Answer:
n=m/M, so
Explanation:
Molar mass of Na is 22,9... so rounded to 23
n=42g/23g/mol
=1,826mol
If 3.90 g of CuNO3 is dissolved in water to make a 0.840 M solution, what is the volume of the solution in milliliters?
Volume:
The volume of the solution is 24.8 milliliters (mL).
To solve this problem, we can use the formula:
Molarity (M) = moles of solute / liters of solution
We are given the mass of CuNO3 and the molarity of the solution, so we can first calculate the number of moles of CuNO3:
moles of CuNO3 = mass / molar mass
molar mass of CuNO3 = 63.55 + 14.01 + 3(16.00) = 187.56 g/mol (using atomic weights from the periodic table)
moles of CuNO3 = 3.90 g / 187.56 g/mol = 0.0208 mol
Next, we can rearrange the formula for molarity to solve for the volume of the solution:
liters of solution = moles of solute / Molarity
liters of solution = 0.0208 mol / 0.840 M = 0.0248 L
Finally, we can convert liters to milliliters:
volume of solution = 0.0248 L x 1000 mL/L = 24.8 mL
For more question on volume click on
https://brainly.com/question/27100414
#SPJ11
Wine goes bad soon after opening because the ethanol (CH₂CH₂OH) in it reacts with oxygen gas (0₂) from the air to form water (H₂O) and acetic acid
(CH₂COOH), the main ingredient of vinegar.
What mass of oxygen gas is consumed by the reaction of 2.0 g of ethanol?
Be sure your answer has the correct number of significant digits.
The mass of oxygen gas that is consumed by the reaction of 2.0 g of ethanol would be 1.28 grams.
Stoichiometric problemThe reaction of ethanol with oxygen to form water and acetic acid is shown in the balanced equation below:
\(CH_3CH_2OH + O_2 -- > CH_3COOH + H_2O\)
The mole ratio of ethanol to oxygen is 1:1.
The mole equivalence of 2.0 g of ethanol would be:
Mole = mass/molar mass = 2/46.07 = 0.04 mol
Thus, the mole equivalence of oxygen consumed will also be 0.04 mol.
The mass of 0.04 mol oxygen consumed can be calculated as:
Mass = mole x molar mass = 0.04 x 32 = 1.28 grams
In other words, the amount of oxygen consumed would be 1.28 grams.
More on stoichiometric problems can be found here: https://brainly.com/question/14301905
#SPJ1
For monosaccharides to cyclize, an alcohol group must attack a carbonyl group. Which carbon of linear pento-ketose has the reactive carbonyl?
For monosaccharides to cyclize, an alcohol group must attack a carbonyl group, the carbon of linear pento-ketose has the reactive carbonyl is the carbon number 1.
What is a monosaccharide?The monosaccharide is a single unit sugar. Recall that sugars could have cyclic or open chain structures. It is possible for the compound to exists in either the cyclic or the open chain structure.
Now, for monosaccharides to cyclize, an alcohol group must attack a carbonyl group, the carbon of linear pento-ketose has the reactive carbonyl is the carbon number 1.
Learn more about monosaccharides:https://brainly.com/question/13416862
#SPJ1
Can I get some help for these chemistry questions .
1. C6H10O5 + 6O2 → 6CO2 + 5H2O
2. MgO + H2O → Mg(OH)2
3. 151.2444 grams of carbon dioxide are required to produce 3.44 moles of carbonic acid in the blood.
1. The complete, balanced chemical reaction for the burning of cellulose (C6H10O5), or wood, is:
C6H10O5 + 6O2 → 6CO2 + 5H2O
This reaction represents the combustion of cellulose in the presence of oxygen, resulting in the formation of carbon dioxide (CO2) and water (H2O).
2. The balanced equation for the reaction between magnesium oxide (MgO) and water (H2O) to produce magnesium hydroxide (Mg(OH)2) is:
MgO + H2O → Mg(OH)2
According to the equation, 1 mole of magnesium oxide reacts with 1 mole of water to produce 1 mole of magnesium hydroxide. Therefore, if 2.55 moles of magnesium oxide react, the same number of moles of magnesium hydroxide will be produced.
3. The balanced equation for the reaction between carbon dioxide (CO2) and water (H2O) to form carbonic acid (H2CO3) is:
CO2 + H2O → H2CO3
According to the equation, 1 mole of carbon dioxide reacts with 1 mole of water to produce 1 mole of carbonic acid. Therefore, if 3.44 moles of carbonic acid are produced, the same number of moles of carbon dioxide is required.
