The pKa of a certain weak acid is 5.0. Calculate the ratio of proton acceptor to proton donor at pH 7.0.
A) 1000:1
B) 20:1
C) 100:1
D) 40:1

Answers

Answer 1

Answer:

C) 100:1

Explanation:

To solve this question we must use H-H equation:

pH = pKa + log [A-] / [HA]

Where pH = 7.0, pKa = 5.0, A- is proton aceptor and HA proton donor.

Replacing:

7 = 5 + log [A-] / [HA]

2 = log [A-] / [HA]

100 = [A-] / [HA]

That means the ratio of proton aceptor:proton donor is:

C) 100:1

Related Questions

______ is produced anytime current flows in a circuit, due to the collision between the flowing free electrons and the fixed atoms.

Answers

Heat is produced anytime current flows in a circuit, due to the collision between the flowing free electrons and the fixed atoms. When an electric current flows through a conductor, the free electrons move through the lattice of atoms.

As they move, they collide with the fixed atoms, causing the atoms to vibrate and transfer energy to neighboring atoms. This energy transfer increases the temperature of the conductor, resulting in the production of heat.

The amount of heat produced is directly proportional to the amount of current flowing through the conductor, the resistance of the conductor, and the time for which the current flows. This relationship is described by Joule's law, which states that the heat produced is equal to the product of the current, the resistance, and the time.

Mathematically, this can be expressed as H = I^2RT, where H is the heat produced, I is the current, R is the resistance, and T is the time. The collision between the flowing free electrons and the fixed atoms in a conductor leads to the production of heat, which is proportional to the current, resistance, and time for which the current flows.

To learn more about heat

https://brainly.com/question/30603212

#SPJ4

How many milliliters of a 0.250 MNaOHMNaOH solution are needed to completely react with 500. gg of glyceryl tripalmitoleate (tripalmitolein)

Answers

Answer:

\(7.48X10^3~mL\)

Explanation:

For this question we have:

-) A solution NaOH 0.25 M

-) 500 g of glyceryl tripalmitoleate (tripalmitolein)

We can start with the reaction between NaOH and tripalmitolein. NaOH is a base and tripalmitolein is a triglyceride, therefore we will have a saponification reaction. The products of this reaction are glycerol and (E)-hexadec-9-enoate.

Now, with the reaction in mind, we can calculate the moles of NaOH that we need if we use the molar ratio between NaOH and tripalmitolein (3:1) and the molar mass of tripalmitolein (801.3 g/mol). So:

\(500~g~tripalmitolein\frac{1~mol~tripalmitolein}{801.3~g~tripalmitolein}\frac{3~mol~NaOH}{1~mol~tripalmitolein}=1.87~mol~NaOH\)

With the moles of NaOH we can calculate the volume (in litters) if we use the molarity equation and the Molarity value:

\(M=\frac{mol}{L}\)

\(0.25~M=\frac{1.87~mol~NaOH}{L}\)

\(L=\frac{1.87~mol~NaOH}{0.25~M}\)

\(L=7.48\)

Now we can do the conversion to mL:

\(7.48~L~\frac{1000~mL}{1~L}=~7.48X10^3~mL\)

I hope it helps!

45g of COz gas has a pressure of 1.24 ATM in a container at 43°C. What is the volume of the gas?

Answers

The volume of the CO2 gas is approximately 21.0 L.

To solve this problem

We can use the ideal gas law equation

\(PV = nRT\)

where

P is the pressureV is the volumen is the amount of gas (in moles)R is the gas constantT is the temperature (in Kelvin)

We need to convert the temperature from Celsius to Kelvin:

T = 273 + 43 = 316 K

Next, we can calculate the amount of gas (n) using the mass of CO2 and its molar mass:

n = m/M

where m is the mass of the gas and M is the molar mass of CO2.

Molar mass of CO2 = 12.01 + 2(16.00) = 44.01 g/mol

n = 45 g / 44.01 g/mol = 1.022 mol

Now we can rearrange the ideal gas law to solve for the volume:

V = nRT/P

V = (1.022 mol)(0.0821 L·atm/mol·K)(316 K)/(1.24 atm)

V = 21.0 L

Therefore, the volume of the CO2 gas is approximately 21.0 L.

Learn more about ideal gas law here : brainly.com/question/20348074

#SPJ1

The chemical equation below is unbalanced. CaS + AlC → A + CaC Balance this equation.

