To prove that the expression sin(e) csc(cose) + sec(tan(coto)) is an identity, we need to simplify it using trigonometric identities. Let's start:
Recall the definitions of trigonometric functions:
- cosec(x) = 1/sin(x)
- sec(x) = 1/cos(x)
- tan(x) = sin(x)/cos(x)
Substituting these definitions into the expression, we have:
sin(e) * (1/sin(cose)) + (1/cos(tan(coto)))
Since sin(e) / sin(cose) = 1 (the sine of any angle divided by the sine of its complementary angle is always 1), the expression simplifies to:
1 + (1/cos(tan(coto)))
Now, we need to simplify cos(tan(coto)). Using the identity:
tan(x) = sin(x)/cos(x)
We can rewrite cos(tan(coto)) as cos(sin(coto)/cos(coto)).
Applying the identity:
cos(A/B) = sqrt((1 + cos(2A))/(1 + cos(2B)))
We can rewrite cos(sin(coto)/cos(coto)) as:
sqrt((1 + cos(2sin(coto)))/(1 + cos(2cos(coto))))
Finally, substituting this back into our expression, we have:
1 + (1/sqrt((1 + cos(2sin(coto)))/(1 + cos(2cos(coto)))))
This is the simplified form of the expression.
By simplifying the given expression using trigonometric identities, we have shown that sin(e) csc(cose) + sec(tan(coto)) is indeed an identity.
To learn more about trigonometric function click here brainly.com/question/31540769
#SPJ11
I need help my teacher didn’t even explain how to do this
Answer:its b
first off its a straight line ill give it that but its not going through the origin is think its b
hoped this helped lmk if it did
Michael is planning to put fencing along the edge of his rectangular backyard, which is 22 yards by 16 yards. One long side of the backyard is along his house, so he will need to fence only 3 sides. How many yards of fencing will michael need?.
Michael will need 54 yards of fencing.
Dimensions of Michael's rectangular yard = 22 yards, 16 yards
Length of Michael's rectangular yard = 22 yards
Breadth of Michael's rectangular yard = 16 yards
Perimeter of Michael's yard = 2 [l+b] = 2 [22+16] = 2×38 = 76 yards
As Michael nee
ds to fence only 3 sides leaving a long side, so he needs to fence = perimeter - length = 76-22 = 54 yards
Hence, Michael will need 54 yards of fencing.
To understand more about perimeter and rectangles refer-
https://brainly.com/question/19819849
#SPJ4
$22.00+$14.00=
answer this
Answer:
$36
Step-by-step explanation:
22+14=36
Please I need help this is due tomorrow and I'm falling behind :(:
Answer:
there are 8 one dollar bills and 3 five dollar bills
Step-by-step explanation:
Find the value of the power 254⁰
Answer:
1
Step-by-step explanation:
Anything raised to the power of 0 is 1
Find the median of the data set represented in the following stem-and-leaf plot.
62
63
64
67
Answer:
67
Step-by-step explanation:
A highway's path can be found using the equation 2x + 3y = 18. Use the graphs of the functions to determine the number of intersections there will be between the railroad and the highway, and explain completely. (5 points)
Part B: A turnpike's route is determined by the equation y equals one third times x squared period Prove algebraically how many intersections there will be between the railroad and the turnpike, showing all necessary work
The intersection between the roads shown algebraically are a. no intersection, b. (4, 16/3) and (-6, 12).
What is intersection?The junction of two lines is referred to as the point of intersection. The equations a1x + b1y + c1 = 0 and a2x + b2y + c2 = 0 correspondingly depict these two lines.
The standard equation of a linear line is given as:
y = mx +c
where, m is the slope of the line.
To find the slope we require two points, and the slope is given as:
m = (y2 - y1)/ (x2 - x1)
From the graph we see that the line passes through the point (0. 8) and (3, 6).
So the slope of the graph is as follows:
m = (6 - 8) / (3 - 0)
m = - 2/3
The path of the highway also has the same slope - 2/3.
Since, L1 and L2 are parallel, there are no intersections.
Part B:
The equation given is:
y = (1/3)x^2
To find the point of intersection equate the equation of the two lines as follows:
(1/3)x^2 = - 2/3 x + 8
x^2 + 2x = 24
x^2 + x + 1 = 24 + 1
(x + 1)^2 = 25
x + 1 = 5, and x -1 = 5
x = 4, and x = 6
Substituting the value of x in equation of line find the value of y:
y = 16/3 and y = 12
So, the point of intersection is (4, 16/3) and (-6, 12).
