The tendency of an object to resist a change.


A. Inertia

B. Friction

C. Law of conservation of motivation

D. Force

Answer: 2150000 cm

Explanation:

Hey there!

In order to find the answer you have to MULTIPLY the kilometers (km) [21.5] from 100,000 and then you should be able to find your answer in centimeters (cm)

21.5 km * 100,000 = ? cm

Simplify that equation:

cm = 2,150,000

Therefore, your answer should be: 2,150,000

Good luck on your assignment & enjoy your day!

~Amphitrite1040:)

The rate constant of the reaction is 0.0531 min-¹.For a first-order reaction, the rate of the reaction is proportional to the concentration of the reactant. The rate law for a first-order reaction is given by the equation:

Rate = k[A]

where:

Rate is the rate of the reaction

k is the rate constant

[A] is the concentration of the reactant

The integrated rate law for a first-order reaction is:

ln([A]t/[A]0) = -kt

where:

[A]t is the concentration of the reactant at time t

[A]0 is the initial concentration of the reactant

k is the rate constant

t is the time

In this problem, we are given that 50.0% of a compound decomposes in 13.0 min. This means that [A]t/[A]0 = 0.5, and t = 13.0 min. Substituting these values into the integrated rate law, we get:

ln(0.5) = -k(13.0 min)

Solving for k, we get:

k = -ln(0.5)/13.0 min

k = 0.0531 min-¹

Therefore, the rate constant of the reaction is 0.0531 min-¹

To learn more about rate constant here:

https://brainly.com/question/20305871

#SPJ11

The Empirical formula of the compound is C₅H₅O.

and molecular formula of the compound is  C₁₀H₁₀O₂.

mass of C in the compound = (196g CO2)x (12.0 g C/44.0 g CO2) = 53.45g C

mass of H in compound = (40.2 g H2O) x (2.0 g H /18.0 g H2O) = 4.46 g H

mass of O in compound = 72.3 g total - 53.45 g C - 4.46 g H = 14.39 g O

now convert mass of each element to moles

53.45 g C x (1 mole C/12.0 g C) = 4.45 moles C

4.46 g H x (1 mole H/1.0 g H) = 4.46 moles H

14.39 O x (1 mole O/16.0 g O) = 0.899 moles O

Divide each by 0.899 to get C₅H₅O, which has a mass of 81 g

double that to get C₁₀H₁₀O₂ with mass of 162 g.

This is a "classic" example of a combustion analysis problem.

To know more about empirical formula visit the link:

https://brainly.com/question/14044066?referrer=searchResults

#SPJ9

Compounds that are ionic or polar in nature tend to dissolve in water, while compounds that are nonpolar or have strong intermolecular forces are less likely to dissolve in water.

When determining if a compound will dissolve in water, it is important to consider the nature of the compound's chemical bonds and intermolecular forces. Ionic compounds, such as sodium chloride (NaCl), readily dissolve in water due to the attraction between the charged ions and the polar water molecules. The positive ends of water molecules (hydrogen atoms) are attracted to the negative ions, while the negative ends of water molecules (oxygen atoms) are attracted to the positive ions.

Similarly, polar compounds, such as ethanol (C2H5OH), also dissolve in water because they have a positive and a negative region, allowing them to interact with water molecules through hydrogen bonding and dipole-dipole interactions.

On the other hand, nonpolar compounds, such as hydrocarbons like hexane (C6H14), have little to no polarity and do not readily interact with polar water molecules. Therefore, they are insoluble or have very low solubility in water.

In summary, compounds that are ionic or polar generally dissolve in water due to the favorable interactions between their chemical properties and the polar nature of water molecules. Nonpolar compounds, on the other hand, tend to be insoluble in water because they lack the necessary polarity to interact with water molecules effectively.

To know more about intermolecular forces, visit:-

https://brainly.com/question/12243368
#SPJ11

Explanation: i don't know how can i know the moles in element?

Answer:

Electrons

Explanation:

Cathode rays carry electronic currents through the tube. Electrons were first discovered as the constituents of cathode rays. J.J. Thomson used the cathode ray tube to determine that atoms had small negatively charged particles inside of them, which he called “electrons.”

The rays produced in a cathode tube are electrons which are present in the shells surrounding the nucleus of an atom.

An atom is defined as the smallest unit of matter which forms an element. Every form of matter whether solid,liquid , gas consists of atoms . Each atom has a nucleus which is composed of protons and neutrons and shells in which the electrons revolve.

The protons are positively charged and neutrons are neutral and hence the nucleus is positively charged. The electrons which revolve around the nucleus are negatively charged and hence the atom as a whole is neutral and stable due to presence of oppositely charged particles.

Atoms of the same element are similar as they have number of sub- atomic particles which on combination do not alter the chemical properties of the substances.

Learn more about atom,here:

https://brainly.com/question/13654549

#SPJ6

Answer:

A the strong bonds between particles.

Explanation:

this is because in solids we say that they have a weak boling point due to the strong bond that makes it hard to melt

The organic molecule acetone has the chemical formula (CH3)2CO. The smallest and most basic ketone. It is a colorless, incredibly combustible liquid with a distinctively strong smell. Because it is miscible with water, acetone is used as a significant organic solvent in industry, the household, and laboratories.

