PART 1Select Introduction, and for the following unbalanced reactions found in the sim provide the missing coefficients.CoefficientReactant1CoefficientReactant2CoefficientProduct1CoefficientProduct2N2+H2HONH3H2O2COz

PART 1Select Introduction, And For The Following Unbalanced Reactions Found In The Sim Provide The Missing

Answers

Answer 1

They give us the reactions with their respective products and reactants. To balance a reaction we must bear in mind that matter is neither created nor destroyed, it only transforms. So the mass that we have in the reactants must be the same in the products. We verify this by counting the atoms of each element on each side of the reaction.

In the first reaction we have nitrogen and hydrogen. We have 2 nitrogens and 2 hydrogens in the reactants. We start off-balanced in nitrogen, so we place coefficient 2 in the NH3 molecule to get 2NH3. Now that we have 2 nitrogens and 6 hydrogens in the products, we must balance the hydrogen in the reactants. For that, we place the coefficient 3 in the H2 in such a way that there will be 6 hydrogen atoms in the reactants. The equation is balanced and will be:

\(N_2+3H_2\rightarrow2NH_3\)

We do this same procedure for the other two equations. We count the atoms, we put the coefficients so that the number of atoms is conserved and we count again until the number of atoms of each element is the same on each side of the reaction. For the other two reactions we have:

\(2H_2O\rightarrow2H_2+O_2\)\(CH_4+2O_2\rightarrow CO_2+2H_2O\)


Related Questions

Predict and explain the structure of the major and minor products when hydrogen bromide is added to 2-methylbut-2- ene, (Ch3)2CCHCH3

Pls help with homework!!!!

Answers

When hydrogen bromide is added to 2-methylbut-2-ene, two products are expected to be produced: 2-bromo-2-methylbutane (major product) and 3-bromo-2-methylbutane (minor product).

The addition of HBr to 2-methylbut-2-ene follows the Markovnikov addition rule. This means that the hydrogen atom and the bromine atom will add to the carbon atoms in the double bond, such that the hydrogen atom adds to the carbon with the greater number of hydrogen atoms, and the bromine atom adds to the carbon with the lesser number of hydrogen atoms.

In this case, the hydrogen atom will attach to the second carbon atom, which has three hydrogen atoms, while the bromine atom will attach to the third carbon atom, which has only one hydrogen atom. This produces the major product, 2-bromo-2-methylbutane.

The formation of the minor product, 3-bromo-2-methylbutane, occurs due to the rearrangement of the carbocation intermediate formed during the addition reaction. The carbocation can rearrange either by shifting a methyl group from the second to the third carbon, or by shifting a hydrogen atom from the third to the second carbon. This rearrangement produces the minor product, 3-bromo-2-methylbutane.

In conclusion, the addition of HBr to 2-methylbut-2-ene produces two products: 2-bromo-2-methylbutane (major product) and 3-bromo-2-methylbutane (minor product). The major product forms due to Markovnikov addition rule, while the minor product forms due to carbocation rearrangement.

for more such questions on products

https://brainly.com/question/16859279

#SPJ8

What would be the mass of 4.640 x 10²1
particles of Aluminum (Al)?

Answers

The mass of 4.640 x \(10^{2}\) L particles of Aluminium is 33.67 g

The total number of molecules present in 22.4 litres of an element is equal to Avagadro's Number.

The value of Avagadro's number = \(6.023*10^{23}\).

To calculate the mass of \(4.640*10^{2}\) litres of Al, we first need to find the number of molecules present in it, then find the product of the number of molecules present will the mass of one molecule of Al atom.

Mass of Al=27

Number of molecules in 22.4 litres of Al = \(6.023*10^{23}\)

Number of molecules in 1 litre of Al =  \(\frac{6.023*10^{23}}{22.4}\)

Number of molecules in \(4.640*10^{2}\) litres of Al=  \(\frac{{6.023*10^{23}*4.640*10^{2}}}{22.4}\)

=\(1.247*10^{21}\)

Mass of \(1.247*10^{21}\) molecules of Al:

= \(1.247*10^{21}*27\) g

=33.669 g

=33.67 g

Read more about atomic mass from:

https://brainly.com/question/17067547

Polyethylene is 86.0% C and 14.0%
H. Determine the empirical formula of the compound.
Percent to Mass: How many grams of C/and Hare present in 100.0 g?

