PLEASE HURRY
Which input value produces the same output value for the two functions on the graph. f(x) = - x+
g(x) = ģx-2
.
x= -3
x= -1
X = 1
x= 3

PLEASE HURRYWhich Input Value Produces The Same Output Value For The Two Functions On The Graph. F(x)

Answers

Answer 1

Answer:

3

Explanation:

Your problem statement tells you .... f(x) passes through point (3, negative 1) g(x) passes through point (3, negative 1) This tells you the input value that produces the same output value for the two functions is 3, and that output value is -1.

Related Questions

water is a unique material in that the density of the solid is lower than the density of the liquid (which is why ice forms at the top of a pond and why ice floats in our drinks). if the density for ice at 0C is .917g/mL and the density for water at 0C is .999 g/mL, what is the calculated free space (as %) for each of these materials. you will need to estimate the volume of water as the sum of 2 H atoms and 1 O atom with radii 37 and 66 pm respectively. note that you will also have to assume a quantity of water to perform this exercise

Answers

Answer:

% Free space in water = \(\frac{9.945* 10^{-7} }{1*10^{-6} }\)×100 = 99.45%

% Free space in ice  = \(\frac{9.98* 10^{-7} }{1*10^{-6} }\)×100 = 99.8%

Explanation:

As given ,

Density for ice at 0⁰C = 0.917 g/ml

Density for water at 0⁰C = 0.999 g/ml

Radii of H atoms = 37 pm

Radii of O atoms = 66 pm

Now,

Consider 1 ml of water = 1 cm²

As , we know that mass of water in 1 cm² = 0.999 g

Moles of water = \(\frac{0.999}{18} = 0.056\)

Volume of H₂O = 1.624×\(10^{-31}\) m²

Now,

Volume occupied by water = 0.056×6.022×\(10^{23}\)× 1.624×\(10^{-31}\) m²

                                              = 5.48×\(10^{-9}\) m²

⇒Volume occupied by water = 5.48×\(10^{-9}\) m²

Now,

Free space = 1×\(10^{-6}\)  - 5.48×\(10^{-9}\) = 9.95×\(10^{-7}\) m²

% Free space = \(\frac{9.945* 10^{-7} }{1*10^{-6} }\)×100 = 99.45%

Now,

Consider 1 ml of ice  = 1 cm²

S.I unit of ice = 1×\(10^{-6}\) m²

As , we know that mass of water in 1×\(10^{-6}\) m² = 0.917 g

Moles of ice = \(\frac{0.917}{18} = 0.012\)

Volume of H₂O = 6.022×\(10^{23}\) ×0.012

Volume of ice unit = \(\frac{4}{3} \pi (37*10^{-12})^{3} *2 + \frac{4}{3} \pi (66*10^{-12})^{3} = 1.624*10^{-31}m^{3}\)

Now,

Volume occupied by water = 0.012×6.022×\(10^{23}\)× 1.624×\(10^{-31}\) m²

                                              = 1.17×\(10^{-9}\) m²

⇒Volume occupied by water = 1.17×\(10^{-9}\) m²

Now,

Free space = 1×\(10^{-6}\)  - 1.17×\(10^{-9}\) = 9.98×\(10^{-7}\) m²

% Free space = \(\frac{9.98* 10^{-7} }{1*10^{-6} }\)×100 = 99.8%

How many um are in
22.5 mm?

How many um are in22.5 mm?

Answers

Answer:

A

Explanation: That's what I got but I don't know if its correct sorry if it was wrong.

Answer:

the answer is C

Explanation:

hot lead with a mass of 200.0 g of (Specific heat of Pb = 0.129 J/gºC) at 176.4°C was dropped into a calorimeter containing an unknown volume of water. The temperature of the water increased from 21.7°C to 56.4°C. What volume of water is in the calorimeter?

Answers

the Calorimetry relationships you can find the amount of water in the calorimeter is      m = 21.3 g

given parameters

Lead mass M = 200.0 gInitial lead temperature T₁ = 176.4ºCSpecific heat of Lead    \(c_{e Pb}\) = 0.129 J / g ºCSspecific heat of water \(c_{e H_2O}\) = 4.186 J / g ºCInitial water temperature T₀ = 21.7ºCEquilibrium temperature T_f = 56.4ºC

to find

The body of water

Thermal energy is the energy stored in the body that can be transferred as heat when two or more bodies are in contact. Calorimetry is a technique where the energy is transferred between the body only in the form of heat and in this case the thermal energy of the lead is transferred to the calorimeter that reaches the equilibrium that the thematic energy of the two is equal

              Q_{ceded} = Q_{absorbed}

               

Lead, because it is hotter, gives up energy

              Q_{ceded} = M c_{e Pb} (T₁ - T_f)

The calorimeter that is colder absorbs the heat

              Q_{absrobed} = m c_{e H_2O} (T_f - T₀)

where M and m are the mass of lead and water, respectively, c are the specific heats, T₁ is the temperature of the hot lead, T₀ the temperature of cold water and T_f the equilibrium temperature