Calculate the mass of acetone, C3H6O, that vaporizes as a result of absorbing 500 KJ of energy.

Knowing that;

acetone weighs 31.5 g.

Acetone's molar mass is 58.08 g/mol.

Acetone has a heat of vaporization of 31.3 kJ/mol.

Count of moles = mass / molar mass

Acetone molecular weight = 31.5 / 580.8

Acetone has a molecular weight of 0.5424 moles.

By dividing the number of moles of acetone by the heat of vaporization of acetone, one may calculate the amount of heat necessary to evaporate 31.5 g of acetone;

Hence;

31.3 g of acetone must be heated to vaporization temperature of 31.0 kJ/mol, or 0.5424 mole.

16.8144 kJ of heat are needed to evaporate 31.3 g of acetone.

≅ 16.81 kJ

To know more about acetone, click on the link below:

https://brainly.com/question/15008900

#SPJ9

Answer:

We heart you don't have all the information you just got some common substances and their chemical formulas are listed in the chart? That we don't have the chart to see which of the substances are elements

Explanation:

sorry about that if you can take a picture of it and repost it I am sure I could answer it for you

When sodium acetate is dissolved in water, it is hydrolyzed into ions.

When a salt of weak acid or base is dissolved in water, this salt hydrolysis in it. Water ionises into hydroxide and hydrogen due to addition of sodium acetate. In water, sodium acetate splits into sodium and acetate ions.

So we can conclude that when sodium acetate is dissolved in water, it is hydrolyzed into ions.

Learn more about dissolve here: https://brainly.com/question/12983022

The unknown metal X is iron metal as it reacts with copper sulfate solution but does not react with magnesium chloride.

Some metals are very reactive while other metals are less reactive or unreactive. When a more reactive metal is added to the solution of a less reactive metal, then the more reactive displaces the less reactive metal from its solution is known as a displacement reaction.

The general form of a single displacement reaction can be represented as:

\(A + BC \longrightarrow B + AC\)

When iron is placed in copper sulfate (CuSO₄) solution then the blue color of the copper sulfate solution turns a red-brown coating of copper metal deposited on the iron.

\(CuSO_4 (aq)+ Fe (s)\longrightarrow FeSO_4 (aq) +Cu(s)\)

Iron lies above the electrochemical series and is more reactive than copper. So it reacts with copper sulfate but does not give any reaction with magnesium chloride.

Learn more about displacement reaction, here:

https://brainly.com/question/3172917

#SPJ1

Answer:

true.

Explanation:

The energy difference between the orbitals can be calculated from bohr's model.

According to the bohr's model, the electrons are in continuous motion round the nucleus closed orbits of definite energy level. as the distance of the cell increases from the nucleus ,energy level of cell increases..as long as electron occupy a definite energy level, it doesn't radiate out energy. The emission of energy occurs only when electron jumps from one level to other.

            E=  h c/ λ

 Sodium atom emit light with a wavelength of 330nm when an electron moves from a 4p orbital to a 3s orbital.

             λ=330nm

             h=6.625 .10-34 (Planck's constant)

             c= 3.0 .108m/s-1

putting the values in the expression of Energy we get the energy    difference.

To learn more about Bohr's model please visit:

https://brainly.com/question/18002213  

$SPJ4          

The gas-phase decomposition of SO2Cl2 is a first-order reaction, and the rate of the reaction is given by the equation: rate = k[SO2Cl2]

The half-life of a first-order reaction is given by the equation: T1/2 = 0.693/k (a) At 600 K, the half-life for the process is 2.3 x 105 s. To find the rate constant at this temperature, we can use the half-life equation to solve for k: T1/2 = 0.693/k ;2.3 x 105 s = 0.693/k ;k = 0.693 / 2.3 x 105 s = 3 x 10^-5 s-1 , (b) At 320 degree celcius  , the rate constant is 2.2 x 10^-5 s^-1. To find the half-life at this temperature, we can use the half-life equation and substitute in the given rate constant: T1/2 = 0.693/k;T1/2 = 0.693 / 2.2 x 10^-5 s-1 ;T1/2 = 3.15 x 10^4 s Therefore, the half-life of the reaction at 320 degree celcius is 3.15 x 10^4 seconds.

Learn more about rate constant here:

https://brainly.com/question/20305922

#SPJ4

Answer:

131g of Ba₃(PO₄)₂(s) precipitate will be formed

rate as brainliest

Answer:

131

Explanation:

Answer:

72.7% of oxygen

Explanation:

Answer:

i- In beaker A, sodium chloride will dissolve with water.

  and in beaker B, there will be no reaction.

ii- sodium chloride is soluble in water, while sand is insoluble.

iii- The reaction can be increased by adding more sodium chloride to the beaker.

iv- The sodium chloride will no longer dissolve in the water.

The primary cause of recent global warming is believed to be increased burning of fossil fuels.

