Answer:
4.66 g NO₂
Explanation:
To calculate the mass of NO₂ formed, you need to
(1) convert grams NO to moles (using the molar mass of NO)
(2) convert moles NO to moles NO₂ (using the mole-to-mole ratio from the balanced equation)
(3) convert moles NO₂ to grams (using the molar mass of NO₂)
It is important to arrange the ratios/conversions in a way that allows for the cancellation of units. The final answer should have 3 sig figs like the given value. (3.04 = 3 sig figs).
Molar Mass (NO): 14.007 g/mol + 15.999 g/mol = 30.006 g/mol
Molar Mass (NO₂): 14.007 g/mol + 2(15.999 g/mol) = 46.005 g/mol
2 NO(g) + O₂(g) -----> 2 NO₂(g)
^ ^
3.04 g NO 1 mole NO 2 moles NO₂ 46.005 g
------------------ x ------------------- x ----------------------- x -------------------- =
30.006 g 2 moles NO 1 mole NO₂
= 4.66 g NO₂
If 9.8 g of sulfuric acid dissolved in excess quantity moles of hydrogen ion of water, it will yield (H+) and A. 0.1, 0.2 B. 0.1, 0.3 C. 0.2, 0.4 D. 0.2,0.1 mole of sulphate ions (SO4-2)
If 9.8 g of sulfuric acid is dissolved in excess quantity moles of hydrogen ion is 0.1, 0.2. The correct option is A.
What are moles?The mole is a SI unit of measurement that is used to calculate the quantity of any substance.
Molar mass H₂SO₄ = 98 g/mol
9.8 g H₂SO₄ = 0.1 mol
H₂SO₄ produces 2 H+ ions
Therefore, [H+] = 0.2 M
Number of H+ ions = 0.2 x 6.022 x 10²³ = 1.20 x 10²³ H+ ions
H₂SO₄ dissociates in 2 steps
The first dissociation is complete because H₂SO₄ acts as a strong acid here
H₂SO₄ → H+ + HSO₄-
Thus, the 0.1 mol H₂SO₄ will produce 0.1 mol H+ and the moles of sulfate ion is 0.2. The correct option is A.
To learn more about moles, refer to the link:
https://brainly.com/question/14295820
#SPJ1
29) The antimony in a sample of alloy weighing 0.250 g is converted to Sb2O5 and this substance is ignited to Sb2O4. If the Sb2O4, weighs 0.1305 g. what is the percentage of Sb in the alloy?
Answer:
I think it just h sur rn of sb
how does Hanukkah relate to science?
Answer:
oil = burn for 8 days = absurd = doesnt make sense but it happened lol
Explanation:
the most likely explanation for the increase in average beak size of the medium ground finch is that the
Answer:
Well according to the Law of Evolution, depending on where the Finch lives and what it eats depends on it's beak size. For example, if a Finch lives on the coast and eats small fruits it will have a short and stubby beak to peck at the fruits, but if the Finch ate crabs it's beak would be long to swoop down and pluck up crabs.
Hope this helps!
4. What is the necessary volume of H₂ in order to obtain 5.0 g of propane (C3H8)? Assume that dH2=0,09g/l
The necessary volume of H₂ gas to obtain 5.0 g of propane (C₃H₈) is approximately 12.60 liters.
To determine the necessary volume of H₂ gas to obtain 5.0 g of propane (C₃H₈), we need to use the molar ratio between H₂ and C₃H₈, as well as the density of H₂ gas.
First, let's calculate the molar mass of propane (C₃H₈):
C: 12.01 g/mol
H: 1.01 g/mol
Molar mass of C₃H₈ = (3 * C) + (8 * H) = (3 * 12.01) + (8 * 1.01) = 44.11 g/mol
Next, we can determine the number of moles of propane (C₃H₈) using its mass:
Number of moles = Mass / Molar mass
Number of moles of C₃H₈ = 5.0 g / 44.11 g/mol ≈ 0.1134 mol
Now, we can establish the molar ratio between H₂ and C₃H₈ from the balanced chemical equation:
C₃H₈ + 5H₂ → 3CH₄
According to the balanced equation, 5 moles of H₂ are required to produce 1 mole of C₃H₈.