Hence, the intersection between the roads shown algebraically are a. no intersection, b. (4, 16/3) and (-6, 12).
Learn more about intersection here:
https://brainly.com/question/14217061
#SPJ1
the makers of biodegradable straws have an automated machine that is set to fill each box with 100 straws. at various times in the packaging process, we select a random sample of 121 boxes to see whether or not the machine is filling the boxes with an average of 100 straws per box which of the following is a statement of the null hypothesis?
a. The machine fills the boxes with the proper amount of straws. The average is 100 straws. b. The machine is not filling the boxes with the proper amount of straws The average is not 100 straws. c. The machine is not putting enough straws in the boxes. The average is less than 100 straws.
The correct answer is: a. The machine fills the boxes with the proper amount of straws. The average is 100 straws. In hypothesis testing, the null hypothesis typically represents a statement of no effect or no difference. In this case, it means that the machine is functioning properly and filling the boxes with the expected average of 100 straws per box.
The null hypothesis in this scenario is option a, which states that the machine fills the boxes with the proper amount of straws, and the average is 100 straws per box. This is because the null hypothesis assumes that there is no significant difference between the observed sample mean and the expected population mean of 100 straws per box. To reject this null hypothesis, we would need to find evidence that the machine is not filling the boxes with the proper amount of straws, which would require further investigation and analysis. In conclusion, the null hypothesis can be summarized in three paragraphs as follows: The null hypothesis for the makers of biodegradable straws is that the machine fills the boxes with the proper amount of straws, and the average is 100 straws per box.
This hypothesis assumes that there is no significant difference between the observed sample mean and the expected population mean. To test this hypothesis, a random sample of 121 boxes is selected to determine whether or not the machine is filling the boxes with an average of 100 straws per box. If the observed sample mean is not significantly different from the expected population mean, then the null hypothesis is accepted. However, if the observed sample mean is significantly different from the expected population mean, then the null hypothesis is rejected, and further investigation is required to determine the cause of the difference.
To know more about average visit :-
https://brainly.com/question/28873924
#SPJ11
A basketball player made 81 out of 100 attempted free throws. What percent of free throws was made?
Answer:
81%
Step-by-step explanation:
81 out of 100 is 0.81, which is 81%
Hope this helps plz mark brainliest if correct :D
Answer:
0.800
Step-by-step explanation:
Hope it Helps
A study of existing records of 27,000 automobile accidents involving children in Michigan found that about 10 percent of children who were wearing a seatbelt were injured and that about 15 percent of children who were not wearing a seatbelt were injured (the percentages were obtained from historical data; the data just indicated the reason of the accident and if the passengers were wearing a seatbelt or not). Which of the following statements should NOT be included in a summary report about this study?
a. Inferences from this study should only be applied to automobile accidents involving children in Michigan.
b. The child's location in the car may be a confounding variable.
c. Driver behavior may be a confounding variable.
d. This study demonstrates clearly that seat belts save children from injury.
e. The child" $ age may be a confounding variable.
The statement that should not be included in a summary report about the study is, "This study demonstrates clearly that seat belts save children from injury." Therefore, the correct option is D.
A study of existing records of 27,000 automobile accidents involving children in Michigan found that about 10 percent of children who were wearing a seatbelt were injured and that about 15 percent of children who were not wearing a seatbelt were injured. The statement that "This study demonstrates clearly that seat belts save children from injury" shouldn't be included in a summary report about this study.
It's because the study only presents correlations and doesn't establish causation. The data simply indicated the reason for the accident and if the passengers were wearing a seatbelt or not. Factors like driver behavior, location of the child in the car, and the child’s age could be confounding variables that were not included in the data, and thus may have impacted the findings.
Inferences from this study should only be applied to automobile accidents involving children in Michigan. The child's location in the car, driver behavior, and the child’s age may be confounding variables.
Hence, the correct answer is option D.
Learn more about Summary report:
https://brainly.com/question/13346067
#SPJ11
now that you have determined which variable goes on each axis, the graph can be constructed. an effective graph marks off the axes with just enough evenly spaced tick marks to accommodate the full set of data.assuming that the x-axis tick marks will be separated by 1.0 units (0, 1.0, 2.0, and so on), what is the largest value that should appear on the x-axis?
The output is the variable that change depending on the input which is mostly the time.