Fossil fuels such as coal, oil, and natural gas are used to produce energy for transportation, electricity, and heating. When these fuels are burned, they release carbon dioxide and other greenhouse gases into the atmosphere.Chemical reactions in the atmosphere that are driven by solar heat and increased levels of atmospheric pollution can also contribute to global warming, but they are not considered the primary cause.

Depletion of the rainforests can also have a negative impact on the climate, as they absorb carbon dioxide and release oxygen. The consequences of global warming are numerous and severe. They include rising sea levels, more frequent and intense natural disasters. It is essential that we take action to address this problem by reducing our dependence on fossil fuels and investing in renewable energy sources such as solar and wind power.

Know more about   global warming    here:

https://brainly.com/question/3553382

#SPJ11

The nitrogen hybridizations in NF3 and NH3 are, respectively, sp3 and sp3.

To learn more about hybridization visit:

https://brainly.com/question/22765530

#SPJ4

The correct statement about the energy of the bob in the given scenario is: The potential energy of the bob is greatest in Position C.

In a pendulum, the bob's energy undergoes continuous transformation between kinetic energy (associated with motion) and potential energy (associated with position or height). As the bob moves, its energy changes between these two forms.

When the bob is at Position A, it is at its highest point in the swing, and its velocity is zero. At this point, the bob has maximum potential energy because it is at its maximum height from the reference point (usually the lowest point in the swing). Potential energy is directly related to the height or position above the reference point.

As the bob starts to move downward from Position A, its potential energy decreases, and its kinetic energy increases. At Position C, the bob reaches its lowest point in the swing, where its potential energy is at its minimum because it is closest to the reference point. At this point, the bob has converted all its potential energy into kinetic energy, as its velocity is at its maximum.

From Position C to Position D, as the bob starts moving upward, its kinetic energy decreases, and its potential energy increases again. The bob is gaining height, and its potential energy is being converted back into kinetic energy. This conversion continues until the bob reaches Position E, where it momentarily stops before starting its descent back to Position A.

In summary, the potential energy of the bob is greatest at Position C, while the kinetic energy is greatest at Position A. The bob's energy continuously changes between potential and kinetic as it swings back and forth.

To know more about potential energy, please click on:

https://brainly.com/question/24284560

#SPJ11

The percentage of aniline protonated in a 0.010 M solution with a pH of 8.32 is approximately 0.021%.

Aniline (C6H5NH2) is a weak base that can be represented by the equation

C6H5NH2 + H2O ⇌ C6H5NH3+ + OH-.

The equilibrium constant expression for this reaction is

Kb = [C6H5NH3+][OH-]/[C6H5NH2].

At equilibrium, the concentration of aniline that has reacted to form the protonated form is [C6H5NH3+], and the concentration of aniline that has not reacted is [C6H5NH2].

Using the relationship between pH and [OH-] (pH = 14 - pOH), we can calculate that [OH-] = 10^(-5.68) M.

Using the equilibrium constant expression and the known concentration of aniline, we can solve for [C6H5NH3+]/[C6H5NH2], which is approximately 0.000213. This value multiplied by 100 gives the percentage of aniline that is protonated, which is approximately 0.021%.

For more questions like Aniline click the link below:

https://brainly.com/question/31081529

#SPJ11

Answer: 0.813 L

Explanation:

Ideal gas law is valid only for ideal gas not for vanderwaal gas. Combined Boyle's and Charles' gas law is used here. Therefore the new pressure of helium gas is 5.63 atm.

Ideal gas equation is the mathematical expression that relates pressure volume and temperature.

Mathematically the relation between Pressure, volume and temperature can be given as

PV=nRT

where,

P = pressure of  radon gas

V= volume of  radon gas

n =number of moles of  radon gas

T =temperature of radon gas

R = Gas constant = 0.0821 L.atm/K.mol

Combining Boyle's and Charles' gas law

P₁V₁/T₁ = P₂V₂/T₂

{ (1.15 atm) (1.53 L)} ÷305  K ={ (P2) ( 1.78)} ÷325 K

P2 = 7.55÷1.34 = 5.63 atm

Therefore the new pressure of radon gas is 5.63 atm when the temperature is changed to 325K and volume is decreased to 1.78liter.

To learn more about ideal gas equation, here:

https://brainly.com/question/14826347

#SPJ5

Answer:

Because of the summer season

Explanation:

The water in the dish which is uncovered will evaporate faster as compared to the one which is

covered. This is because the air above the uncovered dish has less water vapour over it as

compared to the one which is covered. The covered dish has good amount of moisture over it as

the closed lid does not allow the moisture to come in direct contact with air.

Answer:

Tetrahedral

Explanation:

Answer:

33 minutes

Explanation:

60 km/h = 37.28 mi/h

20/37.28 = 0.5364 h

0.5364 * 60 min = 32.2 minutes

I am unsure if this is correct, but this might be the whole section:

Answer:

The density of the material is 7.5 g/m^3

Explanation:

The volume of a rectangle is:

Volume = Length*Height*Width

Replacing with data:

Volume = 5 m * 2 m * 4 m = 40 m^3

Density is computed as follows:

Density = Mass/Volume

Replacing with data:

Density = 300 g/40 m^3

Density = 7.5 g/m^3

(Answer creds: jbiain)