Therefore, the number of moles of H₂ required can be calculated as:
Number of moles of H₂ = 5 * Number of moles of C₃H₈ = 5 * 0.1134 mol = 0.567 mol
Finally, we can determine the necessary volume of H₂ gas using the ideal gas law equation:
Volume = (Number of moles * Gas constant * Temperature) / Pressure
Given that the density of H₂ is 0.09 g/L, we can convert it to moles per liter:
Density = Mass / Volume
0.09 g/L = 2 g/mol / Volume (since the molar mass of H₂ is 2 g/mol)
Solving for Volume:
Volume = 2 g/mol / 0.09 g/L ≈ 22.22 L/mol
Now, we can calculate the necessary volume of H₂ gas:
Volume of H₂ = Number of moles of H₂ * Volume per mole
Volume of H₂ = 0.567 mol * 22.22 L/mol ≈ 12.60 L
For more such questions on propane visit:
https://brainly.com/question/23779346
#SPJ8
list at least 3 examples of giant Ionic structure and it's uses and application in today's industrial world.
The three examples of giant ionic structures used in industrial world today include. NaCl: sodium chloride. NaBr: sodium bromide. NaF: sodium fluoride.
What are giant ionic structures?A giant ionic structure is also known as an ionic compound which has a regular repeating arrangement called an ionic lattice.
Typical examples of giant ionic structures include the following:
NaCl (sodium chloride): It is used for manufacturing of household bleach, soaps, detergents and dyes in industries.NaBr (sodium bromide): Used as an antiseptic, detergent, and as reagent in pharmaceutical preparationsNaF (sodium fluoride): used to fluoridate water, in chemical cleaning and electroplating, and as an insecticide.Learn more about sodium here:
https://brainly.com/question/28106660
#SPJ1
What is an advantage of using an energy pyramid to describe the flow of energy in an ecosystem?
Answer:
A pyramid of energy represents how much energy, initially from the sun, is retained or stored in the form of new biomass at each trophic level in an ecosystem. Typically, about 10% of the energy is transferred from one trophic level to the next, thus preventing a large number of trophic levels.
What is the maximum number of grams of NO (30.01 g/mol) that can be formed from the reaciton of 15.9 g of NH3 (17.03 g/mol) with 25.9 g of O2 (32.00 g/mol)?
4 NH3(g) + 5 O2(g) → 4 NO(g) + 6 H2O(l)
Based on the mole ratio, the maximum number of grams of NO that can be produced is 19.4 g.
What is the maximum number of grams of NO that can be produced?The maximum number of grams of NO that can be produced is calculated from the equation of the reaction as follows:
Equation of the reaction: 4 NH₃ (g) + 5 O₂ (g) → 4 NO (g) + 6 H₂O(l)
Mole ratio of NH₃ and O₂₂is 4 : 5
moles of NH₃ = 15.9 / 17.03
moles of NH₃ = 0.9336 moles
moles of O₂ = 25.9 / 32
moles of NH₃ = 0.809 moles
the limiting reactant is O₂
Mass of NO produced = 0.809 * 4/5 * 30
Mass of NO produced = 19.4 g
Learn more about limiting reactants at: https://brainly.com/question/26905271
#SPJ1
A 1.0 mole sample of fluorine gas at 25 °C has an average molecular velocity of 415 m/s. What is the total KE of the gas sample? Report your answer in kilojoules to the nearest tenth.