What is a Graph?It is a pictorial representation or a diagram that represents the data or information or values in an organized manner. It is a mathematical representation of a network and it describes the relationship between the lines and points. A graph has two axes, They are x-axis and y-axis. It is a structure amount to a set of objects.
When we need to determine which variable will go with which axis when we graph the output will always be the variable that will change depending on the input. The input is the always the variable that is changing independently. Input is mostly going to be the time.
The output is the variable that change depending on the input which is mostly the time.
To know more about graph, visit:
https://brainly.com/question/17267403
#SPJ4
What's the slope of the line
Answer:
-1/2
Step-by-step explanation:
first point is 1,-4
second point is 5,-6
Slope is y2-y1/x2-x1
-6 - -4 / 5 - 1
-2/ 4
-1/2
Fill in the blank with an integer so that the given list has an average of 12.
13, 15, 9, 5, 10, ...
Answer:
We can use the formula for the average (arithmetic mean) of a set of numbers to solve this problem:
average = (sum of numbers) / (number of numbers)Let's call the missing number x. Then the sum of the numbers in the list is:
13 + 15 + 9 + 5 + 10 + xWe want the average of this list to be 12, so we can set up the following equation:
12 = (13 + 15 + 9 + 5 + 10 + x) / 6Multiplying both sides by 6, we get:
72 = 52 + xSubtracting 52 from both sides, we get:
x = 20Therefore, the missing number is 20, and the complete list is:
13, 15, 9, 5, 10, 20The average of this list is:
average = (13 + 15 + 9 + 5 + 10 + 20) / 6average = 72 / 6average = 12So the list now has an average of 12.
Scaling factors! Help please!
Answer:
x=3
y=12
Step-by-step explanation:
The scale factor is 1:4
we divide 12 by 4 to get 3
if we multiply 3 by 4 it is 12 so y=12
2 V The soccer field at Niall's school is 98 meters long and 55 meters wide. What is the perimeter of the field?
Perimeter of the soccer field is 306 meters.
What is perimeter?A shape's perimeter is defined as the total length of its bounds. The perimeter of a shape is determined by summing all sides and side lengths that enclose the shape. It is measured in linear measurement units such as centimeters, meters, inches, and feet.
Given,
Length of the soccer field = 98 meters
Width of the soccer field = 55 meters wide
Perimeter of rectangle = 2(Length + Width)
Perimeter of soccer field = 2(98 + 55)
Perimeter of soccer field = 2(153)
Perimeter of soccer field = 306 meters
Hence, 306 meters is the perimeter of the soccer field.
Learn more about perimeter here:
https://brainly.com/question/6465134
#SPJ1
write an explicit formula for a subscript n, the nth term of the sequence 8, 11, 14,...
please please help
The required explicit formula for the given sequence to determine the nth term is given as nth term = 8 + (n - 1)3.
What is arithmetic progression?Arithmetic progression is the series of numbers that have common differences between adjacent values.
here,
The Sequences 8, 11, 14,...
first term a = 8
common difference = 11 - 8 = 3
Now,
The explicit formula is given as,
nth terms = a + (n - 1)d
nth term = 8 + (n - 1)3
Thus, the required explicit formula for the given sequence to determine the nth term is given as nth term = 8 + (n - 1)3.
Learn more about arithmetic progression here: https://brainly.com/question/20334860
#SPJ1
Write a function that represents the relationship between X and y shown in the graph below
Answer:
y = 3x - 10
Step-by-step explanation:
Find the slope of the line by calculating the Rise/Run between any two points. I picked (-2,-16) and (4,2).
The Rise is = (2-(-16))=18
The Run is = (4 -(-2)) = 6
Rise/Run is 18/6 = 3. The slope is three:
y = 3x + b
b is the y-intercept, the value of y when x=0. b is - 10 in this graph.
y = 3x - 10 is the line of this graph.
heyy! i’ll give brainliest please help.
Answer: i'm pretty sure its c.
Step-by-step explanation:
(x = 3)
y=x+5
How would I solve this problem
A lottery ticket on which the odds of winning are 1 in 1 million is given to every person in attendance at a college football game. The most likely result is that there will be
a. no winners in the stadium.
b. one winner in the stadium.
c. many winners in the stadium.
Answer:
The most likely result is that there will be no winners in the stadium.
Step-by-step explanation:
The odds of winning are 1 in 1 million, which means that there is a 99.9999% chance that any given person will not win. If there are 100,000 people in attendance at the game, then the expected number of winners is 0.1.
