The initial mass of the sample was. 851 g, after heating the sample weighed. 627 g. How much water was in the sample in grams and percent?.

Answer:

The overall charge of an atom is zero. ... The charge from a proton or electron are of equal strength, therefore if an atom has an equal number of protons and electrons, it will be electrically neutral. However, atoms are not always electrically neutral, in which case they are called ions.

Explanation:

Sorry if it's wrong!!!!

The new volume of the ballon at the same temperature is 17.65litres.

What is Boyles Law?

Boyles Law states that the product of pressure and volume is constant until the temperature remains constant.

PV = constant defines the Boyles law.

As given,

V₁ = 15L, P₁ = 1.0atm, P₂= 0.85atm

P₁V₁ = P₂V₂

Substitute values respectively,

1 × 15 = 0.85 × V₂

    V₂ = 15/0.85

     V₂ = 17.65L

Hence, the new volume of the balloon at the same temperature is 17.65L.

To learn more about The Boyles law from the given link.

https://brainly.com/question/1696010

#SPJ4

Answer:

An emerald can be described as a compound because it is made up of many different elements.

Explanation:

There are two types of chemical compound one is covalent compound and other is ionic compound, covalent compound formed by sharing of electron and ionic compound formed by complete transfer of electron. Therefore, an emerald can be described as Compound.

Chemical Compound is a combination of molecule, Molecule forms by combination of element and element forms by combination of atoms in fixed proportion.

An ionic compound is a metal and nonmetal combined compound.  Ionic compound are very hard. They have high melting and boiling point because of strong ion bond. The chemical formula for emerald is Be\(_3\)Al\(_2\)(SiO\(_3\))\(_6\). An emerald can be described as Compound.

Therefore, the chemical formula for emerald is Be\(_3\)Al2(SiO\(_3\))\(_6\). An emerald can be described as Compound.

To learn more about chemical compound, here:

brainly.com/question/26487468

#SPJ2

The molecular formula of the compound is given as CgH1403 and the spectroscopic data are given as follows: IR:1820cm, 1760cm1 1H NMR: 1.08 (triplet, 1-6), 1.6δ (sextet, 1-4), 2.20 (triplet, 1-4).The molecular formula suggests the compound to have 14 hydrogen atoms.

The IR spectrum of the compound suggests the presence of a carbonyl group (C=O) around 1760 cm-1 and the N-H bond (O-H is missing from the spectrum) which suggests the presence of carboxylic acid or amide. The 1H NMR spectrum indicates three types of hydrogen atoms: A triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons. A sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons. A triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons.

From the chemical shift of the hydrogen atoms, we can propose that the hydrogen atoms with δ = 1.08 ppm are CH3 groups, the hydrogen atoms with δ = 1.6 ppm are CH2 groups, and the hydrogen atoms with δ = 2.20 ppm are CH groups. From the integration values of the signals, we can deduce the following:- The triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons indicates that there are two CH3 groups (6 protons in total).- The sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH2 groups (8 protons in total).- The triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH groups (8 protons in total).From the above information, we can propose the structure of the compound as follows: CH3-CH(CH3)-CH2-CO-NH-CH2-CH2-CH2-CO-CH-CH3

To know more about carbonyl group visit

https://brainly.com/question/13564853

#SPJ11

I am only in 6th grade so all I have to say is good luck and I wish you the best on that quiz.

The correct statement that describes the relationship between thermal energy and particle movement is "As thermal energy increases, there is more particle movement".

WHAT IS THERMAL ENERGY?

Hence, as thermal energy of substance increases, there is more particle movement of that substance.

Learn more: https://brainly.com/question/24291347

Answer:

I believe the answer is A: shaken

Explanation:

The solute will dissolve quicker if the solute is more shaken.

A solute is a substance that can be dissolved by a solvent to create a solution. A solute can come in many forms. It can be gas, liquid, or solid.

The solvent, or substance that dissolves the solute, breaks the solute apart and distributes the solute molecules equally. This creates a homogenous mixture, or solution that is equal throughout.

Solutes in solution are measured by their concentration. The concentration of a solute is the amount of solute divided by the total volume of solution.

A solvent can dilute various amounts of solute, depending on how strong of a solvent is used and how easily the solute molecules come apart. This property of solutes to dissolve in a solvent is known as solubility.

Therefore, The solute will dissolve quicker if the solute is more shaken.