Answers

The empirical formula of polyethylene can be determined by converting the given percentages of carbon (C) and hydrogen (H) into grams. To find the grams of each element, we assume a 100.0 g sample of polyethylene.

For carbon:

Mass of carbon = 86.0% × 100.0 g = 86.0 g

For hydrogen:

Mass of hydrogen = 14.0% × 100.0 g = 14.0 g

Therefore, in a 100.0 g sample of polyethylene, there are 86.0 grams of carbon and 14.0 grams of hydrogen.

The empirical formula of a compound represents the simplest whole-number ratio of atoms present in the compound. To determine the empirical formula, we need to find the ratio of carbon to hydrogen in terms of moles.

First, we convert the masses of carbon and hydrogen into moles using their respective molar masses. The molar mass of carbon is approximately 12.01 g/mol, and the molar mass of hydrogen is approximately 1.008 g/mol.

Number of moles of carbon = 86.0 g / 12.01 g/mol ≈ 7.162 mol

Number of moles of hydrogen = 14.0 g / 1.008 g/mol ≈ 13.89 mol

Next, we divide the number of moles of each element by the smallest number of moles to get a simplified ratio.

Carbon: Hydrogen ≈ 7.162 mol : 13.89 mol ≈ 1 : 1.939

Since we want to express the ratio in whole numbers, we multiply both sides by 2 to get a whole number ratio.

Carbon: Hydrogen ≈ 2 : 3.878

Rounding to the nearest whole number, we find that the empirical formula of polyethylene is CH₂.

for such more questions on hydrogen

https://brainly.com/question/24433860

#SPJ8

. A gas has a solubility of 0.028 g/L at a pressure of 3.5 atm. At what pressure would its solubility be at 0.2 g/L?

Answers

Answer:

To find the pressure at which the solubility of the gas would be 0.2 g/L, we can use the concept of Henry's Law. Henry's Law states that the solubility of a gas in a liquid is directly proportional to the pressure of the gas above the liquid.

The equation for Henry's Law is:

S = k * P

Where:

S is the solubility of the gas in the liquid (in g/L)

k is the Henry's Law constant (which depends on the specific gas and liquid)

P is the partial pressure of the gas above the liquid (in atm)

We can set up a proportion to find the unknown pressure (P2) when the solubility (S2) is 0.2 g/L:

S1 / P1 = S2 / P2

Substituting the given values:

0.028 g/L / 3.5 atm = 0.2 g/L / P2

Now we can solve for P2:

P2 = (0.2 g/L * 3.5 atm) / 0.028 g/L

P2 = 24.5 atm

Therefore, at a pressure of 24.5 atm, the solubility of the gas would be 0.2 g/L.

Two asteroids are 75,000 m apart one has a mass of 8 x 10^7 N what is the mass of the other asteroid

Answers

The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / \(r^{2}\)

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x \(10^{11}\) kg

B. 8.3 x \(10^{12}\) kg

C. 1.2 x \(10^{12}\) kg

D. 1.2 x \(10^{10}\) kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

In the winter, a heated home in the Northeast might be maintained at a temperature of 67 °F. What is this
temperature on the Celsius and Kelvin scales?
(Round your answer to the nearest whole number.)
°C
K

Answers

Celsius: 19.4 degrees
Kelvin: 292.59

How many mL of a 0.75 N KOH solution
should be added to a 500 mL flask to make
500 mL of a 0.300 M KOH solution?

Answers

The amount of volume of KOH solution that should be added to make 500mL of a 0.300M solution is 200mL.

How to calculate volume?

The volume of a solution given the concentration can be calculated using the following expression;

CaVa = CbVb

Where;

Ca = initial concentrationVa = initial volumeCb = final concentrationVb = final volume

According to this question, we are to calculate how many mL of a 0.75 M OH solution that should be added to a 500 mL flask to make 500 mL of a 0.300 M KOH solution.

