PLZZZ HELPPPPPP

Choose the reaction type for the following.

LigN+ 3NH4NO3 + 3LiNO: + (NH4)2N

PLZZZ HELPPPPPPChoose The Reaction Type For The Following.LigN+ 3NH4NO3 + 3LiNO: + (NH4)2N

Answers

Answer 1

Answer:

double displacement reaction


Related Questions

Carbon disulfide and carbon monoxide are produced when carbon is heated with sulfur dioxide.
5C(s)+2SO2(g)→CS2(l)+4CO(g)
How many moles of C are needed to react with 0.460 mole SO2?
How many moles of CO are produced when 2.0 moles C reacts?
How many moles of SO2 are required to produce 0.35 mole CS2?
How many moles of CS2 are produced when 2.4 moles C reacts?

Answers

1) To react with 0.460 mole of SO₂, 1.15 moles of C are needed.

2) When 2.0 moles of C reacts, 1.6 moles of CO are produced.

3) To produce 0.35 mole of CS₂, 0.70 moles of SO₂ are required.

4) When 2.4 moles of C reacts, 0.48 moles of CS₂ are produced.

1.

From the balanced equation, the stoichiometric ratio between C and SO₂ is 5:2. Therefore, to calculate the moles of C required, we can set up a proportion:

(5 moles C / 2 moles SO₂) = (x moles C / 0.460 moles SO₂)

Solving for x, we find:

x = (5/2) × 0.460 = 1.15 moles C

2.

From the balanced equation, the stoichiometric ratio between C and CO is 5:4. Therefore, to calculate the moles of CO produced, we can set up a proportion:

(5 moles C / 4 moles CO) = (2.0 moles C / x moles CO)

Solving for x, we find:

x = (4/5) × 2.0 = 1.6 moles CO

3.

From the balanced equation, the stoichiometric ratio between SO₂ and CS₂ is 2:1. Therefore, to calculate the moles of SO₂ required, we can set up a proportion:

(2 moles SO₂ / 1 mole CS₂) = (x moles SO₂ / 0.35 moles CS₂)

Solving for x, we find:

x = (2/1) × 0.35 = 0.70 moles SO₂

4.

From the balanced equation, the stoichiometric ratio between C and CS₂ is 5:1. Therefore, to calculate the moles of CS₂ produced, we can set up a proportion:

(5 moles C / 1 mole CS₂) = (2.4 moles C / x moles CS₂)

Solving for x, we find:

x = (1/5) × 2.4 = 0.48 moles CS₂

Learn more about number of moles from the link given below.

https://brainly.com/question/20370047

#SPJ4

Which of these is not an essential element of the
petroleum system for oil and gas to exist? a. Reservoir Rock b. Organic Matter c. Source Bed d. Cap Rock

Answers

The option b) is correct since an organic matter is not an essential element for oil and gas to exist in the petroleum system. The key components of the petroleum system are reservoir rock, source bed, and cap rock.

Reservoir rock provides the porous structure to hold oil and gas, while the source bed is where organic matter undergoes thermal maturation to generate hydrocarbons.

Caprock acts as a seal, preventing the upward migration of hydrocarbons.

These three elements—reservoir rock, source bed, and cap rock—are essential for the formation and accumulation of oil and gas.

Organic matter itself, while serving as the source material for hydrocarbon generation, is not considered an essential element within the petroleum system.

Thus, the option b) is correct because organic matter is not an essential element for oil and gas to exist in the petroleum system.

Read more about  Essential element.

https://brainly.com/question/30752057

#SPJ11

Using dimensional analysis, how many kilometers are there in 34 inches?

Answers

Answer:

There are many ways to figuring this out: you could use a ruler, a calculator or scrap paper.

Explanation:

This is not an actual flat out answer, but it’s helpful methods to getting the answer the next time you are stuck. Hope you are having a nice day. Bless your heart and soul.

Pls help me here, thanks in advance

Pls help me here, thanks in advance

Answers

Answer:

i think is

first is 2

second is 3

third is 2

fourth is 2

Answer:

which one do you want me to do there is four questions

beryllium and iodine

Express your answer as a chemical formula.

