(SAT Prep) Find the value of x

(SAT Prep) Find The Value Of X

Answers

Answer 1

Answer:

x=120°

Step-by-step explanation:

angles on parallel lines ,there's an imaginary parallel line at x.

70 and 50 alternate respectively.

so x=50+70

x=120

(SAT Prep) Find The Value Of X
Answer 2

Answer:

120 degrees

Step-by-step explanation:

I'm Big Brain


Related Questions

I needs someone’s help pls

I needs someones help pls

Answers

Answer:

won't it make 30 smoothies

Step-by-step explanation:

then that means danielle makes more!!

i need help on this translation stuff

i need help on this translation stuff

Answers

The translated shape would have the vertices of :

U' = (3, 5)S' = (0, 1)T' = (0, 4)

How to translate ?

Geometry employs translation to move a figure from a certain location to another while retaining its shape, size, and orientation. All points on the initial object are shifted equidistant in a unified direction. A vector showcases the magnitude and course of the movement.

The vectors of the original shape are:

U ( - 2 , 0 )

S ( -5 , - 4 )

T ( - 5, - 1 )

The translated vectors would be:

U' ( - 2 + 5, 0 + 5) = (3, 5)

S' ( -5 + 5, -4 + 5) = (0, 1)

T' ( -5 + 5, -1 + 5 ) = (0, 4)

Find out more on translation at https://brainly.com/question/12861087

#SPJ1

Find the limit, if it exists,
Lim (x, y) -> (0, 0) xy/(√x^2+y^2)
to examine lim (x, y) → (0, 0) xy/(√x^2+y^2), first approach (0, 0) along the x-axis. on this path, all points have _________

Answers

The limit of xy/(√\(x^2+y^2\)) as (x, y) approaches (0, 0) does not exist.

On the x-axis, all points have y = 0. Therefore, the expression xy/(√\(x^2+y^2\)) reduces to 0/|x|, which is equal to 0 for x ≠ 0 and undefined at x = 0.

Next, let's approach (0, 0) along the y-axis. On this path, all points have x = 0. Therefore, the expression xy/(√\(x^2+y^2\)) reduces to 0/|y|, which is equal to 0 for y ≠ 0 and undefined at y = 0.

Since the limit of the expression along the x-axis and y-axis are different, the limit at (0, 0) does not exist.

To prove this, we can also use polar coordinates.

Let x = r cosθ and y = r sinθ, then the expression becomes:

lim (r, θ) -> (0, 0) \(r^2\) cosθ sinθ / r

which simplifies to:

lim (r, θ) -> (0, 0) r cosθ sinθ

This limit does not exist, as the value of r cosθ sinθ depends on the angle θ. For example, when θ = 0, r cosθ sinθ = 0, but when θ = π/4, r cosθ sinθ = \(r^2\)/2.

for such more question on limit

https://brainly.com/question/12017456

#SPJ11

To find the limit, if it exists, of Lim (x, y) → (0, 0) xy/(√x^2+y^2), we first examine the limit as we approach (0, 0) along the x-axis. When we follow this path,it helps to analyse the limit.

On the x-axis, y=0 for all points. Therefore, the limit can be examined as lim (x, 0) → (0, 0) x(0)/(√x^2+0^2). Simplifying, we get lim (x, 0) → (0, 0) 0/|x|. As we approach 0 from both positive and negative sides of the x-axis, the denominator |x| approaches 0. However, the numerator remains 0. Thus, the limit is 0. Therefore, all points on the x-axis approach 0 as we approach (0, 0).

that is,  Lim (x, y) → (0, 0) x(0)/(√x^2+0^2) = Lim (x, y) → (0, 0) 0/(√x^2)

As x approaches 0, the numerator is always 0, while the denominator is |x|. Thus, the limit along the x-axis is:

Lim (x, y) → (0, 0) 0/|x| = 0

To learn more about limit click here, brainly.com/question/29795597

#SPJ11

What is the point halfway between (a, 2b) and (-a, 8b)?