Answers

The balanced chemical equation is CaS + AlC → A + CaC

To balance the chemical equation CaS + AlC → A + CaC, we need to ensure that the same number of atoms of each element is present on both sides of the equation. Here's the step-by-step process to balance the equation:

Begin by counting the number of atoms of each element on both sides of the equation.

Left side (reactants):

Calcium (Ca): 1

Sulfur (S): 1

Aluminum (Al): 1

Carbon (C): 1

Right side (products):

A: 1

Calcium (Ca): 1

Carbon (C): 1

Sulfur (S): 0

Start by balancing the elements that appear in the fewest compounds. In this case, we can balance sulfur (S) first. Since there is only one sulfur atom on the left side and none on the right side, we need to add a coefficient of 1 in front of A on the right side to balance the sulfur.

CaS + AlC → 1A + CaC

Next, balance calcium (Ca) by adding a coefficient of 1 in front of CaS on the left side.

1CaS + AlC → 1A + CaC

Now, balance aluminum (Al) by adding a coefficient of 1 in front of AlC on the left side.

1CaS + 1AlC → 1A + CaC

Finally, balance carbon (C) by adding a coefficient of 1 in front of CaC on the right side.

1CaS + 1AlC → 1A + 1CaC

The balanced chemical equation is:

CaS + AlC → A + CaC

For more question on balanced chemical equation visit:

https://brainly.com/question/30196693

#SPJ8

Relate the temperature of atmospheric gases to the production of rain.

Answers

Better temperatures can growth the quantity of water vapor withinside the air, that could growth the probability of precipitation.

Different factors, inclusive of air pressure, wind, and atmospheric instability, additionally play a function withinside the formation of rain, and the connection among temperature and precipitation may be complicated. The temperature of atmospheric gases could have a substantial effect at the manufacturing of rain. The environment is a complicated device that performs a vital function with inside the Earth`s water cycle, which incorporates the system of precipitation, inclusive of rain. Precipitation takes place while water vapor with inside the air condenses into liquid droplets or ice crystals, which fall to the floor as rain, snow, or hail. The temperature of the environment impacts the quantity of water vapor that the air can preserve. As temperature increases, the air can preserve extra water vapor, that could cause better tiers of humidity. When the air will become saturated with water vapor, it reaches its dew point, and the extra water vapor condenses into liquid droplets or ice crystals, that could shape clouds and subsequently precipitation. In addition, international warming, that's inflicting an growth in atmospheric temperatures, can cause modifications in precipitation styles and extra severe climate events. Understanding the connection among temperature and precipitation is vital for predicting and mitigating the affects of weather change.

For such more questions on precipitation

https://brainly.com/question/20469884

#SPJ11

A student conducts an experiment to see how music affects plant growth. The student obtains four identical plants. Each one is potted in the same type of soil and receives the
same amount of sunlight and water each day. Plant A listens to classical music for three hours each day. Plant B listens to rock music for three hours each day. Plant C listens to
country music for three hours each day. Plant D does not listen to any music at all.

2. Based on the experiment in the scenario, which visual aid would be most helpful in showing the change in the plants' heights over time?
O A. A timeline
OB. A line graph
OC. A pie chart
D. A bar graph

Answers

Answer:

The type of music each plant listens to.

Explanation:

A variable is any factor or condition whose value is changing in an experiment. A variable can occur in different types or quantity, and three types of variable (independent, dependent, and controlled) can be found in an experiment. In the experiment described above, "the type of music each plant listens to" is the variable. It is an independent variable whose value is changing because it exists in different types and it is the one that the student is observing its effect on the plant’s growth. In this experiment, this variable which differ will also produce different results (or effects).

Calculate the number of moles in 144 g of P. Please show your work to receive credit.

Answers

Answer:

144 g of phosphorus contain 4.65 moles.

Explanation:

Given data:

Mass of phosphorus = 144 g

Number of moles = ?

Solution:

Formula:

Number of moles = mass/ molar mass

Molar mass of phosphorus is 31 g/mol

Now we will put the values in formula.

Number of moles = 144 g/ 31 g/mol

Number of moles = 4.65 mol

Thus, 144 g of phosphorus contain 4.65 moles.

Which Kingdom does the organism belong to?



Animalia


Protista


Fungi


Plantae
pls help guys

Answers

what is the organism?