To learn more about solute, refer to the link:

https://brainly.com/question/1616939

#SPJ3

Answer:

Explanation:

Answer:

answer is 60

Explanation:

The criteria for choosing an appropriate wavelength for absorbance measurements include the absorbance range of the sample, the spectral characteristics of the sample, and the presence of interfering substances.

It is important to choose the appropriate wavelength because absorbance measurements are dependent on the wavelength of light used, and different substances have different absorbance spectra. Using the wrong wavelength can result in inaccurate or misleading results, making the choice of wavelength crucial for obtaining a direct answer.

Additionally, it is important to choose a wavelength at which the absorbance of the sample is high enough to provide a reliable measurement, but not so high that it saturates the detector. Generally, the wavelength should be chosen to correspond to the peak absorbance of the sample, but this may not always be possible due to the presence of interfering substances. In such cases, a wavelength that minimizes the interference should be chosen.

In summary, the choice of wavelength for absorbance measurements is critical for obtaining accurate and reliable results. It requires consideration of the spectral characteristics of the sample, the presence of interfering substances, and the range of absorbance values expected.

To know more about wavelength, visit:

https://brainly.com/question/31143857

#SPJ11

Answer:

Write the experimental procedure like a step-by-step recipe for your science experiment. A good procedure is so detailed and complete that it lets someone else duplicate your experiment exactly. Often it includes a sketch of how to set up the experiment. The directions may be numbered to be sure they are done in the correct order.

Explanation:

Answer:

C3H8(g) + 5O2(g) —> 3CO2(g) + 4H2O(g)

Explanation:

The burning of propane is simply called Combustion of propane.

When an organic compound under goes Combustion, carbon dioxide, CO2 and water, H2O are produced respectively.

Thus, the burning of propane will yield the following:

C3H8(g) + O2(g) —> CO2(g) + H2O(g)

Now, let us balance the equation. This is illustrated below:

C3H8(g) + O2(g) —> CO2(g) + H2O(g)

There are 3 atoms of C on the left side and 1 atom on the right side. It can be balance by putting 3 in front of CO2 as shown below:

C3H8(g) + O2(g) —> 3CO2(g) + H2O(g)

There are 8 atoms of H on the left side and 2 atoms on the right side. It can be balance by putting 4 in front of H2O as shown below:

C3H8(g) + O2(g) —> 3CO2(g) + 4H2O(g)

There are 2 atoms of O on the left side and a total of 10 atoms on the right side. It can be balance by putting 5 in front of O2 as shown below:

C3H8(g) + 5O2(g) —> 3CO2(g) + 4H2O(g)

Now, the equation is balanced.

Based on the Hund's Rule, the three electrons in a 2p orbital are arranged as shown in option C.

The term orbital refers to a region in space where there is a high probability of finding the electron. We know that an electron in an atom could be defined by the use of four sets of quantum numbers which are;

Hund's rule states that, electrons occur singly before pairing takes place. In this case, we can see that the only arrangement that obeys the Hund's Rule is option C.

Learn more about Hund's rule:https://brainly.com/question/12646067

#SPJ1

Answer:

1875 nm

Explanation:

Given the Rydberg formula for hydrogen: 1/λ = R(1/n₁² - 1/n₂²)

where R ≈ 1.097* 10^7 /m

Hence;

1/λ = 1.097* 107/m * (1/3² - 1/4²) = 5.3 * 10^5/m

λ = 1.875 * 10-6 m = 1875 nm

The hormone classified as an amino acid derivative is epinephrine.

Epinephrine, also known as adrenaline, is a hormone that belongs to the category of amino acid derivatives. Amino acid derivatives are a class of hormones derived from the amino acid tyrosine. These hormones are synthesized in the body from the amino acid through a series of enzymatic reactions.

To understand the process of epinephrine synthesis, let's start with the precursor molecule, tyrosine. Tyrosine is an amino acid that is obtained from dietary protein sources. Within the body, tyrosine is converted into a compound called L-DOPA (L-dihydroxyphenylalanine) through the action of an enzyme called tyrosine hydroxylase.

The next step in the synthesis of epinephrine involves the conversion of L-DOPA into dopamine, which is catalyzed by an enzyme called aromatic L-amino acid decarboxylase. Dopamine then undergoes further enzymatic reactions to be transformed into norepinephrine, a neurotransmitter and hormone involved in the body's stress response.

Finally, norepinephrine is converted into epinephrine through the addition of a methyl group by the enzyme phenylethanolamine N-methyltransferase (PNMT). This last step occurs primarily in the adrenal medulla, which is the inner part of the adrenal glands located on top of the kidneys. Epinephrine is released into the bloodstream in response to stress or excitement and plays a vital role in the "fight or flight" response, increasing heart rate, blood pressure, and energy availability to prepare the body for action.

