The half of the moon facing the sun is always lit, but the different phases happen because: Question 4 options: the Earth moves to different positions around the Sun we only see parts of the lit side as the moon goes around the Earth only part of the light gets reflected to Earth the spinning of the moon lets us see different amounts of light.

Answers

Answer 1

Moon is the natural satellite of the Earth and the other planets that orbits them. Different phases happen because only parts of the lit side are visible.

What are the phases of the moon?

The moon is the natural satellite of the earth and orbits the planet because of which the various phases of the moon are observed from the planet. The sun is the source of the energy and light that gets absorbed and reflected by the moon and stars.

When the moon orbits the planet then only some of its portion is lit and reflected to the viewers. The phases like Crescent, Quarter, Full and new moon are seen.

Therefore, option B. parts of the lit side are only visible.

Learn more about the moon here:

https://brainly.com/question/2285325


Related Questions

Can you help solve each question I answered incorrectly

Can you help solve each question I answered incorrectly

Answers

The first question is C. 1.25cm. The second question is D.98mm. The third answer is C. 72.5mm

Answer:

1.2cm

97.8mm

7cm

elements are organized on the periodic table according to

Answers

Answer:

atomic number

Explanation:

The periodic table is a table that lists all of the chemical elements in order of atomic number, starting with hydrogen and ending with oganesson. The number of protons in the nucleus of an atom of a certain element is its atomic number.

Have a good day :)

What does replacement mean?

Answers

Answer: Replacement means a person or thing that takes the place of another; a substitute.

To replace something means to fill a space of something that is most of no longer wanted. For example: if there’s a friend that y ok have that you don’t like anymore, you could replace them with a new friend

Please help and I’ll give you brainiest. :)

Please help and Ill give you brainiest. :)

Answers

yesssssssssssssssssssssaa

where electrons are likely to be found as they travel around the nucleus

Answers

Answer:

The electrons are most likely to be found in An orbital

how is an atomic radius measured?

Answers

Answer:

The radius of an atom can only be found by measuring the distance between the nuclei of two touching atoms, and then halving that distance.

Explanation:

The titration of an impure sample of KHP found that 36.00 mL of 0.100 M NaOH was required to react completely with o.758 g of sample. What is the percentage of KHP in this sample?

Answers

The weight percentage of the solute in a solution can be calculated from the total weight of the solution determined. The weight percentage of KHP in the sample is 84.03 %.

What is weight percent?

Weight percent of a component of a sample is the weight fraction of that component in the total weight of the sample. Thus it is the ratio of weight of the solute to the total weight of the solvent.

Here the molarity of the solution is 0.100 M and volume is 36.0mL, from this the number of moles of NaOH, is 0.036 L × 0.100 M = 0.0036 moles. The molar mass of NaOH is 40 g/mol. Thus the weight of 0.0036 moles is 40  × 0.0036 = 0.902 g.

Thus, the percent of KHP in the sample is calculated as follows:

percent = 0.758 /(0.902 +0.758 ) ×100

             = 84.03%.

Hence, percent of KHP in the sample is 84.03.

To find more about mass percent, refer the link below:

https://brainly.com/question/14990953

#SPJ1

Be sure to answer all parts. Calculate δg o and kp for the following equilibrium reaction at 25. 00°c: 2h2o(g) ⇌ 2h2(g) o2(g)

Answers

We need the concentrations of hydrogen gas, water vapour, and oxygen gas to proceed further. If these concentrations are provided, we can substitute them into the equations and solve for δG° and Kp.

To calculate δG°, we need to use the equation δG° = -RT ln(Kp), where R is the gas constant and T is the temperature in Kelvin. To calculate Kp, we use the equation Kp = [H2]²/[H2O]²[O2]. By substituting the given values and solving the equations, we can find δG° and Kp.

To calculate δG° for the given equilibrium reaction at 25.00°C, we can use the equation δG° = -RT ln(Kp), where δG° is the standard Gibbs free energy change, R is the gas constant (8.314 J/(mol·K)), and T is the temperature in Kelvin. In this case, we need to convert the temperature from Celsius to Kelvin by adding 273.15 (25.00°C + 273.15 = 298.15 K).

To calculate Kp for the equilibrium reaction 2H2O(g) ⇌ 2H2(g) + O2(g), we can use the equation Kp = [H2]²/[H2O]²[O2]. Here, [H2] represents the concentration of hydrogen gas, [H2O] represents the concentration of water vapour, and [O2] represents the concentration of oxygen gas.