              M c_{ePb} (T₁ - T_f) = m c_{eH2O} (T_f - T₀)

               m = \(\frac{ M\ c_{ePb} \ (T_1 - T_f)}{c_{eH_2O} \ (T_f - T_o)}\)

let's calculate

              m = \(\frac{200 \ 0.129 (176.4-56.4)}{ 4.186 \ (56.4 -21.7)}\)

              m = 3096 / 145.25

              m = 21.3 g

Using the Calorimetry relationships you can find the amount of water in the calorimeter is:

             m = 21.3 g

learn more about calorimetry here:

https://brainly.com/question/15073428

According to the following reaction, how many grams of sulfur are formed when 37.4 g of water are formed?
2H₂S(g) + SO₂(g) → 3S(s) + 2H₂O(l)

Answers

Answer:

Mass = 100.8 g

Explanation:

Given data:

Mass of sulfur formed = ?

Mass of water formed = 37.4 g

Solution:

Chemical equation:

2H₂S + SO₂      →   3S + 2H₂O

Number of moles of water:

Number of moles = mass/molar mass

Number of moles = 37.4 g/ 18 g/mol

Number of moles = 2.1 mol

Now we will compare the moles of water and sulfur.

          H₂O         :            S

            2             :          3

           2.1            :         3/2×2.1 = 3.15

Mass of sulfur:

Mass = number of moles × molar mass

Mass = 3.15 mol × 32 g/mol

Mass = 100.8 g

What is a quasar?
Two stars moving around each other.
A star that emits a repeated radio signal.
A star that emits intense radio and light energy.
A system of stars held together by gravity.
A collapsed star emitting no light.

Answers

A quasar is a star that emits intense radio and light energy.

A quasar is an extremely bright radio source. It is called a quasi-stellar radio source. It appears to be like a star but is not a star. These quasars are young galaxies that are located far away from us and are highly luminous. The luminosity of a quasar is 1000 times greater than the luminosity of a milky way galaxy.

A quasar is powered by a supermassive black hole with its mass ranging from millions to tens of billions of solar masses, surrounded by a gaseous accretion disc.

The quasars were first discovered in the 1950s using the Hubble space telescope and were found to be a massive bright source emitting radio waves of unknown origin. But now, millions of quasars were discovered.

To know more about stars, click below:

https://brainly.com/question/1041175

#SPJ1

Please if you know the answer put it thanks

Please if you know the answer put it thanks

Answers

The diagram shows a picture of a compound.

What is a compound?

A compound is a substance that is made up of two or more different elements that are chemically bonded together in a specific ratio.

This means that the elements are combined in a way that creates a new substance with different physical and chemical properties than the individual elements.

Compounds can be formed through a variety of chemical reactions, such as combining elements through a chemical bond or through a reaction between an acid and a base.

So for the given diagram, we can see that it represents two or more elements chemically combined.

Learn more about a compound here: https://brainly.com/question/29108029

#SPJ1

How many fluorine atoms are in 410.0 g of uranium hexafluoride, UF?

Answers

ANSWER - The molar mass of uranium hexafluoride (UF6) is:

1 uranium atom (238.03 g/mol) + 6 fluorine atoms (6 × 18.998 g/mol) = 352.02 g/mol

To calculate the number of fluorine atoms in 410.0 g of UF6, we need to convert the mass to moles, and then use Avogadro's number to convert moles to number of particles (atoms or molecules).

moles of UF6 = 410.0 g / 352.02 g/mol = 1.165 mol UF6

Using the molecular formula of UF6, we can see that there are 6 fluorine atoms in one UF6 molecule. Therefore, the total number of fluorine atoms is:

number of fluorine atoms = 6 × Avogadro's number × moles of UF6
number of fluorine atoms = 6 × 6.022 × 10^23 mol^-1 × 1.165 mol
number of fluorine atoms = 4.041 × 10^24

Therefore, there are approximately 4.041 × 10^24 fluorine atoms in 410.0 g of uranium hexafluoride.

I need help with this

I need help with this

Answers

As a result, the ideal gas law is applied, and the pressure of the gas in the container is 1.44 atm.

How does Charles Law compute pressure?

The Kelvin temperature and hence the volume are going to be in direct proportion when the pressure on a sample of a dry gas is held constant, according to the definition of the Charles Law Formula. PV = k is the law's equation, and k might be a constant.

This issue can be resolved by applying the ideal gas law:

PV = nR

T = -52 °C + 273.15 = 221.15 K

n = 0.642 mol

V = 8.6 L

T = 221.15 K

\(R = 0.0821 L·atm/mol·K (gas constant for ideal gases)\)

PV = nRT

P = nRT/V

P = (0.642 mol)(0.0821 L·atm/mol·K)(221.15 K)/(8.6 L)

P = 1.44 atm

To know more about ideal gas visit:-

https://brainly.com/question/28257995

#SPJ1

water can be made using the reversible reaction shown, which change would kee
p this reaction from shifting to form more of the product?

Answers

We can produce more products by;

A. Increasing the concentration of H₂ gas in the reaction vessel

B. Decreasing the temperature in the reaction vessel

C. Removing the H₂O from the reaction vessel as it forms

Is formation of water an exothermic reaction?

