Answer:
d) It incorrectly describes the two processes
Hope it helps you
And please mark it as the brainliest answer
What is the element of lowest atomic number whose electronic configuration has four completely filled p sub shells
The element of lowest atomic number whose electron configuration has 4 completely filled p orbitals is, Xenon, Xe with electron configuration:1s²2s²2p⁶3s²3p⁶4s²3d¹⁰4p⁶5s²4d¹⁰5p⁶.
According to the question, we are required to identify the element with the lowest atomic number whose electronic configuration has four completely filled p sub-shells.
Evidently, the shell with energy level one has no p orbital.
Therefore, the existence of p orbitals in electron configuration begins with shell energy level, n=2.However, we must know that the p-orbital comprises of 3 sub-orbitals namely;p(x) , p(y) and p(z) with two electrons of opposing spin in each sub orbital.
Therefore, the total number of electrons in the p orbital is 6 electrons.In essence, the element in question should have electron configuration;
1s²2s²2p⁶3s²3p⁶4s²3d¹⁰4p⁶5s²4d¹⁰5p⁶.The electron configuration above contains 54 electrons and has atomic number, 54.
In essence, the element of lowest atomic number whose electron configuration has 4 completely filled p orbitals is, Xenon, Xe.
Read more:
https://brainly.com/question/2183111
1 . 6.11 mol SF6 to L at STP
2. 16 mol bromine monochloride to L at STP
3. 30.3 g magnesium oxide to mol
4. 17.4 mol Mn2(Cr2O7)3 to g
5. 1.71 mol Cr2(SO4)3
pls help me
The number of molecules in 1.71 moles of magnesium oxide is 0.56.02310 23 =3.011510 23.
What amount of molecules are there?Avogadro's number (6.022140857 1023) states that all substances have exactly the same number of molecules in a mole.
Determine the substance's molecular weight for one mole in order to calculate the necessary number of molecules. Next, divide the molar mass value by the molecular mass, and multiply the result by the Avogadro constant.
17.4 mol Mn2(Cr2O7)3 to g
6.11 mol SF6 to L at STP
=1L -7.466L⟶
Avogadro calculated that a mole of magnesium oxide comprises 6.023 x 6.11 molecules.
The number of molecules in 1.71 moles of magnesium oxide is 0.56.02310 23 =3.011510 23.
The complete question is Calculate the number of molecules6.11 mol SF6 to L at STP
2. 16 mol bromine monochloride to L at STP
3. 30.3 g magnesium oxide to mol
4. 17.4 mol Mn2(Cr2O7)3 to g
5. 1.71 mol Cr2(SO4)3
To learn more about magnesium oxide refer to:
https://brainly.com/question/1379389
#SPJ1
PLEASE HELP QUICKLY!!!
HI gas is removed from the system
at equilibrium below. How does the
system adjust to reestablish
equilibrium?
51.8 kJ + H₂(g) + 1₂(g) = 2HI(g)
A. The reaction shifts to the right (products) and the concentrations
of I, and H₂ decrease.
B. The reaction shifts to the left (reactants) and the concentrations
of H₂ and I increase.
C. The reaction shifts to the right (products) and the concentrations
of I, and H₂ increase.
D. The reaction shifts to the left (reactants) and the concentration of
HI increases.
Answer:
A. The reaction shifts to the right (products) and the concentrations of I and H₂ decrease.
Explanation:
If gas is removed from the system at equilibrium, the system will try to compensate for the loss by shifting the reaction in a direction that produces more gas molecules. This is known as Le Chatelier's principle, which states that a system at equilibrium will respond to a disturbance by shifting in a way that minimizes the effect of the disturbance.
In this case, since gas is being removed from the system, the reaction will shift to the side that produces more gas molecules. Looking at the balanced equation, we can see that 2HI(g) has a greater number of gas molecules compared to H₂(g) and I₂(g). Therefore, the system will shift to the right (products) to produce more HI(g) and reestablish equilibrium.