Which of the following is in correct order in terms of increasing intermolecular forces?

Which of the following is in correct order in terms of increasing intermolecular forces?

Answers

Answer:

C

Explanation:

I PROMISE you its right :D

Why LDL called "bad" cholesterol?​

Answers

Answer:

Its called bad cholesterol because a high LDL level leads to  buildup of cholesterol in your arteries.

Explanation:

WHEN YOU SEE A BLUE CAR WHAT COLER IS BEING REFLECTED

Answers

Answer:

violet

Explanation:

just violet

oh and you spelled "COLER" wrong, its color or colour if you live somewhere else

How many grams the gamma emitter l-125 remain after 240 days if you started with 100.00g and the half life is 60 days?

Answers

Answer:

6.23 g.

Explanation:

From the question given above, the following data were obtained:

Original amount (N₀) = 100 g

Time (t) = 240 days

Half life (t½) = 60 days

Amount remaining (N) =?

Next, we shall determine the decay constant (K). This can be obtained as follow:

Half life (t½) = 60 days

Decay constant (K) =.?

Decay constant (K) = 0.693/Half life (t½)

K = 0.693/60

K = 0.01155 /day

Finally, we shall determine the amount of gamma emitter l-125 that remains after 240 days as follow:

Original amount (N₀) = 100 g

Time (t) = 240 days

Half life (t½) = 60 days

Decay (K) = 0.01155 /day

Amount remaining (N) =?

Log (N₀/N) = kt/2.3

Log (100/N) = (0.01155 × 240)/2.3

Log (100/N) = 2.772/2.3

Log (100/N) = 1.2052

Take the anti log of 1.2052

(100/N) = antilog (1.2052)

100/N= 16.04

Cross multiply

100 = N × 16.04

Divide both side by 16.04

N = 100/16.04

N = 6.23 g

Therefore, the amount of the gamma emitter l-125 that remains after 240 days is 6.23 g

If 10 moles of a gas are at a pressure of 3.6 atm and at a temperature of 27°C, what is the volume of the container that the gas is in.

Answers

Answer:

68.4 liters

Explanation:

PV = nR T       R = gas constant = .082057  L atm / K-mole

                        n = 10      T = 27C = 300.15 K

3.6 V = 10 * .082057 * 300.15      solve for V = 68.4 liters

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

1) In the nuclear equation below, what does the letter X represent? Show your work.

1) In the nuclear equation below, what does the letter X represent? Show your work.

Answers

I believe that would be an alpha decay

A 1.85-mole sample of H₂O2 weighs
(A) 33.3 amu
(B) 35.9 g
C) 62.9 g
(D) 1.85 g
E 33.3 g

Answers

Considering the definition of molar mass, the correct answer is option c): the mass of 1.85 moles H₂O₂ is 62.9 grams.

Definition of molar mass

The molar mass of substance is a property defined as the amount of mass that a substance contains in one mole.

The molar mass of a compound is the sum of the molar mass of the elements that form it (whose value is found in the periodic table) multiplied by the number of times they appear in the compound.

Molar mass of H₂O₂

In this case, you know the molar mass of the elements is:

O= 16 g/moleH= 1 g/mole

So, the molar mass of the compound H₂O₂ is calculated as:

H₂O₂= 2× 1 g/mole + 2× 16 g/mole

Solving:

H₂O₂= 34 g/mole

Mass of 1.85 moles H₂O₂

You can apply the following rule of three: If by definition of molar mass 1 mole of the compound contains 34 grams, 1.85 moles of the compound contains how much mass?

mass= (1.85 moles× 34 grams)÷ 1 mole

mass= 62.9 grams

Finally, the mass of 1.85 moles H₂O₂ is 62.9 grams.

Learn more about molar mass:

brainly.com/question/5216907

#SPJ1

Which of the following choices is not an example of artificial selection?
Scientists genetically alter watermelon to produce a seedless variety.
Scientists cross a plum and an apricot to produce a new variety of fruit, a pluot.
Farmers use genetic engineering to create larger ears of corn.
A blue-eyed man and a brown-eyed woman have two children, both of whom have brown eyes.

Answers

Answer:

A blue-eyed man and a brown-eyed woman have two children, both of whom have brown eyes.