Answers

The midpoint of the x values a and -a would be 0 because of a was a number the mid point between the negative and positive of the same number is 0

The midpoint of 2b and 8b is found by adding them together and dividing by 2:

2b + 8b = 10b / 2 = 5b

The midpoint is (0,5b)

Zoe placed colored blocks on a scale in science class. Each block weighed 0.8 ounces. The total weight of all the colored blocks was 12.8 ounces. How many blocks did Zoe place on the scale? Write and solve an equation to find the answer. number of blocks =

Answers

Answer:

16 blocks. 12.8=(.8)x

Step-by-step explanation:

Answer:

16

Step-by-step explanation:

because it both so it come out to be 16

Hello! I got this answer but I am unsure as to how I got the answer.

Hello! I got this answer but I am unsure as to how I got the answer.

Answers

Given a quadratic equation: y = ax² + bx + c, "a", "b" and "c" are the coefficients of the regression and can be estimated using the formulas below.

a = {[Σ x²y * Σ xx ] - [Σ xy * Σ xx² ] } / { [ Σ xx * Σ x²x²] - [Σ xx² ]²}

b = {[Σ xy * Σ x²x² ] - [Σ x²y * Σ xx² ] } / { [ Σ xx * Σ x²x²] - [Σ xx² ]²}

c = [Σ y / n ] - { b * [ Σ x / n ] } - { a * [ Σ x² / n ]}

Where:

Σ xx = [Σ x²] - [ ( Σ x )² / n]

Σ xy = [Σ x y] - [ ( Σ x * Σ y ) / n]

Σ xx² = [Σ x³] - [ ( Σ x² * Σ x ) / n]

Σ x²y = [Σ x²y] - [ ( Σ x² * Σ y ) / n]

Σ x²x² = [Σ x⁴] - [ ( Σ x² )² / n]

And:

x and y are the Variables.

n = Number of Values or Elements

Σ x = Sum of x Scores

Σ y = Sum of y Scores

Σ x² = Sum of Square of x

Σ x³ = Sum of Cube of x

Σ x⁴ = Sum of Power Four of x

Σ xy= Sum of the Product of x and y

Σ x²y = Sum of Square of x and y

To solve the problem, follow the steps below.

Step 01: Find n and the values of x and y.

n = 6.

x = 8, 10, 12, 14, 16, 18

y = 45.94, 56.84, 63.88, 67.07, 66.4, 61.87

Step 02: Find Σ x, Σ y, Σ x², Σx³, Σ x⁴, Σ xy, Σ x²y

* (,) represents a decimal point.

Step 03: Find Σ xx, Σ xy, Σ xx², Σ x²y, Σ x²x²

Substitute the values above in the equations for each variable:

Σ xx = [Σ x²] - [ ( Σ x )² / n]

Σ xy = [Σ x y] - [ ( Σ x * Σ y ) / n]

Σ xx² = [Σ x³] - [ ( Σ x² * Σ x ) / n]

Σ x²y = [Σ x²y] - [ ( Σ x² * Σ y ) / n]

Σ x²x² = [Σ x⁴] - [ ( Σ x² )² / n]

\(\begin{gathered} \sum_^xx=\operatorname{\sum}_^x^2-\frac{(\operatorname{\sum}_^x)^2}{n} \\ \sum_^xx=1084-\frac{78^2}{6} \\ \sum_^xx=1084-\frac{6084}{6} \\ \sum_^xx=1084-1014 \\ \sum_^xx=70 \end{gathered}\)

Doing the same for the other variables, you have the results:

* (,) represents a decimal point.

Step 03: Find "a".

a = {[Σ x²y * Σ xx ] - [Σ xy * Σ xx² ] } / { [ Σ xx * Σ x²x²] - [Σ xx² ]²}

\(\begin{gathered} a=\frac{2611.55*70-111.52*1820}{70*47917.3-1820^2} \\ a=-0.482 \end{gathered}\)

Step 04: Find "b".

b = {[Σ xy * Σ x²x² ] - [Σ x²y * Σ xx² ] } / { [ Σ xx * Σ x²x²] - [Σ xx² ]²}

\(\begin{gathered} b=\frac{111.52*47917.3-2611.55*1820}{70*47917.3-1820^2} \\ b=14.125 \end{gathered}\)

Step 05: Find "c".

c = [Σ y / n ] - { b * [ Σ x / n ] } - { a * [ Σ x² / n ]}

\(\begin{gathered} c=\frac{362}{6}-14.125*\frac{78}{6}-(-0.482)*\frac{1084}{6} \\ c=-36.209 \end{gathered}\)

Answer:

The equation is:

\(-0.482x^2+14.125x-36.209\)

Hello! I got this answer but I am unsure as to how I got the answer.
Hello! I got this answer but I am unsure as to how I got the answer.

