matter.

mole = given mass/ molar mass

substituting all the given values in the above equation, we get

0.045 moles = mass/ 12

mass =0.045×12= 0.54g

Therefore, 0.54g is the mass of carbon in  0.045 moles of carbon.

To learn more about mass, here:

https://brainly.com/question/15368078

#SPJ1

What is the frequency of the light emmitted by the atomic hydrogen according to balmers?

Answers

The frequency released in transition energy is  4.57 x 10¹⁴ Hz.

We need to know about transition energy to solve this problem. Electrons in a hydrogen atom can move to another level of energy. It is also called a transition. In this process, electrons will absorb or release their energy to move. The transition energy can be determined as

ΔE = E2 - E1

where ΔE is transition energy, E2 is the final state of energy and E1 is the initial state of energy.

The state energy of a hydrogen atom can be calculated by

E = -(13.6) / n² eV

E = h.f

where n is the number of energy states, h is Planck constant (4.136 x 10¯¹⁵ eV/Hz), f is frequency.

From the question above, we know that

n1 = 3

n2 = 2

By substituting the following parameter, we get

ΔE = E2 - E1

ΔE = -(13.6) / n2² - (-(13.6) / n1²)

ΔE = -(13.6) / 3² - (-(13.6) / 2²)

ΔE = 3.4 - 1.51

ΔE = 1.89 eV

Calculate the frequency released

ΔE = 1.89 eV

h.f = 1.89

4.136 x 10¯¹⁵ . f = 1.89

f = 4.57 x 10¹⁴ Hz

For more on transition energy at: https://brainly.com/question/19054395

#SPJ4

Select the correct answer.
What is the reason for heat transfer from one substance to another

Answers

Answer:

Difference in temperature.

Explanation:

Conduction is the movement of heat energy through a substance or from one substance to another by direct contact of atoms and molecules. Heat moves directly from one molecule to another. The heat energy speeds up the movement of the atoms and they collide with other molecules setting them into faster motion.

What is generally true about the particles in a gas?

A. Gas particles are closer together and have stronger attraction between them than the particles in a solid.

B. Gas particles are closer together and able to conduct electricity better than the particles in a plasma.

C. Gas particles are farther apart and able to conduct electricity better than the particles in a liquid.

D. Gas particles are farther apart and have weaker attraction between them than the particles in a solid.

Answers

Answer:

D

Explanation:

ILL GIVE BRAINLIEST!!What are you’re thoughts on climate change and the impact it might have on your future?

Answers

Scientists have predicted that long-term effects of climate change will include a decrease in sea ice and an increase in permafrost thawing, an increase in heat waves and heavy precipitation, and decreased water resources in semi-arid regionsClimate change affects human health and wellbeing through more extreme weather events and wildfires, decreased air quality, and diseases transmitted by insects, food, and water.Most people of the world feel that climate change is likely to destroy the world's economy, flood cities, cause mass migrations and even cause regional wars. More than half of the world also feels that climate change will cause a new world war, although Europe and the United States think that is less likely

In the solar system, most asteroids are ____. (A). Beyond Neptune (B). Orbiting Saturn (C). Between Mars and Jupiter (D). Next to the sun True of false: An object made of ice, dust, and rock that orbits the sun is called an asteroid.

Answers

Answer:

Part 1

In the solar system, most asteroids are;

(C) Between Mars and Jupiter

Part 2

False: An object made of ice, dust, and rock that orbits the Sun is called a Comet

Explanation:

Part 1

The main asteroid belt which is between Mars and Jupiter is the path of the orbit of about 1.9 million asteroids which make up the majority of the known asteroids

Part 2

An asteroids are composed of mainly silicate rocks, and clay for C-type asteroids, nickel-iron, silicate material for the S-type asteroid and nickel-iron, iridium, gold, platinum, palladium, and magnesium for the M-type asteroids

Asteroids are also known to contain olivine and pyroxene minerals, and some asteroids contain water-ice within their interiors

However, a Comet is primarily composed of ice, dust and and rock that orbit the Sun which are as big as a small town in their frozen state.