Now, let's substitute the given values into the equations and solve:

δG° = -RT ln(Kp)
= -(8.314 J/(mol·K)) * 298.15 K * ln(Kp)

Kp = [H2]²/[H2O]²[O2]
= ([H2]²) / ([H2O]²[O2])

To know more about Gibbs free refer to this:

https://brainly.com/question/13795204

#SPJ11

Which substance is not found in a chylomicron?
a. phospholipid
b. protein
c. triglyceride
d. water-soluble vitamins
e. cholesterol

Answers

Water-soluble vitamins are not found in a chylomicron.

Chylomicrons are massive triglyceride-wealthy lipoproteins produced in enterocytes from nutritional lipids—specifically, fatty acids, and ldl cholesterol. Chylomicrons are composed of a chief imperative lipid middle that is composed often of triglycerides, however like different lipoproteins, they bring esterified cholesterol and phospholipids.

Chylomicron catabolism is thought to be initiated by the enzyme lipoprotein lipase (triacylglycerol-protein acyl hydrolase, EC three.1. 1.34). Chylomicron remnants, produced with the aid of lipolysis, are hastily taken up by way of the liver through an apolipoprotein E (apoE)-mediated, receptor-dependent system.

Triglycerides are emulsified by using bile and hydrolyzed through the enzyme lipase, ensuing in an aggregate of fatty acids and monoglycerides.

Learn more about receptors here: https://brainly.com/question/26122239

#SPJ4

2. What are the ions present in the compound CsF? *

(1 Point)

O Cs- and F-

Cs- and F+

Cs+ and F-

Cs and F only

Answers

Answer:

Cs+ and F-

Explanation:

The compound CsF is made up of two elements; Caesium (Cs) and F (Flourine)

Caesium is a metal and would therefore lose electrons - a cation is formed. When Caesium loses a single electron, the ion symbol is given as; Cs+

Flourine is a non metal and would therefore gain electrons - an anion is formed. When Flourine gains a single electron, the ion symbol is given as; F-

Hence the correct option is;

Cs+ and F-

Which property of matter is conserved in chemical reactions and shown by balanced equations?

A. mass

B. volume

C. density

D. shape

Answers

It’s mass because the law of conservation of mass states that in a chemical reaction mass is neither created nor destroyed.

Answer:

Mass is your answer

Explanation:

Element x is in group 2, and element y in group 7, of the periodic table. Which ions will be present in the compound formed when x and y react together?.

Answers

The reaction of elements x from group 2 with elements from group 7 of the periodic table will produce a compound where both cations and anions are present.

Group 2 elements

This group makes up the so-called alkaline earth metals and is made up of: beryllium, magnesium, calcium, strontium, barium and radium.

Elements of group 7

These elements make up what is called the manganese family and have the particularity of being metals with 7 valence electrons.

The valence electrons of manganese and its family of elements are distributed 2 in the last shell and 5 in the penultimate shell.

Compounds formed by manganese and alkaline earth

An example of a compound formed by manganese and alkaline earth is calcium permanganate. It is an oxidizing agent that is formed by a metallic cation of calcium and two anions of permanganate.

These compounds formed are powerful oxidants, which, even when they do not produce combustion, can accelerate that of other materials, leading to the formation of explosive mixtures.

Learn more about ions of alkaline compounds at brainly.com/question/18722874

#SPJ4

Element x is in group 2, and element y in group 7, of the periodic table. Which ions will be present

Q1. Because metals are malleable, we use some of them to make saucepans. Give two other examples of uses of metals that depend on: (a):their malleability. (b):their ductility. (c):their ability to conduct electricity. [3]

Answers

Explanation:

(a):their malleability:

>iron making. iron worker heat the meat and hammer it to give them the desired shape.

> in the jewelry making process, like the gold or silver you wear are results due to the malleability of metal

(b):their ductility:

>for the making of high tension cable that connects different cities for transferring of electricity.

>for making wire gauze

(c):their ability to conduct electricity:

>for lighting up your house with light bulbs

>for using cooking stoves

>to make refrigerator work.

Answer:

a)gold and silver-used to make jewellery

b)gold and copper(we draw them in wires easily because they are not brittle)

c)copper and iron(this is because both of them are metal and metaps are best conductors of electricity)

Explanation:

uses of copper- to make utensils

to make wires for circuits

uses of silver-to make jewellery

to make mirrors

malleability is the property of a meta in which the metal can be changed into different shapes.