Explanation:

why is the sun earth and moon system important

Answers

The Sun-Earth-Moon system is important because it sustains life on Earth, regulates Earth's climate, and influences natural phenomena like tides.

The Sun-Earth-Moon system plays a vital role in supporting and sustaining life on Earth. The Sun is the primary source of energy for our planet, providing heat and light necessary for photosynthesis, the process by which plants convert sunlight into food and oxygen. Sunlight is also crucial for maintaining Earth's temperature and driving weather patterns.

The Moon, as Earth's only natural satellite, contributes to several essential functions. Its gravitational pull creates the tides, which influence coastal ecosystems and shape coastal landscapes.

The Moon's orbit also stabilizes Earth's axial tilt, providing a stable climate for life to thrive. Additionally, the Moon's phases have cultural and historical significance, influencing human activities such as agriculture, navigation, and calendar systems.

The Sun-Earth-Moon system's interactions are responsible for natural phenomena like eclipses, both solar and lunar, which have fascinated humans throughout history and continue to be important for scientific study and exploration.

Understanding these celestial events enhances our knowledge of astrophysics and helps us comprehend the vastness and complexity of the universe.

Furthermore, the study of the Sun-Earth-Moon system provides insights into celestial mechanics, orbital dynamics, and the broader field of planetary science. By examining the interplay between these celestial bodies, scientists can gain a deeper understanding of Earth's place in the universe and explore potential habitable conditions on other celestial bodies.

Overall, the Sun-Earth-Moon system is of immense importance as it sustains life, regulates climate, influences natural phenomena, and provides a platform for scientific exploration and discovery.

For more question on climate visit:

https://brainly.com/question/12801279

#SPJ8

how many elements are in Li2SO4?how many elements are in li2s 04 how many elements are in li2s 04 ​

Answers

Answer:

3

Explanation:

the three elements involved in this compound are Li, S, O.

lithium, sulfur, and oxygen. Which create the ionic compound, "Lithium Sulfate."

7 atoms total, since there are two lithium, four oxygen, and one sulfate atom. this is a white inorganic salt.

There are three different types of elements in LiSO₄ which are lithium (Li), sulfur (S), and oxygen (O).

What is an element?

An element is a pure substance made of only one kind of atom which all have the same number of protons in their nuclei.

The chemical element was first presented by Robert Boyle who defined it as "incapable of decomposition”. Boyle’s this definition lies admirably close to present-day theory.

When different kinds of elements undergo particular chemical reactions then atoms are rearranged into new compounds connected together by chemical bonds.

All other naturally occurring elements occur on the Earth as compounds or mixtures. Air is a mixture of the elements nitrogen (N₂), oxygen (O), and argon (Ar), though it does contain carbon dioxide and water.

Given compound, lithium sulfate is formed of LiSO₄ has elements lithium, sulfur, and oxygen.

Learn more about the chemical element, here:

https://brainly.com/question/9249660

#SPJ2

The equation below represents the dissociation of vinegar which is a weak acid. How can you tell that it is an acid and it is weak? Just from looking at the equation.

The equation below represents the dissociation of vinegar which is a weak acid. How can you tell that

Answers

Because it is not very effective at transferring \(H^{+}\) ions to water, vinegar is a weak acid. Less than 0.4% of the \(CH_{3}CO_{2}H\)molecules in a 1 M solution interact with water to create \(H_{3}O^{+}\)and \(CH_{3}CO_{2}^{-}\) ions. More than 99.6% of the acetic acid molecules are still whole.

Weak acidsAcids that partially dissociate in solution are referred to as weak acids. To put it another way, a weak acid is any acid that is not a strong acid. A weak acid's strength is influenced by how much it dissociates; the more it dissociates, the stronger the acid.In comparison to weak acids, strong acids have a lower pH. 2) Strong acids dissociate more, resulting in a lower pH (greater concentration of \(H^{+}\) ions in solution). 3) This can be verified by using

For more information on weak acid kindly visit to

https://brainly.com/question/22104949

#SPJ1

The reaction for photosynthesis producing glucose sugar and oxygen gas is:
__CO2(g) + __H2O(l) UV/chlorophyl−→−−−−−−−−−−−−−− __C6H12O6(s) + __O2(g)
What is the volume of oxygen gas at STP produced from 2.20 g of CO2 (44.01 g/mol)?
a. 1.12 L
b. .187 L
c. 4.32 L
d. 6.72 L
e. 1.60 L

Answers

Answer:

a. 1.12 L

Explanation:

Step 1: Write the balanced equation for the photosynthesis

6 CO₂(g) + 6 H₂O(l) ⇒ C₆H₁₂O₆(s) + 6 O₂(g)

Step 2: Calculate the moles corresponding to 2.20 g of CO₂

The molar mass of CO₂ is 44.01 g/mol.

