NEED HELP FAST
All living and nonliving things are made up of a combination of ______________.
Elements

Liquids

Crystals

Oxygen

Answers

Answer 1

Answer:

elements bruh

Explanation:


Related Questions

You have 0.14 moles of sodium chloride (NaCl). How many grams do you have? ( 1 mole of NaCl = 58 grams NaCl) *


0.14 grams NaCl

3.2 grams NaCl

5.9 grams NaCl

8.12 grams NaCl

Answers

Answer:

Option D is correct = 8.12 grams of NaCl

Explanation:

Given data:

Moles of sodium chloride = 0.14 mol

Mass of sodium chloride = ?

Solution:

Formula:

Number of moles = mass of NaCl / Molar mass of NaCl

Molar mass of NaCl = 58 g/mol

Now we will put the values in formula.

0.14 mol = Mass of NaCl / 58 g/mol

Mass of NaCl = 0.14 mol  ×  58 g/mol

Mass of NaCl = 8.12 g of NaCl

Thus, 0.14 moles of NaCl contain 8.12 g of NaCl.

how many atoms it would take to make up the thickness of a banknote.

Answers

Answer:

Since one banknote has a thickness of about 0.1 millimeters, if all the banknotes produced in a year were stacked up, they would reach a height of approximately 300 kilometers, which is about 80 times the height of Mount Fuji.

Number 12Have some knowledge on how to do this but not much.

Number 12Have some knowledge on how to do this but not much.

Answers

Explanation

12. Given equation:

\(Mg+2HCl\rightarrow H_2+MgCl_2\)

From the Periodic Table; the Molar mass of H = 1.01 g, Mg = 24.31 g, Cl = 35.45 g

Therefore, the molar masses of all substances involved are:

Mg = 24.31 g

2HCl = 2(1.01 + 35.45)g = 2 x 36.46 g = 72.92 g

H₂ = 2 x 1.01 g = 2.02 g

MgCl₂ = 24.31 g + 2(35.45) = 24.31 g + 70.90 g = 95.21 g

TOPIC: Chemical Reactions
Select the two (2) chemical reactions that are balanced.
OC2 H4 (g) + O2 (g)
OC2 H4 (g) + 302 (g)
Mg(s) + HCL(g)
Mg(s) + 2HCL(g)
CO2 (g) + H₂ O(1)
-> 2CO2 (g) + 2H₂O (1)
-> MgCl2(aq) + H2(g)
-> MgCl2(aq) + H2(g)

TOPIC: Chemical ReactionsSelect the two (2) chemical reactions that are balanced.OC2 H4 (g) + O2 (g)OC2

Answers

Answer:

C2H4(g) + 3O2(g) ----> 2CO2 + 2H2O(l)

Mg(s) + 2HCL(l) ----> MgCl2(aq) + H2(g)

What is the movement of air during the day where land and water meet? Cooler sea air moves toward land, where conduction from the land warms it. , . Direction cannot be predicted; it must be observed. . Cooler air over land moves toward the water, where it is warmed by radiation.​

What is the movement of air during the day where land and water meet? Cooler sea air moves toward land,

Answers

I hope I'm not late, but it's "Cooler air over land moves toward the water, where it is warmed by radiation.​"

7. A mixture of oxygen, nitrogen, and hydrogen gases exert a total pressure of 740 torr at 0°C. The partial
pressure of oxygen is 200 torr and the partial pressure of nitrogen is 400 torr. What is the partial pressure
of hydrogen gas in the mixture?
a. 140 torr
b. 200 torr
c. 740 torr
d. 1,340 torr

Answers

The partial pressure of hydrogen gas in the mixture is 140 torr. Option A.

Solution:

So if the total is 740torr Hg then 740 = 400+200+x so solving for x the unknown pressure we get 740-600 = 140torr.

In a gas mixture, the partial pressure of each gas is the product of the total pressure and the mole fraction of that gas. The pressure exerted by a single gas in a mixture is called partial pressure. Assuming you have an ideal gas mixture, you can use the ideal gas law to solve the problem of gases in a mixture. The pressure exerted by a gas in a gas mixture when it alone occupies the entire volume occupied by the mixture. A partial volume of a particular gas in a mixture is the volume of one component of the gas mixture.