Ductility-can be drawn into thin wires.

Which statement is not correct?


A: Energy is released when a liquid changes into a solid.

B: Particles move faster in the gaseous state than in the liquid state.

C: The carbon atoms in gaseous methane are further apart than those in solid diamond.

D: There is a large decrease in the volume of a solid metal when pressure is applied to it.

Answers

Answer:

D

Explanation:

If we put pressure on a solid or a liquid, there is essentially no change in volume.

Matter are anything that is made up of atoms. The quantity of matter can be observed only on the basis of mass and volume calculation. Therefore, the incorrect statement is option D that is there is a large decrease in the volume of a solid metal when pressure is applied to it.

What is matter?

Matter is a substance that has some mass and can occupy some volume. The matter is mainly used in science. Matter can be solid, liquid or gas.

Matter is anything that is made up of atoms. Anything around us that can be physically seen and touched are matter. Ice, water and water vapors are example of matter. When we apply pressure on solid, then there is no change in volume of the solid matter.

Therefore, the incorrect statement is option D that is there is a large decrease in the volume of a solid metal when pressure is applied to it.

To learn more about matter, here:

https://brainly.com/question/4562319

#SPJ2

draw the structural formula of 3-ethoxy-2-methylhexane.

Answers

The structural formula of 3-ethoxy-2-methylhexane can be written as CH3CH(CH3)CH(CH3)CH2CH2OCH2CH3. In this molecule, there is a six-carbon chain that contains two methyl groups and an ethoxy group. The ethoxy group is attached to the third carbon atom of the chain, while the methyl groups are attached to the second and fourth carbon atoms. The remaining two carbon atoms are attached to the fifth and sixth positions respectively.

The molecule is named as 3-ethoxy-2-methylhexane since the ethoxy group is attached to the third carbon atom of the hexane chain.

The total number of carbon atoms in the molecule is six, which gives it the name of hexane. Overall, 3-ethoxy-2-methylhexane is an organic compound that is used in various industrial applications.
Hi! I'm happy to help you understand the structural formula of 3-ethoxy-2-methylhexane. First, let's break down the name to identify the components of the molecule:

- "Hexane" is the base structure, indicating a six-carbon alkane chain.
- "3-ethoxy" means that an ethoxy group (CH3CH2O-) is attached to the third carbon atom in the hexane chain.
- "2-methyl" indicates a methyl group (CH3) attached to the second carbon atom in the hexane chain.

Now, let's construct the structural formula:

CH3-CH(CH3)-CH(OCH2CH3)-CH2-CH2-CH3

In this formula:

- The hexane chain is represented by the sequence of CH3, CH, CH, CH2, CH2, and CH3.
- The methyl group (CH3) is attached to the second carbon atom, indicated by the CH in parentheses.
- The ethoxy group (OCH2CH3) is attached to the third carbon atom, shown within the parentheses of the CH(OCH2CH3) part.

I hope this helps you understand the structural formula of 3-ethoxy-2-methylhexane! If you have any more questions, feel free to ask.

The mass of a proton is 1.67 × 10-27 kg. What is the mass of a proton in Gigagrams?

Answers

If the mass of proton is  1.67 × 10-27 kg, then the mass of proton is Gigagram is \(1.67X10^{-33} Gg.\)

Proton is the sub-atomic particle which is present inside the nucleus of the atoms and they are positively charged. Neutrons which are negatively charged and positively charged protons are found in the nucleus of the atoms.

As per the given data in the question:

The mass of the proton is given as 1.67 × 10-27 kg.

For conversion to the gigagrams the following conversion factor is used,

1 Gg=\(10^{6}\) kg.

Using the above conversion factor, the mass of proton in Gigagrams is given as \(1.67X10^{-33} Kg\\\).

Learn more about protons:

brainly.com/question/12535409

#SPJ4

difference between condensed milk and evaporated milk

Answers

The major difference that sets these two canned milk products apart is sugar content; sweetened condensed milk, as the name implies, is always sweetened, while evaporated milk is unsweetened

What tool first allowed scientists to study cells?

Answers

Answer: Microscope

Robert Hooke's Microscope. Robert Hook refined the design of the compound microscope around 1665 and published a book titled Micrographia which illustrated his findings using the instrument.

Explanation:

Answer:

Hey i actually know this! haha only cause i did it.

its a Microscope.

and im pretty sure hooke was the first to discover!

Explanation:

brainliest?