The total kinetic energy of the gas sample is 3.3 KJ
What is kinetic energy?This is the energy possessed by an object in motion. Mathematically, it can be expressed as:
KE = ½mv²
Where
KE is the kinetic energy m is the mass v is the velocity How to determine the mass of the fluorine gasMolar mass of fluorine gas = 38 g/molMole of fluorine gas = 1 moleMass of fluorine gas = ?Mass = mole × molar mass
Mass of fluorine gas = 1 × 38
Mass of fluorine gas = 38 g
How to determine the KE of the gas sampleMass (m) = 38 g = 38 / 1000 = 0.038 KgVelocity (v) = 415 m/sKinetic energy (KE) =?KE = ½mv²
KE = ½ × 0.038 × 415²
KE = 3272.275 J
Divide by 1000 to express in kilojoule
KE = 3272.275 / 1000
KE = 3.3 KJ
Learn more about energy:
https://brainly.com/question/10703928
#SPJ1
Form a group and discuss the possible reasons why EA, is a positive quantity for oxygen atom.
Answer:
Possible reasons why EA, or electronegativity, is a positive quantity for oxygen atom include:
Explanation:
What is the formula for the polyatomic ion thiocyanate?
Answer:
Explanation:
Names - Formula
peroxide (O2 2−)
cyanide (CN−)
cyanate (OCN−)
thiocyanate (SCN−)
The partial pressure of oxygen was observed To be 156 torr
When the partial pressure of oxygen is 156 torr and the atmospheric pressure is 743 torr, the mole fraction of oxygen is 0.210.
What is partial pressure?Partial pressure is the pressure exerted by an individual gas in a mixture of gases. The partial pressure of a gas depends on its mole fraction.
The relationship between the partial pressure of a gas and the total pressure is given by Dalton's law, which states that the sum of the partial pressures is equal to the total pressure.
We can calculate the partial pressure of oxygen using the mathematical expression of Dalton's law:
pO₂ = P × X(O₂)
X(O₂) = pO₂ / P
X(O₂) = 156 torr / 743 torr = 0.210
where,
pO₂ is the partial pressure of oxygen.P is the total pressure of the mixture.X(O₂) is the mole fraction of oxygen.The mole fraction of oxygen is 0.210 when its partial pressure is 156 torr and the atmospheric pressure is 743 torr.
The complete question is:
The partial pressure of oxygen was observed To be 156 torr in air with a total atmospheric pressure of 743 torr. Calculate the mole fraction of oxygen present.
Learn more about partial pressure here: https://brainly.com/question/19813237
#SPJ1
Hey guys! Can anyone help me out? I'm not familiar with the formula (equation) at all! :(
CO2 makes up 0.0314% of Earth’s atmosphere. Convert that into parts per million.
Answer:
419 parts per million
Explanation:
The amount of carbon dioxide in Earth's atmosphere reached 419 parts per million in May, its highest level in more than four million years, the National Oceanic and Atmospheric Administration announced on Monday.
Hope it helps <3
THEORY 1. illustrate the formation of the Compound AIC 13 Electron dot representation.
The electron representation shows the electrons in the atoms as dots as in the image attached.
What is electron dot representation?An electron dot representation, also known as a Lewis dot structure or electron dot diagram, is a way of representing the valence electrons of an atom using dots around the symbol of the element.
Valence electrons are the outermost electrons of an atom, and they play an important role in chemical bonding. The electron dot representation shows the valence electrons as dots around the symbol of the element, with each dot representing one valence electron.
Learn more about electron dot:https://brainly.com/question/25929171
#SPJ1
how is gas different from a liquid and a solid
a. a gas is mad of tiny particles
b. a gas has volume
c. a gas expands to fill the container
d. a gas has density
Answer:
a. a gas is mad of tiny particles
Explanation:
I believe
Explain the principles behind an acid-base titration. What is an indicator?
An acid–base titration is a method of quantitative analysis for determining the concentration of an acid or base by exactly neutralizing it with a standard solution of base or acid having known concentration. A pH indicator is used to monitor the progress of the acid–base reaction.
There is no change in the concentration of the reactants or the products.
When a reversible process reaches equilibrium,
The forward reaction rate is the same as the backward reaction rate.
The quantity of product being formed is therefore equal to the quantity of reactant being formed in a given amount of time.
Therefore, for a reversible reaction at equilibrium, both the reactant concentration and the product concentration are constant.
