What is a physical change and what are several common examples?
Answer:
1.will not
2.crushing a rock
3.changes in the phase of mater
Explanation:
this teacher failing me i wanna get her back
what chemical species is called alpha particle
Answer:
Helium-4 atom
Alpha particle, positively charged particle, identical to the nucleus of the helium-4 atom, spontaneously emitted by some radioactive substances, consisting of two protons and two neutrons bound together, thus having a mass of four units and a positive charge of two.
Explanation:
hope this helps
Helium (⁴₂He) atoms are chemical species called alpha particles.
What is an alpha particle?Alpha particles or Alpha rays are positively charged particles emitted from the decay of several radioactive materials. The mass of the Alpha particle is due to the two protons and two neutrons. Therefore, the Alpha ray nucleus is very identical to the nucleus of the Helium atom. They are denoted by the Greek alphabet α.
An alpha particle is also known by the interchangeable term doubly ionized helium nuclei (He²⁺). The mass of an alpha particle is equal to 6.64 × 10⁻²⁷ Kg. Alpha particles are usually formed during the standard radioactive decay of atomic nuclei.
Alpha particles have an average kinetic energy of 5MeV and a velocity of 5% of that of the velocity of light. They are also generated in high-energy particle accelerators. They are highly ionized particles and have low penetration depth compared to other subatomic particles.
Learn more about alpha particles, here:
https://brainly.com/question/2288334
#SPJ5
3. Does matter increase in
mass when mixed with
another substance?
a Yes
b. No
Answer:
b. No
Explanation:
The question above is related to "The Law of Conservation of Mass." This law states that mass is neither created nor can it be destroyed. Even if a particular matter will be mixed with another substance or it undergoes chemical reaction, the mass of the matter will remain the same. Even with a change in phase, the mass of the matter will remain the same.
2. (2 points) Calculate the Effective Nuclear Charge for each atom. Show all of your work for full credit. Se: Br: (1 point) Which atom is larger? (This is your claim.)
Answer:
Bromine.
Explanation:
There is more nuclear charge on bromine because in bromine, there are 35 number of protons and 46 number of neutrons while in selenium, there are 34 number of protons and 45 number of neutrons. The atomic size of selenium is larger because they have lower nuclear charge as compared to bromine and we know that when we go to the left of periodic table atomic size increases which attract the electrons towards itself so the shell comes close to the nucleus and decrease occurs in atomic radius.
Write the chemical symbols for three different atoms or atomic anions with 23 electrons.
Krypton, Chromium, and Oxygen with the following symbols Kr-13, Cr-2, and O-15 respectively have 23 electrons.
The atomic number of an atom determines the number of electrons it has. When the number of protons is equivalent to the number of electrons, the atom is electrically neutral. An anion, on the other hand, is an atom with a negative charge. It has gained an electron or two, or even more. Below are the chemical symbols for three different atoms or atomic anions with 23 electrons.Krypton:Kr has an atomic number of 36, indicating that it has 36 electrons. However, if we add 13 electrons to it, the total number of electrons becomes 49. Krypton with 13 additional electrons becomes Kr-13, with a total of 49 electrons.Chromium:Cr has an atomic number of 24, indicating that it has 24 electrons. Adding two more electrons to it, the total number of electrons becomes 26. The atomic anion with 26 electrons is Cr-2.Oxygen:Oxygen has an atomic number of 8, indicating that it has 8 electrons. However, if we add 15 electrons to it, the total number of electrons becomes 23. Oxygen with 15 additional electrons becomes O-15, with a total of 23 electrons.
for more questions on electrons
https://brainly.com/question/371590
#SPJ8
Express the answer to the following in scientific notation.
850,000 - 9.0x10^5
The molar heat capacity is represented in the temp range 298 to 400 k by the emprical expression 14.73+0.1272 calculate the enthalpy if formation of ethane at 350 k from its valu at 298 k
Answer:
\(\Delta _f H=-81.1\frac{kJ}{mol}\)
Explanation:
Hello!
In this case, since the enthalpy of formation of ethane at 298 K is about -84 kJ/mol, via the Kirkoff's law, we can compute it a 350 K as shown below:
\(\Delta _f H=\Delta _f H\° +\int\limits^{350K}_{298K} {14.73+0.1272T} \, dx\)
It means we can integrate to get:
\(\Delta _f H=\Delta _f H\° +14.73\frac{J}{mol*K} (350K-298K)+\frac{0.1272}{2}\frac{J}{mol*K^2} (350K^2-298K^2)\)
Now, we can plug in the enthalpy of formation in consistent units to obtain:
\(\Delta _f H=-84,000\frac{J}{mol} +14.73\frac{J}{mol*K} (350K-298K)+\frac{0.1272}{2}\frac{J}{mol*K^2} (350K^2-298K^2)\\\\\Delta _f H=-81,091\frac{J}{mol}\\\\\Delta _f H=-81.1\frac{kJ}{mol}\)
Best regards!
what does rows represent on the periodic table
Answer:
Rows on the periodic table represents a period, which is the number of energy levels or rings. It is the last shell which valence electrons are on.