Which fractions are equivalent to 7/6? Select all that apply.

Which fractions are equivalent to 7/6? Select all that apply.

Answers

Answer:

C and D are equivalent.

Step-by-step explanation:

if you multiply 7/6 both by 2 it will =14/2 and also if you multiply 7/6 both by 10 you will get 70/60.

A project has a 60% chance of doubling your investment in one year and a 40% chance of losing half your money. What is the standard deviation of this investment?
a. 62%
b. 73%
c. 50%
d. 25%

Answers

In this case, standard deviation is b. 73%.

How to find standard deviation

To determine the standard deviation of an investment with a 60% chance of doubling and a 40% chance of losing half the investment, we can use the formula for standard deviation of a probability distribution, which is:

σ = √[∑(x - μ)²P]

Where σ is the standard deviation, x is the possible return on investment, μ is the expected return on investment, and P is the probability of each possible return.

In this case, the possible returns are doubling the investment (a return of 100%) or losing half the investment (a return of -50%).

The probabilities of these outcomes are 0.6 and 0.4, respectively. The expected return can be calculated as:

μ = 0.6(100%) + 0.4(-50%) = 40%

Using this information, we can calculate the standard deviation as:

σ = √[((100% - 40%)²)(0.6) + ((-50% - 40%)²)(0.4)]

σ = √[(60²)(0.6) + (-90²)(0.4)]

σ = √[2160 + 3240]

σ = √5400

σ ≈ 73.48%

Therefore, the answer is option B: 73%.

Learn more about standard deviation at

https://brainly.com/question/29088233

#SPJ11

Assume that demand for a commodity is represented by the equation
P = -2Q-2Q_d
Supply is represented by the equation
P = -5+3Q_1
where Q_d and Q_s are quantity demanded and quantity supplied, respectively, and Pis price
Instructions: Round your answer for price to 2 decimal places and enter your answer for quantity as a whole number Using the equilibrium condition Q_s = Q_d solve the equations to determine equilibrium price and equilibrium quantity
Equilibrium price = $[
Equilibrium quantity = units

Answers

The equilibrium price is $0 and the equilibrium quantity is 5 units.

To find the equilibrium price and quantity, we need to set the quantity demanded equal to the quantity supplied and solve for the equilibrium values.

Setting Q_d = Q_s, we can equate the equations for demand and supply:

-2Q - 2Q_d = -5 + 3Q_s

Since we know that Q_d = Q_s, we can substitute Q_s for Q_d:

-2Q - 2Q_s = -5 + 3Q_s

Now, let's solve for Q_s:

-2Q - 2Q_s = -5 + 3Q_s

Combine like terms:

-2Q - 2Q_s = 3Q_s - 5

Add 2Q_s to both sides:

-2Q = 5Q_s - 5

Add 2Q to both sides:

5Q_s - 2Q = 5

Factor out Q_s:

Q_s(5 - 2) = 5

Q_s(3) = 5

Q_s = 5/3

Now that we have the value for Q_s, we can substitute it back into either the demand or supply equation to find the equilibrium price. Let's use the supply equation:

P = -5 + 3Q_s

P = -5 + 3(5/3)

P = -5 + 5

P = 0

Therefore, the equilibrium price is $0 and the equilibrium quantity is 5 units.

Learn more about supply equation here:brainly.com/question/13218367

#SPJ11

When rolling two dice, which of the following events are independent of the event that the first die is 4:
A. the second is 2, B. the sum is 6, C. the sum is 7
D. the sum is even.

Answers

To determine which events are independent of the event that the first die is 4, we need to consider whether the probability of each event is affected by the outcome of the first die.

A. The second die is 2:

The probability of the second die being 2 is not affected by the outcome of the first die. Therefore, event A is independent of the event that the first die is 4.

B. The sum is 6:

The sum of the two dice will be 6 only if the second die is 2. Since event B depends on the outcome of the second die, it is not independent of the event that the first die is 4.