Sketch the line 4x+3y=11
sketch of the line 4x + 3y = 11, slope (-4/3), y-intercept of the line y = 11/3
Step 1: Convert the equation to slope-intercept form (y = mx + b) by solving for y:
3y = -4x + 11
y = (-4/3)x + 11/3
Step 2: Identify the slope and y-intercept:
From the equation in slope-intercept form, we can see that the slope (m) is -4/3 and the y-intercept (b) is 11/3.
Step 3: Plot the y-intercept:
On the y-axis, mark a point at y = 11/3 (approximately 3.67). This is the y-intercept of the line.
Step 4: Use the slope to find additional points:
Using the slope of -4/3, we can find other points on the line. The slope represents the change in y for every 1 unit change in x. So, starting from the y-intercept, we can move down 4 units and to the right 3 units to find the next point, and continue this pattern to find more points.
Step 5: Connect the points:
Once you have a few points on the line, you can connect them with a straight line. Make sure the line extends beyond the plotted points to show that it continues indefinitely.
The resulting line should have a negative slope (-4/3) and be slanting downward from left to right.
To know more about line click here :
https://brainly.com/question/28947895
#SPJ4
I would really appreciate some help
Answer:
A or x = 1
Step-by-step explanation:
So we can see from the most right column that the sum of the three number is 9 (2 + 4 + 3) so we know that every row or column has to add up to 9. We want to find x so we must make sure that, 8 + 0 + x should be 9 and 2 + 6 + x should be 9. From 8 + 0 + x, we know that 8 + 1 is 9 so x is 1. We can also see that 2 + 6 is 8 and 8 + 1 is 9 so x = 1.
The graph shows the number of possible passengers for a given
number of roller coaster cars that leave the platform. Complete parts a
and b.
Answer:
a. Use two sets of coordinates to write an equation to describe the relationship.
m = \(\frac{24-16}{3-2} = \frac{8}{1}\)
y = 8x
b. Interpret the equation in words.
Each roller coaster car holds 8 passengers.
which of the following is the best order-of-magnitude estimate in meters of the height of a mountain
a. 1m b. 10m c 100m d. 1,000m
Answer:
The best is:
d. 1.000m
Find the missing angles
Let's find a.
We are given a right angle which is 90° and an angle marked by "a" next to it. We know that when they are added together, they make a supplementary angle so we can make a equationa and solve.
90 + a = 180
a = 90°
Let's find b.
By looking at the graph, we can tell that the angle "b" and the angle that measures 163° is the same. Thus, b = 163°.
Let's find c.
Using what we did for a, we can solve for c using what we got for b. We can make an equation and solve.
163 + b = 180
c = 27°
Let's find d.
Using the angle that measures 70°, we can solve it like we did with a and c.
70 + d = 180
d = 110°
Let's find e.
Now that we know what d equals, we know that d and e make a supplmentary angle. So, make an equation and solve.
110 + e = 180
e = 70°
Best of Luck!
what are the ordered pairs of the solutions for this system of equations?
f(x)=x^(2)-2x+3; f(x)=-2x+12
The ordered pairs for the system of equations f(x) = x^2 -2x + 3 and f(x) = -2x + 12 are (3, 6) and (-3, 18)
What is a quadratic equation?A quadratic equation is an algebraic equation of the second degree in x. The quadratic equation in its standard form is ax2 + bx + c = 0, where a and b are the coefficients, x is the variable, and c is the constant term. The first condition for an equation to be a quadratic equation is the coefficient of x2 is a non-zero term(a ≠ 0)
f(x) = x^2 -2x +3 and f(x) = -2x + 12
which means
x^2 -2x +3 = -2x + 12
x^2 -2x +3 + 2x - 12 = 0
x^2 -9 = 0
by factorizing we have
(x-3)(x+3) = 0
x = 3 or -3
when x = 3
f(x) = -2x + 12
f(3) = -2(3) + 12 which is 6
when x = -3
f(-3) = -2(-3) + 12 which is 18
ordered pairs are (3, 6) and (-3, 18)
In conclusion, (3, 6) and (-3, 18) are the ordered pairs
Learn more about Quadratic equation: https://brainly.com/24334139
#SPJ1
PLEASEEEEEEEEEEEEEEEEEEEEEE Edgar rolls two six-sided number cubes. What is the probability that he rolls a 2 on
the first cube and a number less than 5 on the second cube? Use the diagram 1of
the sample space to help you.
a. 3/36=1/12
b. 2/36=1/18
c. 4/36=1/9
d. 7/36
4/36 = 1/9
==============================================================
Explanation:
Circle the second row. This is where each of the red die results are "2"
Then look at the cases when the second die is less than "5". So we could have a 1, 2, 3, or 4 on this second die.