To calculate the mass of carbon dioxide, we need to know its molar mass, which is approximately 44.01 g/mol. Therefore, the mass of carbon dioxide required to produce 3.44 moles of carbonic acid is:
Mass = Moles × Molar mass
Mass = 3.44 moles × 44.01 g/mol
Mass = 151.2444 g
Therefore, 151.2444 grams of carbon dioxide are required to produce 3.44 moles of carbonic acid in the blood.
For more such qeustions on carbon dioxide visit:
https://brainly.com/question/21256960
#SPJ8
How is steel made from the raw product of the blast furnace known
as "pig iron"? What are the advantages of using steel?
List references used (if any were used) to answer this question.
Steel is produced from pig iron through a process known as steelmaking or iron and steel production.
The pig iron obtained from the blast furnace contains high amounts of carbon, impurities, and other elements. To convert pig iron into steel, the carbon content needs to be reduced to desired levels, and impurities must be removed.One common method of steelmaking is the basic oxygen process (BOP). In this process, pig iron is placed in a vessel called a converter, where oxygen is blown through the molten metal. The oxygen reacts with the carbon and impurities, causing them to oxidize and form gases that are released. Alloying elements and desired additives can be added at this stage to achieve specific steel properties. Another method is the electric arc furnace (EAF), where an electric arc is used to heat and melt the pig iron, allowing impurities to be oxidized and removed.The advantages of using steel are numerous. Steel is strong, durable, and versatile, making it suitable for a wide range of applications. It has high tensile strength, which means it can withstand heavy loads and pressures. Steel is also resistant to corrosion, making it ideal for construction, infrastructure, and transportation projects. It is a recyclable material, contributing to sustainability and reducing environmental impact. Additionally, steel can be fabricated into various shapes and sizes, allowing for customization and flexibility in design.References:
A. Ghosh and A. Chatterjee, Ironmaking and Steelmaking: Theory and Practice, PHI Learning, 2008.
R.H. Tupkary and V.R. Tupkary, An Introduction to Modern Iron Making, Khanna Publishers, 2010.
J.R. Davis, ed., ASM Specialty Handbook: Carbon and Alloy Steels, ASM International, 1995.
for such more questions on production
https://brainly.com/question/25597694
#SPJ8
The East African Rift is a divergent boundary found in the continent of South America.
Group of answer choices
True
False
If the caffeine concentration in a particular brand of soda is 2.99 mg/oz, drinking how many cans of soda would be lethal? Assume 10.0 grams of caffeine is a lethal dose, and they are 12 oz in a can
If the caffeine concentration in a particular brand of soda is 2.99 mg/oz, drinking, The number of cans of soda would be lethal is 258 cans.
What is caffeine ?Caffeine is a stimulant. In the brain, it blocks the effects of a chemical called adenosine, which makes you feel sleepy. we then feel more alert and energetic, which is why many people drink soda, coffee or tea to stay awake. Caffeine may keep you awake even if you don't want it to
Given
1000 mg = 1 g10.0 g= 10 000 mgv = 10 000/3.23 =3095.96 oz
Therefore,
Number of cans = 3095.96 /12 =258 cans
If the caffeine concentration in a particular brand of soda is 2.99 mg/oz, drinking, The number of cans of soda would be lethal is 258 cans.
Learn more about Caffeine here ;
https://brainly.com/question/2677136
#SPJ1
Which factor causes Earth’s seasons?
Answer:
The sun's position near earth
Explanation:
Which type of reaction is represented by this graph?
The given potential energy diagram represents an endothermic reaction. The activation energy of reactants will be lower than that of products in endothermic reactions.
What is an endothermic reaction?There are broadly two types of reactions based on the heat energy involved in the reaction. An endothermic reaction is a reaction, in which heat is absorbed by the reactants to proceed the reaction.
An exothermic reaction, is the one which evolve heat to the surroundings. The enthalpy change of endothermic reactions is positive whereas that of endothermic reactions is negative.
The activation energy for a reaction is the minimum energy to overcome the barrier potential. For an endothermic reaction, the activation energy is reduced for reactants because, they acquire sufficient energy by absorbing heat whereas for products to convert back to reactants, they need more energy.
Therefore, the given diagram with less barrier potential for reactants is representing an endothermic reaction.