C. The sum is 7:

The sum of the two dice will be 7 if the second die is 3. Since event C depends on the outcome of the second die, it is not independent of the event that the first die is 4.

D. The sum is even:

The sum of the two dice will be even if the second die is 2, 4, or 6. Since event D depends on the outcome of the second die, it is not independent of the event that the first die is 4.

In summary, event A (the second die is 2) is the only event that is independent of the event that the first die is 4.

To learn more about probability , refer below:

brainly.com/question/26703830

#SPJ11

PLSS HELP MATHH !!!!

12/11 - ( -2/3 ) = ?

Answers

the answer should be 58/33 or 1 25/33

A relation is defined by the points (1, 4), (3, -1), (-1, -2), and (1, -3).
This relation ( is , is not ) a function because there ( is no x-value,is one x-value,are two x-values) corresponding to multiple y-values.

Answers

Answer: is not / is one x-value

Step-by-step explanation:

The relation is not a function because there is one x-value corresponding to multiple y-values.

Why it is not a function?

For a function, each point on the domain is mapped into only one point on the range.

In this relation we can see the points:

(1, 4), (3, -1), (-1, -2), and (1, -3).

Then we can see that the element of the domain "1" is being mapped into two different elements of the range (4, and -3).

Then the relation is not a function because there is one x-value corresponding to multiple y-values.

If you want to learn more about functions:

https://brainly.com/question/4025726

#SPJ2

Is y=2^x linear, exponential or neither

Answers

Answer:
exponential

Step-by-step explanation:
An exponential function is defined as a function with a positive constant other than 1 raised to a variable exponent. A function is evaluated by solving at a specific input value. An exponential model can be found when the growth rate and initial value are known.

which expression is equivalent to 19x-23x

Answers

Answer:

-4x

Step-by-step explanation:

Lets analyze the expression:

\(19x-23x\)

These two are like terms, which means we can combine them. Lets subtract both of them.

\(-4x\)

if x, y, and z are integers and xy z is an odd integer, is x an even integer? (1) xy xz is an even integer. (2) y xz is an odd integer. a) statement (1) alone is sufficient, but statement (2) alone is not sufficient. b) statement (2) alone is sufficient, but statement (1) alone is not sufficient. c) both statements together are sufficient, but neither statement alone is sufficient. d) each statement alone is sufficient. e) statements (1) and (2) together are not sufficient.

Answers

c) both statements together are sufficient, but neither statement alone is sufficient.

According to the question

The query asks if statements (1) and (2) by themselves are sufficient to determine whether x is an even number. The answer is that neither assertion by itself is adequate to ascertain what x is worth. However, when both claims are taken into account, they are adequate to decide whether or not x is an even number. This is due to the fact that if xyz is even and yz is odd, x must be even. If x were odd, both xy xz and y xz would be strange as well. Due to this, the proper response is "c) neither statement is adequate when read alone, but both assertions taken together are sufficient."

To know more about integers on brainly : brainly.com/question/17510894

#SPJ4

Find the common difference of the arithmetic sequence 14, 8, 2,.

Answers

Answer:

-6

Step-by-step explanation:

Someone help please. (The teacher added an extra question for some reason but please help with all.)​

Someone help please. (The teacher added an extra question for some reason but please help with all.)

Answers

The probability of obtaining tails and the number 5 is 1/12

the probability of obtaining an even number is 1/2

P(heads and prime number)  1/4

How to calculate the probability

Since the events are independent, the probability of obtaining tails and the number 5 is:

P(tails and 5) = P(tails) * P(5) = (1/2) * (1/6) = 1/12

The coin toss outcome is irrelevant, so the probability of obtaining an even number is:

P(even number) = 1/2

The probability of obtaining heads and a prime number is:

P(heads and prime number) = P(heads) * P(prime number) = (1/2) * (1/2) = 1/4

Learn more about probability on

https://brainly.com/question/24756209

#SPJ1

Determine The Present Value P You Must Invest To Have The Future Value A At Simple Interest Rate R After Time T. A=$5000.00,R=14.0%,T=13 Weeks (Round To The Nearest Cent.)

Answers

The present value (P) that needs to be invested to achieve a future value (A) of $5000.00 at a simple interest rate (R) of 14.0% after a time period (T) of 13 weeks is approximately $1773.05 (rounded to the nearest cent).

To calculate the present value, we use the formula P = A / (1 + R * T), where A is the future value, R is the interest rate, and T is the time period. Plugging in the given values, we get P = 5000 / (1 + 0.14 * 13). After evaluating this expression, the result is approximately $1773.05.

Therefore, in order to have a future value of $5000.00 with a simple interest rate of 14.0% after 13 weeks, one would need to invest approximately $1773.05.

Learn more about simple interest here: brainly.com/question/30964674

#SPJ11

another part thanks for the help on the other one MIDDLE SCHOOL

another part thanks for the help on the other one MIDDLE SCHOOL

Answers

As per the similarity rule in angles, we can here find the value of x to be = 85°.

Define similar triangles?

One of the types of angles created when a transversal intersects two parallel lines are corresponding angles. These are created in the transversal's equivalent or matching corners.

Applications for corresponding angles can be found in both mathematics and physics. Knowing the comparable angles can help you identify unknown angles, determine the congruence of two figures, and other geometry-related difficulties.

Here in the question,

As per the angle similarity rule:

(x + 60) ° = 145°

Subtracting 60 from both the sides:

⇒ x° + 60° - 60° = 145° - 60°

⇒ x° = 85°

Hence, as per the similarity rule in angles, we can here find the value of x to be = 85°.

To know more about similar angles, visit:

https://brainly.com/question/30857117

#SPJ1

1) A 0.5 - 10 lead screw has a 0.25 hp applied at a rotational speed of 294 rpm, determine the shear stress from the torque. (1hp = 550 ft-lbf/sec)
2) What is the pitch of a single start 1/2 - 10 lead screw?

Answers

1) To find the shear stress from the torque, we need to use the following formula:Shear Stress = (Torque x radius of lead screw) / (Polar Moment of Inertia x length of lead screw)In this case, we are given the rotational speed and power, but not the torque. So, we first need to find the torque.Torque = Power / (Rotational Speed x 2π)Substituting the given values, we get:Torque = 0.25 hp x 550 ft-lbf/sec / (294 rpm x 2π)Torque = 0.888 ft-lbfNow, substituting the torque and lead screw specifications into the shear stress formula, we get:Shear Stress = (0.888 ft-lbf x 0.25 in) / (π x (0.5/2 in)^4 / 2 x 10 in)Shear Stress = 232.69 psi (rounded to two decimal places)Therefore, the shear stress from the torque is 232.69 psi.2) The pitch of a single start 1/2 - 10 lead screw can be found using the formula:Pitch = (1/Threads per inch) x (1/Number of Starts)Substituting the given values, we get:Pitch = (1/10) x (1/1/2)Pitch = 0.1 inches (or 2.54 mm, if you prefer SI units)Therefore, the pitch of the lead screw is 0.1 inches (or 2.54 mm).

A. The shear stress from the torque applied to the lead screw is 1.71e8 lb/ft².

B. The pitch of the single start 1/2 - 10 lead screw is 0.1 inches.

a. To determine the shear stress from the torque applied to the lead screw, we need to use the formula:

τ = Tc / J

where:

τ = shear stress

Tc = torque

J = polar moment of inertia

First, we need to calculate the torque from the given power and speed:

P = Tω

where:

P = power = 0.25 hp = 137.5 ft-lbf/sec (using 1 hp = 550 ft-lbf/sec)

ω = angular velocity = (294 rpm) * (2π/60) = 30.8 rad/sec

Therefore, T = P / ω = 4.46 ft-lbf

Next, we need to calculate the polar moment of inertia:

J = π/2 * (D⁴ - d⁴)

where:

D = major diameter = 0.5 inches = 0.0417 ft

d = minor diameter = D - 2p = D - 2/10 = 0.3 inches = 0.025 ft

Therefore, J = π/2 * ((0.0417)⁴ - (0.025)⁴) = 2.61e-8 ft⁴

Substituting these values into the formula, we get:

τ = Tc / J = (4.46 ft-lbf) / (2.61e-8 ft⁴) = 1.71e8 lb/ft²

Therefore, the shear stress from the torque applied to the lead screw is 1.71e8 lb/ft².

b. The pitch of a single start 1/2 - 10 lead screw is 0.5 inches, which means that the screw will travel a linear distance of 0.5 inches in one complete revolution. The 10 in the lead screw specification refers to the number of threads per inch, which means that there are 10 complete threads in one linear inch of the screw.