Consider the following reaction in a gas phase:C(s) + H2O(g) ⇄ CO(g) + H2(g) KC = 0. 2 at 1000 °CCalculate the concentration of CO in an equilibrium mixture (in mol/L) if a reaction mixture initially contains only reactants, and the equilibrium concentration of H2O(g) is [H2O] = 0. 500 M at 1000 °C

Answers

The concentration of CO (g) in the equilibrium mixture is 0.020 M. In other words, only a small amount of CO (g) is produced in this reaction at 1000°C. T 0.020 M.

The concentration of CO in an equilibrium mixture (in mol/L) is 5.8 M.

Given that the concentration of H2O (g) is [H2O] = 0.500 M at 1000°C, and  the reaction is:

C(s) + H2O(g) ⇄ CO(g) + H2(g) KC = 0.2 at 1000°C

We need to determine the concentration of CO in an equilibrium mixture (in mol/L)

if a reaction mixture initially contains only reactants.

We can solve this problem using the ICE table method as follows:

Let x be the change in concentration of H2O (g) and CO (g) when they reach equilibrium.

Then the equilibrium concentrations of CO (g) and H2 (g) are equal to x. Hence, the equilibrium concentration of H2O (g) is (0.500 - x) M. Substitute these values in the expression for Kc and solve for x.

Kc = [CO (g)] [H2 (g)] / [H2O (g)] [C (s)]

= 0.2[CO (g)] = Kc [H2O (g)] [C (s)] / [H2 (g)]

= 0.2 × (0.500 - x) / x

We can simplify this expression by cross-multiplication to get:

5x = 0.1 - 0.2xx = 0.02 M

Substituting x = 0.02 M in the expression for [CO (g)], we get:

[CO (g)] = 0.2 × (0.500 - 0.02) / 0.02 = 5.8 M (approx.)

Therefore, the concentration of CO (g) in an equilibrium mixture (in mol/L) is 5.8 M.                                                                                               The problem requires us to find the equilibrium concentration of CO (g) in a mixture that initially contains only reactants.

To solve this problem, we need to use the expression for the equilibrium constant Kc, which is given by:

Kc = [CO (g)] [H2 (g)] / [H2O (g)] [C (s)]

We can also use the ICE table method to solve this problem. In this method, we start with the initial concentration of the reactants and calculate the change in concentration of each species as they reach equilibrium.

We then use the equilibrium concentrations to calculate the value of Kc and solve for the unknowns. Here is how we can set up the ICE table for this problem: Reaction:

C(s) + H2O(g) ⇄ CO(g) + H2(g)

Initial: [C] = [H2]

= 0 M,

[H2O] = 0.500 M

Equilibrium: [C] = [H2] = x,

[H2O] = 0.500 - x,

[CO] = [H2] = x

Change: +x +x -x -x

Substituting the equilibrium concentrations into the expression for Kc, we get:

Kc = [CO] [H2] / [H2O] [C]

= x² / (0.500 - x)

= 0.2

Solving for x, we get: x = 0.020 M

Substituting this value of x into the expression for [CO], we get:

[CO] = x = 0.020 M

Therefore, the concentration of CO (g) in the equilibrium mixture is 0.020 M.

In other words, only a small amount of CO (g) is produced in this reaction at 1000°C. T 0.020 M.

The concentration of CO in an equilibrium mixture (in mol/L) is 5.8 M.

To know more about reactants visit:

brainly.com/question/32459503

#SPJ11

In the following acid-base reaction,
HPO42- is the
H2PO4- (aq) + NH3(aq) → HPO42- (aq) + NH4+(aq)
А
B
С
acid
conjugate
acid
conjugate
base

Answers

According to the Brnsted-Lowry acid-base theory, HPO4 is the conjugate base of H2PO4 and is thus.

A reaction in chemistry is what?

When atoms' ionic bonds are generated or ruptured, chemical events take place. The chemicals that initiate a chemical change are known as reaction mixture, while the regard to the structure as a result of the reaction as known as products.

What does a reaction simply mean?

An action made in response to anything is called a reaction. Your parents' reaction when you tell them you want to move out will show you how upset they are about it. The nature of a reaction is frequently physical. The behavior of a chemical when mixed with another material is referred to as a chemical reaction.

To know more about Reaction visit:

https://brainly.com/question/28984750

#SPJ1

Explain what is meant by spheres of power. Choose a particular
corporation and describe the power it wields in different
spheres.