0.75 × Va = 500 × 0.3

0.75Va = 150

Va = 150/0.75

Va = 200mL

Learn more about volume at: https://brainly.com/question/14710169

#SPJ1

Tellurium is a period 5 chalcogen. Selenium is a period 4 chalcogen. If the only factor affecting ionization energies was the nuclear charge, then electrons would be easier to remove (ionize) from Se than Te. Experimentally the opposite is true. It takes 941.0 kJ/mol of energy to ionize the outermost electron from Se while it only takes 869.3 kJ/mol to ionize from Te. A good model should account for this. Quantum mechanical calculations do predict this but require access to sophisticated software, large amounts of computing power and technical expertise. Slater suggested that some simple empirical rules that take into account electron electron repulsion (or shielding) could give a good estimate of the effective nuclear charge (Zeff). The Zeff for the outermost electron in Te is . The Zeff for the outermost electrons in Se is . According to Slater's calculation of effective nuclear charge (does or does not) predict the correct ordering of ionization energies for Se and Te. A better means of rationalizing ionization energies is to include the atomic as follows: [Z subscript e f f end subscript over r squared] . For Te, r = 136 pm and for Se r = 117 pm. This new model (does or does not) predict the correct ordering of first ionization energies for Se and Te.

Answers

Answer:

yes

Explanation: took quiz

Given the reaction at equilibrium:
2NO2(g) → N204(g) Heat of
reaction is -55.3 kJ) What type of
reaction is this?
O Endothermic
O Exothermic

Answers

When the equilibrium constant is higher than one, it indicates that the reaction prefers to produce products, whereas if the equilibrium constant is less than one, it indicates that the reaction prefers to produce reactants. If the equilibrium constant is equal to one, the reaction proceeds in both directions equally.

In a chemical reaction, exothermic reactions are defined as reactions that release heat into their environment. It implies that heat is given off when reactants are converted to products. At equilibrium, an exothermic reaction continues to be exothermic, meaning that heat is given off even after the reaction reaches a state of equilibrium.There are two types of reactions: exothermic and endothermic.

A reaction is classified as exothermic if it releases heat, and endothermic if it absorbs heat. The direction of the reaction is determined by whether it is exothermic or endothermic. At equilibrium, the reaction is no longer moving forwards or backwards. It's also worth noting that reactions can be exothermic in one direction and endothermic in the other.

The equilibrium constant (K) is defined as the ratio of the concentration of products to the concentration of reactants in the chemical reaction equation. It is used to express how much of the products is generated by the reaction in comparison to the reactants.  the equilibrium constant aids in the identification of the direction in which the reaction will proceed at equilibrium.

for more questions on equilibrium

https://brainly.com/question/3159758

#SPJ8

WILL GIVE BRAINLIEST!!! :)
What products are formed during the electrolysis of a concentrated aqueous solution of CrI3?

Answers

hydrogen ions H +(aq) (from the water) are discharged at the negative electrode as hydrogen gas, H 2(g)

What does the atomic number represent?
number of protons in an atom
O total number of protons, neutrons, and electrons in an atom
number of electrons in an atom
mass of an atom

Answers

The atomic number represent the number of protons in an atom

What is atomic number?

We know already from particulate nature of atom that an atom is made up three sub-particles. These are:

Proton which is positive and found in the nucleus of the atom.Neutron which is neutral and found in the nucleus of the atom.Electron which is negative and revolves around the nucleus.

Each atom has atomic number and mass number.

The atomic number of an atom is simply defined as the number of protons in an atom.

The mass number is the sum of the proton and neutron number.

From the above information, we can see that the atomic number is the number of protons,

Learn more about atomic number:

https://brainly.com/question/14190064

#SPJ1

Which of the following samples of gas would have a new volume of 3.00 liters if the pressure is decreased from 3.00 atm to 1.00 atm at constant temperature?

Answers

The group of choices associated with the questions is as follows:

A) 1.00 L He

B) 5.00 L CO2

C) 9.00 L H2S

D) more than one correct response

E) no correct response

Answer:

The correct answer is - A) 1.00 L He

Explanation:

According to the Boyles law, the pressure of the gas is inversely proportional to the volume of the gas at a constant temperature which means if the pressure increases then the volume will decrease and vice versa.