Water is created through an exothermic process. Heat energy is released when hydrogen gas (H2) and oxygen gas (O2) mix to make water (H2O). An exothermic reaction is characterized by this energy release.

The reaction's overall energy change is negative, which shows that energy is released. The reaction is exothermic because the extra energy is released as heat into the environment.

Learn more about exothermic reaction:https://brainly.com/question/28546817

#SPJ1

Missing parts;

Water can be made using the reversible reaction shown. Which change would

keep this reaction from shifting to form more of the product?

2H₂+022H₂O + energy

A. Increasing the concentration of H₂ gas in the reaction vessel

B. Decreasing the temperature in the reaction vessel

C. Removing the H₂O from the reaction vessel as it forms

D. Increasing the temperature in the reaction vessel

What is the mass of 6.02 x 10^^24

molecules of hydrogen, H2? The molar

mass of H2 is 2.02 g/mol.

A- 2.02 g H2

B- 2.98 x 10^24 g H2

C- 10.0 g H2

D- 1.22 x 10^25 g H2

Answers

Mole measures the number of elementary entities of a given substance that are present in a given sample. The mass of hydrogen is 20.2gram.

What is mole?

The SI unit of amount of substance in chemistry is mole. The mole is used to measure the quantity of amount of substance.

Given number of atoms= 6.02 x 10²⁴atoms

we know one mole of any element contains 6.022×10²³ atoms which is also called Avogadro number

mole =given number of atoms ÷ 6.022×10²³(Avogadro number)

Substituting the values

mole=6.02 x 10²⁴÷ 6.022×10²³

mole = 10 mole

Mole = mass ÷Molar mass

Molar mass = 2.02 g/mol

Substituting the given values

10= mass ÷ 2.02 g/mol

Mass = 20.2gram

Therefore, mass of hydrogen is 20.2gram.

To know more about mole, here:

https://brainly.com/question/15209553

#SPJ1

3. A Wilkinson’s catalyst is widely used in the hydrogenation of alkenes. Show a catalytic cycle, including: i. chemical structure of the catalyst, with complete stereochemistry ii. molecular geometry of catalyst iii. type of reactions involved iv. the appropriate starting material, reagent and solvent v. major and minor end-products vi. all intermediates, for each reaction stated in (iii)

Answers

We can see here that the catalytic cycle for the hydrogenation of alkenes using Wilkinson's catalyst involves several steps.

What are the steps involved?

Here's an overview of the catalytic cycle, including the necessary details:

i. Chemical structure of the catalyst:

Wilkinson's catalyst, also known as chloridotris(triphenylphosphine)rhodium(I), has the following chemical structure: [RhCl(PPh3)3]

ii. Molecular geometry of the catalyst:

The Wilkinson's catalyst has a trigonal bipyramidal geometry around the rhodium center. The three triphenylphosphine (PPh3) ligands occupy equatorial positions, while the chloride (Cl) ligand occupies an axial position.

iii. Type of reactions involved:

The catalytic cycle involves several reactions, including:

Oxidative addition: The rhodium center undergoes oxidative addition, reacting with molecular hydrogen (H2) to form a dihydride intermediate.Alkene coordination: The alkene substrate coordinates to the rhodium center, forming a π-complex.Hydrogenation: The coordinated alkene undergoes hydrogenation, resulting in the addition of hydrogen atoms to the double bond and formation of a metal-alkyl intermediate.Reoxidation: The metal-alkyl intermediate reacts with a hydrogen molecule to regenerate the rhodium dihydride species.

iv. Starting material, reagent, and solvent:

The starting material is an alkene, and the reagent is Wilkinson's catalyst ([RhCl(PPh3)3]). The reaction is typically carried out in a suitable solvent, such as dichloromethane (CH2Cl2) or tetrahydrofuran (THF).

v. Major and minor end-products:

The major end-product of the hydrogenation reaction is the fully saturated alkane, resulting from the addition of hydrogen across the double bond. The minor end-product may include cis- or trans-configured alkanes if the original alkene substrate possesses geometric isomers.

vi. Intermediates:

The intermediates in the catalytic cycle include:

Rhodium dihydride complex: [RhH2(PPh3)3]Alkene-Rhodium π-complex: [Rh(η2-alkene)(PPh3)3]Metal-alkyl intermediate: [Rh(alkyl)(PPh3)3]

These intermediates play a crucial role in facilitating the hydrogenation reaction and enabling the catalytic cycle to proceed.

Learn more about Wilkinson’s catalyst on https://brainly.com/question/31972308

#SPJ1

You walk into the lab, and you find a beaker sitting on the bench labeled HNO3. However, the concentration is not given. Your instructor tells you to do a titration to determine the concentration of the acid. You find that is takes 27.60 mL of 1.00 M NaOH to neutralize 10.00 of the HNO3. What is the concentration oft the HNO3?

HNO3 + NaOH
H2O + NaNO3

Answers

The concentration of the HNO₃ solution needed to neutralize the 27.60 mL of 1.00 M NaOH is 2.76 M

How do i determine the concentration of the HNO₃ solution?

