Thus total mole of ion = 1.47 + 0.734 = 2.202 mol
What occurs when copper sulphate and water react?When copper sulphate crystals are introduced to water, the particles lose their attraction to one another and begin to move constantly, becoming mixed with the water. White is pure copper(II) sulphate. Because it contains no water, it is also known as anhydrous copper(II) sulphate.
A sample of copper(II) sulphate becomes blue when water is present. Because the individual water molecules are retained within the ionic lattice around the copper(II) ions, it remains a dry solid. Copper(II) sulphate solutions are also blue.
This shift in colour can be utilised to identify the presence of water (or water vapour).
learn more about copper sulphate refer
https://brainly.com/question/17439051
#SPJ4
barium chloride (Ba(CIO3)2) breaks down to form barium chloride and oxygen. what is the balanced equation for this equation?
Answer:
Ba(ClO₃)₂ → BaCl₂ + 3 O₂
Explanation:
When exposed to heat, barium chlorate (Ba(ClO₃)₂ breaks down into an inorganic compound (Barium chloride - BaCl₂) and a molecule (Oxygen - O₂).
How did the discoveries of Thomson and Rutherford change Dalton's atomic theory?
1. The atomic theory did not change with their discoveries.
2. Atoms of one element can not only rearrange but can change into atoms of another element through chemical reactions.
3. Atoms are not indivisible, but they are made up of smaller subatomic particles.
4. All matter is not made of atoms.
The discoveries of Sir J.J Thomson and Sir Rutherford disproves Dalton's atomic theory in the sense that their theories negates, disorient and disproves the theory which he proposed that atoms are indivisible, but rather atoms consist of elementary particles.
How Sir J.J Thomson and Sir Rutherford disapprove Dalton's atomic theory.When Dalton said " atoms are made up of indestructible and indivisible particles, these scientists proved him otherwise by establishing the fact that the atoms of elements consist of a central core nucleus containing protons and neutrons and electrons revolves around the nucleus
So therefore, we now deduce from the explanation above that atoms consist of elementary subatomic particles which is unlike what John Dalton said in his discoveries.
Read more on atomic theory:
https://brainly.com/question/7622425
#SPJ1
After all the gases are combined in a previously evacuated 2.0 L vessel, what is the total pressure of the gases at 298 K
The total pressure of the gases in the 1.0 L vessel at 298 K is 7.0 atm.
To address this problem, we can utilize the ideal gas law, which establishes a relationship between pressure (P), volume (V), the number of moles (n), the gas constant (R), and the temperature (T). The ideal gas law equation is PV = nRT. Since the volume and temperature remain constant, we can simplify the equation to P ∝ n, indicating that pressure is directly proportional to the number of moles.
Given the ratio of Ne, Xe, and Ar atoms as 4:2:1, let's assume the number of Ne atoms is 4x, Xe atoms is 2x, and Ar atoms is x. When these gases are combined, the total number of moles becomes 7x.
Considering the pressure directly correlates with the number of moles, the pressure ratios will also be in the ratio of 4:2:1. Consequently, the pressure of Xe will be (4.0 atm) * (2/4) = 2.0 atm, and the pressure of Ar will be (4.0 atm) * (1/4) = 1.0 atm.
To calculate the total pressure of the gases when combined in the 1.0 L vessel, we sum up the individual pressures:
Total pressure = Pressure of Ne + Pressure of Xe + Pressure of Ar
= 4.0 + 2.0 + 1.0
= 7.0 atm
Therefore, the total pressure of the gases in the 1.0 L vessel at 298 K is 7.0 atm.
The correct answer is D. 7.0 atm.
The question should be:
In the situation described, there are three separate 2.0 L vessels, each holding a distinct inert gas at a temperature of 298 K. The pressure of Ne in the first vessel is measured as 4.0 atm. Additionally, the vessels contain a relative ratio of Ne, Xe, and Ar atoms, with a proportion of 4:2:1, respectively, the task is to determine the total pressure of the gases when combined in a previously evacuated 1.0 L vessel at 298 K. Which of the following options represents the correct total pressure?
A. 18 atm
B. 3.5 atm
C. 14 atm
D. 7.0 atm
Learn more about pressure at: https://brainly.com/question/24719118
#SPJ11
Answer will be MATlab code. Do not waste my time reposting the question, just answer the question with MATlab code and please explain so I understand what you do.