6) The density of ammonia gas (NHs) in a 6.0 L container at a pressure of 820 mm Hg and a g/L.
The density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.
To determine the density of ammonia gas (NH3) in a 6.0 L container at a pressure of 820 mm Hg, we need to use the ideal gas law equation, which relates pressure, volume, number of moles, and temperature for a given gas.
The ideal gas law equation is:
PV = nRT
Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.
Since we are given the pressure (820 mm Hg), volume (6.0 L), and assuming standard temperature and pressure (STP), we can use the values for R (0.0821 L·atm/(mol·K)) and convert the pressure to atm by dividing by 760 (1 atm = 760 mm Hg).
820 mm Hg / 760 mm Hg/atm = 1.08 atm
Now we can rearrange the ideal gas law equation to solve for density (d):
d = (P * M) / (RT)
Where M is the molar mass of ammonia (NH3), which is approximately 17.03 g/mol.
Substituting the values, we have:
d = (1.08 atm * 17.03 g/mol) / (0.0821 L·atm/(mol·K) * 298 K)
Simplifying the equation, we find:
d ≈ 0.805 g/L
Therefore, the density of ammonia gas in the 6.0 L container at a pressure of 820 mm Hg is approximately 0.805 g/L.
For more question on density
https://brainly.com/question/26364788
#SPJ8
28 °℃ = __? __K
help.
Answer:
301.15 K
Explanation:
What is true of a Lewis base?
A. A Lewis base donates electron pairs.
B. A Lewis base donates H* ions.
C. A Lewis base donates a salt in solution.
D. A Lewis base donates OH ions.
The statement that is true of a Lewis base is that a Lewis base donates electron pairs (option A).
What is a Lewis base and acid?A Lewis base is any nucleophylic compound that can donate a pair of electrons and form a coordinate covalent bond.
On the other hand, a Lewis acid is any electrophylic compound that can accept a pair of electrons and form a coordinate covalent bond.
This means that a Lewis base can donate a pair of electrons to a Lewis acid to form a product containing a coordinate covalent bond. This product is also referred to as a Lewis adduct.
Therefore, option A is correct about Lewis base
Learn more about Lewis base at: https://brainly.com/question/24076507
#SPJ1
A 3.69 g
sample of a compound consisting of carbon, hydrogen, oxygen, nitrogen, and sulfur was combusted in excess oxygen. This produced 2.08 g
CO2
and 1.28 g
H2O
. A second sample of this compound with a mass of 4.65 g
produced 4.77 g
SO3
. A third sample of this compound with a mass of 8.62 g
produced 3.48 g
HNO3
. Determine the empirical formula of the compound. Enter the correct subscripts on the given chemical formula.
The empirical formula of the compound is C₂H₁₆S₂N₃O.
What is the empirical formula of the compound?The moles of each element is as follows::
For CO₂:
Carbon (C) has a molar mass of 12.01 g/mol.
Oxygen (O) has a molar mass of 16.00 g/mol.
Moles of C in CO₂ = 2.08 g / 12.01 g/mol = 0.173 moles
Moles of O in CO₂ = 2.08 g / 16.00 g/mol = 0.130 moles
For H₂O:
Hydrogen (H) has a molar mass of 1.01 g/mol.
Oxygen (O) has a molar mass of 16.00 g/mol.
Moles of H in H₂O = 1.28 g / 1.01 g/mol = 1.27 moles
Moles of O in H₂O = 1.28 g / 16.00 g/mol = 0.080 moles
For SO₃:
Sulfur (S) has a molar mass of 32.06 g/mol.
Oxygen (O) has a molar mass of 16.00 g/mol.
Moles of S in SO₃ = 4.77 g / 32.06 g/mol = 0.149 moles
Moles of O in SO₃ = 4.77 g / 16.00 g/mol = 0.298 moles
For HNO₃:
Hydrogen (H) has a molar mass of 1.01 g/mol.
Nitrogen (N) has a molar mass of 14.01 g/mol.