Indicators can be used to roughly determine the equivalence point of an acid-base titration as this colour shift only happens over a narrow pH range.
Learn more about concentration here:
https://brainly.com/question/10725862
#SPJ4
The principle behind the acid-base titration is that at the equivalence point , is where the no. of moles of the OH⁻ and H⁺ is equals. . indicator is the dye that color depends on the acidity or the basicity of solution.
The principles in which the acid - base titration is based on is that at the equivalence point the number of the moles of the OH⁻ ions and the number of moles of the H⁺ both are equals. in the neutralization reactions the acid and the base will react and form the salt and the water.
An indicator is the dye or the chemical substances the will indicates the nature of the acidic and the basic solution.
To learn more about titration here
https://brainly.com/question/30046193
#SPJ4
Which of the following is common to both nuclear fusion and nuclear fission? PLZ I NEED ANSWER quickly
1.The fuel must be in the plasma state
2.A chain reaction is needed to start the reaction
3.Matter is converted into energy
4.Temperatures over one million degrees Celsius are needed for the reaction to occur
Answer:
I think number4.Nuclear fusion reaction is not possible in earth
Nuclear fusion and nuclear fission both have common to temperatures over one million degrees Celsius are needed for the reaction to occur. Therefore, option 4 is correct.
What is nuclear fusion ?A reaction known as nuclear fusion occurs when two or more atomic nuclei fuse to create new atomic and subatomic particles. Energy is released or absorbed depending on how much mass there is between the reactants and products.
Nuclear reactions that involve fusion and fission both yield enormous quantities of energy that can be used to generate power.
The two heavy isotopes of hydrogen, deuterium and tritium, are the primary fuels used in nuclear fusion. Only 0.0153% of natural hydrogen is deuterium, which may be easily and cheaply produced from seawater. Lithium, which is also widely distributed in nature, can be used to create tritium.
Thus, option 4 is correct.
To learn more about nuclear fusion, follow the link;
https://brainly.com/question/12701636
#SPJ2
What type of words should you include when you write your hypothesis
Answer:
An if/then statement. If ____happens, then _____ happens.
Explanation:
A baseball is thrown straight up into the air and falls back down. When does the baseball have the least amount of kinetic energy?
Answer:
it has the same energy until it hits the ground.
whatever imparted by its throw
Explanation:
just before it hits the ground all the available energy has been diverted into kinetic energy
The kinetic energy of the baseball will be minimum when it reaches the maximum height.
What is the kinetic energy and potential energy?Kinetic energy (KE) is defined as the energy possessed by a moving object due to its motion. Work should be done to change the kinetic energy of a body. The kinetic energy can be expressed as K.E = ½mv² where ‘m’ is the mass and ‘v’ is the velocity of the object.
Potential Energy (P.E) is described as the energy that is stored in an object due to its position. This is expressed in the form P.E = mgh where ‘m’ is the mass, ‘g’ is the acceleration and ‘h’ is the height in meters.
The ball has maximum kinetic energy as it leaves the contact from the thrower and when about to touch the ground. When the baseball reached the maximum height in the air it has zero velocity and zero kinetic energy.
Learn more about kinetic energy and potential energy, here:
brainly.com/question/15764612
#SPJ2
What does it mean to be an invertebrate?
invertebrate is a animal that does not have a back bone but may have a exoskeleton examples could be earthworm, jellyfish, snail and a spider because it has a exoskeleton a hard outer shell hope this helps
Vertebrates have a back bone like sea turtles , fish ,foxes and humans.
A compound has the formula X2Fe(CN)6 ∙ 12H2O, where X is an unknown element.
If the compound is 45.34% water by mass, what is the identity of element X?
The identity of element X in the compound X2Fe(CN)6 · 12H2O is sodium (Na).
To find the identity of element X in the compound X2Fe(CN)6 · 12H2O, we can start by determining the molar mass of the compound.