Therefore, an object made of ice, dust, and rock that orbits the Sun is called a Comet.

Answer:

Its C between Mars and Jupiter

Explanation:

Most asteroids are found in the main asteroid belt located between Mars and Jupiter

is a hollow tube that serves as passageway of air into the luns

Answers

Answer:

The air that we breathe in enters the nose or mouth, flows through the throat (pharynx) and voice box (larynx) and enters the windpipe (trachea). The trachea divides into two hollow tubes called bronchi

Explanation:

what is the most reactive metal in Period 4 of the periodic table?

Answers

Answer:

Potassium

Explanation:

Use the information and table to answer the following question.
A group of students collects data to determine whether compounds were ionic or covalent. They placed each
compound in a small bowl and stuck two open ends of a battery-powered circuit in the compound.
Compound
CO2 (s)
KCI (s)
CaO (s)
SIO2 (s)
Conductive
No
No
No
No
Based on the student's data, can they determine which substances are ionic, and which are
covalent?
A. No, as lonic compounds are only conductive in an aqueous (water) solution.
B. Yes, as all of these compounds are lonic since they are not conductive.
C. No, as covalent compounds are only conductive in an aqueous (water) solution.
C
D. Yes, as all of these compounds are covalent since they are not conductive.

Use the information and table to answer the following question.A group of students collects data to determine

Answers

Answer:

d

Explanation

all are compounds

Yes, as all of these compounds are covalent since they are not conductive. Therefore, the correct option is option D.

What is chemical compound?

A chemical compound is a material made of several similar molecules (as well as molecular entities) joined by chemical bonds and comprising atoms from various chemical elements.

Chemical reactions, which may entail interactions with other molecules, can change a compound into a distinct substance. Atomic bonds may be shattered or new ones created during this process. Yes, as all of these compounds are covalent since they are not conductive.

Therefore, the correct option is option D.

To know more about chemical compound, here:

https://brainly.com/question/26487468

#SPJ5

11. How many elements do all the "P" orbital span (go across) in each period? (circle your answer)
a) 2
b) 6
c) 10
d) 14

Answers

Answer: B

can u pls give me brain list?

atomic radii decrease from left to right in a period (na → ar) on the periodic table. choose the best explanation for this observed trendA) The ionization potential decreases in that direction B) The electron affinity increases in that direction: C) The atomic mass increases in that direction. D) The nuclear charge increases in that direction. E) The number of electrons increases in that direction:'

Answers

The nuclear charge increases in that direction.

Option D is correct.

What periodic pattern does the atomic radius follow, which is a left to right decrease?

Atoms often have a period-long reduction in atomic radius from left to right. There are a few minor deviations, such as the oxygen radius slightly exceeding the nitrogen radius. In a short amount of time, protons are added to the nucleus at the same time that electrons are added to the main energy level.

Why does the atomic radius in a period for Class 11 drop from left to right?

The valence shell size stays constant as we move from left to right, despite the nuclear charge increasing. As a result, the element's atomic size falls from left to right during any time.

To know more about  nuclear charge visit:-

https://brainly.com/question/13664060

#SPJ1

BRAINLIEST!! PLS HELP!!

BRAINLIEST!! PLS HELP!!

Answers

Answer:

b be aosum

Explanation:

Tyson is a deontologist while Aria is a utilitarian. Tyson will emphasize duty _____ while Aria will emphasize duty for the sake of _____.

Answers

Tyson will emphasize duty for the sake of moral obligations, while Aria will emphasize duty for the sake of maximizing overall happiness or utility.