The equation of Boyle's law :

P1V1=P2V2

and V1 = P2V2/P1

Placing the value

V1 = 3*1/3

V1 = 1 L

thus, there is only one option has one liter that is A) 1.00 L He

leucine is an amino acid with the formula c6h13no2 c 6 h 13 no 2 . determine the number of moles of carbon in 57.77 g 57.77 g of leucine.

Answers

There are 3 moles of carbon in 57.77 g of leucine.

Define molar mass

Molar mass is the mass of one mole of a substance, typically expressed in units of grams per mole (g/mol).

To determine the number of moles of carbon in 57.77 g of leucine, we first need to find the molar mass of leucine.

The molar mass of leucine can be calculated by adding the atomic masses of all the elements in its chemical formula (C6H13NO2):

(6 x 12.01 g/mol) + (13 x 1.01 g/mol) + (1 x 14.01 g/mol) + (2 x 16.00 g/mol) = 131.18 g/mol Next, we can use the molar mass of leucine to convert the given mass of 57.77 g into moles:

57.77 g / 131.18 g/mol = 0.4408 mol

Finally, to determine the number of moles of carbon in 57.77 g of leucine, we can use the ratio of the number of carbon atoms to the total number of atoms in one molecule of leucine:

(6 carbon atoms / 1 molecule) x (0.4408 mol) = 2.645 moles of carbon

Therefore, there are 3 moles of carbon atoms in 57.77 g of leucine.

Learn more about leucine here:

https://brainly.com/question/23664518

#SPJ1

When 0.384 g of sodium metal is added to an excess of hydrochloric acid, 3990 J of heat are produced. What is the enthalpy of the reaction as written?

Answers

The enthalpy of the reaction when 0.384 g of sodium metal is added to an excess of hydrochloric acid and 3990 J of heat is produced is 266 KJ.

The balanced chemical equation of reaction is -

2 Na(s) + 2 HCl(aq)  ⟶  2 NaCl(aq) + H₂(g)

We know that,

weight of sodium metal is 0.384 g

Molar mass of Na is 23 g/mol

we will calculate the number of moles,

Number of moles = Given mass

                                 Molar mass

Moles of Na =  0.348 g   = 0.015 mol

                        23 g/mol

We will calculate the energy in 1 mole of sodium metal

In 0.015 moles of sodium metal, 3990 J of energy is produced.

so, in 1 mole of sodium metal, 3990 J of energy is produced

                                                  0.015

In 1 mole, 266000 J of energy is produced.

1 J = 0.001 KJ

266000 J = 266 KJ

The enthalpy of the reaction will be 266 KJ.

To learn more about enthalpy,

brainly.com/question/13648876

#SPJ1

What is the main advantage of using the Kelvin temperature scale when discussing the properties and laws of gases

Answers

The main advantage of the Kelvin scale is that all the temperatures on this scale are positive

The Kelvin scale is a temperature scale that has no negative values.

kelvin scale is a scale of temperature. It was Lord William Thomson Kelvin who discovered Kelvin's scale of temperature.

The melting point of ice on the Kelvin scale is 273 K.

The boiling point of water on the Kelvin scale is 373 K.

The SI unit for measuring temperature is Kelvin which is denoted by the symbol ‘K’.

To learn more about the  Kelvin temperature scale on:

https://brainly.com/question/13290721.

HELP DUE TOMORROWWWW ILL GIVE BRAINLIEST

HELP DUE TOMORROWWWW ILL GIVE BRAINLIEST

Answers

Answer:

Thermal energy refers to the energy contained within a system that is responsible for its temperature. Heat is the flow of thermal energy. A whole branch of physics, thermodynamics, deals with how heat is transferred between different systems and how work is done in the process (see the 1ˢᵗ law of thermodynamics).

 Thermodynamics, and many other related fields, phase transitions are the physical processes of transition between a state of a medium, identified by some parameters, and another one, with different values of the parameters.

1 x 3 2 9. Find the value of x if-1 -1 2 | 04-21 10. Sobre the linear system using Cramer's rule = 16​

Answers

The value of x is 1.