The balanced equtaion is given below:

HNO₃ + NaOH —> H₂O + NaNO₃

Mole ratio of the HNO₃ (nA) = 1Mole ratio of the NaOH (nB) = 1

Now, we shall obtain the concentration of the HNO₃ solution needed for the neutralization reaction. This is shown below:

Volume of HNO₃ (Va) = 10 mLVolume of NaOH (Vb) = 27.60 mLConcentration of NaOH (Cb) = 1.00 M Concentration of HNO₃ (Ca) =?

CaVa / CbVb = nA / nB

(Ca × 10) / (1 × 27.6) = 1

(Ca × 10) / 27.6 = 1

Cross multiply

Ca × 10 = 27.6

Divide both side by 10

Ca = 27.6 / 10

Ca = 2.76 M

Thus, the concentration of the HNO₃ solution needed is 2.76 M

Learn more about titration:

https://brainly.com/question/27817549

#SPJ1

Hurricane Andrew hit Florida in 1992, and as a result, caused great amounts of damage to property in Miami. Which of the following terms describes a hurricane?

A. a current
B. a severe storm
C. a stable air mass
D. a jet stream

Answers

The answer is

B. A severe storm
the correct answer is b; a severe storm

Ph of a 0.00150 M HNO3 solution

Ph of a 0.00150 M HNO3 solution

Answers

The pH of a 0.00150 M HNO3 solution is 2.82

5. Practice: Turn off Show electron dot diagram. Use the Gizmo to create a neutral atom of
each of the following elements. Draw an electron dot diagram for each. When you are
finished, turn on Show electron dot diagram and check your answers.
H
He
Li
Be
B
C
N
O
F
Me
Na
Mg
Al
Si

Answers

Answer:  You would put one dot for each valence electron the element has so Hydrogen would be 1 He:2 Li:1 Be:2  B:3 C:4 N:5 O:6 F:7 Ne:10

Na:1 Mg:2 Al:3 Si:4

Explanation:

This is also called the lewis structure you will draw the dots around the letter. 2 on each side and there are 4 sides per letter

Lewis diagram, or Lewis structure, is a diagram that employs dots to represent the valence electrons of such an atom. Hydrogen has 1 valence electron.

What is electron dot diagram?

A Lewis electron dot diagram, also known as an electron dot diagram, Lewis diagram, or Lewis structure, is a diagram that employs dots to represent the valence electrons of such an atom. The amount of dots corresponds to the atom's valence electron count.

Chemical bonds are virtually often created by interactions between atoms' valence electrons. A straightforward technique to depict those valence electrons might be helpful to improve our comprehension of how they interact.

Element                         number of electron

   H                                    1

   He                                   2

  Li                                     1

  Be                                   2

Therefore, in above given way number of valence electron can be shown.              

To learn more about electron dot diagram, here:

https://brainly.com/question/30299328

#SPJ2

   

-Convert 6.02 x 1020 formula units of MgCl₂ to mol of MgCl₂:​

Answers

6.02 x \(10^{20\) formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

To convert formula units of MgCl₂ to moles of MgCl₂, we need to use Avogadro's number, which relates the number of formula units to the number of moles.

Avogadro's number (NA) is approximately 6.022 x 10^23 formula units per mole.

Given that we have 6.02 x 10^20 formula units of MgCl₂, we can set up a conversion factor to convert to moles:

(6.02 x 10^20 formula units MgCl₂) * (1 mol MgCl₂ / (6.022 x 10^23 formula units MgCl₂))

The formula units of MgCl₂ cancel out, and we are left with moles of MgCl₂:

(6.02 x 10^20) * (1 mol / 6.022 x 10^23) = 0.1 mol

Therefore, 6.02 x 10^20 formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

It's important to note that this conversion assumes that each formula unit of MgCl₂ represents one mole of MgCl₂. This is based on the stoichiometry of the compound, where there is one mole of MgCl₂ for every one formula unit.

Additionally, this conversion is valid for any substance, not just MgCl₂, as long as you know the value of Avogadro's number and the number of formula units or particles you have.

For more such questions on MgCl₂ visit:

https://brainly.com/question/26311875

#SPJ8

A 2.23-L flexible flask at 19°C contains a mixture of N2, He, and Ne at partial pressures of 0.309 atm for N2, 0.169 atm for He, and 0.463 atm for Ne.
a.)Calculate the total pressure of the mixture.
b.)Calculate the volume in liters at STP occupied by He and Ne if the N2 is removed selectively.

Answers

The total pressure  of the mixture is 0.941  atmospheres  and the volume in liters at STP occupied by He is 13430.30 liters while that occupied by Ne is 4902.20 liters.

What is pressure?

Pressure is defined as the force applied on an object perpendicular to it's surface per unit area over which it is distributed.Gauge pressure is a pressure which is related with the ambient pressure.

There are various units by which pressure is expressed most of which are derived units which are obtained from unit of force divided by unit of area . The SI unit of pressure is pascal .