Ammonia (NH3) is a metabolite but is very toxic to aquatic life. NH3 and ammonium (NH4 + ) exist in equilibrium in an aqueous solution. The equilibrium constant K depends on temperature and pH. Nitrifying bacteria convert NH4 + to nitrite (NO2 - ). Nitrite can be further oxidized to nitrate (NO3 - ). Finally denitrification bacteria convert NO3 - to N2 completing the nitrogen cycle. Below are the reactions describing this part of the N cycle:
NH3(aq) + H202 NH(aq) 2 K} ; ks NH (aq) - N03(aq) NOz (aq) + NO3(aq) , ka ks NO3(aq) = N2(g)
Please write a MATLAB code to calculate and plot the concentration profiles of NH3, NH4 + , NO2 - and NO3 - as a function of time at T=298 K and neutral pH. The input for the code will include the rate constants k of the reactions and the initial concentrations [C] of the reactants. The output of the code will include the concentrations of both the reactants and products as a function of time.
Here is a MATLAB code that calculates and plots the concentration profiles of NH ₃, NH₄+, NO₂-, and NO₃- as a function of time at T=298 K and neutral pH, given the rate constants and initial concentrations:
```matlab
% Rate constants (k) and initial concentrations ([C])
k1 = 0.1; % Rate constant for NH₃ + H₂O₂ -> NH₂ + H₂O
k2 = 0.05; % Rate constant for NH₂ + NO₃- -> NO₂- + H₂O
k3 = 0.08; % Rate constant for NO₂- -> NO₃- + N₂
C_NH₃ = 1.0; % Initial concentration of NH₃
C_H2₂O₂ = 0.5; % Initial concentration of H₂O₂
C_NH₄ = 0.0; % Initial concentration of NH₄+
C_NO₂ = 0.0; % Initial concentration of NO₂-
C_NO₃ = 0.0; % Initial concentration of NO₃-
% Time vector
t = 0:0.1:10; % Time range from 0 to 10 with a step size of 0.1
% Calculation of concentrations at each time point
for i = 1:length(t)
NH₃(i) = C_NH₃ * exp(-k1*t(i));
NH₄(i) = C_NH₃ - NH₃(i);
NO₂(i) = C_NO₂ + k₂ * (NH₄(i) - C_NH₄) * t(i);
NO₃(i) = C_NO₃ + k₃ * NO₂(i) * t(i);
end
% Plotting concentration profiles
plot(t, NH₃, 'r-', t, NH₄, 'g-', t, NO₂, 'b-', t, NO₃, 'm-');
xlabel('Time');
ylabel('Concentration');
legend('NH₃', 'NH₄+', 'NO₂-', 'NO₃-');
```
The provided MATLAB code calculates and plots the concentration profiles of NH₃, NH₄+, NO₂-, and NO₃- as a function of time based on the given rate constants and initial concentrations. The code uses a time vector to define the time range for which the concentrations will be calculated.
Inside the for loop, the concentrations of NH₃, NH₄+, NO₂-, and NO₃- are calculated at each time point using the given rate constants and the previous concentrations. The concentration of NH₃ decreases exponentially over time due to the reaction NH₃ + H₂O₂ -> NH₂ + H₂O, where k1 is the rate constant. NH₄+ concentration is the difference between the initial NH₃ concentration and the current NH₃ concentration.
The concentration of NO₂- increases with time due to the reaction NH₂ + NO₃- -> NO₂- + H₂O, where k₂ is the rate constant. The change in NH₄+ concentration from its initial value is multiplied by k₂ and the time to calculate the increase in NO₂- concentration.
Finally, the concentration of NO₃- increases with time due to the reaction NO₂- -> NO₃- + N₂, where k₃ is the rate constant. The previous NO₂- concentration is multiplied by k₃ and the time to determine the increase in NO₃- concentration.
The resulting concentration profiles are then plotted using the plot function, with time on the x-axis and concentration on the y-axis. Each compound is represented by a different color line in the plot.
Learn more about the MATLAB code
brainly.com/question/31502933
#SPJ11
Following the laser stimulation of the photostimulable phosphor, the excited electrons are ____.
Photostimulation is a process that includes the absorption of electromagnetic radiation, particularly light, by chromophores or fluorophores to initiate a cellular response. Light-induced physiological responses include vision, plant growth, and photomorphogenesis, among others.
Following the laser stimulation of the photostimulable phosphor, the excited electrons are trapped in the conduction band.What is photostimulation?