Answers

Answer:  Aberham Lincon was an basketball player for the brick walls and then got traded to the wasthiton bottle caps then I will go to the bus stop

Explanation:

which of the following molecules has hydrogen bonding as its only intermolecular force? group of answer choices none of these choices is correct h2o ch3oh nh3 hcl

Answers

None of these choices is correct. The given molecules have intermolecular forces other than hydrogen bonding, such as dipole-dipole interactions or London dispersion forces.

Among the given choices, none of these molecules exhibit hydrogen bonding as their main keyword. Hydrogen bonding occurs when hydrogen is bonded directly to highly electronegative elements like oxygen, nitrogen, or fluorine.

H2O (water) exhibits hydrogen bonding due to the hydrogen atoms bonding with oxygen, resulting in strong intermolecular forces. CH3OH (methanol) also has hydrogen bonding because of the oxygen-hydrogen bonds.

However, NH3 (ammonia) and HCl (hydrochloric acid) have dipole-dipole interactions as their main intermolecular forces. Ammonia has a lone pair of electrons on the nitrogen atom, creating a dipole moment. Hydrochloric acid has a polar covalent bond, leading to dipole-dipole interactions.

In conclusion, while all the given molecules have intermolecular forces, hydrogen bonding is not the only intermolecular force present in any of them.

Learn more about hydrogen bonding here:

https://brainly.com/question/31139478

#SPJ11


Which of these is a dependent variable in this demonstration?
A. the amount of water in the pan
B. the height of the water in the jar
C. the size of the bottle
D. the number of candles in the jar

Answers

Answer:

B). The height of the water in the jar.

Explanation:

A dependent variable is characterized as the variable that observes the change or effect caused by experimental manipulation in the independent variable. It is the variable that is being tested in the experiment. In the given experiment of the burning candle, 'the height of water in the jar' will rise or drop with manipulation in the independent variable i.e. 'the number of candles.' Since it is affected by the alteration in other variables, it is the dependent variable. Thus, option B is the correct answer.

Question ( please help me )

1 . Which diagram shows pure substance that are elements

2. Which diagram shows pure substance are compounds

3. Which diagram shows a mixture of compounds

4. Which diagram shows a mixture of elements

5. Which diagram shows a mixture of an element and a compound

Question ( please help me )1 . Which diagram shows pure substance that are elements2. Which diagram shows

Answers

Answer:

1. F, H, E

2. A, D, I

3. G

4. E, B, H

5. C

Explanation:

What type of chemical reaction is this one?
C2H2 + O2 --> CO2 + H2O

Answers

Answer:

unbalanced

Explanation:

as the atoms on the one side do not equal to the atoms on the other sides

Elements in a ___ on the Period Table of Elements have similar chemical characteristics and properties.

Answers

The answer is : Group

The melting point of a pure substance is -187˚C. Its boiling point is 42˚C. What is its physical state at room temperature?

Answers

Explanation:

We can assume that room temperature is 25 °C.

The melting point of a pure substance is the temperature at which it changes state from solid to liquid. The metling point of our substance is -187 °C. Since the room temperature is 25 °C we can say that it won't be solid. At least it will be liquid.

The boiling point of a pure substance is the temperature at which it changes state from liquid to gas. The boiling point of our substance is 42 °C. At room temperature we are under that temperature, so it won't convert into a gas. It will remain as a liquid also.

Since room temperature is between the boiling and melting point of our substance, the physical state is liquid.

Answer: liquid

If the volume of the gas is increased to 5.30 L, what is the pressure?
(Assume constant temperature.)
Express your answer in millimeters of mercury to three significant
figures.

Answers

The final pressure can be calculated using Boyle's law. The final pressure of the gas if the volume is increased from 3.98 L to 5.30 L is obtained as 526.4 mmHg.

What is Boyle's law?

Boyle's law states that at constant temperature, the volume of a gas is inversely proportional to the pressure of the gas. Hence, volume decreases with increase in pressure and vice versa.

If P₁ and V₁ be the initial pressure and volume respectively and P₂, V₂ be their final quantities, then the relation between them can be written as:

P₁  V₁  =  P₂ V₂ .