Learn more about The partial pressure here:-https://brainly.com/question/14119417

#SPJ1

Please Help me ASAP - Next 90 minutes!! With my Homework Assignment!
100 Points + Brainliest if correct! Both questions please!!!!

Please Help me ASAP - Next 90 minutes!! With my Homework Assignment!100 Points + Brainliest if correct!

Answers

Answer:

see below

Explanation:

1) here we are given that one mole of propane releases 2221kJ of energy.

now use unitary method as ,

to burn 1 mol (44g) propane 2221kJ of energy is required

to burn 1g of propane 2221kJ/44g of energy is required

therefore to burn 25g of propane 2221/44*25kJ of energy is required= 1261.93kJ ≈ 1262 kJ

Hence 1262kJ of energy is required to burn 25g propane.

2) amount of heat absorbed= 25kJ

amount of work done = 12J

change in energy= (25-12)kJ = 13kJ

Hence the value of E is 13kJ .

and we are done!

The System at Equilibrium below is cooled. How does the system adjust to reestablish equilibrium?

The System at Equilibrium below is cooled. How does the system adjust to reestablish equilibrium?

Answers

The correct answer is A. Since the system is cooled, the reaction will try to generate heat to compensate for the loss.

According to Le Chatelier's principle, the system will shift in the direction that opposes the stress. In this case, cooling is the stress and the system will shift in the direction that produces heat.

Therefore, the reaction will shift to the right (products) to generate heat. This will cause the concentration of HI to increase, while the concentrations of H₂ and I₂ decrease, according to the stoichiometry of the reaction. Therefore, the correct answer is A. The reaction shifts to the right (products) and the concentration of HI increases.

To know more about Le Chatelier's principle, visit:

https://brainly.com/question/29009512

#SPJ1

Answer: The reaction shifts to the left (reactants) and the concentrations of H^2 and I^2 increase is correct. (Answer C)

Once the seed turns into a young plant, how will it receive its food?
endosperms
photosynthesis
seed leaves
oxygenation

Answers

Endosperm is the part of the seed which provides nutrients to embryo.

How seed grow in early stages?

Inside the seed there are is an embryo which is the baby plant and the endosperm. When the seed begins to grow, the embryo used the endosperm part as a food source for its growth and development so we can conclude that endosperm is the part of the seed which provides nutrients to embryo.

Learn more about seed here: https://brainly.com/question/1394041

Answer: The seed leaf

Explanation: 100 on quiz

When the temperature of a gas increase at constant volume, the pressure of the gas decreases.True or false?

Answers

The given statement is false.

When the temperature of a gas increases at a constant volume, the particles will have more frequent collisions against the wall of their container which will result in the increase of the pressure.

what size will the kids tongue be? normal or long
The mom has two capital t's
The dad has two lowercase t's
the mom has a long tongue and the dad has a normal tongue
picture is the punnet square

what size will the kids tongue be? normal or long The mom has two capital t'sThe dad has two lowercase

Answers

Long tongue the big t is dominant if it was two little t’s it would have been normal

which is the formula of nitrogen (I) oxide?

Answers

Answer:

Oxides of nitrogen are a mixture of gases that are composed of nitrogen and oxygen. Two of the most toxicologically significant compounds are nitric oxide (NO) and nitrogen dioxide (NO2). Other gases belonging to this group are nitrogen monoxide (or nitrous oxide, N2O), and nitrogen pentoxide (NO5).

Explanation:

The formula of nitro oxide is NO

The equation 2NaNO3 + CaCl2 - 2NaCl + Ca(NO3)2 is balanced. How many atoms
of sodium (Na) are there on either side of the equation?
one
two
four
six

Answers

Answer:3

Explanation:

I took the test

the correct answer is two

The equation 2NaNO3 + CaCl2 - 2NaCl + Ca(NO3)2 is balanced. How many atomsof sodium (Na) are there on

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

How is the rate of a chymotrypsin-catalyzed reaction affected by using more enzyme in the reaction mixture

Answers

The rate of a chymotrypsin-catalyzed reaction will increase by using more

enzyme in the reaction mixture.