Photostimulation is a process that includes the absorption of electromagnetic radiation, particularly light, by chromophores or fluorophores to initiate a cellular response. Light-induced physiological responses include vision, plant growth, and photomorphogenesis, among others.
Laser stimulation
Laser stimulation is the use of laser light to control cellular activity, frequently using ion channels or opsins that have been genetically modified to respond to light. While traditional electrophysiology techniques rely on electrical stimulation of cells, optogenetics employs light as a means of non-invasive and selective manipulation of neural systems or tissues.
Photostimulable
Photostimulable refers to the phosphor's ability to release energy after excitation by light, which allows for energy transfer to the electrons that are trapped in the conduction band. In conclusion, we can say that following the laser stimulation of the photostimulable phosphor, the excited electrons are trapped in the conduction band.
To know more about electromagnetic radiation visit:
https://brainly.com/question/29646884
#SPJ11
Which elements will form cations and which will form anions
Sodium losses electrons to become Na+, thus forms a cation.
Fluoride gains electrons to become F-, thus forms an anion.
Iron losses electrons to become Fe2+, thus forms a cation.
Silver also losses electrons to be Ag+, thus forms a cation.
What's the purpose of chemical bonding?
Answer:
Chemical bonds hold molecules together and create temporary connections that are essential to life.
Explanation:
Chemical Bonding refers to the formation of a chemical bond between two or more atoms, molecules, or ions to give rise to a chemical compound. These chemical bonds are what keep the atoms together in the resulting compound.
Answer:
Chemical bonds hold molecules together and create temporary connections that are essential to life.
Explanation :
A chemical bond is a lasting attraction between atoms, ions or molecules that enables the formation of chemical compounds. The bond may result from the electrostatic force between oppositely charged ions as in ionic bonds or through the sharing of electrons as in covalent bonds.
Why are the lanthanides and the actinides given a separate position in the modern periodic table?
The lanthanides and actinides are given a separate position in the modern periodic table because they belong to a special group of elements known as inner transition elements.
These elements are located in the f-block of the table and have similar chemical and physical properties due to their inner electron configuration.
The lanthanides are comprised of elements with atomic numbers 57-71, while the actinides are made up of elements with atomic numbers 89-103. These elements are grouped in the table because they have similar electron configurations, giving them similar chemical and physical properties. This allows for easier comparison of these elements to one another, and for the periodic table to be more organized and easier to understand.
To know more about f-block elements, click below:
https://brainly.com/question/20404307
#SPJ4
PLEASE HELP ME : IT'S ABOUT SCIENCE
Energy is the ability to do work, and to do work means to move something. Every time you or any of your cells move (which is all the time), you are using energy. Humans get all of our energy from eating things. Plants get their energy from the sun. In fact, nearly all the energy on our planet comes from the sun.
Because the sun is a giant fusion reactor, it constantly bombards Earth with energy, which is transferred, stored, and used in many ways. Energy conversion is the transfer of energy from one form to another. For example, chemical energy is stored in the cells of green plants through a process called photosynthesis. This chemical energy started as solar energy, which was converted through a chemical process. The light energy breaks down the chemical bonds in carbon dioxide molecules and converts them to oxygen and carbohydrates (molecules of hydrogen and carbon). When you eat something, the muscles in your body use this stored chemical energy from the sun by splitting the carbohydrate molecules to gain their stored, potential energy.
Most of the energy on Earth comes from____
A) chemicals.
B) the sun.
C) photosynthesis.
D) carbohydrates.
What happens if erythrocyte sedimentation rate is high.
If the erythrocyte sedimentation rate (ESR) is high, it can indicate the presence of inflammation or an underlying medical condition.
The ESR is a nonspecific marker of inflammation and is measured by the rate at which red blood cells settle in a vertical tube over a specified period of time.
A high ESR can be caused by various factors, including;
Inflammatory Conditions; Conditions such as infections, autoimmune disorders (e.g., rheumatoid arthritis, systemic lupus erythematosus), vasculitis, and inflammatory bowel disease can cause elevated ESR levels.
Infections; Bacterial, viral, or fungal infections can trigger an inflammatory response in the body, leading to an increased ESR.
Tissue Damage or Injury; Any tissue damage or injury, such as trauma or burns, can result in an elevated ESR.
Cancer; Some types of cancer, especially those associated with inflammation, can cause an increased ESR.