It is given that the initial volume and pressure is 3.98 L and 701 mmHg, and the final volume is 5.30 L. Then, the final pressure is calculated as follows:

P₂ =  P₁  V₁ / V₂

    = (3.98  L × 701 mm Hg) / 5.30 L

    = 526.4 mmHg.

Hence, the final pressure of the gas will be 526.4 mmHg.

To find more on Boyle's law, refer here:

https://brainly.com/question/1437490

#SPJ1

Your question is incomplete, but your complete question probably was:

A sample of gas has an initial volume of 3.98 L at a pressure of 701 mmHg If the volume of the gas is increased to 5.30 L, what is the pressure? (Assume constant temperature.)

Select six different types of energy. physical light chemical mechanical atomic electrical mental heat

Answers

Answer:

Mechanical energy is energy that results from movement or the location of an object. Mechanical energy is the sum of kinetic energy and potential energy.

Explanation:

Nuclear energy is energy resulting from changes in the atomic nuclei or from nuclear reactions.

Example: Nuclear fission, nuclear fusion, and nuclear decay are examples of nuclear energy. An atomic detonation or power from a nuclear plant are specific examples of this type of energy.

How many atoms of each element are in the chemical formula......
CA(OH)2

A.1 calcium, 1 oxygen, and 1 hydrogen

B.1 calcium, 2 oxygen, and 2 hydrogen

C.2 calcium, 1 oxygen, and 2 hydrogen

D.2 calcium, 2 oxygen, and 2 hydrogen

Answers

Answer:

Option B. 1 calcium, 2 oxygen, and 2 hydrogen

Explanation:

The number of each atoms present in Ca(OH)2 can be summarised as follow:

Calcium (Ca) = 1

Oxygen (O) = 2

Hydrogen (H) = 2

From the above illustration, we can see clearly that Ca(OH)2 contains 1 calcium, 2 oxygen and 2 hydrogen.

Answer:

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

1 calcium, 2 oxygen, and 2 hydrogen

XD

Explanation:

What is Atomic Radius

Answers

Answer:

Atomic Radius can be simply defined as the distance between the last shell of electrons and the nucleus of an atom.

Answer: The atomic radius of a chemical element is a measure of the size of its atoms, usually the mean or typical distance from the center of the nucleus to the boundary of the surrounding shells of electrons. Illustrated Glossary of Organic Chemistry - Atomic radius. Atomic radius: The radius of an atom. This distance between an atom's nucleus and outer electron shell. ... Atomic radius differs with the bonding state of an atom (for example a nonbonded atom of an element versus the same element within a covalent bond). Atomic radius is determined as the distance between the nuclei of two identical atoms bonded together. The atomic radius of atoms generally decreases from left to right across a period. The atomic radius of atoms generally increases from top to bottom within a group.

hope this helps..... Stay safe and have a great weekend!!!! :D

Is wax a good conductor of electricity?

Answers

No, it isn’t but it is a good heat conductor, metal is a good electricity conductor though

Ara Ara... well... hope this helps
Is wax a good conductor of electricity?

questions 4-7 are related to the following organic synthesis reaction. there are four total reactions associated with this reaction sequence. questions 4 and 5 will be multiple choice and questions 6 and 7 will be short answer. question 4 - what is the necessary reagent to accomplish step 1 of this reaction sequence?

Answers

To accomplish step 1 of this organic synthesis reaction, the necessary reagent is sodium hydride (NaH). This is a strong base commonly used in organic synthesis to remove acidic hydrogen atoms and form new carbon-carbon bonds. In this reaction, NaH is used to deprotonate the alpha carbon of the ketone, forming an enolate ion.

The enolate ion then attacks the electrophilic carbon of the ester in an aldol condensation reaction, resulting in the formation of a beta-hydroxyketone product.
NaH is preferred over other bases because it is highly reactive and can be easily removed from the reaction mixture by filtration. Additionally, it does not add any unwanted byproducts to the reaction, making it a clean and efficient choice. Other bases, such as potassium tert-butoxide or lithium diisopropylamide (LDA), could also be used in this reaction, but NaH is often the preferred choice due to its high reactivity and ease of use.

for more such questions on  sodium hydride

https://brainly.com/question/13061869

#SPJ11

calcium bicarbonate produced in the chemical weathering process of carbonation ________.