The rate of a chemical reaction and the enzyme concentration have a direct

relationship. As concentration increases, the rate of a chemical reaction  

also increases and vice versa.

In this scenario, we were told more enzyme was used in the reaction mixture

which signifies an increase in the concentration and a corresponding

increase in the rate of reaction.

Read more on https://brainly.com/question/12330608

what type of chemical reaction is represented

what type of chemical reaction is represented

Answers

Answer:

1) Oxidation-Reduction (Redox) Reaction

2) Combustion Reaction

3) Decomposition Reaction

4) Synthesis Reaction

5) Single Displacement (Substitution) Reaction

6) Double Displacement (Metathesis) Reaction

7) Acid-Base Neutralization Reaction

8) Precipitation Reaction

Here are the Answer:

1. Oxidation-Reduction (Redox) Reaction

2. Combustion Reaction

3. Decomposition Reaction

4. Synthesis Reaction

5. Single Displacement (Substitution) Reaction

6. Double Displacement (Metathesis) Reaction

7. Acid-Base Neutralization Reaction

8. Precipitation Reaction

Hope this Helped! Don't have a good day, have a GREAT DAY!

What amount of heat (in kJ) is required to convert 13.7 g of an unknown liquid (MM = 83.21 g/mol) at 19.2 °C to a gas at 93.5 °C? (specific heat capacity of liquid = 1.58 J/g・ °C; specific heat capacity of gas = 0.932 J/g・ °C; ∆Hvap = 22.5 kJ/mol; normal boiling point, Tb = 57.3 °C)

Answers

The first amount of heat required to convert 13.7 into 19.9

What is it that gives substances their different properties?

Answers

The physical properties of substances are those properties that can be seen and observed as the chemical properties of substances.

What gives a substance its properties?

Chemical changes occur when bonds are crushed and/or formed between molecules or atoms. This method that one substance with a definite set of properties (such as melting point, color, taste, etc) to rotate into a different substance with different properties.

A physical property is a characteristic of a substance that can be noticed or measured without changing the specification of the substance. Physical properties involved color, density, hardness, and melting and boiling points.

So we can conclude that those properties occur as the result of a chemical reaction and change the constitution of the substance.

Learn more about substance here: https://brainly.com/question/24647756

#SPJ1

Joan wrote a science fiction story where the people only texted each other, and never talked. They still had vocal chords, but they could no
longer make sounds. Their vocal chords were

Answers

Answer:

Vestigial

Explanation:

The retention of genetically determined traits or structures that have partially or completely lost their ancestral purpose in a specific species is known as vestigiality. In most cases, evaluating the vestigality requires comparison with comparable traits in closely related species.

Which of the following is an example of a physical change?
A
sugar and oxygen reacting to produce water and carbon dioxide

B
honey dissolving in tea

C
a raw egg being cooked

D
metal rusting after being left out in the rain

Answers

Answer:B

Explanation:B can be reversed.

Answer:

Explanation:

Physical properties are characteristics of matter not associated with a change in chemical composition. Identity of the molecules do not change. A physical change is a change in state without changing the composition (e.g., melting wax, freezing water, grinding solids into powders).  Examples: density, color, melting and boiling points, evaporation, odor, taste, hardness, conductivity.

B. Honey dissolving in tea would be a physical change. The honey is not changing chemically but physically as it dissolves in the hot tea.

Aqueous hydrochloric acid will react with solid sodium hydroxide to produce aqueous sodium chloride and liquid water . Suppose 16.4 g of hydrochloric acid is mixed with 23. g of sodium hydroxide. Calculate the minimum mass of hydrochloric acid that could be left over by the chemical reaction. Be sure your answer has the correct number of significant digits.

Answers

Aqueous hydrochloric acid will react with solid sodium hydroxide to produce aqueous sodium chloride and liquid water . Suppose 16.4 g of hydrochloric acid is mixed with 23. g of sodium hydroxide.The minimum mass of hydrochloric acid that could be left over by the chemical reaction is 20.5 g.

What is chemical reaction ?

A chemical reaction is defines as a process in which one or more substances, also called reactants, are altered to one or more different substances, known as products.