Answers

Spheres of power refer to the different areas in which corporations hold influence and power, including economic, political, cultural, and social spheres.

Corporations hold significant power in modern societies, often extending beyond traditional political boundaries. Corporate power is often characterized by the ability to influence public policy, shape public opinion, and control economic markets. Different corporations wield power in different spheres, depending on their size, sector, and geographic location.

Let us consider the example of Apple Inc. to describe the power it wields in different spheres.

Economic Sphere: Apple is one of the world's largest corporations, with a market capitalization of over $2 trillion. It holds significant economic power, controlling a sizable portion of the global smartphone and computer markets. It has been able to leverage its economic power to negotiate favorable trade deals, acquire smaller companies, and invest in research and development.

Political Sphere: Apple has been able to influence public policy through lobbying efforts. For example, it has lobbied for tax breaks and incentives to promote innovation and job creation. Apple has also been involved in high-profile legal battles over privacy concerns and intellectual property rights, with the outcome of these cases having implications for other technology companies.

Cultural Sphere: Apple has a strong brand identity and is often associated with innovation, creativity, and high quality. Its products have become a symbol of status and aspiration for many people, contributing to its cultural power. Apple has also invested in the entertainment industry through its Apple Music and Apple TV+ services, further extending its cultural influence.

Social Sphere: Apple has been able to shape social norms and behaviors through its products and marketing. For example, the iPhone has revolutionized the way people communicate and interact with technology, contributing to the rise of social media and the decline of traditional forms of communication. Apple's marketing campaigns have also had a significant impact on popular culture, influencing fashion trends and consumer behavior.

More on Spheres of power: https://brainly.com/question/32220690

#SPJ11

John traveled on a motorbike a distance of 1,500 meters north to get to the nearest shopping center. He then turned back south and rode
another 1,450 meters to meet his friend. What was his displacement?

Answers

Answer:

50 Meters North

Explanation:

Displacement is the distance/direction from the start point to

the ending point, regardless of which route you took from the start to the end.

So, you would simply subtract:

1,500 meters North- 1,450 meters South= 50 meters North

if a bowing ball hits a wall with a force of 6 N, the wall exerts a force of ____ back on the bowing ball
Α. 0N
B. 3N
C. 6N
D. 12N

Answers

Answer:

A

Explanation:

good luck

Which element is depicted from this orbital diagram? A NA N 3p 35 Increasing Energy A NA A 2p 2s 11 1s O Fluorine O Chlorine O Neon Argon​

Answers

Answer:

Explanation:

neon

Ca(s) + O2(g) -

O A. Cao(s)
B. Ca2O(s)
O C. 2Ca(s) + O2(g)
O D. CaO2(s)

Answers

Answer:

bbbbnnnnnnnnnnnnnnn

Explanation:

Jennifer checked the pressure in her bike tires before school and they had a pressure of 0. 890 atm. She checked the tire pressure again after school and they had a pressure of 1. 01 atm. Why was there an increase in pressure? Check all that apply. The temperature increased outside. The temperature decreased outside. The air molecules in the tire moved around more rapidly later in the day and collided with the tire walls with more force. There was a hole in the tire.

Answers

Answer:

A and C

Explanation: Don't worry, I gotchu

In what order are redox reactions balanced?

In what order are redox reactions balanced?

Answers

Answer:

B

Explanation:

Answer:

b

Explanation:

a p e x :)

classify each of these compounds as an arrhenius acid, an arrhenius base, or neither. drag each item to the appropriate bin. view available hint(s)for part a resethelp arhenius aciddroppable arhenius basedroppable neitherdroppable

Answers

In order to classify a compound as an Arrhenius acid or base, we need to consider its behavior in aqueous solutions. An Arrhenius acid is a compound that donates a hydrogen ion (H+) in water, while an Arrhenius base is a compound that donates a hydroxide ion (OH-) in water.

If a compound does not exhibit these behaviors in water, it is classified as "neither" an Arrhenius acid nor base.

For example:
- Hydrochloric acid (HCl) donates H+ ions in water, making it an Arrhenius acid.
- Sodium hydroxide (NaOH) donates OH- ions in water, making it an Arrhenius base.
- Carbon dioxide (CO2) does not donate H+ or OH- ions in water, so it is neither an Arrhenius acid nor base.