Oxygen (O) has a molar mass of 16.00 g/mol.
Moles of H in HNO₃ = 3.48 g / 1.01 g/mol = 3.45 moles
Moles of N in HNO₃ = 3.48 g / 14.01 g/mol = 0.248 moles
Moles of O in HNO₃ = 3.48 g / 16.00 g/mol = 0.217 moles
The simplest whole-number ratio of the elements will be:
Carbon: 0.173 moles / 0.080 moles ≈ 2.16
Hydrogen: 1.27 moles / 0.080 moles ≈ 15.88
Sulfur: 0.149 moles / 0.080 moles ≈ 1.86
Nitrogen: 0.248 moles / 0.080 moles ≈ 3.10
Oxygen: 0.080 moles / 0.080 moles = 1
Therefore, the empirical formula is C₂H₁₆S₂N₃O.
Learn more about empirical formulas at: https://brainly.com/question/1603500
#SPJ1
Help ASAP
Please and thank you
Answer: C
Explanation: Everything else is true.
A student wants to do scientific research to find new ways to detect toxic
substances in water. What field of science would this research mostly
involve?
OA. Biology
O B. Astronomy
O
OD. Physics
C. Chemistry
SUBMIT
the field of science which would mostly research is chemistry.
What are the two most abundant chemicals in air?
Answer:
The most abundant chemical/gas is Nitrogen, which makes up about 78% and Oxygen at second place with approximately 21%
Answer:
Nitrogen and Oxygen because about 70% of air is nitrogen and around 20% of air is Oxygen.
Hope this helps!
nononononononononononon
Answer:
Explanation:
yesyesyesyesyesyesyesyesyes
Part A
How much heat is required to vaporize 28.3 g of water at 100 °C? (AHvap (H₂O) = 40.7 kJ/mol)
Express your answer with the appropriate units.
First, we have to remember the equation to calculate the heat of evaporation:
\(Q_{vap}=\text{ }\Delta H_{vap}*\text{ m}_{sust}\)Q is the heat, ΔH is the vaporization heat of the substance, and m is the mass.
If we have the vaporation heat in terms of moles (as in this case), we have to multiply it by the number of moles instead of the mass. For that purpose, we have to calculate the molecular weight of the water:
\(M.W.\text{ of water = 1*2+16=18 g/mol}\)Then, we can pass the grams to moles:
\(28.3\text{ g *}\frac{1\text{ mol}}{18\text{ g}}=1.5722\text{ moles}\)And we can finally calculate the heat:
\(Q_{vap}=\text{ 40.7 }\frac{kJ}{mol}*1.5722\text{ mol = 63.9894 kJ}\)The answer is that the necessary heat to evaporate the water is 63.9894 kJ approx.
5 measures in keeping the salon clean and in a safe state
Answer:
Measures in Keeping the Salon Clean and Safe1. All beauty salons must be well-lighted and well-ventilated and must be in good sanitary condition.
2. The salon premises must be free from rodents, vermin, flies or other similar insects.
3. All salon establishments must be provided with continuous running hot and cold water.
4. The curtains and floor coverings in the salon must be washable and kept clean.
5. All hair, used cotton or other waste materials must be removed from the floor immediately, and deposited in a closed container. Get rid of them from the salon premises at frequent intervals.
6. The rest rooms must be well-sanitized and be provided with individual towels.
7. Each beautician must wear a washable uniform while working on clients.
The salon is a place meant for the treatment of hair. Measures have to be taken to ensure that it is kept clean and safe at all times.
The measures that have to be taken in keeping the salon clean and safe are:
The floor must be swept clean at all timesEquipment used must be clean and sterilizedHairdressers and beauticians must wash their hands always before attending to peopleProper ventilation must be maintained at all timesAntiseptic should be used on any wounded skinLearn more here: https://brainly.com/question/18718321
Mary claims that two Duluth Solutions will have a lower reaction rate than two concentrated Solutions which statement tells whether Mary is right and gives a correct explanation a she is right because there will be fewer successful collisions between reactants and the dilute Solutions B be she is right because the Duluth solution gives the molecule more space to move more quickly see she is not right because of the dilute solution gives the molecules more room to move around and align themselves well for collisions or D she is not right because there will be fewer successful collisions between reactants in the dilute Solutions.