According to ideal gas equation volume of helium, V= 1×8.314×273/0.169=13430.30 liters and that of neon volume=1×8.314×273/0.463 =4902.20 liters.

Learn more about pressure,here:

https://brainly.com/question/18431008

#SPJ1

A sample of 0.35 L of argon gas (at a temperature of 13 oC and a pressure of 568 torr) is heated to 156 oC and a new pressure of 897 torr. Calculate the new volume of the gas.

Answers

Answer:

The new volume of the gas is 0.332 liters.

Explanation:

Let suppose that argon behaves ideally, the equation of state of the ideal gas is:

\(P\cdot V = n \cdot R_{u}\cdot T\)

Where:

\(P\) - Pressure, measured in torr.

\(V\) - Volume, measured in liters.

\(n\) - Molar quantity, measured in moles.

\(T\) - Temperature, measured in kelvins.

\(R_{u}\) - Ideal gas constant, measured in \(\frac{torr\cdot L}{mol \cdot K}\).

Since gas sample is a closed system experimenting a heating process, that is, molar quantity remains constant, the following relationship is derived from the equation of state described above:

\(\frac{P_{o}\cdot V_{o}}{T_{o}} = \frac{P_{f}\cdot V_{f}}{T_{f}}\)

Where:

\(P_{o}\), \(P_{f}\) - Initial and final pressures, measured in torr.

\(V_{o}\), \(V_{f}\) - Initial and final volumes, measured in liters.

\(T_{o}\), \(T_{f}\) - Initial and final temperatures, measured in kelvins.

Now, the final volume of the gas is found:

\(V_{f} = \left(\frac{T_{f}}{T_{o}}\right)\cdot \left(\frac{P_{o}}{P_{f}} \right)\cdot V_{o}\)

If \(T_{o} = 286.15\,K\), \(T_{f} = 429.15\,K\), \(P_{o} = 568\,torr\), \(P_{f} = 897\,torr\) and \(V_{o} = 0.35\,L\), the new volume of the gas is:

\(V_{f} = \left(\frac{429.15\,K}{286.15\,K} \right)\cdot \left(\frac{568\,torr}{897\,torr} \right)\cdot 0.35\,L\)

\(V_{f} = 0.332\,L\)

The new volume of the gas is 0.332 liters.

Pearson Education Chapter 4 Covalent Bonds quiz [ Just Send Me A Image of it or write it down ]

Answers

Covalent bond is a bond which is formed by the sharing of electrons between the two atoms.

What is a covalent bond?

Covalent bond is defined as a type of bond which is formed by the mutual sharing of electrons to form electron pairs between the two atoms.These electron pairs are called as bonding pairs or shared pair of electrons.

Due to the sharing of valence electrons , the atoms are able to achieve a stable electronic configuration . Covalent bonding involves many types of interactions like σ bonding,π bonding ,metal-to-metal bonding ,etc.

Sigma bonds are the strongest covalent bonds while the pi bonds are weaker covalent bonds .Covalent bonds are affected by electronegativities of the atoms present in the molecules.Compounds having covalent bonds have lower melting points as compared to those with ionic bonds.

Learn more about covalent bond,here:

https://brainly.com/question/19382448

#SPJ1

Read the passage on the California Zero-Emission Vehicle Program. Should automobile makers be made to adhere to quotas of zero-emission vehicles set by states, even if it causes automakers to lose revenue?

Answers

Transport media is a significant pollution source by emitting gasses and particles. YES. Automobile makers should adhere to quotas for zero-emission vehicles.

What are the Zero-Emission vehicles?

These are cars, trucks, and buses that mostly run on electricity. The pollution degree caused by these vehicles is highly reduced compared with ordinary vehicles because of the reduction in fuel use and the consequent reduction in gasses and other substances emissions.

There are three types of zero-emission vehicles

Hybrids vehicles that combine gasoline and electricityFully electric vehicles that run entirely on electricityHydrogen cells vehicles that use hydrogen gas to produce electricity

Currently, and for decades, transport media are one of the most significant sources of gasses and other polluting substances emissions that lead to an increase in the greenhouse effect and global warming. Some of them are mentioned in the article -VOCs, nitrogen oxide, carbon monoxide, and dioxide, hydrocarbon-.

These are all primary pollutants suspended in the air that can produce secondary pollutants.

The mentioned pollutants could be significantly reduced by substituting transport media or improving the combustion processes. This last goal could be achieved by using alternative fuels and technologies or by using catalytic converters.

A considerable reduction in pollutant emissions from Zero-Emission Vehicles has already been proven in many countries. So several actions and regulations should be done about it to decrease even more -to near-zero- gasses and other particles emission. And more countries should be involved.

Following this thinking line, the answer is YES. Automobile makers should adhere to quotas of zero-emission vehicles set by states, even if it causes automakers to lose revenue.

You can elarn more about zero-Emission Vehicles at

https://brainly.com/question/24603233

https://brainly.com/question/14319636

if 3 moes of cl reacts with 3 moles oxygen, then which substance is the limitting reactant and excess reactant​

Answers

If 3 moles of cl reacts with 3 moles oxygen, there is no limiting reactant or excess reactant because the reactants are in stoichiometric proportions.