Given:

HCl = 16.4 g

NaOH = 23 g

Excess of HCl = ?

Balanced chemical reaction is as follows:

HCl  +  NaOH  ⇒   NaCl  +  H₂O              

Molar weight of HCl

= 1 + 35.5

= 36.5 g

Molar weight of NaOH

= 23 + 16+ 1

= 40 g

Calculate the limiting reactant

theoretical yield HCl/NaOH

= 36.5/40

= 0.9125

experimental yield HCl/NaOH

= 31.4/12

= 2.62

Therefore,

The limiting reactant is NaOH because the experimental yield increases.

Calculate the mass of Excess reactant

36.5 g of HCl ⇒ 40 g of NaOH

x ⇒ 12 g of NaOH

x = (12 x 36.5) / 40

x = 438 / 40

x = 10.95 g of HCl                          

Excess HCl

= 31.4 - 10.95

= 20.5 g

Thus, the minimum mass of hydrochloric acid that could be left over by the chemical reaction is 20.5 g.

To learn more about the chemical reaction, follow the link;

https://brainly.com/question/29762834

#SPJ1            

Read the following chemical equation.

Cl2 (g) + K+ Br− → K+ Cl− + Br2 (g)

What most likely happens during this reaction?

Potassium loses an electron.
Potassium gains an electron.
Bromine loses an electron.
Bromine gains an electron.

Answers

Answer:

Bromine loses an electron.

Explanation:

Hello there!

In this case, according to the given chemical reaction, it will be possible for us to realize that as the reaction progresses, we see that the bromine, as it is initially negative, it increases the oxidation state as it loses an electron for which it is oxidized.

Moreover, no change is potassium is evidenced as it remains as the cation in the reaction; therefore, the answer is Bromine loses an electron.

Regards!

Answer:

The above answer is correct

Explanation:

I took the test

Calculate the pH of a 0.002 M acetic acid solution if it is 2.3% ionised at this dilution. Ka = 1.8 x 10-5.

Answers

Refer to this attachment........

Calculate the pH of a 0.002 M acetic acid solution if it is 2.3% ionised at this dilution. Ka = 1.8 x

Using salt (NaCl)
as an
example-how are elements & compounds different?

Answers

Both salt and sugar have radically different properties (both ... known as table salt, is an ionic compound with the chemical formula NaCl, ...

how to convert mass into volume ( mass-volume relation)

Answers

Answer:

V=mass/Density

Explanation:

Since density is measured as grams/mL or grams/cm^3 and we are interested in converting mass to volume, we need to rewrite the equation.
Therefore, in order to convert the gram to mL, you just need to multiply the mass of the substance in grams with its density to get the volume in liters.

Answer:

Volume equals mass divided by density.

and

Mass equals density times volume.

Hope this helps :)

Pls brainliest...

oxygen and sulfur bonding patterns: build each of the indicated molecules below in the simulator and match them to the correct bonding pattern in respect to either oxygen or sulfur. remember if a molecule does not have a name when you build it is not a stable arrangement and you might have to reorder your atoms. for example: h2o - 2 single bonds as you complete the matching below think of the following: how do oxygen and sulfur atoms tend to bond in molecules? what patterns do you see? how many covalent bonds (total) do oxygen atoms or sulfur atoms tend to form? group of answer choices ocl2 [ choose ] no [ choose ] onh [ choose ] co2 (only describe one of the oxygen atoms) [ choose ] bs [ choose ] sis2 (only describe one of the sulfur atoms) [ choose ]

Answers

The compromise for these two elements would be to share valence electrons in order for them to adhere to the octet rule. Nonmetallic elements oxygen and Sulphur fall into this category. Covalent bonds are produced when atoms share electrons.

What is meant by element?Chemical substances that cannot be converted into other chemicals are referred to as elements.Chemical elements are distinguishable from one another by the number of protons in their atoms' nucleus, which is the fundamental particle that makes up a chemical element. A crucial component of a whole. a simple substance that cannot be divided into smaller components or transformed into another substance is referred to as in chemistry. Atoms, which are made up of protons, neutrons, and electrons, are the building blocks of an element. One element has a fixed number of protons in each of its atoms. A basic thing that is difficult to divide into smaller parts is known as an element.