2.20 g × 1 mol/44.01 g = 0.0500 mol

Step 3: Calculate the moles of O₂ produced

The molar ratio of CO₂ to O₂ is 6:6. The moles of O₂ produced are 6/6 × 0.0500 mol = 0.0500 mol

Step 4: Calculate the volume occupied by 0.0500 moles of O₂ at STP

At STP, 1 mole of O₂ occupies 22.4 L.

0.0500 mol × 22.4 L/1 mol = 1.12 L

a material that is not a mixture; has the same properties all the way through

Answers

Answer:

Explanation:

The material that is not a mixture; it has the same properties all the way through is called a substance. Thus the material that is not a mixture; it has the same properties all the way through is called a substance.

ALL THE BEST :)

I can’t solve this anymore cause I don’t know what I am doing wrong.

I cant solve this anymore cause I dont know what I am doing wrong.

Answers

The mass of H2 is 2.62x10^-3 g.

To calculate the mass of H2 we can use the Ideal Gas formula:

\(P\mathrm{}V=n\mathrm{}R\mathrm{}T\)

P is the pressure of the gas (atm).

V is the volumen of the gas (L).

n is the number of moles of the gas.

R is the gas constant (0.082 atm.L/mol.K)

T is the temperature of the gas (K).

- First, we need to assume that the pressure is 1 atm, as this information is not given. Then, we have to do the units change so that everything is in the units of the R constant (atm.L/mol.K).

In this case:

P = 1 atm

V= 0.0331 L

T = 308 K

- Second, the number of moles can be calculated from the Ideal Gas formula:m

\(\begin{gathered} PV=nRT \\ n=\frac{P\mathrm{}V}{R\mathrm{}T} \\ n=\frac{1atm.0.0331L}{0.082\frac{\text{atm}\mathrm{}L}{\text{mol}\mathrm{}L}.308K} \\ n=1.31x10^{-3}\text{mol} \end{gathered}\)

So far, we know that there are 1.31x10^-3 moles of H2.

- Finally, we can calculate the H2 mass from its the molar mass and a mathematical Rule of Three:

\(\begin{gathered} 1\text{ mol\_\_\_\_\_\_\_\_\_\_\_ 2g} \\ 1.31x10^{-3}mol\text{\_\_\_\_\_\_ x= }\frac{1.31x10^{-3}mol.2g}{1\text{mol}}_{}_{}_{}_{} \\ x=2.62x10^{-3\text{ }}g \end{gathered}\)

So, the mass of H2 is 2.62x10^-3 g.

The hydrogen chloride (HCl) molecule has an internuclear separation of 127 pm (picometers). Assume the atomic isotopes that make up the molecule are hydrogen-1 (protium) and chlorine-35. (a) Find the energy of the third excited rotational state; that is, the J

Answers

Answer:

the energy of the third excited rotational state \(\mathbf{E_3 = 16.041 \ meV}\)

Explanation:

Given that :

hydrogen chloride (HCl) molecule has an intermolecular separation of 127 pm

Assume the atomic isotopes that make up the molecule are hydrogen-1 (protium) and chlorine-35.

Thus; the reduced mass μ = \(\dfrac{m_1 \times m_2}{m_1 + m_2}\)

μ = \(\dfrac{1 \times 35}{1 + 35}\)

μ = \(\dfrac{35}{36}\)

∵ 1 μ = 1.66 × 10⁻²⁷ kg

μ  = \(\\ \\ \dfrac{35}{36} \times 1.66 \times 10^{-27} \ \ kg\)

μ  = 1.6139 × 10⁻²⁷ kg

\(r_o = 127 \ pm = 127*10^{-12} \ m\)

The rotational level Energy can be expressed by the equation:

\(E_J = \dfrac{h^2}{8 \pi^2 I } \times J ( J +1)\)

where ;

J = 3 ( i.e third excited state)  &

\(I = \mu r^2_o\)