Deontology is an ethical theory that focuses on moral duties and obligations. Tyson, as a deontologist, will prioritize the inherent rightness or wrongness of actions based on principles and rules. He will emphasize duty for the sake of fulfilling moral obligations, regardless of the consequences or outcomes. For Tyson, it is essential to adhere to ethical principles and follow moral duties, even if the results may not lead to the greatest overall happiness or utility.

On the other hand, Aria is a utilitarian, adhering to the ethical theory of utilitarianism. Utilitarianism emphasizes maximizing overall happiness or utility as the basis for ethical decision-making. Aria will prioritize duty for the sake of maximizing the greatest happiness for the greatest number of people. She believes that actions should be evaluated based on their consequences and the overall happiness or utility they generate.

Therefore, Tyson's emphasis on duty lies in fulfilling moral obligations, whereas Aria's emphasis on duty stems from the goal of maximizing overall happiness or utility.

Learn more about Deontology

brainly.com/question/32539655

#SPJ11

what type of heat transfer when you get warm standing infront a fireplace,explain your reasoning​

Answers

Answer:

Radiation refers to the emission of energy in rays or waves. Heat moves through space as energy waves. It is the type of heat one feels when sitting in front of a fireplace.

Explanation:

To determine the molar mass of thevolatile material it is necessary to use theideal gas law to solve for the pressure inthe container.TrueFalse

To determine the molar mass of thevolatile material it is necessary to use theideal gas law to solve

Answers

Answer:

I think true

Explanation:

Please somone help me with a chemistry question brainliest to whoever answers correctly and 20 points

Please somone help me with a chemistry question brainliest to whoever answers correctly and 20 points

Answers

Answer:

3132 is the answer

Explanation:

3BaCl2 + Al2S3 → 3BaS + 2AlCl3

Answer:

Explanation:

Hope this helps u !!

Please somone help me with a chemistry question brainliest to whoever answers correctly and 20 points

Derek needs a tool that delivers 5.00 ml of a sodium hydroxide solution. which tool would be best for him to use? a beaker a pipette a graduated cylinder an erlenmeyer flask

Answers

Because 5.00 mL is a small amount, the best tool he could use is a pipette.

What is a pipette?

Pipette or sometimes spelled as pipet can be used to transport liquid samples. It is made out of glass or plastic and can is usually used to transfer measured volumes of liquid from one container to another.

Before the pipette was invented, scientists used to use straws and they would suck in the samples carefully.

Hence 5.00 mL is a small amount, the best tool he could use is a pipette.

To know more about Pipette follow

https://brainly.com/question/25311014

For the reversable elementary liquid phase reaction A<=>B+C :
1) Express rate of reaction with initial conc and conversion of A along with the constants.
2)Find the equilibrium conversion of this system.
3)In a case where the reaction is carried out in an isothermal PFR, using numerical integration determine the volume required to achieve 90% of q2's answer.
4)In the case of a PFR determine how you can maximise the amount of B obtained.

Answers

1)  The initial concentration of A can be denoted as [A]0, and the conversion of A, denoted as X, is defined as (1 - [A]/[A]0).

2) The equilibrium conversion Xeq can then be calculated as (1 - [A]eq / [A]0).

3) (-rA) = k1 * [A] - k2 * [B] * [C]

By numerically integrating this equation from X = 0 to X = 0.9 * Xeq, the corresponding volume can be determined.

4)  One approach is to ensure that the initial concentration of A is sufficiently high, as a higher concentration of A will favor the forward reaction and result in more B being produced.

1) The rate of the reversible elementary liquid phase reaction can be expressed as follows:

Rate = k1 * [A] - k2 * [B] * [C]

where [A], [B], and [C] are the concentrations of species A, B, and C, respectively, and k1 and k2 are the rate constants for the forward and backward reactions, respectively. The initial concentration of A can be denoted as [A]0, and the conversion of A, denoted as X, is defined as (1 - [A]/[A]0).