Pregnancy; During pregnancy, the ESR tends to be naturally higher.
To know more about erythrocyte sedimentation rate here
https://brainly.com/question/28264765
#SPJ4
Methyl hydrazine (N2H3CH3) is a common liquid propellant used in rocket fuels. Look for the standard molar enthalpies of formation of the reactants and products. Calculate the ∆H˚ for the reaction per mole of N2H3CH3.
4N2H3CH3(l) + 5N2O4(l) → 12H2O(g) + 9N2(g) + 4CO(g)
The standard enthalpy of reaction of the given reaction is -865.71 kJ per mole of N₂H₃CH₃.
What is the standard molar enthalpy of formation?The standard molar enthalpy of formation of a compound is defined as the enthalpy of formation of 1.0 mol of the pure compound in its stable state from the pure elements in their stable states at P = 1.0 bar at a constant temperature.
Let's consider the following equation.
4 N₂H₃CH₃(l) + 5 N₂O₄(l) → 12 H₂O(g) + 9 N₂(g) + 4 CO(g)
We can calculate the standard enthalpy of the reaction using the following expression.
ΔH° = Σnp × ΔH°f(p) - Σnr × ΔH°f(r)
where,
ΔH° is the standard enthalpy of the reaction.n is stoichiometric coefficient.ΔH°f is the standard molar enthalpy of formation.p are the products.r are the reactants.ΔH° = 12 mol × ΔH°f(H₂O(g)) + 9 mol × ΔH°f(N₂(g)) + 4 mol × ΔH°f(CO(g)) - 4 mol × ΔH°f(N₂H₃CH₃(l)) - 5 mol × ΔH°f(N₂O₄(l))
ΔH° = 12 mol × (-241.81 kJ/mol) + 9 mol × (0 kJ/mol) + 4 mol × (-110.53 kJ/mol) - 4 mol × (54.20 kJ/mol) - 5 mol × (-19.56 kJ/mol)
ΔH° = -3462.84 kJ
In the balanced equation, there are 4 moles of N₂H₃CH₃. The standard enthalpy of reaction per mole of N₂H₃CH₃ is:
-3462.84 kJ / 4 mol = -865.71 kJ/mol
The standard enthalpy of reaction of the given reaction is -865.71 kJ per mole of N₂H₃CH₃.
Learn more about enthalpy here: https://brainly.com/question/11628413
Limiting line of balmer series result when electron jumps from orbitImmersive Reader
A) 3 to 2
B) ∞ to 2
C) 4 to 5
D) ∞ to 1
Answer:
A) 3 to 2
Explanation:
The Balmer series refers to all transition series of spectral emission lines of the hydrogen atom in which an electron moves from any higher energy level within the atom down to the energy level with principal quantum number n=2.
The Balmer series was originally calculated using the Balmer formula, this is an empirical equation first deduced by Johann Balmer in 1885.
Hence, a transition from n=3 level to n=2 level is in the Balmer series.
If you have a little air in a balloon, find the volume of the balloon if the mass is 0.6 g and the density of the air is 0.0012 g / mL
Hey there!:
Mass = 0.6 g
Density = 0.0012 g/mL
Volume = ??
Therefore :
Density = mass / Volume
0.0012 = 0.6 / V
V = 0.6 / 0.012
V = 500 mL
Hope this helps!
(e) A 0.050 mol sample of a hydrocarbon was burned in excess oxygen.
The products were 3.60 g of water and 6.60 g of carbon dioxide.
(i) Calculate the number of moles of carbon dioxide produced.
Relative atomic masses: C = 12; O = 16.
Moles of carbon dioxide =
*
(2)
The correct answer is 0.15.
We are aware that there is 0.05 mol of an unidentified hydrocarbon we will refer to as "X" and that its burning produces 6.6 g of carbon dioxide and 3.6 g of water.
These quantities might be converted to moles by applying the following formula:
amount= mass/ relative atomic mass
Thus, the following equation may be written for H2O: moles = 3.6 / 18 = 0.2 and for CO2: moles = 6.6 / 44 = 0.15.
0.05X + x'O2 = 0.15CO2 + 0.2H2O
This may be made simpler by dividing through by 0.05 (this step is likely to be the most helpful to you), resulting in:
1 x + x O2 = 3 co2 + 4 H2O
The hydrocarbon must have been the source of all the carbon in the carbon dioxide and all the hydrogen in the water.