To solve the linear system using Cramer's rule, we need to find the value of x in the equation 1x + 3(2) + 9 = 16.

Simplifying the equation, we have:

x + 6 + 9 = 16

x + 15 = 16

x = 16 - 15

x = 1

Therefore, the value of x is 1.

Cramer's rule is a method used to solve systems of linear equations by using determinants. In this case, we have a single equation with one variable, so the determinant involved is a 1x1 matrix. The determinant of a 1x1 matrix is simply the value of the element.

The determinant of the coefficient matrix in this equation is 1. The determinant of the entire system is the determinant of the coefficient matrix divided by the determinant of the matrix formed by replacing the column of the variable with the constants.

Since the determinant of a 1x1 matrix is the value of the element, we have:

determinant of the entire system = determinant of the coefficient matrix / determinant of the constant matrix

= 1 / 1

= 1

Therefore, the determinant of the entire system is 1.

Using Cramer's rule, we can solve for the value of x by dividing the determinant of the matrix formed by replacing the column of the variable with the constants by the determinant of the coefficient matrix. In this case, both determinants are 1. Thus, The value of x is 1.

For more such questions on value

https://brainly.com/question/30371221

#SPJ8

What is the voltage this voltmeter is measuring? Be sure your answer has a reasonable number of decimal place

What is the voltage this voltmeter is measuring? Be sure your answer has a reasonable number of decimal

Answers

Hi! I would say the voltage can be measured at 0.083 volts

How many moles of Sulfur are in 7.0x1021 atoms?

Answers

Answer:

0.012 mol

Explanation:

Step 1: Given data

Atoms of sulfur: 7.0 × 10²¹ atoms

Step 2: Calculate the moles corresponding to 7.0 × 10²¹ atoms of sulfur

In order to convert atoms to moles, we need a conversion factor. In this case, we will use Avogadro's number: there are 6.02 × 10²³ atoms of sulfur in 1 mole of atoms of sulfur.

7.0 × 10²¹ atoms S × 1 mol S/6.02 × 10²³ atoms S = 0.012 mol S

A light emitting diode will emit light when
A) A hole jumps to the conduction band.
B) A hole jumps to the valence band.
C) An electron hops between orbitals in the conduction band.
D) An electron gives up energy when it falls into the valence band to fill a hole.

Answers

The answer is D. When an electron falls into the valence band to fill a hole, it gives up energy in the form of light.

The diode in an LED bulb is a semiconductor device that allows electricity to flow in one direction only. It is made of two pieces of semiconductor material, one positive and one negative, that are joined together.

The diode in the process of electrolysis has two terminals, called the anode and the cathode. The anode is the positive terminal and the cathode is the negative terminal in the electrolysis. The anode is connected to the positive terminal of the power supply and the cathode is connected to the negative terminal of the power supply.

When the power is turned on, the diode allows electricity to flow from the anode to the cathode and lights up the LED bulb.

The light-emitting diode will emit light when an electron jumps from the conduction band to the valence band. This is because when the electron falls into the valence band, it will release energy in the form of light.

Therefore the correct option is d.

To know more about semiconductors, click below:

https://brainly.com/question/1918629

#SPJ1

5. How many moles in 49.8 Liters of O2 at STP?

Answers

The answer is 49.8 liter that the answer

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Which of the following correctly describes the location of subatomic particles within an atom?
ОА.
Electrons are located outside of the atom's nucleus.
B. Protons are located inside neutrons.
OC. Neutrons are located inside of electrons.
OD. The nucleus of the atom surrounds the electrons.

Answers

Answer:

electrons are located outside of the atoms nucleus

The sky is blue or red on or dead wait... who am I.??

1. A male patient has been diagnosed with diminished thyroid function. His
doctor prescribes a dosage of 0.150 mg of Synthroid to be taken once a day. If
each tablet contains 75 mcg of Synthroid, how many tablets (total) are taken in
a span of one week?
Show your work.