2) To find the equilibrium conversion of the system, we set the rate of the forward reaction equal to the rate of the backward reaction, which gives us:

k1 * [A]eq = k2 * [B]eq * [C]eq

By rearranging this equation, we obtain:

[A]eq / [A]0 = k2 / k1 * [B]eq * [C]eq

The equilibrium conversion Xeq can then be calculated as (1 - [A]eq / [A]0).

3) To determine the volume required in an isothermal plug flow reactor (PFR) to achieve 90% of the equilibrium conversion (q2's answer), numerical integration can be used. The volume can be calculated by integrating the equation:

dV/dX = 1 / (-rA)

where dV is the infinitesimal volume element, dX is the infinitesimal conversion element, and (-rA) is the rate of disappearance of A, given by:

(-rA) = k1 * [A] - k2 * [B] * [C]

By numerically integrating this equation from X = 0 to X = 0.9 * Xeq, the corresponding volume can be determined.

4) To maximize the amount of B obtained in a PFR, several strategies can be employed. One approach is to ensure that the initial concentration of A is sufficiently high, as a higher concentration of A will favor the forward reaction and result in more B being produced. Additionally, adjusting the temperature and pressure conditions can influence the equilibrium position and favor the formation of B. Lowering the temperature or increasing the pressure can shift the equilibrium towards B production. Furthermore, by using a catalyst that selectively promotes the forward reaction or inhibits the backward reaction, the production of B can be enhanced. It is important to consider the specific reaction kinetics and thermodynamics to optimize the process conditions for maximizing the production of B.

for such more questions on  concentration

https://brainly.com/question/28564792

#SPJ8

Most thermal conductors are made of which material?

Answers

Answer:

Most are made of copper.

Explanation:

Answer: The answer is metal

Explanation:

I took the test:) np!

Other Questions
I need help with some of this please ASAP!!!! . Write a balanced equation for thecombustion of propane, C3H8When balanced, the equation indicatesthat moles ofO2 are required for each mole of C3Hg8 Which two disciplines should you study if you are considering a career in robotics well how do I get better at maths, am unable to understand no matter how hard I study What impact was affirmative action designed to have?increasing diversity in schools and workplacesestablishing multiple African American collegesrequiring companies to only hire female executivesmandating that universities eliminate all scholarship programs In Worcester v. Georgia, Supreme Court Chief Justice John Marshall ruled that the Cherokee were a sovereign nation not subject to US federal or state laws. state of Georgia had a right to forcibly remove the Cherokee from their land. state of Georgia had authority over the affairs of American Indians within its borders. Cherokee had to be paid by Georgia for the rights to their homeland. (t - 6)2 for t= 11Evaluate the expression for the given value of the variable. ensure that money lent under a line of credit agreement is actually being used to finance seasonal needs. group of answer choices operating-change restrictions annual cleanups compensating balances commitment fees Name the endocrine glands located ontop of the kidneys:___________Adrenalglands_____________________6. Name the two major parts of theorgans in question 5:______________________ which of the following statements are true? group of answer choices a. surveys are qualitative b. focus groups are quantitative c. interviews are qualitative a and b all of the above type 1 alcoholics have a . a. tendency to fight and resist arrest. b. tendency to seek out novel situations. c. tendency to use alcohol to achieve positive feelings. d. tendency to use alcohol to escape negative feelings. In an attempt to better understand why border states in America seem to have differing opinions on immigration, Molly spends a number of months in each state observing trends, attitudes, and behaviors of citizens. What methodology is Molly using Name two small molecules that can diffuse through the membrane. The outlier of the data set is If a data set has only one outlier, which value will always change when the outlier is excluded? 18x - 432 - 18x - 6x +144 Anya graphed the line (y2)=3(x1) on the coordinate grid. In the R program, with what code is the vectoroutoregressive model found? (for daily return) Who were the presidential candidates in 1800? The graph of an absolute value function opens up and has a vertex of (0, -3).The domain of the function isThe range of the function is What happened to remove from a place with low gravity to a place with high gravity