To find more on endothermic reactions, refer here:
https://brainly.com/question/23184814
#SPJ5
How many grams of oxygen form when each quantity of reactant completely reacts?
2HgO(s)→2Hg(l)+O2(g)
When 216.59 g of HgO completely reacts, 16.00 g of O2 will be produced.
The oxygen produced
The balanced chemical equation for the reaction:
2HgO(s) → 2Hg(l) + O2(g)
states that 2 moles of HgO will produce 1 mole of O2.
We can use the molar mass of HgO and the mole ratio of HgO to O2 to calculate the mass of O2 produced from a given mass of HgO.
The molar mass of HgO is 216.59 g/mol (200.59 g/mol for Hg + 16.00 g/mol for O).
So, 1 mole of HgO has a mass of 216.59 g.
According to the balanced equation, 2 moles of HgO produce 1 mole of O2.
Therefore, 1 mole of O2 has a mass of 32.00 g.
Using stoichiometry, we can calculate the mass of O2 produced when a certain mass of HgO reacts completely.
For example, if we start with 216.59 g of HgO (1 mole), then the amount of O2 produced will be 0.5 moles (1 mole of O2 for every 2 moles of HgO), which is equivalent to 16.00 g of O2 (0.5 moles of O2 x 32.00 g/mol).
So, when 216.59 g of HgO completely reacts, 16.00 g of O2 will be produced.
Learn more on chemical reaction here https://brainly.com/question/11231920
#SPJ1
10. What is lost in an atom as a result of radioactive decay? What equation relates this loss to
energy produced? (1 pt)
Mass that is number of protons and neutrons is lost in an atom as a result of radioactive decay.
What is an atom?
An atom is defined as the smallest unit of matter which forms an element. Every form of matter whether solid,liquid , gas consists of atoms . Each atom has a nucleus which is composed of protons and neutrons and shells in which the electrons revolve.
The protons are positively charged and neutrons are neutral and hence the nucleus is positively charged. The electrons which revolve around the nucleus are negatively charged and hence the atom as a whole is neutral and stable due to presence of oppositely charged particles.
Learn more about atom,here:
https://brainly.com/question/13981855
#SPJ1
What is a solution?
Two solutes mixed together
A solute and solvent mixed together
A solute or solvent by themselves
Two solvents mixed together
oc
d
Answer:
A solute and a solvent mixed together.
Explanation:
A solution is a solute and a solvent mixed together. An example would be salt water. Salt would be the solute (the thing that's getting dissolved) and water would be the solvent (the thing that does the dissolving)
The half reaction with a more positive standard reduction potential will
The half reaction with a more positive standard reduction potential will proceed spontaneously in a redox reaction
The half reaction with a more positive standard reduction potential will undergo reduction when compared to the half reaction with a more negative standard reduction potential.
Oxidation-reduction reactions, often known as redox reactions, are a set of chemical reactions that involve electron transfer between reactants. In a redox reaction, one reactant is oxidized, losing electrons, while the other reactant is reduced, gaining electrons.
The oxidation half-reaction is the process of losing electrons and increasing the oxidation number, whereas the reduction half-reaction is the process of gaining electrons and decreasing the oxidation number. The total reaction is referred to as the redox reaction.
Half-reaction:Half-reaction refers to the two parts of an oxidation-reduction reaction that happen separately. A half-reaction must always be either an oxidation reaction or a reduction reaction. It also describes the movement of electrons and hydrogen ions in an equation.
Know more about redox reaction here:
https://brainly.com/question/21851295
#SPJ8
4 Al(s) + 3 O2(g) > 2 Al2O3(s)How many grams of Al2O3 can be formed from 32.19 g of Al and 50.22 g of O2?(Hint: You need to determine which one is the limiting reactant).
1) Chemical equation
\(4Al_{(s)}+3O_{2(g)}\rightarrow2Al_2O_{3(s)}\)2) Convert grams to moles
Al: 32.19g
The molar mass of Al is 26.98 g/mol
\(molAl=32.19gAl\cdot\frac{1molAl_{}}{26.98gAl_{}}=_{}1.19molAl_{}\)We have 1.19 mol Al.
O2: 50.22g
The molar mass of O2 is 31.999 g/mol
\(molO_2=50.22gO_2\cdot\frac{1molO_2}{31.999gO_2}=1.57molO_2\)We have 1.57 mol O2.
3) Limiting reactant
How many moles of O2 do we need to use all of the Al?
The molar ratio between O2 and Al is 3 mol O2: 4 mol Al.