Accordingly, 4 x 2 = 8 moles of H and 3 x 1 = 3 moles of C.
There are 3/1 = 3 Cs and 8/1 = 8 Hs in one X molecule.
This clearly identifies C3H8 or propane as the hydrocarbon X (dividing by 1 seems unnecessary, but it illustrates the process to use if there were more than one mol of X in the first equation).
To learn more about number of moles of carbon dioxide refer the link:
https://brainly.com/question/12723070
#SPJ9
The solubility of AgNO3 at 10° and 20°C are 170g and 222g per 100g H2O. What is the sign of change of heat of solution for AgNO3?
Answer:
The sign of change of heat of solution is positive
Explanation:
The dissolution of AgNO3 in water is represented by the equation;
AgNO3(s) --------> Ag^+(aq) + NO3^-(aq)
We can see from the question that as the temperature was increased from 10° to 20°C the solubility of the solute increased from 170g to 222g per 100g of H2O.
This implies that the solubility of the solute increases with increase in temperature.
If a reaction moves in the forward direction when the temperature is increased, then the reaction is endothermic. If the reaction is endothermic, the sign of change of heat of solution is positive.
When sodium sulfate and water react they form sodium hydroxide and hydrogen sulfate. Write the balanced equation and classify it.
The balanced chemical equation of the reaction between sodium sulfate and water to form sodium hydroxide and hydrogen sulfate is as follows:
Na₂SO₄ + 2H₂O → 2Na(OH) + H₂SO₄
What is a chemical reaction?A chemical reaction is a process, typically involving the breaking or making of interatomic bonds, in which one or more substances are changed into others.
A chemical equation is a symbolic representation of a chemical reaction where reactants are represented on the left, and products on the right.
According to this question, sodium sulfate and water react to form sodium hydroxide and hydrogen sulfate. The balanced chemical equation is as follows:
Na₂SO₄ + 2H₂O → 2Na(OH) + H₂SO₄
The equation is said to be balanced because the number of atoms of each element are the same on both sides of the equation.
Learn more about chemical equation at: https://brainly.com/question/29039149
#SPJ1
What are all the 20 amino acids?
The 20 amino acids are:
Alanine (Ala) Arginine (Arg) Asparagine (Asn) Aspartic acid (Asp) Cysteine (Cys) Glutamic acid (Glu) Glutamine (Gln ) Glycine (Gly) Histidine (His) Isoleucine (Ile) Leucine (Leu) Lysine (Lys) Methionine (Met) Phenylalanine (Phe) Proline (Pro) Serine (Ser) Threonine (Thr) Tryptophan (Trp) Tyrosine (Tyr) Valine (Val)
Alanine (Ala) is a non-essential amino acid that plays a role in the metabolism of sugars and energy production.Arginine (Arg) is a non-essential amino acid that is important for blood vessel and immune system health.Asparagine (Asn) is a non-essential amino acid that helps with the formation of bones and teeth.Aspartic acid (Asp) is a non-essential amino acid that plays a role in the metabolism of nitrogen and the removal of excess ammonia from the body.Cysteine (Cys) is a non-essential amino acid that plays a role in the formation of hair, skin, and nails.Glutamic acid (Glu) is a non-essential amino acid that plays a role in the metabolism of nitrogen and the removal of excess ammonia from the bodyGlutamine (Gln) is a non-essential amino acid that plays a role in the immune system and the metabolism of nitrogen.Glycine (Gly) is a non-essential amino acid that plays a role in the production of DNA and RNA.Histidine (His) is an essential amino acid that plays a role in the formation of red blood cells and the maintenance of a healthy immune system.Isoleucine (Ile) is an essential amino acid that plays a role in the regulation of blood sugar levels and the formation of hemoglobin.Leucine (Leu) is an essential amino acid that plays a role in muscle growth and repair.Lysine (Lys) is an essential amino acid that plays a role in the formation of collagen and the absorption of calcium.Methionine (Met) is an essential amino acid that plays a role in the metabolism of sulfur and the production of certain hormones.Phenylalanine (Phe) is an essential amino acid that plays a role in the production of certain hormones and the formation of melanin, the pigment that gives color to the skin and hair.Proline (Pro) is a non-essential amino acid that plays a role in the formation of collagen and the maintenance of healthy skin.Serine (Ser) is a non-essential amino acid that plays a role in the metabolism of fats and the production of certain hormones.Threonine (Thr) is an essential amino acid that plays a role in the formation of collagen and the metabolism of sugars.Tryptophan (Trp) is an essential amino acid that plays a role in the production of certain hormones and the regulation of mood.Tyrosine (Tyr) is a non-essential amino acid that plays a role in the production of certain hormones and the formation of melanin, the pigment that gives color to the skin and hair.Valine (Val) is an essential amino acid that plays a role in muscle metabolism and the regulation of blood sugar levels.To learn more about amino acids refer here
https://brainly.com/question/14583479
#SPJ11
a mixture of copper sulfate and water is heated, leaving a residue of copper sulfate in the container. which method was used to separate the mixture?