Answers

Carbonation is a crucial process in rock breakdown and formation of karst topography, involving the formation of calcium bicarbonate through precipitation of carbon dioxide and dissolved substances. This process affects rocks' physical properties and regulates atmospheric carbon dioxide concentration.

Calcium bicarbonate produced in the chemical weathering process of carbonation causes the rock to become weak and break down. This occurs when rainwater reacts with carbon dioxide and turns into a weak carbonic acid solution that can dissolve rocks. As a result, carbonation is an essential process in the breakdown of rocks and formation of karst topography.The chemical formula of calcium bicarbonate is Ca(HCO3)2. It is formed when rainwater, which contains carbon dioxide, reacts with rocks that contain calcium carbonate (CaCO3) like limestone and marble. The reaction is as follows:

CaCO3 + H2CO3 → Ca(HCO3)2

The carbonic acid solution reacts with the rock and breaks it down into calcium bicarbonate and other dissolved substances. Calcium bicarbonate is carried away by groundwater and eventually deposits to form stalactites, stalagmites, and other types of cave formations.

This chemical weathering process of carbonation not only affects the physical properties of rocks but also plays a significant role in the carbon cycle of the Earth. Carbonation helps to regulate the concentration of carbon dioxide in the atmosphere by removing it and storing it underground in the form of calcium carbonate deposits.

To know more about Carbonation Visit:

https://brainly.com/question/14581272

#SPJ11

What is a molecular orbital energy diagram? and draw it?

Answers

An atomic orbital is a three-dimensional representation of the position of an electron relative to an atom's nucleus. In other words, there is a maximal likelihood of discovering an electron in an atomic orbital.

A molecular orbital diagram, also referred to as a MO diagram, is a qualitative descriptive tool used in conjunction with the linear combination of atomic orbitals (LCAO) approach and general molecular orbital theory to describe chemical bonding in molecules. These ideas are founded on the fundamental assumption that as atoms unite to form molecules, a certain number of atomic orbitals combine to produce the same number of molecular orbitals, even though the electron distribution of the orbitals may differ. This approach becomes more difficult when talking about even very straightforward polyatomic molecules, like methane. For straightforward diatomic compounds like carbon monoxide, oxygen, and dihydrogen, it performs admirably. The existence of some molecules and the absence of others can be explained via MO diagrams. They are able to forecast bond strength as well.

To know more about orbital diagram please refer:

https://brainly.com/question/19044422

#SPJ4

What is a molecular orbital energy diagram? and draw it?

materials generally become warmer when light is reflected by them. absorbed by them. transmitted by them. all of these none of these

Answers

Materials generally become warmer when they are "absorbed" by light, this statement is more detailed. So, the correct answer is "absorbed by them."

Explanation: When a material absorbs light, it receives energy from the light, which leads to an increase in temperature. When light is absorbed by a material, the energy of the light is transformed into internal energy in the material. The temperature of a material can increase as a result of this energy absorption.

This is due to the fact that the increased internal energy of the molecules in the material causes them to vibrate more quickly and hence results in a temperature rise.

The light reflects or transmits when it passes through the material. When light reflects off a surface, it bounces back in the opposite direction. Transmitted light travels through a material without being absorbed by it.

To learn more about Materials visit;

https://brainly.com/question/27403649

#SPJ11

True or false the stomach is made of strong muscles that mix the food with digestive juices.
plz answers QUICK !
i will make you the brainist if you answer FIRST !

Answers

Answer:

it is true that stomach is made of muscle that mix food with digestive juices.

Answer:

true

Explanation:

the stomach is full of mussels and stomach acid is used to break down food

helpp!!
how much energy is required to heat up 100.0 grams of water from 0.000C to 60.00C?

helpp!!how much energy is required to heat up 100.0 grams of water from 0.000C to 60.00C?
helpp!!how much energy is required to heat up 100.0 grams of water from 0.000C to 60.00C?

Answers

Answer:

25,104

Explanation:

100.0 x 4.184 x 60.0 = 25,104

Energy required to heat up 100 grams of water(4.184J/g°C) from 0.000C to 60.00C is 25,104.

What is Thermodynamics?