To learn more about element, refer to:

https://brainly.com/question/18096867

#SPJ4

Help me please answer this with solution....A piece of granite weighing 250g is heated in a boiling water to 100°C. When a granite is place in a calorimeter containing 400g water, the temperature of the water increases from 20°C to 28.5°C. What is the specific heat of the granite, assuming all the heat is transferred to the water?​

Answers


heat lost by granite + heat gained by H2O = 0

[mass granite x specific heat granit x (Tfinal-Tinitial)] + [mass H2O x specific heat H2O x (Tfinal-Tinitial)] = 0
Substitute and solve for specific heat granite, the only unknown.

The specific heat capacity of the granite is 0.796 J/gºC

We'll begin by calculating the heat absorbed by the water. This can be obtained as follow:

Mass of water (M) = 400 g

Initial temperature of water (T₁) = 20 °C

Final temperature (T₂) = 28.5 °C

Change in temperature (ΔT) = T₂ – T₁ = 28.5 – 20 = 8.5 °C

Specific heat capacity of water (C) = 4.184 J/gºC

Heat absorbed (Q) =?

Q = MCΔT

Q = 400 × 4.184 × 8.5

Q = 14225.6 J

Thus, the heat absorbed by the water is 14225.6 J

Finally, we shall determine the specific heat capacity of the granite

Heat absorbed = Heat released

Heat absorbed = 14225.6 J

Heat released = –14225.6 J

Mass of granite (M) = 250 g

Initial temperature of granite (T₁) = 100 °C

Final temperature (T₂) = 28.5 °C

Change in temperature (ΔT) = T₂ – T₁ = 28.5 – 100 = –71.5 °C

Specific heat capacity of granite (C) =?

Q = MCΔT

–14225.6 = 250 × C × –71.5

–14225.6 = –17875 × C

Divide both side by –17875

C = –14225.6 / –17875

C = 0.796 J/gºC

Therefore, the specific heat capacity of the granite is 0.796 J/gºC

Learn more: https://brainly.com/question/21218237

Which two particles are found in the nucleus of an atom?
neutrons and electrons
protons and electrons
protons and neutrons
neutrons and atoms

Answers

Answer:

C.) protons and neutrons

Explanation:

Most atoms contain proton(s), neutron(s), and electron(s). Within the nucleus of an atom, there are protons and neutrons. Electrons are located outside of the nucleus.

1. For one atom of lithium -6 I will need_____ atom of lithium -7 for an average atomic mass of 6.944? 2. For one atom of lithium -6 needed _____ Adams of lithium -7 for an average atomic mass of 6.944.

Answers

Answer:

For one atom of lithium -6 I will need_16.85____ atom of lithium -7 for an average atomic mass of 6.944 .

Explanation:

1 ) Let required atom be m .

\(\frac{6\times 1 + 7\times m}{1 + m} = 6.944\)

6 + 7m = 6.944 + 6.944m

7 m - 6.944 m = .944

.056 m = .944

m = 16.85

Here, we are required to find how many atoms of lithium -7 is to combine with 1 atom of lithium -6 for an average atomic mass of 6.944.

For one atom of lithium -6 I will need 16.86 atoms of lithium -7 for an average atomic mass of 6.944.

Let the total number of lithium -6 and lithium -7 required be; x.

Therefore, the number of lithium -7 required is;

(x-1)

Therefore;

{(1/x) × 6 + ((x-1)/x)× 7} = 6.944

Therefore, (6 + 7x - 7)/x = 6.944

And, 7x -1 = 6.944x

0.056x = 1

And, x = 1÷0.056 = 17.86 atoms.

Therefore, the number of lithium -7 atoms needed is;

x - 1 = 17.86 - 1 = 16.85 atoms of lithium -7.

Read more:

https://brainly.com/question/17453319

What is the molar concentration of Pb+ in a solution that contains 6.73 ppm of
Pb(NO3)2?
Answer with correct number of S.F.
(Hint: the unit of your answer is mol/L = M)
Answer:

Answers

Answer:

2.03 × 10⁻⁵ M

Explanation:

Step 1: Given data

Concentration of Pb(NO₃)₂: 6.73 ppm = 6.73 mg/L

Step 2: Convert 6.73 mg/L to mol/L

The molar mass of 331.2 g/mol.