To determine the limiting reactant and excess reactant, we need to compare the stoichiometry of the reaction to the given amounts of each reactant.

The balanced chemical equation for the reaction between chlorine (Cl2) and oxygen (O2) can be represented as follows:

2Cl2 + O2 → 2Cl2O

According to the balanced equation, it requires 2 moles of chlorine (Cl2) to react with 1 mole of oxygen (O2) to produce 2 moles of chlorine oxide (Cl2O).

Given that we have 3 moles of chlorine (Cl2) and 3 moles of oxygen (O2), we can determine the limiting reactant by comparing the ratio of moles between the two reactants.

The ratio of Cl2 to O2 required for complete reaction is 2:1. However, since we have equal amounts of Cl2 and O2 (both 3 moles), neither reactant is present in excess.

Therefore, in this scenario, there is no limiting reactant or excess reactant because the reactants are in stoichiometric proportions. All of the chlorine and oxygen will be consumed in the reaction, resulting in the complete conversion to chlorine oxide (Cl2O).

It's important to note that if the amounts of Cl2 and O2 were different, the reactant present in lesser quantity would be the limiting reactant, and the reactant in greater quantity would be the excess reactant.

for more questions on reactant
https://brainly.com/question/30129541

#SPJ11

2. The nonmetals in the Groups 16 and 17________.
a) lose electrons when they form ions
b) gain electrons making them an anion
c) all have ions with a -1 charge
d) end in -ate

Answers

The nonmetals in the Groups 16 and 17 gain electrons making them an anion.

Why gaining electrons is a significant characteristic of nonmetals in Groups 16 and 17?

The nonmetals of group 16 are made up of Oxygen, Sulfur, and Selenium whereas group 17, also called the halogen group is made up of Fluorine, Chlorine, etc.

The further right we go in the periodic table, the atomic size decreases. Due to the increase in the number of protons, the electrons are more tightly bound and the atom shows strong attraction to electrons.  

The gain of additional electrons helps in the completion of octets for the atoms further making their configuration stable, and more alike to that of the noble gases.

To learn more about electron gain click here:

brainly.com/question/14351799

#SPJ1

Which option correctly shows the concentration of H3O+ ions in pure water?

7 mol/L

1.0 × 10-7 mol/L

1.0 x 10-14 mol/L

14 mol/L

Answers

Answer:

C 1.0 x 10-14 mol/L

Explanation:

also do you do connections academy?

with the balanced equation C6H12O6 = 2C2H5OH + 2CO2How many moles of Carbon dioxide are produced from 0.4 moles of C6H12O6?

Answers

In this question, we have the following balanced equation:

C6H12O6 -> 2 C2H5OH + 2 CO2

From this balanced equation, we can determine that the molar ratio between C6H12O6 and CO2 is 1:2, 1 mol of glusoce for 2 moles of carbon dioxide, for 0.4 moles, we will have:

1 C6H12O6 = 2 CO2

0.4 C6H12O6 = x CO2

x = 2*0.4

x = 0.8 moles of CO2 will be produced from 0.4 moles of C6H12O6

What is the significance of negative signs on delta T values and on the heat values?

Answers

When measuring heat transfer, the sign of the delta T (ΔT) and the heat transfer (q) values is significant.

The negative sign indicates that the heat flow is in the opposite direction from the expected direction based on the given temperature gradient. When a negative sign is present in the delta T value or heat value, it implies that heat is being absorbed rather than being given off.  For example, when a substance absorbs heat, the temperature difference between the two regions decreases, resulting in a negative delta T value. When the surroundings absorb heat, the object's temperature drops, resulting in a negative heat value. The opposite is true for positive signs. When an object loses heat, its temperature drops, and the temperature difference between two regions increases, resulting in a positive delta T value. The heat transfer is said to be positive if heat is given off by the system to the surroundings. When heat flows from the surroundings to the system, the heat transfer is negative. The negative sign is significant since it shows that the energy flow is in the opposite direction from the expected direction based on the given temperature gradient.The amount of heat transferred by the system is proportional to the absolute value of the heat value and the delta T value.

for such more questions on heat

https://brainly.com/question/30738335

#SPJ8

This state of matter is characterized by atoms that are moving rapidly, spread apart, and unorganized and that will take the shape of the container.
a. gas
b.liquid
c.plasma
d.solid

Answers

The state of matter that is characterized by atoms that are moving rapidly, spread apart, and unorganized and that will take the shape of the container is gas; option A

What is matter?

Matter is the material substance from which the universe is made from,

Matter exists in four different states:

gasliquidplasmasolid

Each of the four states of matter possess unique properties that differentiate them one from another.

Generally however, the properties of shape and volume is as follows:

Gases have no definite volume or shape. They rapidly fill up the volume of their containers.

Liquids have definite volume but no definite shape.

Solids have definite volume and shape.

In conclusion, matter exists in different states which all have unique properties.