The molar mass of X2Fe(CN)6 is:
2 × molar mass of X + molar mass of Fe + 6 × molar mass of C + 6 × molar mass of N
= 2 × atomic mass of X + atomic mass of Fe + 6 × 12.01 g/mol + 6 × 14.01 g/mol
= 2 × atomic mass of X + 55.85 g/mol + 432.72 g/mol + 84.06 g/mol
= 2 × atomic mass of X + 572.63 g/mol
The molar mass of 12H2O is:
12 × (atomic mass of H + atomic mass of O) = 12 × (1.01 g/mol + 16.00 g/mol) = 216.24 g/mol
The total molar mass of the compound is:
2 × atomic mass of X + 572.63 g/mol + 216.24 g/mol = 2 × atomic mass of X + 788.87 g/mol
Now we can use the given information that the compound is 45.34% water by mass. This means that the mass of water in the compound is 45.34% of the total mass of the compound, and the mass of the rest of the compound (X2Fe(CN)6) is 100% - 45.34% = 54.66% of the total mass of the compound.
Let's assume we have 100 g of the compound. Then the mass of water in the compound is:
45.34 g water = 0.4534 × 100 g compound
The mass of the rest of the compound (X2Fe(CN)6) is:
54.66 g rest of the compound = 0.5466 × 100 g compound
We can now use the mass of the rest of the compound (X2Fe(CN)6) to find the number of moles of the compound:
moles of X2Fe(CN)6 = (54.66 g) / (2 × atomic mass of X + 572.63 g/mol)
We can also use the mass of water to find the number of moles of water:
moles of H2O = (45.34 g) / 18.02 g/mol
Since the compound has 12 moles of water per mole of X2Fe(CN)6, we have:
moles of X2Fe(CN)6 = 1/12 × moles of H2O
We can now set these two expressions for moles of the compound equal to each other and solve for the atomic mass of X:
(54.66 g) / (2 × atomic mass of X + 572.63 g/mol) = 1/12 × (45.34 g) / 18.02 g/mol
Simplifying this equation and solving for the atomic mass of X gives:
atomic mass of X = 22.99 g/mol
The atomic mass of X is very close to the atomic mass of sodium (22.99 g/mol), so it is likely that X is sodium. Therefore, the identity of element X in the compound X2Fe(CN)6 · 12H2O is sodium (Na).
learn more about molar mass here
https://brainly.com/question/837939
#SPJ1
Explain how the properties of ammonium lauryl sulfate make it useful for its intended purpose. Write a short paragraph.
Sodium lauryl sulfate is a surfactant that help with the mixing of oil and water to clean the skin and hair by helping water to mix with oil and dirt so that they can be rinsed away or suspend poorly soluble ingredients in water.
Why Ammonia lauryl sulfate serve as a surfactor ?They frequently serve as detergents, foaming agents, and other cleaning agents by assisting in the mixing of water with oil and dirt so that they can be rinsed away.It consist of long nonpolar hydrocarbon chains and the ionic sulfate end group which make it a surfactant.They lower the surface tension of the water so that air bubbles do not rupture when you brush your teeth or shampoo your hair.The 'lauryl sulphate' portion is the most important part of this molecule having one fatty acid end and one charged end, allowing it to function as an oil-water adaptor.Thus, ammonia lauryl sulfate serve as surfactore due to it's ability to lower the surface tension of water and ability to form micelles in water.
Know more about ammonia lauryl sulfate here:
brainly.com/question/10834028
#SPJ1
Find the formula mass of the compound, then divide the individual element total by the total mass-move the decimal over two to change it to percentage Na3PO4
In order to find the total mass of Na3PO4, we need to add all the value of mass from each individual element, and in this compound we have:
Na = 23g, but we have 3, 23*3 = 69 grams of sodium
P = 31 grams of phosphorus
O = 16g, but we have 4, 16*4 = 64 grams of oxygen
69 + 31 + 64 = 164 g/mol is the molar mass of this compound
The percent composition for each element is:
69/164 = 42.1% of Na
31/164 = 18.9% of P
64/164 = 39% of O
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the best method of separating the mixture of sand and fine salt?