To know more Arrhenius base visit:

https://brainly.com/question/9936252

#SPJ11

Bài 1. Lập phương trình hóa học của các phản ứng sau:
a, Cho kẽm tác dụng với khí oxi thu được kẽm oxit ( ZnO)

Answers

phương trình: 2Zn+O2->2ZnO

Identify which of the following statements that are true of buffer solutions: 1) A buffer solution could consist of equal concentrations of ammonia and ammonium bromide. 2) A buffer solution could consist of equal concentrations of perchloric acid (HClO4) and sodium perchlorate. 3) A buffer solution will change only slightly in pH upon addition of small amounts of acid or base. 4) If you add NaOH to a buffer solution containing benzoic acid (C6H5COOH) and sodium benzoate (NaC6H5COO), the species that reacts with added hydroxide ion is the benzoate ion.

Answers

A buffer solution could consist of equal concentrations of ammonia and ammonium bromide. A buffer solution will change only slightly in pH upon addition of small amounts of acid or base.

A buffer solution is a solution that resists changes in pH when small amounts of acid or base are added. A buffer solution is made up of a weak acid and its conjugate base, or a weak base and its conjugate acid.

In statement 1, ammonia is a weak base and ammonium bromide is its conjugate acid. In statement 3, a buffer solution will resist changes in pH because the weak acid or base in the solution can react with the added acid or base to keep the pH constant.

Statement 2 is false because perchloric acid is a strong acid and sodium perchlorate is its salt. A buffer solution cannot be made with a strong acid or base.

Statement 4 is also false because the benzoate ion is the conjugate base of benzoic acid. The hydroxide ion will react with the benzoic acid to form water and benzoate ion.

To learn more about buffer solution here brainly.com/question/31428923

#SPJ11

Other Questions
Summarize the articles of confederation and the weaknesses of the document Lysergic acid diethylamide (LSD) is a psychedelic drug that stimulates the reward pathway, among other effects. Which of the following is a possible mechanism of how it affects neurons?a) LSD molecules block the release of dopamine from axon terminals.b) LSD molecules promote the reuptake of dopamine into the presynaptic neuron.c) LSD molecules catalyze the breakdown of dopamine in the synaptic cleft.d) LSD molecules act as an agonist and bind to dopamine receptorsd) LSD molecules act as an agonist and bind to dopamine receptors The half-life of a source of carbon-14 is 5760 years. After how many years will thenumber of radioactive particles left be 12.5% of the original amount?Show your working out here. If 2/3 of a number is 10, then what is 0.15 times of that number? a) 225 b) 825 c) 22.5 d) 2.25step by step explanation needed an external event, rather than the independent variable, changes scores of the dependent variable. press space to open participants show spontaneous change. press space to open the thought of treatment, rather than the treatment itself, causes participants to report changes. press space to open participants leave a study in a systematic way. press space to open groups vary systematically on traits other than the levels of the independent variable. If a firm is more concerned about the quick return of its initial investment than it is about the amount of value created, then the firm is most apt to evaluate a capital project using the _____ method of analysis. Group of answer choices Write the syntax of GOTO, ON GOTO and IF THEN ELSE with examples. Define what culture is and describe the basic culturaldimensions proposed by Hofstede. If x = 1, what is 5x + 15 ? Complete the proof of the identity by choosing the Rule that justifies each step. 1 cotx (1 + tanx) = sinx cosx cups = how many pint On Adams third shot, the ball lands on the fringe of the green. Which club should he use?Explain your choice an insurance company offers a no-claims discount of 55% for drivers who have not had an accident for four years. if the discounted premium for such driver is 334 how much did the driver save POSSIBLE POINTS: 2Jack had $32 to spend on 5 markers. He had $12 remaining after buying the markers. How much did each marker cost? ASAP!!! Which mineral property is the least useful for identifying minerals, and why? 1. What do you value in your business? list the key obra provisions provided by your text. what are overall content areas that are regulated in ltc as a result of obra? summarize the problems associated with uncoordinated regulation of the ltc sector due to the fact that regulations have emerged at different times, for different reasons. finally, explain the disjointed nature and inconsistent licensure requirements for ltc administrators. Mrs. Moran and Mr. Moran decided to move the cabinet in their dining room. Mrs.Moran stood on one side, and Mr. Moran stood on the other. They each pushedwith 30 N of force. What was the net force on the cabinet? A nurse is shampooing a client's hair while the client is in bed. which intervention should the nurse make to reduce back strain while performing the procedure? two semicircles are used to make the shaded shape below one semiciricle has a diameter of 16 cm and the other has a diameter of 20 cm work out the area of the shaded shape