Learn more about states of matter at: https://brainly.com/question/3998772

#SPJ1

A 0.750 M Ca(OH)2 solution was prepared by dissolving 48.0 grams of Ca(OH)2 in enough water. What is the total volume of the solution formed?

Answers

The total volume of the solution prepared by dissolving 48.0 grams of Ca(OH)₂ in enough water is 0.865 L

How do i determine the volume of the solution?

First, we shall obtain the mole of 48.0 grams of Ca(OH)₂. This is shown below:

Mass of Ca(OH)₂ = 48.0 grams Molar mass of Ca(OH)₂ = 74 g/mol Mole of Ca(OH)₂ =?

Mole = mass / molar mass

Mole of Ca(OH)₂ = 48 / 74

Mole of Ca(OH)₂ = 0.649 mole

Finally, we shall obtain the total volume of the Ca(OH)₂ solution. Details below:

Molarity of solution = 0.750 MMole of Ca(OH)₂ = 0.649 moleVolume of solution =?

Volume = mole / molarity

Volume of solution = 0.649 / 0.750

Volume of solution = 0.865 L

Thus, we can conclude that the total volume of the solution is 0.865 L

Learn more about volume:

https://brainly.com/question/29144710

#SPJ1

What is the condensed structural formula for 2,2-dimethylbutane?

CH3(CH2)2CH3

(CH3)3CCH2CH3

C6H4(CH3)2

CH3CH2CH2CH2CH3

Answers

The structural formula for 2,2-dimethylbutane in the above task is (CH3)3CCH2CH3.

The correct answer choice is option b.

The structural formula for 2,2-dimethylbutane.

It follows that the structural formula for the above compound in the above task has 4 carbon atoms as the parent chain and has 2 different methyl substituents on the same carbon 2.

The image to the paper work is attached for more clearity.

The compound; 2,2-dimethylbutane ( (CH3)3CCH2CH3 ) belong to an alkane family. They have a general formula CnH2n+2.

So therefore, we can now confirm from the explanation given above that the only correct answer for the structural formula of the compound above is (CH3)3CCH2CH3

Read more on structural formula:

https://brainly.com/question/16693647

#SPJ1

What is the condensed structural formula for 2,2-dimethylbutane?CH3(CH2)2CH3(CH3)3CCH2CH3C6H4(CH3)2CH3CH2CH2CH2CH3

How is it possible to recognize the end point of a titration?

Answers

Answer:

The end point of a titration is the point at which the reaction between the analyte (the substance being analyzed) and the titrant (the solution being added to the analyte) is complete. The end point is usually determined by a change in the color of the solution, and this change is typically caused by an indicator added to the analyte solution.

The indicator is a substance that changes color at or around the pH at which the reaction is complete. The indicator is chosen based on the properties of the analyte and titrant, and the pH range over which the reaction occurs. Common indicators include phenolphthalein, bromothymol blue, and methyl orange.

For example, when titrating a strong acid (like HCl) with a strong base (like NaOH), phenolphthalein is often used as the indicator. The phenolphthalein molecules are colorless in acidic solution, but they turn pink in basic solution. As the NaOH is added to the HCl, the solution becomes increasingly basic. Once the pH reaches the endpoint, the indicator turns pink. This indicates that the reaction is complete and no further addition of NaOH is required to completely react with the HCl.

The endpoint determination is critical in performing accurate titrations. The endpoint must be identified accurately and consistently in order to obtain reliable and reproducible results.

A titration is a technique that is used to measure the concentration of an unknown substance in a solution using a standard solution with a known concentration. The endpoint of a titration is the point at which the reaction between the two solutions is complete, and no more titrant (standard solution) is needed to react with the analyte (unknown substance). There are several ways to recognize the endpoint of a titration, including:1. Indicators: An indicator is a substance that changes color when the endpoint is reached.

This change in color indicates that the reaction is complete. Examples of indicators include phenolphthalein, methyl orange, and bromothymol blue.2. pH measurements: pH measurements can be used to determine the endpoint of a titration. In some cases, the pH of the solution will change significantly when the endpoint is reached. For example, when hydrochloric acid (HCl) is titrated with sodium hydroxide (NaOH), the pH of the solution will change from acidic to basic when the endpoint is reached.3. Conductivity measurements: Conductivity measurements can also be used to determine the endpoint of a titration. As the reaction proceeds, the conductivity of the solution will change. When the endpoint is reached, the conductivity will either increase or decrease significantly.. Potentiometric measurements: Potentiometric measurements can be used to determine the endpoint of a titration. This involves measuring the potential difference between two electrodes in the solution. When the endpoint is reached, there will be a sudden change in potential due to the completion of the reaction.

For such more question on titration

https://brainly.com/question/13031875

#SPJ8

PLEASE HELP

We wish to determine the moles of solid AgCl formed when 50.0 ml of 0.250 M AgNO3 reacts with excess MgCl2 according to the equation below.
2AgNO3(aq) + MgCl2(aq) 2Ag Cl(s) + Mg (NO3)2(aq)
In the previous step you determined 0.0125 mol AgNO3 react. How many moles of AgCl form during the reaction?