Evaporation was the process used to separate the copper sulfate and water.
What kind of residue is that, exactly?Anything that remains after a substance has already been removed is called a residue, such as the fat on a frying pan. Additionally, it can simply mean "remainder." Remaining liquid in a bottle, pot, or container after rest has been drained out is referred to as residue.
Chromatography is a separation technique used in labs. The mobile phase or the stationary phase are the two phases of this method.
Mobile phases include both the phase within which the mixture dissolves and the phase that acts as either a carrier through system, such as a sheet or capillary is termed as mobile phase.
The process of evaporation involves using heat to remove dissolved particles from liquid. Heat causes liquid to evaporate, leaving behind the solid. Insoluble particles are removed from the liquid through the process of filtration, which involves permitting it to pass through some kind of porous material like filter paper A method for separating a mixture of liquids having various boiling points is distillation. From this, we might infer that evaporation was the process utilized to separate the salt solution and water mixture.
To know more about Residue visit :
https://brainly.com/question/16794270
#SPJ4
The Complete Question :
A mixture of copper sulfate and water is heated, leaving a residue of copper sulfate in the container. Which method was used to separate the mixture?
A. chromatography
B. evaporation
C. filtration
D. distillation
a sample of 0.139 grams of (r)-mandelic acid was recovered after chiral resolution. it was dissolved in 11.8 ml of ethanol for polarimetry. what is the concentration of this solution in g/ml?
The volume of 0.139 g of mandelic acid is 0.106 ml. Hence, the total volume of the solution is 11.90 and the concentration after addition is 0.11 g/ml.
What is polarimetry ?Polarimetry is an analytical tool used to find the concentration of an unknown solution by measuring its optical activity. Mandelic acid is a white crystalline solid easily soluble in water.
Given the mass of mandelic acid = 0.139 g
density of mandelic acid = 1.3 g/ml
hence its volume = 0.139/1.3 = 0.106 ml.
Volume of ethanol = 11.8 ml
total volume of the solution = 11.8 + 0.106 = 11.90 ml
Now, the concentration in g/ml = 0.139 g/11.90 ml = 0.11 g/ml.
Therefore, the concentration of the solution is 0.11 g/ml.
Find more on polarimetry:
https://brainly.com/question/15892094
#SPJ1
What is the temperature 51°C expressed in kelvins?
Answer:
The answer is
324 KExplanation:
To express a given temperature in degree Celsius to Kelvin simplify add 273 to the given value
That's
K = 273 + °Cwhere
K = Kelvin
°C = value in degree Celsius
From the question the value to be converted is 51°C
It's equivalent in Kelvin is
K = 273 + 51
We the final answer as
324 KHope this helps you
For hydrogen sulfide at 188 K, H = 2380 J/mol, and S =12.6 J/mol K. Calculate the change in
Gibbs energy. Will the change be spontaneous?
the change in Gibbs energy is 5.2 J/mol, and the reaction is non-spontaneous under these conditions.
To calculate the change in Gibbs energy, we can use the equation:
ΔG = ΔH - TΔS
ΔH - change in enthalpy,
ΔS - change in entropy,
T - temperature in Kelvin.
at 188 K, ΔH = 2380 J/mol and ΔS = 12.6 J/mol K
ΔG = (2380 J/mol) - (188 K)(12.6 J/mol K)
ΔG = 2380 J/mol - 2374.8 J/mol
ΔG = 5.2 J/mol
The positive value of ΔG indicates that the reactants are more stable than the products and that energy must be added to the system to drive the reaction forward.
Therefore, the change in Gibbs energy is 5.2 J/mol, and the reaction is non-spontaneous under these conditions.