Answers

Answer:

Explanation:

0.150mg - one day

Convert 75 Mcg to mg

= 75/100=0.75mg

If 0.150mg is taking for one day

Then 0.75/0.150=5mg

5mg multiple by 7 will be talking for a week 5 mg * 7=35mg

what is the percent by mass of nitrogen in the following fertilizers? NH3

Answers

The percent by mass of nitrogen in ammonia (NH3) is approximately 82.15%

Calculating the mass of nitrogen to the total mass of the compound and then expressing the result as a percentage will allow us to determine the percent by mass of nitrogen in NH3 (ammonia).

Ammonia's molecular structure, NH3, indicates that it is made up of one nitrogen atom (N) and three hydrogen atoms (H). We must take both the molar masses of nitrogen and ammonia into account when calculating the percent by mass of nitrogen.

Nitrogen's (N) molar mass is roughly 14.01 g/mol. The molar masses of nitrogen and hydrogen are added to determine the molar mass of ammonia (NH3). Since hydrogen's molar mass is around 1.01 g/mol, ammonia's molar mass is:

(3 mol H 1.01 g/mol) + (1 mol N 14.01 g/mol) = 17.03 g/mol = NH3.

Now, we can use the following formula to get the nitrogen content of ammonia in percent by mass:

(Mass of nitrogen / Mass of ammonia) / 100% is the percentage of nitrogen by mass.

Ammonia weighs 17.03 g/mol and contains 14.01 g/mol of nitrogen by mass. By entering these values, we obtain:

(14.01 g/mol / 17.03 g/mol) 100% 82.15 % of nitrogen by mass

Ammonia (NH3) has a nitrogen content that is roughly 82.15 percent by mass.

For more questions on mass
https://brainly.com/question/24191825
#SPJ8

What is the length of the paper clip in cm

What is the length of the paper clip in cm

Answers

Answer:

24.5 cm

Explanation:

It would be really complicated to type out, so I've attached an image of how I solved this:

*I separated the paperclip into different sections, figured out the length of those sections, and added them together.

(sorry that my work isn't the neatest)

What is the length of the paper clip in cm

What is the temperature (in K) of 16.45
moles of methane gas in a 70.7 L
container at 3,557 torr?

Answers

At 3,557 torr, 16.45 moles of methane gas are at a temperature of T=17.15 K in a 70.7 L container.

According to the ideal gas law: PV=nRT, where R=0.082 and T is temperature in Kelvin (K). P is pressure, V is volume, n is the amount in moles.

(4.68)*(4.95)=(16.45)*(0.0821)*

T=17.15, therefore calculate it.

What's called gas?

An object that is in the gaseous, or vaporous, condition of matter, is referred to as a gas. When referring to material with characteristics of a gaseous substance, the word "gas" can also refer to the condition itself. Along with liquid, solid, and plasma, gases are one of the four natural states of matter. The shape or volume of a gas can change.

To know more about Gas visit:

https://brainly.com/question/10725862

#SPJ1

Answer:

245

Explanation:

everyone needs to chill don't answer if you can't get it right it wastes you time and others as well not trying be a hater but its true

Help me I'm desperate :( no links or u will be reported

Help me I'm desperate :( no links or u will be reported

Answers

Answer:

Here is the answer from somewhere in the internet

Help me I'm desperate :( no links or u will be reported

what is the complex equation for copper sulfate and sodium hydroxide reaction?

Answers

Oh great, just what the world needs, another armchair chemist trying to sound smart by throwing around fancy-sounding equations they don't even understand. But fine, I'll humor you. The equation for the reaction between copper sulfate and sodium hydroxide is:

CuSO4 + 2NaOH → Cu(OH)2 + Na2SO4

There you go, happy now? But I have a feeling that you don't actually understand what this equation means or how the reaction works. So, before you start pretending to be a chemist again, maybe actually learn some basic chemistry first.

Cuso4 + NaoH -》cu(oH)2 +Na2So4

Cuso4 + 2NaoH -》cu(oH)2 +Na2So4

Explanation:

this is balanced equation

A piece of metal is heated to 250 degrees then placed in a bucket of water with an initial temperature of 15 degrees. After 10 minutes, the system reaches a point of thermal equilibrium. The water is now 22 degrees. Which of the following is the most likely temperature of the piece of metal?