6.73 × 10⁻³ g/L × 1 mol/331.2 g = 2.03 × 10⁻⁵ mol/L = 2.03 × 10⁻⁵ M

Step 3: Calculate the molar concentration of Pb²⁺

Let's consider the ionization of Pb(NO₃)₂.

Pb(NO₃)₂(aq) ⇒ Pb²⁺(aq) + 2 NO₃⁻(aq)

The molar ratio of Pb(NO₃)₂ to Pb²⁺ is 1:1. The molar concentration of Pb²⁺ is 1/1 × 2.03 × 10⁻⁵ M = 2.03 × 10⁻⁵ M.

Other Questions
a juice drink filling machine, when in perfect adjustment, fills the bottles with 14 ounces of drink on an average. a random sample of 41 bottles is selected, and the contents are measured. the sample yielded a mean content of 13.89 ounces with as a standard deviation of 0.3485 ounces. What is transitive closure of relation? Which might be a logical first step in researching a story's historical and cultural context?. Read a blography of the author.B. Read a summary so that you would know when and where the story is set.C. Read a work of literary criticism about the author,D.Read a work of literary criticism about the story. Escoge la respuesta correcta. Qu es el cuy? a type of seafood a guinea pig a vegetarian dish in Ecuador a type of turtle Plzz send format which is coming for creative writing in english class 10 8. Read this passage from "Keeping America's Women Moving forward."Read MeThis passage contains both reasons and evidence for the daim Support for women is support for our economy as a whole." Which of the following qualifies as a piece of factual evidence for thatclaim?Women still face barriers to participation in the workplace and marketplaceDomestic violence costs our nation $8 billion annually in lost productivity and healthcare expensesWomen entrepreneurs have a harder time accessing the capital they need to start and sustain their businesses.Women still make just 77 cents for every dollar men makeSUS8 of 16 NEXT The Area of a rectangle is 486.2 m2, and the base is 21m, find the height to the nearest hundredth. maurice works in an industry where above-normal profits are being earned. which situation would cause above-normal profits to continue to be earned by firms in the industry What aspect of the United States best completes the table?A. More importance placed on social classB. Less constrained by religionC. More respectful of backgroundD. Higher value on liberty Find integral from 0 to 2/3 of sqrt4-9x^2? Simplify,Remove all perfect squares from inside the square root.V108 Five balls, A, B, C, D, and E, weigh 30g, 50g, 50g, 50g, and 80g each. Which ball weighs 30g? A standard normal distribution has a mean of _____ and a standard deviation of _____. a. 1 and 1b. 0 and 1c. 1 and 0d. 0 and 0 _____ refers to an employees work performance judged by predicting how well future, usually distinct, tasks will be accomplished. if c = 3k + 4 and d = 7 + 9k^2, what is d in terms of c? a) c^2 + 8c + 23 b) c^2 - 8c + 23c) 9c^2 - 108c +144d) 9c^2 - 108c + 148e) 9c^2 + 108c + 148 item20 item 20 efficiency is , while effectiveness is . multiple choice using resources wisely; leading by example The ratio of lime juice to orange juice in a drink is 3:8. How much orange juice is used in 50 L of the mixture? Round to one decimal place. ncreasing the tidal volume while keeping everything else constant increases the inspiratory capacity alveolar co2 tension (pco2) functional residual capacity (frc) alveolar ventilation dead space ventilation Human milk provides of calories from protein. Multiple Choice 10% to 15% less than 10% 15% to 25% more than 25 Read the following description:She had the face of an arrogant headmistress who waslong past her prime, yet she hadn't bothered to find out.Something in the severe lines of her face suggested shehad long since been defeated by time but was still fightingpointlessly against it.What are two literary themes that can be identified in this description?A. The indignity of vanity and the futility of the pursuit of beautyB. The cruelty of time and the importance of integrityC. The uselessness of youth and the value of kindnessD. The inevitability of aging and the dignity of self-worth