As you can see, there are 4 cases when the first number is a 2 (red) and the second number is less than 5 (white).
We have m = 4 cases we want out of n = 6*6 = 36 cases total.
m/n = 4/36 = 1/9 is our final answer.
Read the passage.
[1] It is important to repot plants to maintain healthy
growth. [2] First, check whether the plant has grown
too large for its current pot. [3] If so, remove the plant
and gently shake loose as much of the soil as possible,
leaving the roots intact and exposed. [4] Rinse the
roots by soaking them thoroughly. [5] Next, fill the new
pot with layers of perlite (for drainage), manure (for
fertilization), sand, and garden soil. [6] Make sure to
find a new pot that is big enough to allow for future
growth. [7] Make a hollow in the potting mixture and
tuck in the plant. [8] Add more soil around the plant,
then water it generously. [9] Place it in a spot with the
correct amount of sun exposure, and watch it thrive!
How could the error in this set of instructions be resolved?
O by rearranging the steps so they are in sequential
order
O by adding multiple drawings that show how the roots
should look when rinsed and how the plant should
look when it is repotted correctly
O by revising sentence 2 to read, "Check to see
whether the plant has grown too large for its pot by
measuring the space between it and the rim."
O by including measurements for each type of potting
material
The error in the set of instructions can be resolved by rearranging the steps so they are in sequential order. The Option A is correct.
How could the error in the set of instructions be resolved?The most effective solution would be to rearrange the steps so they follow a logical order.
For example, the steps could be rearranged as follows:
1) check the plant's size2) choose a new pot3) remove the plant and rinse the roots4) prepare the potting mixture5) repot the plant6) water and place the plant in a suitable location.Therefore, by doing this would make the instructions clearer and easier to follow. The Option A is correct.
Read more about error
brainly.com/question/1191244
#SPJ1
Ian is buying apples at the farmer’s market.
The apples come in packages of different sizes.
Choose the package that is the best buy.
A. 2 lb for $4.98
B. 5 lb for $12.25
C. 8 lb for $18.80
D. 10 lb for $23.70
If w = 12 units, x = 7 units, and y = 8 units, what is the surface area of the figure? Figure is composed of a right square pyramid on top of a square prism. The sides of the square pyramid are equal to the sides of the square prism, the length and width of the square prism is w, the height of the square prism is x, and the height of the square pyramid, which forms a right angle with the center, is y.
Answer:
720 sq units.
Step-by-step explanation:
Length and width of square prism, w = 12 units
Height of square prism, x = 7 units
Height of square pyramid, y = 8 units
Please have a look at the attached image.
Here 2 Surfaces will not be exposed which are base of the square pyramid and the top of the square prism i.e. 2 square surfaces will not be exposed.
Here, surface area of the composite figure will be:
Surface Area of Composite Figure = Lateral surface area of Square Pyramid + Surface Area of 5 surfaces of the square prism
For finding the lateral surface area of pyramid, we need to find the slant height of the pyramid.
Let slant height be \(l\) units.
Using pythagoras theorem, we can find out the value of \(l\).
As per theorem:
\(Hypotenuse^{2} = Base^{2} + Height^{2}\\\)
\(\Rightarrow l^{2} = (\dfrac{w}{2})^{2} + y^{2}\\\Rightarrow l^{2} = (\dfrac{12}{2})^{2} + 8^{2}\\\Rightarrow l^{2} = {6}^{2} + 8^{2}\\\Rightarrow l^{2} = 36+64 = 100\\\Rightarrow l = 10\ units\)
Lateral surface area of square prism = 4 \(\times\) Area of triangular surface
\(\Rightarrow 4 \times \dfrac{1}{2}\times Base \times Slant\ Height\\\Rightarrow 4 \times \dfrac{1}{2} \times 10 \times 12\\\Rightarrow 240\ sq\ units\)
Surface Area of 5 surfaces of the square prism =
\(4 \times x \times w + w^2\\\Rightarrow 4 \times 12 \times 7 + 12^2\\\Rightarrow 336 +144\\\Rightarrow 480\ sq\ units\)
So, total surface area of composite figure:
240 + 480 = 720 sq units.
Answer:
B 720 units2
Step-by-step explanation: