The formula unit is the representative particle for what?

Answers

Answer 1

Answer:

The representative particle of an ionic compound is the formula unit. A formula unit uses a formula to calculate the basic whole number ratio of the ions in an ionic compound.

Explanation:

HAHAH I'm not sure


Related Questions

What does voltage describe?

Answers

The Voltage is the pressure from the electrical circuit of the power source that passes the current.

The Voltage is defined as the pressure from the electrical circuit of the power source that will passes the charged electrons that is the current through the conducting loop, it will enable them to do work  because of the illuminating the light. The in simple terms is : voltage = pressure, and it is denoted as the volts and the symbol is the V.

The voltage is described as the force that causes the flow of the charged particles. The Voltage is also called as the electromotive force.

To learn more about voltage here

https://brainly.com/question/13177389

#SPJ1

Hydrogen gas is collected over water at 23°C, 767 torr. At this temperature the vapor pressure of water is 21.0 torr. What is the partial pressure of hydrogen in the collected gas?

Answers

The partial pressure of hydrogen gas in the collected gas is 746 torr.

To determine the partial pressure of hydrogen gas in the collected gas, we need to consider the difference between the total pressure of the collected gas and the vapor pressure of water at the given temperature. The partial pressure of hydrogen gas is the pressure exerted by hydrogen alone.

Given information:

Total pressure of the collected gas (Ptotal) = 767 torr

Vapor pressure of water (Pwater) = 21.0 torr

The partial pressure of hydrogen gas (Phydrogen) can be calculated using Dalton's law of partial pressures, which states that the total pressure of a mixture of gases is equal to the sum of the partial pressures of each individual gas.

Phydrogen = Ptotal - Pwater

Plugging in the given values:

Phydrogen = 767 torr - 21.0 torr

Phydrogen = 746 torr

Therefore, the partial pressure of hydrogen gas in the collected gas is 746 torr.

It's important to note that in this calculation, we assume that the water vapor does not react with or dissolve in the hydrogen gas and that the gases behave ideally. Additionally, it's assumed that the collected gas is dry, meaning all the water vapor has been removed or does not significantly contribute to the total pressure.

Fo rmore such questions on partial pressure visit:

https://brainly.com/question/19813237

#SPJ8

What type of reaction will occur if AH is negative and entropy increases?
O spontaneous reaction
O Gibbs free reaction
O exothermic reaction
endothermic reaction

Answers

The type of reaction that will occur if AH is negative and entropy increases is option  A which is a spontaneous reaction .

Spontaneous reaction explained.

The spontaneity of any chemical reaction depends on the Gibbs free reaction which is related to entropy change and enthalpy change.ΔG= ΔH-TΔS

Where T is temperature change in kelvin.If AH is negative, entropy will increases which is ΔS. Then the ΔG will depend on the temperature change.

If TΔS is larger than ΔH, the reaction will be spontaneous and ΔG will be negative which means the reaction will move forward without any external input.

When a change in entropy increases with the temperature in the system, the reaction will be spontaneous and this will make the Gibbs free energy to be negative.

Learn more about spontaneous reaction below.

https://brainly.com/question/14061406

#SPJ1

This graduated cylinder is being used to measure an amount of a liquid. The numbers represent milliliters. What is the most precise measurement of the volume of this liquid? 37.0 ml 37.1 ml 37.2 ml 37.3 ml

This graduated cylinder is being used to measure an amount of a liquid. The numbers represent milliliters.

Answers

Answer:

37.1 mL

Explanation:

To accurately read the measurement using a cylinder, we read the measurement at the meniscus i.e measurement under the curve as shown in the diagram above.

The meniscus i.e the measurement under the curve as shown above is 37.1 mL.

Therefore, the volume of the liquid as obtained from the cylinder is 37.1 mL

Answer:

37.1 ml

Explanation:

a graduated cylinder's measurement is taken at the bottom of the meniscus

When a chemical reaction occurs blank happens

Answers

Answer:

In a chemical reaction, reactants contact each other, bonds between atoms in the reactants are broken, and atoms rearrange and form new bonds to make the products.

Explanation:

Part A
Which claim is supported by evidence in the passage?
Lewis's father was strict.
Lewis's family's troupe was successful.
Lewis was too young to remember his lines.
Lewis did not want to perform because patrons threw eggs.

Answers

Hamilton explained the choice on the On Purpose show, admitting that the pair's work connection from karting to F1 had placed a burden on an otherwise strong friendship.

Why did Lewis have a falling out with his father?

Lewis Hamilton now has a close connection with his father Anthony, but this was not always the case during his Formula One tenure. Anthony had a significant influence on his son's career, notably working multiple jobs to finance Hamilton's early foray into racing until he was signed by McLaren at the age of 11.

However, his earnings outside of Formula One rose from $8 million in 2021 to $12 million in 2022. Hamilton was the highest-paid Formula One racer. He has profitable agreements with companies such as Monster energy drinks.

Learn more about Hamilton

https://brainly.com/question/31006348

#SPJ1

lewis electron dot notation

Answers

Lewis electron dot notation is a method for representing the valence electrons in an atom. In this notation, the valence electrons are shown as dots around the symbol of the element. The number of dots represents the number of valence electrons.


The Lewis electron dot notation is a useful tool for understanding the chemical behavior of elements. It allows us to see how many valence electrons an atom has and how they are distributed. This information can be used to predict the types of chemical bonds that an atom is likely to form. For example, the Lewis electron dot notation for nitrogen is:
N: ·
Nitrogen has five valence electrons, so there are five dots around the symbol.
In addition to representing individual atoms, the Lewis electron dot notation can also be used to represent molecules. In a molecule, the dots represent the shared electrons between the atoms.  The Lewis electron dot notation is an important concept in chemistry that helps us to understand the properties and behavior of atoms and molecules.

For such more questions on valence

https://brainly.com/question/371590

#SPJ11

How do I do this ? What was AMU again?

How do I do this ? What was AMU again?

Answers

Answer

n=4

Procedure

Data

Sulfur has an atomic mass of 32.065 u

Fluorine has an atomic mass of 18.9984 u

To solve this problem we need to find the number of atoms of fluorine, this can be done using an equation as follows

\(108.01=32.065+18.9984x\)

Solving for x we have

\(x=\frac{108.01-32.065}{18.9984}=3.99\approx4\)

Hence as we can't have a decimal atom we consider 4 atoms of fluorine.

For each of these pairs of half-reactions, write the balanced equation for the overall cell reaction and calculate the standard cell potential. Express the reaction using cell notation. You may wish to refer to Chapter 20 to review writing and balancing redox equations.
1.
Pt2+(aq)+2e-Pt(s)
Sn2+(aq)+2e-Sn(s)
2.
Co2+(aq)+2e-Co(s)
Cr3+(aq)+3e-Cr (s)
3.
Hg2+(aq)+2e-Hg (I)
Cr2+(aq)+2e-Cr (s)

please help out

Answers

1. For the pair of half-reactions:

Pt2+(aq) + 2e- → Pt(s)    ... (1)

Sn2+(aq) + 2e- → Sn(s)    ... (2)

To obtain the balanced equation for the overall cell reaction, we need to multiply the half-reactions by appropriate coefficients to ensure that the number of electrons transferred is equal. In this case, we can multiply equation (1) by 2 and equation (2) by 1:

2(Pt2+(aq) + 2e-) → 2(Pt(s))

Sn2+(aq) + 2e- → Sn(s)

Combining the equations, we have:

2Pt2+(aq) + Sn2+(aq) → 2Pt(s) + Sn(s)

The cell notation for this reaction is:

Pt2+(aq) | Pt(s) || Sn2+(aq) | Sn(s)

To calculate the standard cell potential (E°), we need to know the standard reduction potentials for Pt2+/Pt(s) and Sn2+/Sn(s) half-reactions. Referring to standard reduction potential tables, we find:

E°(Pt2+/Pt(s)) = +1.20 V

E°(Sn2+/Sn(s)) = -0.14 V

The overall cell potential (E°cell) is the difference between the reduction potentials:

E°cell = E°(cathode) - E°(anode) = 0.00 V - (-0.14 V) = +0.14 V

Therefore, the standard cell potential for this reaction is +0.14 V.

2. For the pair of half-reactions:

Co2+(aq) + 2e- → Co(s)    ... (3)

Cr3+(aq) + 3e- → Cr(s)    ... (4)

To balance the number of electrons transferred, equation (4) can be multiplied by 2:

2(Co2+(aq) + 2e-) → 2(Co(s))

Cr3+(aq) + 3e- → Cr(s)

Combining the equations, we have:

2Co2+(aq) + Cr3+(aq) → 2Co(s) + Cr(s)

The cell notation for this reaction is:

Co2+(aq) | Co(s) || Cr3+(aq) | Cr(s)

To calculate the standard cell potential (E°), we refer to the standard reduction potentials:

E°(Co2+/Co(s)) = -0.28 V

E°(Cr3+/Cr(s)) = -0.74 V

The overall cell potential (E°cell) is the difference between the reduction potentials:

E°cell = E°(cathode) - E°(anode) = -0.74 V - (-0.28 V) = -0.46 V

Therefore, the standard cell potential for this reaction is -0.46 V.

3. For the pair of half-reactions:

Hg2+(aq) + 2e- → Hg (l)    ... (5)

Cr2+(aq) + 2e- → Cr(s)    ... (6)

The equation for the overall cell reaction can be obtained by multiplying equation (6) by 2:

2(Hg2+(aq) + 2e-) → 2(Hg (l))

Cr2+(aq) + 2e- → Cr(s)

Combining the equations, we have:

2Hg2+(aq) + Cr2+(aq) → 2Hg (l) + Cr(s)

For more such questions on balanced equation.

https://brainly.com/question/11904811

#SPJ8

Acid-Base Titrations When methylammonium chloride (pKa = 10.645) is titrated with tetramethylammonium hydroxide, the titration reaction is CH3NH + OH - CH3NH2 + H2O BH From B Weak acid (CH3)4N OH Weak base Find the equivalence volume in the titration of 25.0 mL of 0.010 0 M methylammonium chloride with 0.050 0 M tetramethylammonium hydroxide. Calculate the pH at Vo=0, 2.50, 5.00, and 10.00 mL. Sketch the titration curve.

Answers

5.00mL the equivalence volume in the titration of 25.0 mL of 0.010 0 M methylammonium chloride with 0.050 0 M tetramethylammonium hydroxide.

To find the equivalence volume, we need to first determine the moles of methylammonium chloride (MAC) present in the initial solution:

moles of MAC = (25.0 mL)(0.0100 M) = 0.250 mmol

Since the stoichiometry of the reaction is 1:1 between MAC and tetramethylammonium hydroxide (TMAH), the equivalence point occurs when 0.250 mmol of TMAH has been added:

moles of TMAH = (0.250 mmol)/(1000 mL/L) = 0.000250 mol

Now we can calculate the volume of TMAH required to reach the equivalence point:

0.000250 mol / 0.050 0 M = 5.00 mL

Therefore, the equivalence volume is 5.00 mL.

To calculate the pH at different points in the titration, we can use the Henderson-Hasselbalch equation:

pH = pKa + log([A-]/[HA])

At Vo=0, we have only MAC present, so [A-] = 0 and [HA] = 0.0100 M. Therefore:

pH = 10.645 + log(0.000/0.0100) = 10.645

At Vo=2.50 mL, we have added some TMAH, but have not yet reached the equivalence point. We can calculate the concentrations of the acid and conjugate base using the stoichiometry of the reaction and the amount of TMAH added:

moles of TMAH added = (2.50 mL)(0.050 0 M) = 0.000125 mol

moles of MAC remaining = 0.250 mmol - 0.000125 mol = 0.249875 mol

moles of MAC converted to MAC+ = 0.000125 mol

moles of MAC+ = 0.249875 mol

Now we can calculate the concentrations of the acid and conjugate base:

[HA] = (0.249875 mol / 0.0250 L) = 0.009995 M

[A-] = (0.000125 mol / 0.0275 L) = 0.00455 M

Using the Henderson-Hasselbalch equation:

pH = 10.645 + log(0.00455/0.009995) = 10.073

Similarly, we can calculate the pH at Vo=5.00 mL and Vo=10.00 mL:

At Vo=5.00 mL:

moles of TMAH added = (5.00 mL)(0.050 0 M) = 0.000250 mol

moles of MAC remaining = 0.250 mmol - 0.000250 mol = 0.249750 mol

moles of MAC converted to MAC+ = 0.000250 mol

moles of MAC+ = 0.249750 mol

[HA] = (0.249750 mol / 0.0250 L) = 0.009990 M

[A-] = (0.000250 mol / 0.0300 L) = 0.00833 M

pH = 10.645 + log(0.00833/0.009990) = 9.899

At Vo=10.00 mL:

moles of TMAH added = (10.00 mL)(0.050 0 M) = 0.000500 mol

moles of MAC remaining = 0.250 mmol - 0.000500 mol = 0.

To learn more about methylammonium chloride visit;

https://brainly.com/question/31166333

#SPJ4

For the reaction NO(g) + 1/2 O2(g) -----> at 750 degrees Celsius, the equilibrium constant Kc equals

For the reaction NO(g) + 1/2 O2(g) -----> at 750 degrees Celsius, the equilibrium constant Kc equals

Answers

Explanation:

Given the following reaction.

NO (g) + 1/2 O₂ (g) <---> NO₂ (g)

We have to find the relationship between its Kc and Kp.

The Kp can be calculated from the Kc using the following expression.

Kp = Kc * (R*T)^(Δn)

Where Δn is the sum of the coefficients of the products minus the sum of the coefficients of the reactants. So Δn will be equal to:

Δn = Σ n of products - Σ n of reactants

Δn = 1 - (1 + 1/2)

Δn = -1/2

So we can say that:

Kp = Kc * (R*T)^(Δn)

Kp = Kc * (R*T)^(-1/2)

Kc = Kp * (R*T)^(1/2)

Answer: Kc = Kp * (R*T)^(1/2)

The half reaction with a more positive standard reduction potential will

Answers

The half reaction with a more positive standard reduction potential will proceed spontaneously in a redox reaction

The half reaction with a more positive standard reduction potential will undergo reduction when compared to the half reaction with a more negative standard reduction potential.

Oxidation-reduction reactions, often known as redox reactions, are a set of chemical reactions that involve electron transfer between reactants. In a redox reaction, one reactant is oxidized, losing electrons, while the other reactant is reduced, gaining electrons.

The oxidation half-reaction is the process of losing electrons and increasing the oxidation number, whereas the reduction half-reaction is the process of gaining electrons and decreasing the oxidation number. The total reaction is referred to as the redox reaction.

Half-reaction:Half-reaction refers to the two parts of an oxidation-reduction reaction that happen separately. A half-reaction must always be either an oxidation reaction or a reduction reaction. It also describes the movement of electrons and hydrogen ions in an equation.

Know more about redox reaction    here:

https://brainly.com/question/21851295

#SPJ8

What is the importance of the IPK? What might happen if it did not exist?

Answers

Answer:

See detailed explanation.

Explanation:

Hello,

In this case, since the International Prototype of the Kilogram (IPK) is an object  made of a platinum-iridium alloy that was used to define the magnitude of the mass of the kilogram as it weights 2.2 pounds or approximately 1 kg, yet it was replaced by a new definition of the kilogram based on physical constants. In such a way, it is important because it was the base for the current understanding of what a kilogram is and its relationship with other mass measurements.

Thus, if would not have existed, we were not be able to design and use balances or mass-measuring equipment in order to provide a reliable measure of the real mass of an object.

Best regards.

The diagram below shows atoms that are all arranged into groups in the same way.


What does this diagram represent?

A.) two different substances

B.) three different substances

C.) a single type of substance

D.) a single type of element

The diagram below shows atoms that are all arranged into groups in the same way.What does this diagram

Answers

Answer: B

Explanation: Forgive me if I'm wrong

At the boundary between two transparent substances: 1 the light slows down going into a denser substance, and the ray bends towards the normal. 2 the light speeds up going into a less dense substance, and the ray bends away from the normal.

Well its not A and its not C so its B

Answer:

Its C

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What is Chemistry as in science? ​

Answers

Answer: a science concerned with the composition, structure, and properties of substances, as well as the transformations that they go through

Explanation:

chemistry is a branch of science concerned w the substances of which matter is composed, the investigation of their properties and reactions and the use of such reactions to form new substances . Hope this helps pls make me brainliest

if we are constantly taking in more and more c-14 why does it concentration in us not increase

Answers

Although we constantly take in more C-14 through the food we eat, it decays at a constant rate. As a result, the concentration of C-14 in our bodies remains relatively constant over time.

The enthalpy of fusion of butane, CH1o, is 24.3 kJ/mol at the melting point of -0.5°C. What is the change in entropy for the crystallization of 1.25 mole of butane?

Answers

The change in entropy for the crystallization of 1.25 moles of butane can be calculated using the formula ΔS = ΔH_fusion / T, where ΔS is the change in entropy, ΔH_fusion is the enthalpy of fusion, and T is the temperature in Kelvin.

In the given problem, the enthalpy of fusion of butane is 24.3 kJ/mol. To convert this to J/mol, we multiply it by 1000, resulting in 24,300 J/mol. The melting point of butane is -0.5°C, which is equivalent to 272.65 K.

Using the formula, we can calculate the change in entropy as follows:

ΔS = (24,300 J/mol) / 272.65 K

    ≈ 89.25 J/(mol·K)

Therefore, the change in entropy for the crystallization of 1.25 moles of butane is approximately 89.25 J/(mol·K).

The change in entropy (ΔS) for the crystallization of a substance can be determined using the equation ΔS = ΔH_fusion / T, where ΔH_fusion is the enthalpy of fusion and T is the temperature in Kelvin. In this case, the enthalpy of fusion of butane is given as 24.3 kJ/mol, which is converted to 24,300 J/mol. The melting point of butane is -0.5°C, which is equivalent to 272.65 K.

By substituting the values into the equation, we find that the change in entropy is approximately 89.25 J/(mol·K). This means that for the crystallization of 1.25 moles of butane, the entropy decreases by 89.25 J/(mol·K).

Entropy is a measure of the disorder or randomness of a system. In this case, the crystallization process involves the transition from a disordered liquid state to an ordered solid state, resulting in a decrease in entropy. The magnitude of the entropy change depends on the enthalpy of fusion and the temperature. A higher enthalpy of fusion or a lower temperature leads to a larger change in entropy.

for such more questions on entropy

https://brainly.com/question/419265

#SPJ8

what is inside an atom​

Answers

Most atoms have three different subatomic particles inside them: protons, neutrons, and electrons. The protons and neutrons are packed together into the center of the atom (which is called the nucleus) and the electrons, which are very much smaller, whizz around the outside.

How would the Sun look from Neptune compared to Earth?
A.It would look smaller
and brighter

B. It would look bigger
and less bright

C. It would look bigger
and brighter

D. It would look smaller
and less bright

Answers

Answer:

It would look bigger and brighter

Explanation:

It would look bright as sunlight

What is the percentage composition of each element in dinitrogen monoxide, N2O?

Answers

Percentage composition of nitrogen and oxygen are 63.6% and 36.3% respectively. This word refers to the overall mass percentage of each element contained in a compound.

What is percentage composition?

The ratio of each element's quantity to the sum of all the individual components present in the compound, multiplied by 100, is what determines any compound's percentage composition.

Any compound's percent composition expresses its makeup in terms of all the components that are present. The chemical analysis reveals the relevance of this composition calculation. The concentration of such an element in a mixture or component in a combination is expressed using the idea of mass percentage composition.

percentage composition of nitrogen= (28/44)×100=63.6%

percentage composition of oxygen=(16/44)×100=36.3%

Therefore, percentage composition of nitrogen and oxygen are 63.6% and 36.3% respectively.

To learn more about percentage composition, here:

https://brainly.com/question/1350382

#SPJ1

What type of boundary exists at letter b?

What type of boundary exists at letter b?

Answers

Answer:

Convergent boundaries

Explanation:

how many atoms are in 5.7 g of helium?

Answers

Answer:

3.5*1024

Explanation:

3584

Which of the following does pascal's Principle help to explain?

Which of the following does pascal's Principle help to explain?

Answers

Answer:

B) hydraulics

Explanation:

Answer:

hydraulics

Explanation:

i got it right the test on apex

:DDDDDDDD

A person has a standing order for 6 doses of acetaminophen in a 24 hour period for fevers
acetaminophen requires what type of reporting?
ut of
Select one:
a. Routine
estion
b. Emergent
C. Certain Time
d. Urgent
4
A change in the type of seizure the person usually experiences that causes them to stop brea

Answers

Acetaminophen is used to treat patients with aches and fever. It is safe to give a dose of 4 grams in 24 hours period.

It is an effective medicine which does not require much time to provide relief to the patient.

Usually tylenol is the best medicine which consists of Acetaminophen in appropriate quantity to provide relief from pain and fever.

The reporting for the doses introduced to the patient must be routine since it is not an emergency case.

The correct answer is a. Routine

Learn more at https://brainly.com/question/24335381

Recall the information you read in parts B and C. How do the two desalination processes differ from the atmospheric water generator in terms of where the processes can be used?

Answers

The way that the two desalination processes differ from the atmospheric water generator is that:

The Processes for desalinating water is one that tends to remove dissolved salts and other forms of minerals. Seawater, brackish water, wells, surface water (rivers as well as streams), wastewater, as well as industrial feed and process waters are all potential sources of feedwater.

Pressure is one of the driving forces needed for membrane separation (applied as well as vapor).

What is the desalination processes?

Desalination is the process of removing extra salt or other minerals from water, such as seawater, in order to create freshwater fit for drinking or irrigation.

Note that it is seen as reverse osmosis using semipermeable membranes and/or a lot of stage of flash distillation are two possible processes in the desalination process.

Learn more about desalination processes from

https://brainly.com/question/23384687
#SPJ1

A sphere has a diameter of 16 m. What is the volume of the sphere?

Answers

Answer:

V ≈ 2144.66 m³

Explanation:

Volume of sphere formula is:

V = 4/3 πr³

Radius is half the diameter so we divide the given diameter, 16 by 2 to get 8, the radius. Now we can solve

V = 4/3 π (8)³

V = 4/3 (512π)

V = 2048/3 π

V ≈ 2144.66 m³

Answer:

4/3 x π

Explanation:

Determine the best way to deal with each of the following items that may dangle into the way during lab work.
flowy sleeves ________
loose bracelets ________
long necklaces _________
long earrings ________
long hair ________
flowy sleeves--Tie back or secure
loose bracelets-- Remove
long necklaces--Remove
long earrings--Remove
long hair--Tie back or secure

Answers

Roll up the flowy sleeves, loose bracelets, long necklaces, long earrings should be removed or tucked under clothing. Tie the long hairs.

The best way to deal is,

Flowy sleeves: Roll up or tuck in the sleeves to prevent them from interfering with lab equipment.

Loose bracelets: Remove the bracelets or tuck them under gloves.

Long necklaces: Remove the necklaces or tuck them under clothing to prevent them from getting caught on equipment.

Long earrings: Remove the earrings or tuck them under clothing.

Long hair: Tie hair back or wear a hairnet to prevent hair from getting caught on equipment.

To know more about the safety measures, here

brainly.com/question/18315601

#SPJ4

How many electrons are in the 6p subshell of Rn?

Answers

In the electrical arrangement, the 6p subshell of the radon element contains 6 electrons.

What is electronic configuration of radon?Radon is the 86th element in the periodic table, with the symbol 'Rn'. Radon is a type of noble gas. Radon contains a total of eighty-six electrons. These electrons are grouped in accordance with the laws of several orbits.The p-orbital can hold up to six electrons. As a result, the following six electrons enter the 2p orbital. The second orbit is now completely filled. As a result, the remaining electrons will go into the third orbit.As a result, the entire electron configuration of radon is 1s^2 2s^2 2p^6 3s^2 3p^6 3d^10 4s^2 4p^6 4d^10 4f^14 5s^2 5p^6 5d^10 6s^2 6p^6.

For more information on electronic configuration kindly visit to

https://brainly.com/question/29757010

#SPJ1

What happens in a reaction if it is at chemical equilibrium?
Responses

The reaction rates of making products and using reactants are equal.
All of the reactants are used up.
The amount of the product is constantly decreasing.
There are no products in the system.

Answers

The reaction can be said to be at equilibrium when the reaction rates of making products and using reactants are equal.

When is a reaction at equilibrium?

When the rates of the forward and reverse reactions are equal and the concentrations of the reactants and products don't change over time, a chemical reaction is said to be in equilibrium.

When the system reaches equilibrium, it is in a state of balance, which means that the concentrations of the reactants and products have not changed significantly.

Learn more about reaction equilibrium:https://brainly.com/question/9024475

#SPJ1

Other Questions
Which of the questions below could be the equation of this parabola latin american term for nineteenth-century local military leaders which step of the performance management process are heidi and christopher at in the beginning of the video? multiple choice define performance provide support and ongoing performance discussions evaluate performance provide consequences develop employee goals, behavior, and actions to achieve outcomes Select the correct answer from each drop-down menu.Teresa is planning a career in the network systems pathway. Her research tells her she needs to develop network maintenance and security skills.Why would she need those?Network systems professionals need network maintenance skills to know how to perform tasks such asThey need network security skills to know how to perform tasks such asResetNext overdue please help me Mark the letter A, B, C or D to indicate the word whose underlined part differs from theother three in pronunciation in each of the following questions.1.A. treasure B. pleasure C. ensure D. measure2.A. daughter B. author C. laundry D. sausageMark the letter A, B, C or D to indicate the word that differs from the other three in theposition of primary stress in each of the following questions.3.A. product B. celebration C. Vietnamese D. engineer4.A. directory B. generous C. accessible D. traditionalMark the letter A, B, C or D to indicate the correct answer to each of the following question.5.You shouldnt _________ a gift in black or white paper.A. invite B. wrap C. follow D. break6.We have a family tradition of _________ the pagoda on the first day of every lunar month.A. visit B. visiting C. to visit D. visited7.Nam has to leave to tidy his room every day.A. should B. must C. ought to D. need to8.I think someone talk to the boss. We cant work extra hours on SaturdayA. have to B. should C. dont have to D. shouldnt9.Ben _________ a lot in his job but now, since his promotion, he doesnt.A. used travel B. used to travel C. used to travelingD. is used to traveling10.We have to _________our shoes when we go inside a pagoda.A. put on B. give off C. turn off D. take off11.You _________another persons head because its disrespectfulA. should touch B. shouldnt touch C. shouldnt touching D. shouldnt to touching 12.Where _________ before you moved here?A. did you use to live B. did you used to live C. used you to live D.do you use to live13.The buses were very ..this morning. We cant go to the church with you in time.A. crowd B. crowded C. full D. busyMark the letter A, B, C or D to indicate the underlined part that needs correction in eachof the following questions.14.You dont have to taken a thick coat.A B C D15.Its not a good idea to left a child unsupervised.A B C D16.You should take on your shoes before going into a Japanese house.A B C DMark the letter A, B, C or D to indicate the correct response to each of the followingexchanges.17. Lan: Why do they love family customs and traditions?My: ..A. Because they provide a sense of belonging.B. They go there by bus.C. They dont remember.D. They make five-coloured sticky rice.18. A:Do you think you will go there this weekend? B:.A. Yes, I am B. No, I didnt C. Im not sure. D. No, I canMark the letter A, B, C or D to indicate the word(s) CLOSEST in meaning to theunderlined word(s) in each of the following questions.19.A custom is something that has become an accepted way of doing things.A. agreed B. placed C. smiled D. passed down20.Its exactly on time.A. surprised B. sharp C. exciting D. hard Where does regional metamorphism usually occur ? Need help ASAP, thanks in advanceFor each question, choose answer choice a-e and explain why you chose that answer.The weight of the box is changed to 50 N.The weight of the box is changed to 200 N.The applied force is increased to 50 N.The applied force is increased to 80 N.The coefficient of static friction is increased to 0.7.The coefficient of kinetic friction is increased to 0.5.The coefficient of kinetic friction is increased to 0.5 and the coefficient of static friction is increased to 0.7.The weight of the box is changed to 200 N and the coefficient of static friction is increased to 0.7.The weight of the box is changed to 200 N and the coefficient of kinetic friction is increased to 0.5.The weight of the box is changed to 200 N and the applied force is increased to 50 N. One half + four fifths vertical 50 Points! Multiple choice geometry question. Photo attached. Thank you! Callista Roys model in nursing One endpoint of a segment is located at (14,21) find the coordinates of the other ep if the midpoints coordinates are (41,50) What is the role of religion and spirituality in your life as human being and how they affect your perceptions in life? I can't seem to get the right angular acceleration and also not sure how to do part b. Help will be much appreciated. If a customer service representative changes the way she envisions her job, from recording complaints from customers to being an advocate for customer rights, she engages in which form of job crafting If a country experiences high inflation relative to malaysia, its imports from malaysia should ____, its exports should ____, and there is ____ pressure on its currency's against the ringgit. publicly owned companies must file their audited financial statements with which of the following? multiple choice question. the securities and exchange commission the internal revenue service the financial accounting standards board the public company accounting oversight board do fungi live in warm environments A certain company's main source of income is a mobile app. The function hhh models the company's annual profit (in millions of dollars) as a function of the price they charge for the app (in dollars). Answer this for me Step to step