Therefore, the pitch of the lead screw is the distance between adjacent threads, which is:

pitch = 1 / threads per inch = 1 / 10 = 0.1 inches

Therefore, the pitch of the single start 1/2 - 10 lead screw is 0.1 inches.

Learn more about sheer stress at https://brainly.com/question/31110743

#SPJ11

one of the following steps is not required as a step to test for the null hypothesis: compute the p-value. compute the standard error of the slope estimate compute the t-statistic. test for the errors to be normally distributed.

Answers

One of the following steps is not required as a step to test for the null hypothesis is Compute the standard error of the slope estimate.

What is hypothesis testing?

Hypothesis testing is a statistical method for testing the validity of a hypothesis made about a parameter in a population. This method may be used to assess the truth of a hypothesis made about a population parameter.

A hypothesis testing problem involves determining whether there is enough evidence in a sample data to support the hypothesis about the population.

Learn more about hypothesis testing at

https://brainly.com/question/31199947

#SPJ11

The rectangular stage at Radio City Music Hall in New York City measures 144 feet wide and 60 feet deep. What is the number of square yards in its area?

Answers

Given:

The rectangular stage at Radio City Music Hall in New York City measures 144 feet wide and 60 feet deep.

We will find the area by multiplying the width by the deep

So, the area =

\(144\times60=8640\)

So, the answer will be Area = 8640 square yards

What is the standard form and the factored form

What is the standard form and the factored form

Answers

Answer:

See below

Step-by-step explanation:

The factored form, use variables/numbers outside the square:

(x + 6)(x - 4)

The standard form, use variables/numbers inside the square:

x² + 6x - 4x - 24 = x² + 2x - 24

Factored form

(x+6)(x-4)

Simplify to standard form

x(x-4)+6(x-4)x²-4x+6x-24x²+2x-24

The perimeter of a rectangle is 172 feet. Find the length and width if the length is an integer and the width is 2 times the next consecutive integer.

Answers

The length and width of the rectangle is 28 feet and 58 feet respectively.

How to find the sides of a rectangle?

A rectangle is a quadrilateral with opposite sides equal to each other and opposite sides parallel to each other.

Therefore, the perimeter of a rectangle is the sum of the whole 4 sides of the rectangle.

Hence, the perimeter of a rectangle is 172 feet.

perimeter of a rectangle = 2(l + w)

where

l = lengthw = width

l = x

w = 2(x + 1) = 2x + 2

Therefore,

172 = 2(x + 2x + 2)

172 = 2(3x + 2)

divide both sides by 2

172 / 2 = 3x + 2

86 = 3x + 2

86 - 2 = 3x

3x = 84

divide both sides by 3

x = 84 / 3

x = 28

Therefore,

length = 28 feet

width = 2(28) + 2 = 58 feet

learn more on rectangle here: https://brainly.com/question/14656866

#SPJ1

CAN ANYBODY HELP ME WITH THIS? btw not really yelling
The scale factor of a room for a scale drawing is 2.3. The actual length of a wall in the room is 46 feet and the actual width of the room is 69 feet. What is the area of the scale drawing?

Answers

The area of the scale drawing will be:
600 square feet.
Step-by-step explanation:
The actual length of a wall in the room is 46 feet and the actual width of the room is 69 feet.
It is given that:
The scale factor of a room for a scale drawing is 2.3.
The length of the room according to the scale drawing will be:
46÷2.3=20 feet
and the width of the room according to scale drawing will be:
69÷2.3=30 feet
We know that the wall is in the shape of a rectangle.
This means that the area of scale drawing will be:
Length×Width
= 20×30
= 600 square feet.

Dianne's profit from selling magazine subscriptions varies directly with the number of subscriptions sold. Dianne made $30 from selling 24 subscriptions. Which equation relates Dianne's profit (y) to the number of subscriptions she sold (x)?