\(E_J= \dfrac{h^2}{8 \pi \mu r^ 2 \mur_o } \times J ( J +1)\)

\(E_3 = \dfrac{(6.63 \times 10^{-34})^2}{8 \times \pi ^2 \times 1.6139 \times 10^{-27} \times( 127 \times 10^{-12}) ^ 2 } \times 3 ( 3 +1)\)

\(E_3= 2.5665 \times 10^{-21} \ J\)

We know that :

1 J = \(\dfrac{1}{1.6 \times 10^{-19}}eV\)

\(E_3= \dfrac{2.5665 \times 10^{-21} }{1.6 \times 10^{-19}}eV\)

\(E_3 = 16.041 \times 10 ^{-3} \ eV\)

\(\mathbf{E_3 = 16.041 \ meV}\)

In order to ice to melt it must absorb heat This makes it an blank process.
A) Endothermic
B) exothermic
C) integral
D)Kinematic

Answers

Answer: A. Endothermic

Explanation:

In an endothermic reaction, heat is sucked in from the surrounding area by the reactants so that they may use it to react and form new products. This will therefore reduce the temperature in the said surrounding by the amount that the reaction needed.

This is what ice does when it melts. It sucks in the heat surrounding the area and then melts but leaves the area colder. For instance, putting ice in water ensures that the ice melts but because it sucked in the heat from the water to do so, the water gets colder as a result.

( + 0₂ (0₂ 1 Is the molecular mas of carbon is 12 and that of oxygen is 32, Calculate the mass of carbon dioxide formed when 24kg of carbon is burnt completely in oxygen and determine the heat thereby released in MJ if the complete combustion of 1kg of carbon releases 33.8MJ of heat​

Answers

The mass of carbon dioxide formed when 24 kg of carbon is burnt completely in oxygen is 88 kg, and the heat released is 811.2 MJ.

What is Molar Mass?

Molar mass is the mass of one mole of a substance and is expressed in grams per mole (g/mol). It is calculated by adding up the atomic masses of all the atoms in a molecule or formula unit of a compound. The molar mass is used in stoichiometry calculations to convert between mass and moles of a substance.

The balanced equation for the combustion of carbon is:

C + O₂ → CO₂

From the equation, we can see that one mole of carbon reacts with one mole of oxygen to produce one mole of carbon dioxide. The molar mass of carbon dioxide is 12 + (2 × 16) = 44 g/mol.

First, let's find the number of moles of carbon in 24 kg:

n(C) = m/M = 24000 g / 12 g/mol = 2000 mol

Therefore, 2000 mol of CO₂ will be produced.

The mass of CO₂ produced can be calculated as:

m(CO₂) = n(CO₂) × M(CO₂) = 2000 mol × 44 g/mol = 88,000 g = 88 kg

Now, let's calculate the heat released during combustion:

Heat released = 33.8 MJ/kg × 24 kg = 811.2 MJ

Learn more about Molar Mass from the given link

https://brainly.com/question/837939

#SPJ9

Which of the changes are chemical changes?
sugar is dissolved in soda

Answers

Hello! I hope this helps you :)

Soda is carbonated water - it has carbon dioxide dissolved under high pressure. Carbon dioxide is a gas that would like to escape. Shaking the bottle of soda, for example, provides a suitable mechanism to allow release of the gas.

Adding sugar also provides a mechanism for this to occur through nucleation. The sugar crystals give the carbon dioxide a surface via which to escape the solution. This is not a chemical reaction per se, but a physical reaction. It is essentially the same process as the coke-mentos reaction. Sugar crystals are great for this, as they have a rough surface and therefor a very high surface area available.

A parasitic way of life can be best demonstrated by the feeding adaptations of the spider.

TRUE OR FALSE

Answers

The given statement "A parasitic way of life can be best demonstrated by the feeding adaptations of the spider." is False. Because, While some spiders are parasites, not all spiders are parasitic.

Additionally, many spiders are not even true parasites, as they typically do not harm their host organism. Spiders are typically classified as predators, as they feed on other insects and arthropods. While some spiders may occasionally feed on the blood of larger animals, such as birds or mammals, this behavior is not typically considered parasitic, as it does not involve a long-term relationship between the spider and the host organism.

To know more about parasites, here

brainly.com/question/22589174

#SPJ1

I want to know how to solve this question by step by step.
Question: What is the pH value of 500ml of an aqueous solution of 0.005 mol HCl ?