The correct statement that tells whether Mary is right is: A) She is right because there will be fewer successful collisions between reactants in the dilute solutions.
What is Collision?
Collision refers to the physical interaction between two or more objects, particles, or molecules that come into contact with each other. In the context of chemistry and physics, collision often refers to the interaction between particles during a chemical reaction.
The rate of a chemical reaction is influenced by several factors, including the concentration of reactants. In general, higher concentration of reactants leads to a higher reaction rate, as it increases the frequency of collisions between reactant molecules, which is an essential step in most chemical reactions.
Learn more about Collision from the given link
https://brainly.com/question/7221794
#SPJ1
please help me and dont send me a bitly link its a scam
Answer:
Explanation:
4)6.27x10^20/(6.02x10^23)(u should have this number on your formula sheet)=0.001 mol
5)7.4x6.02x10^23=44.548x10^23atoms
6)molar mass for K is 39.10g/mol
3.27x39.10=127.86g
Im bad at sig figs. Just do it urself(:p
What would the approximate age of an
igneous rock that contains only 1/4 of its
original carbon-14 (half-life of carbon is
5700 years)
Explanation:
Carbon-14 has a half life of 5730 years, meaning that 5730 years after an organism dies, half of its carbon-14 atoms have decayed to nitrogen atoms. Similarly, 11460 years after an organism dies, only one quarter of its original carbon-14 atoms are still around.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A 5.687 g sample of iron reacts with oxygen, forming an iron oxide. The final mass of the iron oxide is 8.131 g. What is the formula of the iron oxide
Answer:
Fe₂O₃
Explanation:
Mass of Iron = 5.687 g
Mass of Iron oxide = 8.131 g
Mass of Oxide = Mass of Iron oxide - Mass of Iron
Mass of oxide = 8.131 - 5.687 = 2.444 g
Moles of Iron = Mass / Molar mass = 5.687 / 55.845 = 0.1018 moles
Moles of Oxide = Mass / Molar mass = 2.444 / 16 = 0.15275 moles
To determine the formular, we have to find the smallest whole number ration that exists between the elements.
To do that, we divide by the smallest number;
Iron = 0.1018 / 0.15275 = 0.6664 = 2/3 (Approximately)
Oxygen = 0.15275 / 0.15275 = 1
To get the smallest whole number ratio, multiply all through by 3.
Iron = 2/3 * 3 = 2
Oxygen = 1 * 3 = 3
The formular will be;
Fe₂O₃
Advantages and disadvantages of using tidal energy instead of non-renewable energy sources.
Advantages of using tidal energy:
-Environment-friendly
-A highly predictable energy source
-High energy density
-Operational and maintenance costs are low
-An inexhaustible source of energy
Disadvantages of using tidal energy:
-High tidal power plant construction costs.
-Negative influence on marine life forms.
-Location limits.
-The variable intensity of sea waves.
An automobile engine has a cylinder with a volume of 500.0 mL that is filled with air (21.00 % oxygen) at a temperature of 55.00 C and a pressure of 101.0 kPa. What is the mass of octane, C8H18 that must be injected to react with all of the oxygen in the cylinder to produce carbon dioxide and water? 2C8H18 + 25O2 -------->. 16CO2 + 18H2O
The mass of octane, C8H18 that must be injected to react with all of the oxygen in the cylinder to produce carbon dioxide and water is 0.14 g.
The balanced equation for the combustion of octane is:2C8H18 + 25O2 → 16CO2 + 18H2OFrom the above balanced chemical equation, we can see that 25 moles of O2 react with 2 moles of C8H18.