Answers

B) I say this bcz I divided 30 by 24 and got 1.25

Profit=1.25(subscription)  

(If someone else proves this wrong then I am sorry but I am in Middle School and my teacher just taught me this and I got an 100 so if it doesn't help I'm sorry) (I even used all those math calculator and word problem websites)

For her final​ project, stacy plans on surveying a random sample of students on whether they plan to go to florida for spring break. From past​ years, she guesses that about ​% of the class goes. Is it reasonable for her to use a normal model for the sampling distribution of the sample​ proportion? why or why​ not?.

Answers

Less than 10 attempts were successful in this situation. due to the fact that 5 is less than 10. The data does not satisfy the requirement as a result.

Because the data don't fit the success or failure criteria, it is not appropriate to adopt a normal model for the sampling distribution of the sample.

50 students make up the sample. The likelihood that she assumes 10% of the class will attend is 10%. It will be demonstrated by:

1 - p = 1 - 10%

⇒ 1 - 0.10 = 0.90

np = 50 × 0.1

np = 5

This suggests the number of victories.

In this case, fewer than 10 efforts have been successful. Since 5 is less than 10, this is the situation. The data does not meet the criteria as a result.

To know more about Sampling, refer to this link:

https://brainly.com/question/24466382

#SPJ4

Please help im having problem ​

Please help im having problem

Answers

Answer:

24

Step-by-step explanation:

Do i need to explain ??????

Find the least number which must be added to 2000 to make the sum a perfect square​

Answers

add 25 to 2000 = 2025

sqrt 2025 = 45

During a musical an orchestra is playing. As the music plays, the volume changes in the beginning of the piece can be modeled by the equation s = 10│x - 4│+ 50 where s represents the sound level in decibels and x represents the number of measures of music played. Explain in words each step to find the following question:
At what number(s) measures played would the sound level be at 80 decibles?
( I need the answers, plus the steps please and thank youuu :)​

Answers

Answer:

Kindly check explanation

Step-by-step explanation:

Given the equation:

s = 10│x - 4│+ 50

Where s = sound level in decibels

x = number of measures of music played

Step 1:

Subtract 50 from Both sides

s - 50 = 10│x - 4│+ 50 - 50

s - 50 = 10│x - 4│

For s = 80

80 - 50 = 10│x - 4│

30 = 10│x - 4│

Clear the absolute value sign

± 30 = 10x - 40

Hence ;

Lower value :

- 30 + 40 = 10x

10 = 10x

x = 1

Upper value :