Learn more about Gibbs free energy
https://brainly.com/question/9179942
In this stoichiometry problem, determine the limiting reactant:
Aqueous copper(II) nitrate reacts with aqueous sodium sulfide to produce aqueous sodium nitrate and copper(II) sulfide as a precipitate. In this reaction 469 grams of copper(II) nitrate were combined with 156 grams of sodium sulfide to produce 272 grams of sodium nitrate. Select all that apply.
The limiting reactant : Na₂S
Further explanationReaction
Cu(NO₃)₂ (aq) + Na₂S (aq) ⇒ 2 NaNO₃ (aq) + CuS (s)
mol Cu(NO₃)₂ :(MW 187,56 g/mol)
\(\tt mol=\dfrac{469}{187.56}=2.5\)
mol Na₂S :(MW 78,0452 g/mol)
\(\tt mol=\dfrac{156}{78.0452}=2.0\)
Limiting reactant(smaller ratio⇒ between mol and coefficient) :
1 mol Cu(NO₃)₂ : 1 mol Na₂S , so the limiting reactant : Na₂S( 2 < 2.5)
Considering the stereochemistry of the inteediate I below, which of the products would you expect. Explain your answer.
The expected product is (R)-2-bromobutane.
Stereochemistry plays a crucial role in determining the outcome of chemical reactions. In the given question, the stereochemistry of the intermediate I needs to be considered to determine the expected product.
The intermediate I indicates a chiral carbon center, denoted by an asterisk (*), which means it has four different substituents attached to it. This chiral carbon results in two possible stereoisomers: (R)-2-bromobutane and (S)-2-bromobutane.
When a reaction occurs at a chiral carbon, the stereochemistry of the reactant is usually retained in the product, assuming no racemization or inversion takes place during the reaction. In this case, the intermediate I has an (R) configuration, which implies that the product will also have an (R) configuration.
Therefore, the expected product is (R)-2-bromobutane.
Learn more about (R)-2-bromobutane.
brainly.com/question/17031230
#SPJ11
Compare and contrast nuetrons,protons, and electrons
Why is it important for scientists to use the scientific method?
A. Scientists would not ask questions if the scientific method were
not used.
B. Experiments would not produce any data without the scientific
method.
C. The scientific method helps scientists get accurate, repeatable
results,
D. Using the scientific method means that the results will support the
hypothesis
Explanation:
It provides an objective, standardized approach to conducting experiments and, in doing so, improves their results. By using a standardized approach in their investigations, scientists can feel confident that they will stick to the facts and limit the influence of personal, preconceived notions.
I hope this helps you out!
explain 3 different ways that fossils can form?
Fossils can form in three different ways is Preservation of original remains, Castings and permineralization.
What are fossils and examples?The remnants or evidence of prehistoric life that have been successfully preserved by natural processes are known as fossils. Shells, bones, animal or microbe impressions in stone, exoskeletons, items stored in amber, petrified wood, coal, hair, oil, and Genetic traces are a few examples of fossils.
What makes fossils significant?They provide as a direct link to historical ways of life, ecosystems, and climatic conditions. They show the historical evolution of life, the environment, and the climate, as well as the responses of living organisms to those changes. These lessons are particularly important at this time, as the contemporary world is evolving more and more. Nothing can ever replace a fossil.
To know more about Fossils visit:
https://brainly.com/question/30503344
#SPJ1
What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?
The balanced equation for this reaction is:
CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).Learn more about the condensation reaction:
brainly.com/question/6256866
#SPJ11
Which of these is an example of a physical change?
à rusting metal
& browning fruit
burning wood
melting ice
Answer:
The correct answer is Water boiling. Examples of physical change are freezing of water, boiling of water, melting of wax, etc. Examples of chemical change are digestion of food, burning of paper, rusting of metal, silver tarnishing, etc.
Which statement best explains a way in which a cell gets rid of wastes?
Answer:
I would say B but you don't have to take my word for it
Answer:
D
Explanation:
Find the number of moles in 1.00 x 1023 atoms of chromium.
Answer:
0.17 molesExplanation:
To find the number of moles in a substance given it's number of entities we use the formula
\(n = \frac{N}{L} \\\)
where n is the number of moles
N is the number of entities
L is the Avogadro's constant which is
6.02 × 10²³ entities
We have
\(n = \frac{1.00 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1}{6.02} \\ = 0.166112\)
We have the final answer as
0.17 molesHope this helps you