By using filtration, the sand and fine salt can be effectively separated based on their difference in particle size, providing a clean separation of the two components.
Filtration is a separation technique that takes advantage of the difference in particle size between sand and salt. It involves passing the mixture through a porous material, such as filter paper or a filter funnel, which allows the liquid (saltwater) and small salt particles to pass through while retaining the larger sand particles.
Here's how the filtration process can be carried out:
1. Set up a filter apparatus with a funnel and filter paper or a filter flask.
2. Place the mixture of sand and salt in a beaker or a flask.
3. Slowly pour the mixture into the filter paper or funnel, allowing the liquid (saltwater) to pass through while retaining the sand on the filter paper.
4. Once the liquid has passed through completely, the sand will be left behind on the filter paper or in the filter flask.
5. Carefully remove the sand from the filter paper or filter flask, and the saltwater solution can be collected separately.
For more such questions on filtration
https://brainly.com/question/29756050
#SPJ8
200.0 grams of an organic compounds known to contain 98.061 grams of carbon, 10.381 grams of hydrogen, 32.956 grams of oxygen and the rest is nitrogen. what is the empirical formula of the compound? what is the molecular formula of the compound if its molar mass is 194.101?
Answer:
1. The empirical formula is C₄H₅N₂O
2. The molecular formula is C₈H₁₀N₄O₂
Explanation:
The following data were obtained from the question:
Mass of compound = 200 g
Carbon (C) = 98.061 g
Hydrogen (H) = 10.381 g
Oxygen (O) = 32.956 g
Empirical formula =?
Molecular formula =?
Next, we shall determine the mass of nitrogen in the compound. This can be obtained as follow:
Nitrogen (N) = 200 – (98.061 + 10.381 + 32.956)
Nitrogen (N) = 200 – 141.398
Nitrogen (N) = 58.602 g
1. Determination of the empirical formula of the compound.
C = 98.061 g
H = 10.381 g
O = 32.956 g
N = 58.602 g
Divide by their molar masses
C = 98.061 /12 = 8.172
H = 10.381 /1 = 10.381
O = 32.956 /16 = 2.060
N = 58.602 /14 = 4.186
Divide by the smallest
C = 8.172 /2.060 = 4
H = 10.381 / 2.060 = 5
O = 2.060 / 2.060 = 1
N = 4.186 / 2.060 = 2
Thus, the empirical formula of the compound is C₄H₅N₂O
2. Determination of the molecular formula of the compound.
Empirical formula of the compound => C₄H₅N₂O
Molar mass of compound = 194.101 g/mol
Molecular formula =.?
[C₄H₅N₂O]n = 194.101
[(12×4) + (1×5) + (14×2) + 16]n = 194.101
[48 + 5 + 28 + 16]n = 194.101
97n = 194.101
Divide both side by 97
n = 194.101 /97
n = 2
Molecular formula => [C₄H₅N₂O]n
=> [C₄H₅N₂O]2
=> C₈H₁₀N₄O₂
Consider the balanced equation Zn + 2HCl ZnCl2 + H2 How many
moles of ZnCl2 will be produced if 2 moles of HCl are used?
Answer:
1 mole of ZnCl₂
Explanation:
Just from the stoichiometric equation/ balanced equation:
Zn(s) + 2HCl(aq) → ZnCl₂(s) + H₂(g)
1 mole 2 moles 1 mole 1 mole
Therefore: 2 moles of 2HCl produce 1 mole of ZnCl₂
4Fe + 302 → 2Fe2O3
How many different types of atoms are involved in this reaction?
O2
O3
04
O5
Answer:
2 -> O and Fe
Explanation:
What are the products of the chemical reaction shown?
CH4+2O2 --> CO2 + 2H2O
Question 10 options:
CH4 and O2
O2 and H2O
CO2 and H2O
CH4 and CO2
Answer:
CO2 AND H20 I THINK IM 99 PERCENT SURE
convert each into decimal form.
a) 1.56× 10^3
b) 0.56×10-4
Answer: A = 1560
B = 1.6
Explanation: brainlest please