\(molO_2=1.19molAl\cdot\frac{3molO_2}{4molAl_{}}_{}=0.8925molO_2\)We need 0.8925 mol O2 and we have 1.57 mol O2. We have enough O2.
O2 is the excess reactant.
How many moles of Al do we need to use all of the O2?
The molar ratio between O2 and Al is 3 mol O2: 4 mol Al.
\(molAl=1.57molO_2\cdot\frac{4molAl_{}}{3molO_2}=2.09molAl_{}\)We need 2.09 mol Al and we have 1.19 mol Al. We do not have enough Al.
Al is the limiting reactant.
4) Moles of Al2O3 produced from 1.19 mol Al.
The molar ratio between Al and Al2O3 is 4 mol Al: 2 mol Al2O3.
\(mol_{}Al_2O_3=1.19molAl\cdot\frac{2molAl_2O_3}{4molAl}_{}=0.595molAl_2O_3\)5) Convert moles to grams
The molar mass of Al2O3 is 101.96 g/mol
\(gAl_2O_3=0.595molAl_2O_3\cdot\frac{101.96gAl_2O_3}{1molAl_2O_3}=60.67gAl_2O_3\)The mass of Al2O3 produced is 60.67 g.
With enough ____________,
_______________, and
__________, the original
sedimentary or igneous rock is
changed to ______________ rock.
Answer: with enough heat, pressure, and time, the original sedimentary or igneous rock is changed to metamorphic rock.
Explanation:
Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?
Speed of light is 3.0x108 m/s. Convert speed of light unit into miles per hour (mi/s). 3.0x108 m/s =
mi/s
Report your answer in the format with correct sig figs:
5x1013
Given:
1 mile = 1.61 km
1 km = 1000 m
Explanation:
1 mile = 1.61 km and 1 km = 1000 m
The speed of light is \(3\times 10^8\ m/s\). We need to convert it into miles per hour.
1 m = (1/1000) km
\(3\times 10^8\ m=\dfrac{3\times 10^8}{1000}\\\\=3\times 10^5\ km\)
1 km = (1/1.61) miles
\(3\times 10^5\ km =\dfrac{3\times 10^5}{1.61}\\\\=1.86\times 10^5\ \text{miles}\)
So, \(v=1.86\times 10^5\ \text{miles/s}\)
Hence, this is the required solution.
A. Molecules in the surroundings transfer kinetic energy when they
collide with molecules in the system.
B. Molecules in the system absorb energy when they move to the
surroundings.
C. Molecules in the system absorb energy when they collide with
molecules from the surroundings.
D. Molecules in the system transfer kinetic energy when they collide
with molecules in the surroundings.
Answer:
D) Molecule in the surrounding transfer kinetic energy when they collide with molecules in the surroundings
THIS QUESTION WAS BIIIGGGGG BRAIN TIME XD
I actually did this question by marking True and False
A and C ACTUALLY are the same statements so they cant be true because there cant be two choices right at the same time, so FALSE
B does not make any sense because in order to transfer or absorb energy one needs to collide with each other, they cant just have the energy by just walking into the situation they need to KIND OF struggle abit.
D seems correct because remember WHEN REACTANTS COLLIDE WITH EACHOTHER THEY GIVE OFF ENERGY TO THE SURROUNDING SO THE PRODUCT ALWAYS HAVE LESS ENERGY THAN SURROUNDING.
This implies here too so D is correct
Which of the following is a property of acids?
Answer:
One of the properties of acids is their ability to donate protons (H+ ions) when dissolved in water
Explanation:
One of the properties of acids is their ability to donate protons (H+ ions) when dissolved in water. This property is referred to as acidity. Acids can also be described by the presence of positively charged hydrogen ions (H+) and a pH value below 7. Other properties of acids include their corrosive nature, sour taste, and ability to react with bases to form salts and water in a process called neutralization.
How many moles of nitrogen gas are produced when 36.0 g of NH4NO3 reacts?
The balanced chemical equation for the decomposition of NH4NO3 is:
NH4NO3(s) → N2(g) + 2H2O(g)
what is the molar mass of NH4NO3 ?
The molar mass of NH4NO3 is 80.04 g/mol, which means that 1 mole of NH4NO3 has a mass of 80.04 g.