Answers

The number of moles of AgCl formed during the reaction is 0.0125 mol.

Given the reaction:2AgNO3(aq) + MgCl2(aq) → 2Ag Cl(s) + Mg (NO3)2(aq)We are supposed to determine the moles of solid AgCl formed when 50.0 ml of 0.250 M AgNO3 reacts with excess MgCl2 and in the previous step, we found that 0.0125 mol of AgNO3 reacts.

We can use the stoichiometry method to find the moles of AgCl formed.

To do so, we will have to balance the given chemical equation and find out the number of moles of AgCl formed from the given reactants.

The balanced chemical equation is:2AgNO3(aq) + MgCl2(aq) → 2Ag Cl(s) + Mg (NO3)2(aq)From the equation, we can say that 2 moles of AgCl form from 2 moles of AgNO3 reacted.

In the previous step, we have found the number of moles of AgNO3 reacted, which is 0.0125 mol.

As per the balanced chemical equation, 2 moles of AgCl form from 2 moles of AgNO3 reacted.

Therefore, the number of moles of AgCl formed = (0.0125 mol AgNO3 reacted × 2 moles AgCl / 2 moles AgNO3) = 0.0125 mol AgCl.

The number of moles of AgCl formed during the reaction is 0.0125 mol.

For more questions on AgCl

https://brainly.com/question/15393967

#SPJ8

Other Questions
I got some money for my birthday. I save and spend in the ratio 2:3. I save 32. How much money did I receive for my birthday? to increase diversity awareness within his new team of employees, franco shouldmultiple choicesuppress the personal styles of team members in favor of group identity.stick with one consistent approach rather than trying different ways to do things.let problems grow until they are visible enough to be countered.reduce the time spent in socializing and concentrate on work.improve team members' understanding of others' experiences and perspectives. 10.73. If W and N are Gaussian random processes in Eq. (10.102), are Z and Xn Markov processes? A cookie cake is sliced into 6 equal pieces. Thearc length of one slice of cookie cake is 42in. What is the area of one cookie slice? Which of the following is a true statement about atrial natiuretic peptide? It is released by the adrenal cortex if MAP becomes too high It is released by the heart if MAP drops too low. It is a stero PLEASE HELP ME ASAP 50 POINTS BRAINLEIST WILL BE CHOSEN PLEASE HELP ASAP!!!!!!!!!!!!!Which of the following is the best description of the damage caused by a category five hurricane?A Extreme damage, large amounts of damage to homesB Catastrophic damage, homes completely leveledC Moderate damage, large trees snapped or uprootedD Minimal damage, broken tree branches how do the terms stereotype and discrimination relate to the term prejudice? Using the documents, analyze ways in which Black people sought their freedoms in the Atlantic World during the period 1550 to 1800. Identify one additional type of document and explain how it would help your analysis. Prompt. Spring, an American firm, recently acquired another company, Tazel Inc., in Indonesia. The high-level managers at Tazel quit because they could not cope with the domineering and straightforward approach of their American counterparts. This illustrates how acquisitions may fail because according to class and the powerpoints, all of the following is included in the nature of friendship except: Rose has 3 kg of turkey slices from which to make 20 sandwiches if she divides the slices equally how many grams of turkey will be in each sandwich Do you consider yourself a healthy person? Prove that for an arbitrary vector a (x, y, z) and an arbitrary scalar function (x, y, z) that ( a) = ( x A ) = 0, ( ) = 0Hint: It is easiest if you use rectangular coordinates to prove these identities. (But keep in mind that if you prove them in any coordinate system, the identities must be true in all coordinate systems. What is the best thing about Tuesdays in general? Why? Desde un globo se deja caer un objeto Que velocidad tendra y que distancia habra caido al cabo de 12 segundos? Amino acids are used to build _______? You can buy 2.5 pounds of bananas for $1.00. How much will 8 pounds of bananas costs 2. If your gross biweekly salary is $3,290, then how much is your annual salary?I The Poly-tropic process of ideal gas that satisfies the following requirements. I Please draw them on the p-v and T-s diagrams: (Each question needs a p-v diagram and a T-s diagram) (1) The working fluid expands and cools down; (2) The working fluid is boosted again, and it is heated and exothermic; (3) The working fluid expands again, and it cools down and releases heat. (4) The working fluid expands again, warms up, and depressurizes. Part III: Answer the following questions (TOTAL: 30 points) 1. (10 points): A gift shop in Oslo has a stack of boxes in its warehouse filled with a popular brand of chocolate bars and each box contains equal number of chocolate bars. The stack has a total of 20 layers and, when counted from the top, the first layer of the stack has 25 boxes, the second layer has 27 boxes, the third layer has 29 boxes and so on. Each box is sold at NOK 1500 and it is expected all boxes will be sold by Christmas. What will be the total revenue for the shop from selling all the boxes? 2. (20 points): Anna is saving for her retirement. Currently her retirement account has NOK 100 000 on which she earns 5% annual interest that compounds monthly. She also decided that she will add NOK 500 at the end of each month to the same account for the coming 15 years. What will be the future value of the account in 15 years?