+30 + 40 = 10x

70 = 10x

x = 7

Other Questions
Write the recurring decimal 0.25 (with just the 5 recurring) as an exact fraction. Thank you! 4Find the distance between A (3, 4) and B (15, 13). Write a brief summary about the rule of Sultans, Specify-what went well during their rule. How are artists influenced by social media?They tap into the positive energy of their audience. They can be encouraged or discouraged by the comments. They put all their ego in the responses of their audience. They are skeptical of any negative criticism they receive Subtract 38 from $5.60. Include the dollar sign and no spaces in your answer. :AN ABSENT-MINDED WRITERMr. Smith, a well-known writer, went ... the booking-office and bought a I single ticket... the 7 o'clock express... Manchester. The booking-office clerk told I him that the train was due to arrive ... Manchester... 9 o'clock the next morning... I the evening Mr. Smith came... the railway station... taxi. As he came... the station I ... ten minutes... seven and was afraid to miss the train he hurried ... his carriage. I When he got., the train and found his compartment he put bis suit-case ... the I luggage-rack and sat down to read a magazine. The train was going very fast. After I it had passed two or three stops a ticket-collector came to collect the tickets. Mr. Smith couldn't find his ticket. As some ... the passengers told the ticket-collector I that Mr. Smith was a well-known writer the ticket-collector said ... him: "That's all right, sir. I know you've got a ticket." "But I must find it. I must know where I I'm going ...," was the reply. 20 Combine like terms:3n-10+1-4n a)Declare an array to store objects of the class defined by the UML above. Use a method from the JOption class to request the length of the array from the user.b) Use a method from the JOptionPane class to request values from the user to initialize the instance variables of the Election objects and assign these objects to the array. The array must be filled. whats the rate if 13 inches of snow in 7 hours Which question about the repetition in the excerpt is thebest one to ask in a group discussion?O How does Adichie use repetition to support therhetorical appeal?O Why does Adichie include repetition rather thanethos?O How does the use of repetition appeal toAdichie's audience?O Why does Adichie focus the repetition on food? HELP NEEDED ASAP FIRST PERSON TO ANSWER GETS BRAINLIEST AND 15 MORE POINTS A local company makes cement posts in the shape of the following three-dimensionalcompositeThe cone and cylinder both have the same radius, while the height of the cylinder is 3 times the height of the cone. Which equation can be used to find the total volume of the cement post?V= 4pi(r^2)hV= 4pi(r^4)hV= 10/3pi(r^2)hV= 8/3pi(^2)h the nurse si teaching a community health class about the risk factors for cancer of the larynx. which factor has the least influence in predisposing an individual to this type of cancer Party. Elena is buying cups and plates for her party. Cups are sold in packs of 8 and plates are sold in packs of 6. She wants to have the same number of plates and cups.Find a number of plates and cups that meet her requirement.How many packs of each supply will she need to buy to get that number?Name two other quantities of plates and cups she could get to meet her requirement.Tiles. A restaurant owner is replacing the restaurants bathroom floor with square tiles. The tiles will be laid side-by-side to cover the entire bathroom with no gaps, and none of the tiles can be cut. The floor is a rectangle that measures 24 feet by 18 feet.What is the largest possible tile size she could use? Write the side length in feet. Explain how you know its the largest possible tile.How many of these largest size tiles are needed?Name more tile sizes that are the whole number of feet that she could use to cover the bathroom floor. Write the side lengths (in feet) of the square tiles.Stickers. To celebrate the first day of spring, Lin is putting stickers on some of the 100 lockers along one side of her middle schools hallway. She puts a skateboard sticker on every 4th locker (starting with locker 4), and a kite sticker on every 5th locker (starting with locker 5).Name three lockers that will get both stickers.After Lin makes her way down the hall, will the 30th locker have no stickers, 1 sticker, or 2 stickers? Explain how you know.Kits. The school nurse is assembling first-aid kits for the teachers. She has 75 bandages and 90 throat lozenges. All the kits must have the same number of each supply, and all supplies must be used.What is the largest number of kits the nurse can make?How many bandages and lozenges will be in each kit?What kind of mathematical work was involved in each of the previous problems? Put a checkmark to show what the questions were about.Evaluation: What Kind of Problem?1. For each problem, tell whether finding the answer requires finding a greatest common factor or a least common multiple. You do not need to solve the problems.a. Elena has 20 apples and 35 crackers for making snack bags. She wants to make as many snack bags as possible and wants each bag to have the same combination of apples and crackers. What is the largest number of snack bags she could make?b. A string of holiday lights at a store has three colors that flash at different times. Red lights flash every fifth second. Blue lights flash every third second. Green light flashes every four seconds. The store owner turns on the lights. After how many seconds will all three lights flash at the same time for the first time?c. A florist orders sunflowers every 6 days, starting from the sixth day of the year, and daisies every 4 days, starting from the fourth day of the year. When (or on which day) will she order both kinds of flowers on the same day?d. Noah has 12 yellow square cards and 18 green ones. All the cards are the same size. He would like to arrange the square cards into two rectanglesone of each color. He wants both the yellow and green rectangles to have the same height and to be as tall as possible. What is the tallest possible height for the two rectangles?2. Explain how you know which problem(s) involves finding the greatest common factor. Why do populations rise or fall in particular places? A. a clusterb. a gapc. low frequencyd. symmetric y intercept of f(x) = -2/9 x + 1/3 Carbon monoxide and chlorine gas react to form phosgene: CO(g) + Cl (g) = COC12 (g) Kp: = 3.10 at 700 K Part A If a reaction mixture initially contains 174 torr of CO and 211 torr of C12, what is t In the first week of July, a record people went to the local swimming pool. In the second week, fewer people went to the pool than in the first week. In the third week, more people went to the pool than in the second week. In the fourth week, fewer people went to the pool than in the third week. What is the percent decrease in the number of people who went to the pool over these four weeks? help me please with my math