For example the first row waas Hydrogen and Helium which each have one energy level.
The esecond row has Carbon and Oxygen which has two energy level.
The third row has Sodium which has three energy levels and so on.
For the chemical reaction C2H6 + 137 kJ → C2H4 + H2, the chemical energy of the
a
reactant is greater than the chemical energy of the products.
b
products is greater than the chemical energy of the reactant.
c
reaction is conserved.
d
reactant and the chemical energy of the products are equal.
For a chemical reaction C₂H₆ + 137 kJ → C₂H₄ + H₂, the chemical energy of the reactant and the chemical energy of the products are equal. Option D is correct.
In an exothermic reaction, energy is released as the reactants are converted to products. The negative sign on the enthalpy change (ΔH) indicates that the reaction is exothermic, meaning that energy is released by the system to the surroundings. This energy comes from the chemical energy of the reactants, and in this case, 137 kJ of energy are released.
The chemical energy of a substance is the energy stored in the bonds between its atoms. In this reaction, C₂H₆ (ethane) is converted to C₂H₄ (ethylene) and H₂ (hydrogen gas), which means that some of the bonds in the reactant molecule are broken and new bonds are formed in the product molecules.
The total amount of energy stored in the bonds of the reactants is equal to the total amount of energy stored in the bonds of the products, since energy cannot be created or destroyed, only converted from one form to another. Therefore, the chemical energy of the reactant and the chemical energy of the products are equal.
Hence, D. is the correct option.
To know more about chemical energy here
https://brainly.com/question/30288262
#SPJ1
Energy and Enthalpy Changes, Heat and Work -- Monatomic Ideal Gas dynamically generated plot 2.00-mol of a monatomic ideal gas goes from State A to State D via the path A→B→C→D: State A PA=11.0atm, VA=12.50L State B PB=11.0atm, VB=7.00L State C PC=25.0atm, VC=7.00L State D PD=25.0atm, VD=20.50L Assume that the external pressure is constant during each step and equals the final pressure of the gas for that step. Calculate q for this process. q = 1pts Tries 0/6 Calculate w for this process. w = -902 J Use w = -PΔV and sum over the individual steps. Check that you have the correct energy units and be sure you have the sign right (w is defined as the work done ON THE SYSTEM). 1pts Incorrect. Tries 4/6 Previous Tries Calculate ΔE for this process ΔE = 1pts Tries 0/6 Calculate ΔH for this process. ΔH = 1pts
(a) The heat generated in the process is 28 kJ.
(b) The work done in the process is determined as -28 kJ.
(c) The change in the internal energy is 0.
Heat of the isothermal compression
The heat generated in the process is negative done in the process.
W = -PΔV
W = -P(V₂ - V₁)
From A to BW = -P(VB - VA)
W = -11(7 - 12.5)
W = 60.5 L.atm = 60.5 x 101.325 J/L.atm = 6,130.16 J
From C to DW = -25(20.5 - 7)
W = -337.5 L.atm = -34,197.18 J
Total work , w = -34,197.18 J + 6,130.16 J = -28 kJ
q = - w
q = 28 kJ
Change in internal energyΔE = q + w
ΔE = 28 kJ - 28 kJ = 0
Learn more about change in internal energy here: https://brainly.com/question/17136958
#SPJ1
1 gram of hydrogen ALWAYS reacts with 8 grams of oxygen. Precious mixes 2g of hydrogen with 20g of oxygen. (i) How much water is formed? [2
Answer:
18g
Explanation:
1g H + 8g O = 9g H2O since H is limiting factor
An OBJECT absorbs like between the light wavelengths of 430 - 400 nm. What is the color of the OBJECT?
The color of the object appears as yellow/orange.
What is the color?
The visible light spectrum spans a wavelength range of 400 to 700 nanometers (nm), with shorter wavelengths appearing as blue or violet and longer wavelengths as red.
This object is absorbing light with wavelengths between 430 and 400 nm, indicating that it is absorbing light that is visible in the blue and violet spectrum.
We know that this color that we see is actually a complementary color to blue/violet from the color wheel.
Learn more about color:https://brainly.com/question/796673
#SPJ1
Write the structure of nonessential saturated fatty acid with four double bonds and give the name
The nonessential saturated fatty acid with four double bonds is called Palmitoleic Acid, and its structural formula is CH₃(CH₂)₅CH=CH(CH₂)₇COOH. Its IUPAC name is (Z)-hexadec-9-enoic acid.
What are nonessential saturated fatty acids?Nonessential saturated fatty acids are fatty acids that can be synthesized by the human body and are not required to be obtained from the diet. The human body has the ability to produce these fatty acids through de novo synthesis.
The structure of a nonessential saturated fatty acid with four double bonds is as follows:
Name: Palmitoleic Acid
Structural Formula: CH₃(CH₂)₅CH=CH(CH₂)₇COOH
IUPAC Name: (Z)-hexadec-9-enoic acid
Learn more about nonessential saturated fatty acids on:
https://brainly.com/question/32255805
#SPJ1
How many ways can you recall to synthesize
there are an infinite number of ways to synthesize an answer to a question, including the following:
Summarize the key points in a concise manner.
Provide a detailed explanation of the topic.
Use examples or analogies to illustrate the concept.
Break down the answer into smaller, more digestible pieces.
Address potential counterarguments or alternative perspectives.
Incorporate relevant statistics or data to support the answer.
Compare and contrast different aspects of the topic.
Provide historical context or a timeline of events.
Use a storytelling approach to engage the reader.
Use a Q&A format to organize the information.
To know more about answer synthesize, visit:
https://brainly.com/question/30029537
#SPJ1
En la ecuación: Fe2O3 + CO = Fe + CO2.
El agente reductor es:
a)oxido ferrico
b)dióxido de carbono
c)monóxido de carbono
d)hierro
Answer:
English please
Explanation:
What is the molarity of a solution that contains 4.53 moles of lithium nitrate (LiNO3) in 2.85 liters of solution
Answer:
M= ml - 45301 - 11.59M.
Explanation:
Please help me ASAP ANYONE THANK YOU VERY MUCH(:!!??
The recipe conversion factor (RCF) is 2.5 (option A).
How to calculate conversion factor?Recipes often need to be adjusted to meet the needs of different situations. The most common reason to adjust recipes is to change the number of individual portions that the recipe produces.
The most common way to adjust recipes is to use the conversion factor method.
The conversion factor can be obtained by dividing the required yield by the old yield i.e.
Conversion factor = required/new yield/recipe/old yield
Conversion factor = 25/10
Conversion factor = 2.5
Learn more about conversion factor at: https://brainly.com/question/3280652
#SPJ1
LAPTOP CART 3
COMPUTER 15
Match the group with it's correct group name.
Group Name
1. alkaline earth metals
2. halogens
3. transiton metals
4. carbon family
5. noble gases
6. alkali metal
7. boron family
8. nitrogen family
9. oxygen family
Periodic Table Quiz
Group
a 1 or IA
-configuration
b. 2 or 2A
c. 3 or 3A
d.
14 or 4A
15 or SA
f. 16 or 6A
17 or 7A
b. 18 or SA
3B to 2B
Answer the following questions.
10. How many valence electrons do the halogens have in their valence shell?
11.How many valence electrons do the alkali metals have in their valence shell?
12. The maximum of valence electrons is?
13. The principle that the properties of the elements are arranged in increasing order of
their atomic numbers is called the
14. The group of eight electrons filling the s and p orbitals of the higher-most energy
level of an atom is called
15. Give the noble gas for Al
16. Give the configuration for Ca
17. Give the configuration for Ca ion
18. Give the configuration for the elements that are isoelectronic with Neon (Ne) when
they form a l' ion element name
e-configuration
e-configuration
19.
1-ion element name
20. Which group of elements is the least reactive?
fout act
l
wwww yo
WHEAT AND
Group 1 (Alkali Metals)
Group 2 (Alkaline Earth Metals)
Group I: Lithium and sodium make up the elements.
Chlorine and bromine are the elements in Group I7.
Neon and argon are the elements in Group I8.
What are halogens?
The only periodic table group with elements in all three of the primary states of matter at standard pressure and temperature—though not much above room temperature—is the group of halogens. In groups 1 and 15, the same holds true if white phosphorus is assumed to be the standard state.
All of the halogens react with hydrogen to create acids.
Minerals or salts are often used to manufacture the majority of halogens.
To know more about halogens, click the link given below:
brainly.com/question/11156152
#SPJ1
what are the condition for a gas like carbon (II) oxide to obey the gas laws?
Answer:
I don't know the answer, but I can give options :)
Explanation:
A gas such as carbon monoxide would be most likely to obey the ideal gas law at:
Option 1) High temperatures and low pressure.
Option 2) Low temperatures and high pressure.
Option 3) High temperatures and high pressure.