To find the number of moles of N2 produced, we first need to determine how many moles of NH4NO3 are present in 36.0 g:
moles of NH4NO3 = mass / molar mass
moles of NH4NO3 = 36.0 g / 80.04 g/mol
moles of NH4NO3 = 0.4498 mol
According to the balanced equation, 1 mole of NH4NO3 produces 1 mole of N2. Therefore, the number of moles of N2 produced is also 0.4498 mol.
The balanced chemical equation for the decomposition of NH4NO3 is:
NH4NO3(s) → N2(g) + 2H2O(g)
To learn more about NH4NO3 follow the given link: https://brainly.com/question/489501
#SPJ1
__________ energy travels through matter in the form of waves.
Answer:
A wave is a form of energy therefore, it travels through matter in the form of packets of energy. Examples of waves include light, heat and sound waves. Matter from where the waves travel is known as a medium such as if waves travel through ocean then water is the medium.
Explanation: hope this helps
Which type of element Is not likely to react chemically with other elements to form a compound?
Answer:noble gases
Explanation:
PLEASE HELP Describe at least two advantages and two disadvantages of using hydropower as a
source of energy.
PLS ONLY ANSWER THE FULL QUESTION ON HERE DO NOT SEND A LINK FOR ME TO CLICK!!!!!!!!!!!!!!!!!!!!!!!!!!
Answer:
Advantage: Hydropower is a fueled by water, so it's a clean fuel source.
Advantage: It is a domestic source of energy in the US.
Disadvantage: Fish populations can be impacted if fish cannot migrate upstream past impoundment dams to spawning grounds or if they cannot migrate downstream to the ocean.
Disadvantage: Hydropower plants can be impacted by drought. When water is not available, the hydropower plants can't produce electricity.
Explanation:
Oil spills are a very serious form of pollution. They severely affect marine biodiversity and coastal ecosystems. The table shows methods that can be used to control oil spills.
A scientist wants to design a solution to control an oil spill. This solution should decrease the impact of the oil spill on the local biodiversity of the ecosystem. The solution should also be quick and effective but have minimal negative effects on the environment. Which of the following solutions would be best for the scientist to choose?
A. allowing natural processes to occur without any human intervention
B. using mechanical methods to collect the oil in one part of the ecosystem
C. using chemical methods to break the oil into smaller droplets
D. using bioremediation to speed up existing, natural oil degradation
Hellpppp!
Answer:
D. using bioremediation to speed up existing, natural oil degradation.
Explanation:
Got an A on this.
Explanation:
The correct answer is option D
7. "Kinetic energy" is defined as energy stored through the basis of chemical structure.
position, and physical configuration.
A. True
B. False
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A 300 milliliter container that is filled with 100 milliliters of oxygen and 200 mL of hydrogen has a total pressure of 750 milliliters of mercury. What is the partial pressure of the oxygen
If the molecular weight of horseradish peroxidase is about 44,000 g/mol, how many moles of enzyme are used per mole of vanillin?
What is when the molecular weight of horseradish peroxidase is about 44,000 g/mol, The number of moles of the enzyme used per mole of vanillin is
ME=289.188moles
What is the number of moles of the enzyme used per mole of vanillin?Generally, the equation for the moles of the enzyme is mathematically given as
\(ME=\frac{molecular weight}{vanilin MW}\)
Therefore
ME=44000/152.15
ME=289.188moles
In conclusion, the number of moles of the enzyme is
ME=289.188moles
Read more about Molarity
https://brainly.com/question/9149034
Which of the following statements correctly describe the trends in ionic size?
a. The spin quantum number has values of +1212 or -1212.
b. The spin quantum number is a property of the electron itself.
the spin quantum number has values+1212 of -1212 describes the trends in ionic size.
spin quantum is denoted by (s) as it represents the electronic configuration of the atom and the ionic size also depends on the electronic configuration of the sub-shells of the atom like l, m, n, s.
ionic size increases as the electronic configuration increases because the electron adds as we move up to a higher atomic number
all the other quantum numbers may vary from atom to atom but the spin quantum number remains either +1212 or -1212. it also describes the orientation of the electrons in an atom and the axis of electrons in an atom.
learn more about quantum number here;
https://brainly.com/question/2292596
#SPJ4
5. Write the two resonance hybrids for the carbocation that would be formed by protonation at C-1 of 2-methyl-1,3-pentadiene. Without doing a calculation, would you expect C-2 or C-4 (the two end carbons of the allylic cation) to have the most positive charge on it
Answer:
Follows are the solution to this question:
Explanation:
Please find the complete solution in the attached file.