So, 12.5 moles of O2 will react with 1 mole of C8H18. We can use the ideal gas law PV = nRT to calculate the moles of oxygen present in the cylinder.
Here, we need to use the partial pressure of oxygen only since we are interested in the moles of oxygen only.
O2 = 21.00% × 101.0 kPa = 21.21 kPaV = 500.0 mL = 500.0/1000 = 0.5000 L (convert mL to L)R = 8.314 J/mol K (gas constant).
We have,PV = nRTn = PV/RTn = (21.21 × 10^3 Pa) × (0.5000 × 10^-3 m^3) / (8.314 J/mol K × 328.15 K) = 0.01578 moles of O2.
Since 12.5 moles of O2 react with 1 mole of C8H18,0.01578 moles of O2 will react with= (0.01578 moles × 1 mole C8H18)/12.5 moles = 0.001262 moles of C8H18
The molar mass of C8H18 is = 8 × 12.01 + 18 × 1.01 = 114.16 g/mol.
So, the mass of C8H18 required is = 0.001262 × 114.16 = 0.1445 g or 0.14 g (approx.)
Therefore, the mass of octane, C8H18 that must be injected to react with all of the oxygen in the cylinder to produce carbon dioxide and water is 0.14 g.
For more questions on octane
https://brainly.com/question/28469125
#SPJ8
If we put 100 particles of heavy species of gas into a container and the pressure is 12
atmospheres, predict the new pressure of putting a total of 300 particles of this gas
into the container.
A - 12 atm
B- 36 atm
C- 24 atm
The new pressure of the particles of heavy species of gas is 36 atm.
The correct option is B
What is the new pressure of the gas?The new pressure of the particles of heavy species of gas is determined using the ideal gas equation as follows:
PV = nRT
where;
P is the pressureV is the volume n is the number of particlesR is the molar gas constantT is the temperature
Assuming the temperature, volume, and molar gas constant all remain unchanged, the new equation will be:
P = n
When n = 100, P = 12 atm
Ratio of n and P = 100/12
When, n = 300, P = 300 * 12/100
Pressure = 36 atm
Learn more about gas pressure at: https://brainly.com/question/24719118
#SPJ1
1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5
1. The IUPAC name of N is nitrogen.
2. Nitrogen dioxide
3.The IUPAC name of O is oxygen
4.The IUPAC name of OH is hydroxyl.
The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.
IUPAC names for the given compounds are:1.1. N: Nitrogen
The IUPAC name of N is nitrogen.
It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide
Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.
The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen
Explanation: The IUPAC name of O is oxygen.
It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.
X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.
Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.
It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.
for more question on electronic configuration
https://brainly.com/question/26084288
#SPJ8
Note: The complete question is given below
Provide the IUPAC names for the following compounds:
\(CH_3CH_2CH(CH_3)CH_2CH_2CH_2CH_3\)
C6H5CH(CH3)2
H2NCH2CH2CH2CH2CH2NH2
CH3CH2CH2CH2CH2OH
CH3CH2CH2CHOHCH3
Given the chemical reaction NaOH + HCl → H2O + NaCl how many milliliters of 0.09980 M NaOH will react with 25.00 mL of 0.1169 M HCl? Express your answer to four significant figures.
Copper metal has a face-centered cubic structure with all atoms at lattice points and a density of 8.93 g/cm^3. The edge length of the unit cell is 361.5 pm. Calculate the mass of 1 atom of copper.
The mass of 1 atom of copper metal in the given face-centered cubic structure is determined as 1.054 x 10⁻²² g.
Mass of 1 atom of copperThe mass of 1 atom of copper is calculated as follows;
mass of 1 atom of copper = molar mass of copper / Avogadro's number
substitute the value of molar mass of copper and Avogadro's number;
mass of 1 atom of copper = (63.5 g/mol) / (6.023 x 10²³)
mass of 1 atom of copper = 1.054 x 10⁻²² g
Thus, the mass of 1 atom of copper is determined as 1.054 x 10⁻²² g.