In summary, epinephrine is classified as an amino acid derivative hormone because it is synthesized from the amino acid tyrosine through a series of enzymatic reactions. It is an essential hormone involved in the body's stress response and is responsible for many physiological changes that occur during times of heightened arousal.

Learn more about epinephrine

https://brainly.com/question/22817529

#SPJ11

Answer:

C solid surface

Explanation:

Answer:

c

Explanation:

thrust i THINK ok well bye

Answer:

The solubility of certain salts can be explained due to the small size of the particles.  

Explanation:

As we know, solvents dissolve due to intermolecular spaces between two substance particles, Hence the solvent particle size should fit in those spaces.

Answer:

1) F. harmful gases and solid particles that enter the atmosphere

2) C. pollutant gases react with water vapor

3) B. mixture of smoke, gas, and fog

4) E. sunlight interacts with pollutant gases

5) A. gradual increase in the overall temperature of the earth

6) D. gases are trapped by heat and raise the temperature of the atmosphere

hope this helps

The average atomic mass of the element is calculated to be 69.7256 amu.

The average atomic mass of an element is the weighted average mass of  atoms in naturally occurring sample of the element.

Given, atomic mass of isotope-1 = 68.926 amu ; percent abundance of isotope-1 = 60.00% ; atomic mass of isotope-2 = 70.925 amu ; percent abundance of isotope-2 = 40.00%

Fractional abundance of isotope-1 = 0.6000

Fractional abundance of isotope-2 = 0.4000

Average atomic mass of an element = A

A = ∑ [Atomic mass of an isotope + fractional abundance of isotope]

A= 69.7256 amu

So, the average atomic mass of the element is equal to 69.7256 amu.

To know more about average atomic mass, refer

https://brainly.com/question/24666479

#SPJ4

Overall order of reaction is 2

The order of a chemical reaction is the relationship between the rate of the reaction and the concentration of the reactants. It is determined experimentally and can be used to predict the rate of a reaction under different conditions.

We know that for A;

4 * 10^-3/2 * 10^-3 = (0.1/0.5)

2= (2^-1)^n

1 = -n

n = -1

For B;

8 * 10^-3/1 * 10^-3 = 0.1/0.05

8 = 2^n

2^3 = 2^n

n = 3

The overall order of the reaction is -1 + 3 = 2

Learn more about order of reaction:https://brainly.com/question/1769080

#SPJ1

The anode reaction is: \(Cd(s) → Cd^2+(aq) + 2e^-\)

The cathode reaction is:\(2Br^-(aq) + Br2(l) + 2e^- → 2Br^-(aq)\)

The net cell reaction is: \(Cd(s) + Br2(l) → Cd^2+(aq) + 2Br^-(aq)\)

In a voltaic cell, the anode is where oxidation occurs, while the cathode is where reduction takes place. In this case, the anode consists of a \(Cd|Cd^2\)+ half cell, where the solid cadmium (Cd) electrode is oxidized to form cadmium ions \((Cd^2+)\) in the aqueous solution. The anode reaction is represented by the equation \(Cd(s) → Cd^2+(aq) + 2e^-\).

On the other hand, the cathode is a \(Br^-|Br2\) half cell. Here, bromide ions \((Br^-)\) from the aqueous solution are reduced, along with elemental bromine (Br2) to form additional bromide ions. The cathode reaction can be represented by the equation \(2Br^-(aq) + Br2(l) + 2e^- → 2Br^-(aq)\).

When we combine the anode and cathode reactions, we get the net cell reaction. The cadmium (Cd) from the anode reacts with the bromine (Br2) from the cathode to produce cadmium ions\((Cd^2+)\) and bromide ions (Br^-). The net cell reaction can be represented by the equation\(Cd(s) + Br2(l) → Cd^2+(aq) + 2Br^-(aq).\)

In the external circuit, electrons flow from the cadmium electrode (the anode) to the bromine electrode (the cathode), generating an electric current. The salt bridge, which connects the two half-cell compartments, allows the migration of ions to maintain charge balance. In this case, anions \((Br^-)\) migrate from the bromide half cell to the cadmium half cell through the salt bridge.

Learn more about net cell reaction

brainly.com/question/31857573

#SPJ11

At a pH of 10, approximately 99% of the ammonium ion  will have reacted to form ammonia, leaving 1% of the ammonium ion unreacted.