Option 4) Low temperatures and low pressure.
Answer:
The gas must occupy 0 volume at -273°celcius
Why are plastic containers preferred to glass containers for storing chemicals in the laboratory?
What common characteristics do all planets share?
A Planets are made of gas, orbit the sun, and have atmospheres.
B Planets are made of rock, orbit the sun, and have atmospheres.
C Planets have moons, have atmospheres, and are made of rock, gas, or ice.
D Planets have atmospheres, are made of rock or gas, and some have moons or rings.
Answer:
The answer is D
Explanation:
A block of metal has a mass of 18.361kg and the following dimensions: 22.35 cm x 7.34 cm x 22.05 mm. What is the density of the metal in g/cm^3
Answer:
50.76 g/cm³
Explanation:
We'll begin by converting 18.361 Kg to g. This can be obtained as follow:
1 Kg = 1000 g
Therefore,
18.361 Kg = 18.361 Kg × 1000 g / 1 Kg
18.361 Kg = 18361 g
Next, we shall express the dimension in the same unit of measurement.
Dimension = 22.35 cm x 7.34 cm x 22.05 mm
Thus, we shall convert 22.05 mm to cm. This can be obtained as follow:
10 mm = 1 cm
Therefore,
22.05 mm = 22.05 mm × 1 cm / 10 mm
22.05 mm = 2.205 cm
Thus, the dimension is 22.35 cm x 7.34 cm x 2.205 cm.
Next, we shall determine the volume of the metal. This can be obtained as follow:
Dimension = 22.35 cm x 7.34 cm x 2.205 cm.
Volume = 361.728045 cm³
Finally, we shall determine the density of the metal. This can be obtained as follow:
Mass of metal = 18361 g
Volume of metal = 361.728045 cm³
Density of metal =?
Density = mass / volume
Density of metal = 18361 / 361.728045
Density of metal = 50.76 g/cm³
would you like to explore outer space? Why or why not? If you could travel to any part of the galaxy at lightning speed would like to see what is truly out in the universe would you do it? Why or why not?
Answer:
Yes!
Explanation:
I think It would be fun!, Going thought space going from planet to planet. once i get back to earth i can make a document about my time in space.
When water evaporates from a plant's leaves, this process is
called
Answer:
transpiration
Explanation:
Answer:
Transpiration
Explanation:
1How do you calculate magnification on a light microscope?
When a substance is changing state, temperature stays the same at the melting and boiling point is this true or false
Answer:
True
Explanation:
hope this helps :)
Iron and Chlorine gas react according to the following balanced equation: 2 Fe(S) + 3 Cl2 (g) 2 FeCl3(s) a) Calculate the molar mass in grams of “one mole” of each of the following: Fe ________ Cl2 __________________ FeCl3 ______________
The molar mass in grams of "one mole" of each substance is:
Fe: 55.845 g/mol
\(Cl_2\): 70.906 g/mol
\(FeCl_3\): 162.204 g/mol
To calculate the molar mass in grams of "one mole" of each substance, we need to determine the atomic masses of the elements involved in the equation.
The atomic mass of iron (Fe) is 55.845 g/mol.
For chlorine (\(Cl_2\)), we need to consider that the molar mass of \(Cl_2\) is twice the atomic mass of chlorine because the formula shows that two chlorine atoms combine to form one molecule of \(Cl_2\). The atomic mass of chlorine is 35.453 g/mol, so the molar mass of \(Cl_2\) is 2 * 35.453 g/mol = 70.906 g/mol.
The formula for iron(III) chloride (\(FeCl_3\)) indicates that one mole of \(FeCl_3\)contains one mole of iron and three moles of chlorine. Therefore, we can calculate the molar mass of \(FeCl_3\)by summing the atomic masses of iron and chlorine:
Molar mass of \(FeCl_3\)= (1 * atomic mass of Fe) + (3 * atomic mass of Cl)
Substituting the values, we have:
Molar mass of \(FeCl_3\) = (1 * 55.845 g/mol) + (3 * 35.453 g/mol)
= 55.845 g/mol + 106.359 g/mol
= 162.204 g/mol
For more such questions on molar mass visit:
https://brainly.com/question/837939
#SPJ8
Select the structure that corresponds
to the molecule name:
aniline
B.
A.
-NH₂
C. both
-NH₂
Enter
Answer:
B- \(C_{6} H_{5} NH_{2}\)Explanation:
Aniline is an organic compound with the formula C6H5NH2. Consisting of a phenyl group attached to an amino group, aniline is the simplest aromatic amine.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
ASHTON WANTS TO FIND THE VOLUME OF A BLOCK OF WOOD
Explanation:
need help in a question u stuck in??