Learn more about copper metal here: https://brainly.com/question/24856041
#SPJ1
Which of the following molecules contain POLAR COVALENT bonds?
A.) P4
B.) O2
C.) O3
D.) HF
D.) HF of the following molecules contain POLAR COVALENT bonds
Is the bond formed by HF polar?A polar covalent link holds a hydrogen atom and a fluorine atom together in a hydrogen fluoride (HF) molecule.
The molecule that has a polar covalent link in it is c. H-F since fluorine and hydrogen atoms have different electronegativities, which causes the bond to become polarised.
A polar molecule is one that has a little positive charge on one end and a slight negative charge on the other. A polar molecule is a diatomic compound, such as HF, that has a polar covalent link.
learn more about polar covalent link
https://brainly.com/question/30624263
#SPJ1
During a volcanic eruption, lava flowed at a rate of 37 m/min. At this rate how far in kilometers
can lava travel in 45 minutes?
What is mass of 0.6 molC4H10
Answer:
35 gm
Explanation:
What is mass of 0.6 mol C4H10
C4H10 has a molar nass of
(4X12) (10
X 1) = 48 + 10 8
so 1 mole of C4H10 is 58 gm
so 0.6 moles is
(0.6 X58) = 35 gm
Which of the following elements is NOT involved in the cycling of energy and matter on Earth? O Phosphorus O Gold O Nitrogen O Carbon
Gold is not involved in the cycling of energy and matter on Earth.
option B.
What is Biogeochemical cycles?Biogeochemical cycles refer to the pathways by which essential elements such as carbon, nitrogen, and phosphorus move through the Earth's biosphere, atmosphere, geosphere, and hydrosphere. These cycles are crucial for maintaining the balance of elements required for life on Earth, and they involve both biotic and abiotic processes.
The carbon cycle involves the movement of carbon through the atmosphere, the biosphere, and the oceans, with processes such as photosynthesis, respiration, and decomposition contributing to carbon uptake and release. Carbon is also stored in rocks and sediments as fossil fuels.
The other three elements listed - phosphorus, nitrogen, and carbon - are all essential elements involved in biogeochemical cycles on Earth, including the phosphorus cycle, nitrogen cycle, and carbon cycle. Gold, on the other hand, is a relatively inert element and does not play a significant role in the cycling of energy and matter on Earth.
Learn more about cycling of energy here: https://brainly.com/question/29986752
#SPJ1
The mass of a brick is 5 grams. If the brick is smashed into little pieces, the total mass of all the pieces will be
5 grams
o less than 5 grams
O more than 5 grams
What will the mass be if the brick was smashed
Answer:
I am not sure but i think it is 5 grams
Explanation:
because the total mass= 5g
so it is a physical change so no new substance is formed
so the total mass = total mass of all the broken pieces
Chlorofluorocarbons are ?
A. colorless, odorless gases that prevent red blood cells from carrying oxygen to the body
B. man-made chemicals containing chlorine and fluorine that cause
ozone molecules to break down
C. chemicals produced in factories that are used to prevent air
pollution
D. molecules containing chlorine and fluorine that block UV radiation
from reaching the Earth
Chlorofluorocarbons (CFCs) are man-made chemicals containing chlorine and fluorine that cause ozone molecules to break down. Thus, option B is the answer.
Chlorofluorocarbons are non-toxic, synthetic compounds that contain atoms of Chlorine, Fluorine and Carbon. They are commonly used in the manufacture of aerosol sprays and are also used as solvents and refrigerants. CFCs were first introduced in 1928 by General Motors Company for its refrigerators.
While CFCs are very safe to use in most applications and are stable in the lower atmosphere, these chemicals when released to the upper atmosphere can cause significant reactions. CFCs when released into the upper atmosphere can lead to the destruction of the ozone molecules followed by the release of the UV radiation into the atmosphere.
Thus, CFCs are man-made chemicals which cause ozone molecules to break down.
Learn more Chlorofluorocarbons, here:
https://brainly.com/question/1393491