Answers

The pH value of 500 mL of an aqueous solution of 0.005 mole HCl is 2

How do I determine the pH of the solution?

We'll begin our calculations by obtaining the molarity of the solution. Details below:

Volume of solution = 500 mL = 500 / 1000 = 0.50 LMole of HCl = 0.005 moleMolarity = ?

Molarity = mole / volume

Molarity = 0.005 / 0.50

Molarity = 0.01 M

Next, we shall obtain the concentration of the hydrogen ion, H⁺ in the solution. Details below:

HCl(aq) <=> H⁺(aq) + Cl¯(aq)

From the balanced equation above,

1 mole of HCl contains 1 mole of H⁺

Therefore,

0.01 M HCl will also contain 0.01 M H⁺

Thus, the concentration of the hydrogen ion, H⁺ in the solution is 0.01 M

Finally, we shall determine the pH of the solution. Details below:

Concentration of hydrogen ion [H⁺] = 0.01 MpH of solution =?

pH = -Log H⁺

pH = -Log 0.01

pH = 2

Thus, we can conclude that the pH of the solution is 2

Learn more about pH:

https://brainly.com/question/22983829

#SPJ1

Choose all that apply for neap tides


Moon and sun are at right angles to the earth

Moon, sun, and earth are all in alignment

Smaller than normal range of highs and low tides

Gravity of the sun and moon work against each other

Answers

Answer:

1. Moon and sun are at right angles to the earth

2. Smaller than normal range of highs and low tides

3. Gravity of the sun and moon work against each other

Other Questions
Which argument best supports how nutrients and oxygen get to cells to provide energy? True or false Segment TY is congruent to segment BN 3-paragraph essay on your opinion about its validity and relevance in today's society. PLEASE HELP ME!!!!!!! Samantha wants to buy a bicycle for $129.99. If the sales tax is 6%, what is the total amount she will pay for the bicycle? A) Graph the function: f(x) = 2^x+^4B)domain of the function?C) range of the function ?D) equation of the asymptote?E) y-intercept of the graph? The 24 is between which two numbers on the number line?A)1 and 2B)2 and 3C)3 and 4D)4 and 5 250 mL of argon gas is held in a flexible vessel shown above. If the pressure changes to 12.0 atm, what is the new volume ofthe gas at 20 C? What is the value of 0 by0? The function of the organ's stops is to: select one: control the flow of air to the pipes help pedals function properly help pipes sustain vibrato control the manuals 1. I will assign you one of the following years. Do some Internet googling to find 10 facts related to ONE of the topics for the year I give you. Post the 10 facts here as STATEMENTS. 2. THEN, point out something that you would have enjoyed about living in that time period (the early 1950s). Topics: US government/politics, Pop culture, Family life, Science & TechnologyYear: 1954-55(I give brainest points if you friend me) help me pls!!! asapplease answer correctly suppose that, on another planet, life had evolved with doublestranded dna containing four pairs of complementary bases; for example, a"t, g"c, u"v, and w"x, instead of earthly dna with only two pairs, a"t and g"c. compared with shotgun sequencing of earthly dna with two base pairs, would genome assembly be easier or harder on this other planet where dna contains four base pairs? why? economic theory indicates that the behavior of a. government employees differs from the behavior of employees in the private sector because government employees generally disregard their own personal self-interest when making decisions. b. elected public officials differs from the behavior of all other individuals in society because they are not influenced by private interests. c. individuals when they make decisions about who to vote for is very different from the behavior of these same individuals when they make other types of choices. d. voters, government employees, and public officials is best understood by applying the same basic principle we use to predict the behavior of people in the private sector--that incentives matter. PLSS HELP I WILL GIVE BRAINLIEST PLSSS Select ALL the correct answers.For ABC, which two relationships are true?An Image of a right-angle triangle BAC with B at the right angle. With an angle of (90 minus theta). EDU 302 ASSIGNMENT EXPLAIN THE APPLICABILITY OF THEORY X and Y, and THEORY Z IN NIGERIAN SITUATION(CONTEXT). HINT: write the propounders and what they stand for. plz help me plz plz plz plz 18 + 4.5m = 6m + 12 help plz T/F. there is universal agreement on all sides of the immigration debate that the need to preserve a nations distinctive culture is a good reason to favor closed borders.