When wastewater pH is 10, ammonium ions can combine with hydroxide ions (OH-) to generate ammonia  by the equilibrium reaction:

\(NH_4^+ + OH- NH_3 + H_2O\)

The equilibrium constant (K) determines the fraction of ammonium ions that did not react to generate ammonia. At pH 10, hydroxide ions outnumber ammonium ions, causing ammonia to form.

High hydroxide ion concentrations favour ammonia generation since the equilibrium constant equation for this reaction involves the concentration of products divided by the concentration of reactants. Thus, a considerable portion of ammonium ions would have formed ammonia.

Learn more about wastewater, here:

https://brainly.com/question/9637593

#SPJ4

Answer: 4.5 moles of \(H_{2}\) can be made from complete reaction of 3.0 moles of Al.

Explanation:

The given reaction equation is as follows.

\(2Al + 6HCl \rightarrow 2AlCl_{3} + 3H_{2}\)

This shows that 2 moles of Al reacts with 6 moles of HCl. So, the amount of HCl required to react with 1 mole Al is three times the amount of HCl.

Therefore, 3 moles of Al will react with 9 moles of HCl to give 3 moles of \(AlCl_{3}\) and \(\frac{9}{2}\) moles of \(H_{2}\).

The reaction equation now will be as follows.

\(3Al + 9HCl \rightarrow 3AlCl_{3} + \frac{9}{2}H_{2}\)

The moles \(\frac{9}{2}\) can also be written as 4.5 moles.

Thus, we can conclude that 4.5 moles of \(H_{2}\) can be made from complete reaction of 3.0 moles of Al.

4.5 moles of H2 can be made from complete reaction of 3.0 moles of Al with hydrogen chloride.

STOICHIOMETRY:

Learn more about stoichiometry at: https://brainly.com/question/22288091?referrer=searchResults

The "standard" Diels-Alder reaction works best with an electron-rich diene with an electron-poor dienophile, as this combination allows for efficient electron transfer and bond formation.

The Diels-Alder reaction is a type of cycloaddition reaction that involves the formation of a cyclic product from a diene and a dienophile. In this reaction, the diene acts as a nucleophile, donating a pair of electrons to the electron-deficient dienophile, which acts as an electrophile.

The electron-rich diene has a high electron density and can donate its electrons to the electron-deficient dienophile, leading to the formation of a new carbon-carbon bond. In contrast, an electron-poor diene has a low electron density and cannot donate its electrons effectively to the dienophile, making the reaction less favorable.

Likewise, an electron-poor dienophile is more attractive to the electron-rich diene due to its electron deficiency and can easily accept the electrons from the diene to form a new bond. In contrast, an electron-rich dienophile would have a higher electron density and would be less electrophilic, making it less likely to react with the electron-rich diene.

Therefore, the "standard" Diels-Alder reaction works best with an electron-rich diene with an electron-poor dienophile, as this combination allows for efficient electron transfer and bond formation.

Learn more about Diels-Alder reaction

brainly.com/question/30751490

#SPJ11

The following options correct : 1. A half-reaction shows the electrons gained by the reactants in a galvanic cell.

2. The overall process occurring in a galvanic cell includes both an oxidation and a reduction reaction.

3. The two parts are each known as half-reactions.

A dry cell is the battery which is made up of one or more electrochemical cells and convert the stored chemical energy in to the mechanical energy. the given all of the options are correct for the half reaction cell as :

1. In the galvanic cell the electrons are gained by the reactant is the half reaction cell.

2. The oxidation and the reduction reaction in the galvanic cell shows the occurring of overall process.

3. The half - reaction is the two parts of the overall reaction that is oxidation half - reaction  and the reduction half - reaction.

To learn more about galvanic cell here

https://brainly.com/question/11391843

#SPJ4

The given potential energy letter (f) indicates the potential energy of the products, (c) indicates the potential energy and (b) indicates the potential energy of the reactants. The rest of the alphabet is explained below.

1. The letter (f) in the diagram represents the potential energy of the products.

2. Letter (c) indicates the potential energy of the activated complex.

3. Letter (b) indicates the potential energy of the reactants.

4. Letter (d) indicates the activation energy.

5. Letter (a) indicates the heat of the reaction.

6. This reaction is Endothermic.

7. Letter (e) indicates the activation energy of the reverse reaction.

8. Letter (f) indicates the heat of the reaction of the reverse reaction.

9. The reverse reaction is exothermic. Activation energy is the minimum amount of energy needed to activate atoms or molecules, so they can undergo chemical transformation.

To learn more about, potential energy, follow the link:

https://brainly.com/question/24284560

#SPJ1