The science of thermodynamics examines the connections between heat, work, temperature, and energy. The rules of thermodynamics explain how energy moves inside a system and whether or not the system is capable of performing beneficial work on its surroundings. The heat needed to increase one gram of a substance's temperature by one degree Celsius is known as specific heat capacity.

Here,

The specific heat capacity of water is 4.184 J/g° C

This is the heat required to increase the temperature by 1°C.

same way, 4.186J is heat required to raise the temp of 1 gram of water.

Derived equation is: q = mcΔT

Where,

q is heat required

c is specific heat capacity of the substance

m is mass of the substance and

ΔT is the change in temperature

Given,

m = 100g

ΔT = 60.00C - 0.00C

ΔT = 60°C

c = 4.184 J/g°C

now, substitute the values:

q = mcΔT

q = 100 × 60 × 4.184

∵ q = 25,104

To know more about Thermodynamics, visit:

https://brainly.com/question/3808473

#SPJ2

1 pts Question 7 Which of the following would generally result in a solid coming out of a solution a (crystallization)? Choose all that apply. Lower the temperature. Raise the temperature. Increase the pressure of the solution. Decrease the pressure of the solution

Answers

Lowering the temperature and increasing the pressure of the solution would generally result in a solid coming out of a solution through crystallization.

Crystallization is a process in which a solid forms from a solution by the arrangement of particles into a regular, repeating pattern. Here are the steps involved:

1. Dissolving: Initially, a solute is dissolved in a solvent to form a solution. The solute particles are dispersed and surrounded by the solvent molecules.

2. Saturation: The solution is then brought to a state of saturation by adding more solute or removing the solvent, such that no more solute can dissolve. At this point, the solution contains a high concentration of the solute.

3. Nucleation: When the solution becomes saturated, it becomes unstable, and the solute molecules start to come together and form tiny clusters or nuclei. These nuclei serve as the starting points for crystal growth.

4. Crystal Growth: Once the nuclei form, they start growing as more solute particles join the crystal lattice. This growth occurs by the addition of solute molecules from the solution onto the existing crystal surface.

Now, let's look at how temperature and pressure affect this process:

- Lowering the temperature: Decreasing the temperature of the solution slows down the movement of solute molecules, reducing their kinetic energy. This leads to a decrease in solubility, meaning less solute can remain dissolved in the solution. As a result, excess solute comes out of the solution and starts forming crystals.

- Increasing the pressure: When the pressure of the solution is increased, it compresses the solvent and alters its properties. This compression can enhance the solubility of the solute, allowing it to dissolve more effectively. Consequently, increasing pressure generally inhibits crystallization as more solute remains dissolved in the solution.

Therefore, lowering the temperature favors crystallization by decreasing solubility, while increasing the pressure generally inhibits crystallization by increasing solubility.

Learn more about Crystallization here

https://brainly.com/question/1212769

#SPJ11

How much energy does it take to boil 100 mL of water? (Refer to table of constants for water. )
A. 100 mL × 1g divided by 1mL × 1mol divided by 18. 02g × 6. 03 kJ/mol = 33. 5 kJ
B. 100 mL × 1g divided by 1mL × 1mol divided by 18. 02g × (–285. 83 kJ)/mol = –1586 kJ
C. 100 mL × 1g divided by 1mL × 1mol divided by 18. 02g × 40. 65 kJ/mol = 226 kJ
D. 100 mL × 1g divided by 1mL × 1mol divided by 18. 02g × 4. 186 kJ/mol = 23. 2 kJ

Answers

Therefore, it takes approximately 23.2 kJ of energy to boil 100 mL of water.

The correct answer is D. 100 mL × 1g divided by 1mL × 1mol divided by 18.02g × 4.186 kJ/mol = 23.2 kJ

To calculate the energy required to boil 100 mL of water, we need to use the specific heat capacity of water, which is approximately 4.186 J/g·°C. The molar mass of water is 18.02 g/mol.

First, we convert the volume of water from milliliters to grams:

100 mL × 1 g/1 mL = 100 g

Then, we calculate the number of moles of water:

100 g × 1 mol/18.02 g = 5.548 mol

Finally, we multiply the number of moles by the molar heat of vaporization of water, which is approximately 40.65 kJ/mol:

5.548 mol × 4.186 kJ/mol = 23.2 kJ

Therefore, it takes approximately 23.2 kJ of energy to boil 100 mL of water.