Answers

Answer: 22 degrees

Explanation:

Most of the information in this question is put there to throw you off- the only important piece of information here is the final temperature of the water.

In a system of say 2, like in this example, whichever object has more energy in the form of heat will transfer that heat to the object with lesser heat if there is an available path to transfer heat between them. Once the two objects are at the same temperature, however, heat can not be transferred from one to another since neither object has more heat than the other to transfer- this is thermal equilibrium.

This question tells us that the system is at thermal equilibrium- when both objects are at the same temperature. Given the temperature of one object, the water, we then know the other object, the metal is the same temperature.

Other Questions
Compare the 1830 and 1850 census information. What changes do you see?PLS HELP!!! what is the ground state shorthand notation for manganese (mn)? Family Appliance specializes in selling major appliances for use in kitchen remodeling. One of its more popular items is the Sub Zero refrigerator. Over the past 40 weeks, the store has collected data regarding the weekly demand for this refrigerator. On the basis of these data, the following demand distribution has been estimated: What is one way governments try to encourage growth?. Define electronegativity.A neutral atom has high electronegativity. Describe what happens to this atom during ionic bond formation.No trolls, fake answers, copied answers Please give me 5-8 benefits about home quarantine!! Which of the following is the correct interpretation of a p-value?Group of answer choicesA P-Value is the probability of getting your sample or one more extreme if the null hypothesis is true.A P-Value is the probability of committing a type 1 errorA P-Value is the probability that your null hypothesis is actually true.A P-Value is the probability of rejecting the null hypothesis. when flour is mixed with water, an elastic network forms as gliadin and glutenin combine, and this is known as _____. it is both elastic and plastic and can expand with the inner pressure of gases (air, steam, and co2), allowing the bread to expand with the action of yeast. The wood used to make furniture is a variable cost to an enterprise that manufactures and sells household furniture. Select one: O True O False In order to obtain funding for their research, scientists writedescribing the proposed research and its costs.a hypothesesb research papersC grant proposalsd email What is one of the main differences between a bank and a credit union ?. Find the center of mass of a thin plate of constant density delta covering the given region. The region bounded by the parabola y = 3x - x^2 and the line y = -3x The center of mass is. (Type an ordered pair.) 4,12,16,48,52,156,160,_,_,_ find the next 3 numbers Choose the graph that matches the following system of equations: 5x + 2y = 2 3x 3y = 18 a A line includes points 0 comma 6 and 2 comma 4. A line includes points 0 comma 2 and negative 2 comma 7. b A line includes points 0 comma 1 and 2 comma negative 4. A line includes points negative 1 comma negative 7 and 0 comma negative 6. c A line includes points 0 comma 1 and 1 comma negative 4. A line includes points 2 comma negative 4 and 0 comma negative 6. d A line includes points 0 comma 6 and 1 comma 3. A line includes points 0 comma 1 and 1 comma 6. what are the effects of cultural pressure at a company to hit goals at all costs? (choose every correct answer.) multiple select question. it can cause even honorable employees to behave unethically. it paves the way for managers to keep the company focused on ethical long-term goals. it creates an environment in which workers have license to pursue any profitable strategy they can get away with. it virtually ensures that unethical employees will minimize the importance of observing ethical standards. Opinion-based question: When facing legal action, should teenagers be held to the same standard as adults? Please explain your answer using reasoning, personal knowledge, and current events.Just answer the question, please. Don't send the homework link 'cuz I can't access it at all. Use the answer from whatever link you got it from so I can get my homework done. state department travel warnings should be consulted prior to taking trips across the us-mexican border. A laundry detergent company's 32-ounce bottles pass inspection 98/100 of the time. If the bottle does not pass inspection, the company loses the unit cost for each bottle of laundry detergent that does not pass inspection, which is $3.45. If 800 bottles of laundry detergent are produced, about how much money can the company expect to lose? During the winter, insulation functions much like: a. a warm jacket b. a space heater c. a hot beverage d. a pot of boiling water For what values of a are the following expressions true?1) |a-5|=5-a2) |a|=-aWrite in inequality format!PLS HELP