Learn more about energy

https://brainly.com/question/8630757

#SPJ11

what chromatographic method should make it possible to isolate pure a and b chains?

Answers

Size-exclusion chromatography (SEC) is a suitable chromatographic method for isolating pure a and b chains.

SEC is a technique that separates molecules based on their size. In this case, the a and b chains can be separated from other components based on their molecular weight. SEC columns have porous beads that allow smaller molecules to enter and travel through the beads, while larger molecules are excluded and elute first. By choosing an appropriate SEC column, the a and b chains, which typically have different molecular weights than other components, can be isolated and collected separately. This method ensures the purity of the isolated a and b chains.

Size-exclusion chromatography (SEC) is a useful chromatographic method for isolating pure a and b chains. The technique separates molecules based on their size, and by utilizing a suitable SEC column, the a and b chains can be separated from other components due to their distinct molecular weights. This approach guarantees the purity of the isolated a and b chains, making it an effective method for their isolation.

To learn more about chromatography click here;

brainly.com/question/28731153

#SPJ11

mass of 2 into 10 to power 21 number of atoms of an element is 0.4 gram what is the mass of 0.5 mole of the elements​

Answers

The mass of 0.5 mole of the element is approximately 6.025 grams.

To calculate the mass of 0.5 mole of the element, we need to know the molar mass of the element.

Given that the mass of 2 x 10^21 atoms of the element is 0.4 grams, we can use this information to find the molar mass.

The number of atoms in 1 mole of any substance is given by Avogadro's number, which is approximately 6.022 x 10^23 atoms/mol.

First, we calculate the molar mass of the element using the given information:

Molar mass = Mass of 2 x 10^21 atoms / Number of moles of 2 x 10^21 atoms

Molar mass = 0.4 g / (2 x 10^21 atoms / (6.022 x 10^23 atoms/mol))

Molar mass ≈ 0.4 g / (3.32 x 10^-2 mol)

Molar mass ≈ 12.05 g/mol

Now that we know the molar mass of the element is approximately 12.05 g/mol, we can calculate the mass of 0.5 mole of the element:

Mass = Molar mass x Number of moles

Mass = 12.05 g/mol x 0.5 mol

Mass = 6.025 grams

for more such questions on element

https://brainly.com/question/28376204

#SPJ8

The following is needed on this exercise:
specific heat of (water=4.184J/g °C; ice=2.03 J/g °C;
steam=1.99 J/g °C); heat of vaporization of water = 540 cal/g; heat of fusion of water=80. Cal/g)
1) Calculate the energy required to convert all 15.0 g of ice to water (liquid) at its melting point – Show all your work.

Answers

The energy required to convert all 15.0 g of ice to water (liquid) at its melting point is 303 J

To calculate the energy required to convert 15.0 g of ice to water (liquid) at its melting point, we need to use the following equations:

Q = m x c x (Tfinal – Tinitial)

Q = Energy (J)
m = mass (15.0 g)
c = specific heat of ice (2.03 J/g °C)
Tfinal = Final temperature (0 °C)
Tinitial = Initial temperature (-10 °C)

Q = 15.0 g x 2.03 J/g °C x (0 °C – (-10 °C))

Q = 15.0 g x 2.03 J/g °C x 10 °C

Q = 303 J

Therefore, the energy required to convert all 15.0 g of ice to water (liquid) at its melting point is 303 J.

To know more about melting point refer here:

https://brainly.com/question/29578567#

#SPJ11

What product results from the reaction of CH2==CH2 with Br2?
A. CHBrCHBr
B. CH2CHBr
C. CH3CH2Br
D. CH2BrCH2Br

Answers

The correct option is:D. CH2BrCH2Br.  The product that results from the reaction of CH2=CH2 (ethylene) with Br2 (bromine) is CH2BrCH2Br (1,2-dibromoethane). The reaction of CH2==CH2 with Br2 is a halogenation reaction, which involves the addition of a halogen to an unsaturated organic compound.

The product that results from this reaction is CH2BrCH2Br, which is option D. This product is formed by the addition of one Br atom to each of the carbon atoms in the double bond of ethene. The resulting molecule is a dibromoalkane, which is a type of organic compound that contains two bromine atoms attached to adjacent carbon atoms. This reaction is an example of an addition reaction, where the unsaturated organic compound undergoes a reaction with a halogen to form a saturated organic compound. In summary, the correct answer is D, CH2BrCH2Br. This reaction is an example of an addition reaction, in which the bromine atoms are added to the carbon atoms in the double bond, resulting in a single bond between the carbon atoms and a bromine atom attached to each carbon.

Learn more about halogenation reaction here

https://brainly.com/question/31477102

#SPJ11

Jacqueline is interested in helping her overweight cat lose weight so that he will be healthier and more active. She selects a new cat food based on the label’s claim that it can help with weight loss. Jacqueline measures out the food carefully each day, has been weighing the cat every 48 hours, and records the measurement. What keeps this practice from being a scientific experiment? A. There is only one cat and one type of food being used. B. The cat should be weighed every day to collect more data. C. She has not considered whether the cat will like the new food. D. The food is not the brand that Jacqueline’s friend used for his overweight

Answers

Answer:

sorry bro / sis this is too long question soo try by yourself

Why is pH important for the ocean?

Answers

Answer:

If the ocean is to acidic, people and plants would be negatively affected.

Explanation:

Answer:

if would be dangerous for the animals in water.

Explanation:

Other Questions
Why did the British forces expect to be successful in South Carolina? A.There was a large number of Loyalists in South Carolina B.The British promised the Patriots land lost in the French and Indian War C.Lowcountry Elite had refused to participate in the Revolutionary War D.South Carolina proved to be ineffective in battle after the Cherokee War If this is an autosomal recessive disorder, of the following individuals, which is not an obligate carrier?. y = 15x + 375.Graph the linear equation. What law do you use for SSS? HELP PLEASE WILL MARK BRANILY episodic and residual variations can be projected into the future. true false which of the following events in afghanistan changed the course of the war and contributed to the soviets defeat in 1989? describe the dynamics at the end of this excerpt. group of answer choices ritardando crescendo decrescendo accelerando A 5.00L evacuated cylinder is charged with 25.5g of NH3 and 36.4 g of HCl. Calculate the final pressure at 85.0C after the two compounds have reacted completely: NH3(g)+HCl(g)NH4CI(s)A2.94 atmB5.88atmC8.82atmD14.7atm If mBC in circle A is 60, what is mBDC?. 60. 45C. 30D. 25 _____________ encompasses a societal and professional standard of right and fair practices that are expected of marketing managers in their oversight of strategy formation, implementation, and control. Group of answer choices Fair business practices Organizational responsibility Marketing ethics Sustainability Social consciousness Aspects of the social context that a person grew up in and is now functioning in (macro level context) include:_____ The age of an ancient tree trunk is estimated using radiocarbon dating. If the trunk has a C-14 decay rate that is 34% of what it is in living plants, how old is the trunk, years since healthj motivation is its dentral foxus, the __ is a good fit for adressing problem bhwaviors that evoke health concersn r The following data show the height, in inches, of 11 different garden gnomes: 2 9 1 23 3 7 10 2 10 9 7 after removing the outlier, what does the mean absolute deviation of this data set represent? Order the numbers from least to greatest. An union representative studies the weekly income for a senior level worker position in an automobile industry. It is obtained that a 95% confidence interval for the mean weekly income of all employees of the same senior position is ($1371, $1509). Which one of the following interpretations of this interval is correct?A.We conclude that 95% of all employees from the this position have income between $1371 and $1509 per week.B.We can 95% confident that the sample mean is between $1371 and $1509.C.If random samples of nine employees were repeatedly selected from the population of all employees from the this position, then 95% of the time the sample mean income would be between $1371 and $1509.D.If random samples of nine employees were repeatedly selected from the population of all employees from the this position, then 95% of the time the population mean income would be between $1371 and $1509. at what rotation rate, in revolutions per second, will the astronaut experience a centripetal acceleration of 17.0g what jeans brand should i buy from? Organizational behavior emerged as a distinct field? around world war ii in the 1970s. in the early 1900s. around 500 bc in the 1770s.