The only compound that is a base according to the Brønsted-Lowry theory is CHOO− (formate ion).
Using the Brønsted-Lowry theory, let's identify which compounds from the list are bases. The list includes CH, CH3COOCH2HCOOH, CHOO−, and HNO3.
According to the Brønsted-Lowry theory, a base is a substance that can accept a proton (H+) from another substance. Let's analyze each compound:
1. CH: This compound does not exist as written. It is likely a typo or an incomplete formula. Therefore, we cannot determine its acidic or basic nature.
2. CH3COOCH2HCOOH: This is a complicated compound, but upon inspection, we can see that it is an ester, which does not have any basic sites that can accept a proton. Therefore, it is not a base.
3. CHOO−: This is a formate ion (HCOO−). It has a negatively charged oxygen atom that can accept a proton, making it a Brønsted-Lowry base.
4. HNO3: This is nitric acid, a strong Brønsted-Lowry acid that can donate a proton. It is not a base.
You can learn more about Brønsted-Lowry theory at: brainly.com/question/27901530
#SPJ11
given the pka of each acid, determine whether it is strong or weak.
The answer to the given question about strong acid and weak acid is weak, strong, weak, strong.
Based on how strongly or weakly they ionize in water, acids are categorized as either strong or weak. An acid that is totally ionized in an aqueous solution is referred to be a strong acid. In water, hydrogen chloride (HCl) totally ionizes into hydrogen and chloride ions. An acid that ionizes very little in an aqueous solution is said to be weak. Acetic acid is a highly popular weak acid that can be found in vinegar. Acetic acid's incomplete ionization is indicated in the equation by the double arrow. Weak acids ionize to varying degrees, but often less than 10%. Since just 1.3% of the acetic acid in a 0.10M solution gets ionized, the equilibrium greatly favors the reactants.
Given That:
Acetic acid, pKa = 4.7
This above solution is Weak.
Nitric acid, pKa = -2
The above solution is strong.
Citric acid, pKa = 3.1
The above solution is weak
Sulfuric acid, pKa = -5
The above solution is strong.
Complete Question
Given the pKa of each acid, determine whether it is strong or weak.
acetic acid, pKa=4.7 ___
nitric acid, pKa=-2 ____
citric acid, pKa=3.1 ___
sulfuric acid, pKa=-5 ___
To learn more about strong acid :
brainly.com/question/12811944
#SPJ4
What is coal made of? Where does the energy and matter come from?
Answer:
Coal is made from plants that were once alive! Since coal comes from plants, and plants get their energy from the sun, the energy in coal also came from the sun
Polarities of analyte functional group increase in the order of hydrocarbon ethers < esters
The correct order of the increasing polarity of the analyte functional group isEthers < Esters.
The given statement is "Polarities of analyte functional group increase in the order of hydrocarbon ethers < esters." The order of polarities of functional groups is the order of their increasing polarity (i.e., less polar to more polar) based on their electron-donating or withdrawing ability from the rest of the molecule.Polarity of analyte: The analyte's polarity is directly proportional to the dipole moment of the functional group, which is associated with a difference in electronegativity between the atoms that make up the functional group.The electronegativity of an element is its ability to attract electrons towards itself. The greater the difference in electronegativity between two atoms, the more polar their bond, and hence the greater the polarity of the molecule.
To find the correct order of the increasing polarity of the analyte functional group, let's first compare the two groups: hydrocarbon ethers and esters. Here, esters have a carbonyl group while ethers have an oxygen atom with two alkyl or aryl groups. The carbonyl group has more electronegative oxygen, which pulls electrons away from the carbon atom, resulting in a polar molecule. On the other hand, ethers have a less polar oxygen atom with two alkyl or aryl groups, making them less polar than esters. Therefore, the correct order of the increasing polarity of the analyte functional group isEthers < Esters.
To know more about polarity visit:-
https://brainly.com/question/33242453
#SPJ11
can anyone help me with this please
Answer:
A) The reaction absorbs energy
This is because the before reading show the temperature of 20°C whereas the after reading show the temperature of 13 °C
MORE TO KNOW The reaction in which energy is absorbed is known as Endothermic reaction The reaction in which energy is releases is known Exothermic reactionWhat is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?
The balanced equation for this reaction is:
CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).Learn more about the condensation reaction:
brainly.com/question/6256866
#SPJ11
A solution of NaCl was prepared in the following manner: 0.0842 g of NaCl is massed out on an analytical balance. The solid is transferred to a 25.00 mL volumetric flask. Deionized water is added to the flask such that the bottom of the meniscus is at the line. A 1.00 mL aliquot of the stock solution is transferred to a 50.00 mL volumetric flask using a volumetric pipet and diluted to volume. 6. Calculate the concentration of NaCl in the resulting solution in mg/L NaCl. (answer = 67.4 mg/L) 7. Calculate the concentration of NaCl in the resulting solution using propagation of error through the calculation. Use the manufacturer's tolerance values as the absolute error. The tolerances can be found in Chapter 2 of the Harris text. Assume a Class 1 balance and Class A glassware. Treat the tolerances as random error. (answer = 67.4+0.4 mg/L) 8. Identify 2 possible sources of random (indeterminate) error. Identify 2 possible sourses of systematic (determinate) error.
Two possible sources of systematic (determinate) error in the experiment are; Incorrect calibration of volumetric glasswareIncorrect mass of NaCl
To calculate the concentration of NaCl in the resulting solution in mg/L NaCl, we can use the formula; Concentration (mg/L) = (Mass of solute ÷ Volume of solution in L) × 1000 g / 1 mg NaCl is present in the stock solution of 25 mL. So, the mass of NaCl in the solution would be;0.0842 g ÷ 25 mL = 0.00337 g/mL. Now, in the resulting solution, a 1.00 mL aliquot of the stock solution is transferred to a 50.00 mL volumetric flask and diluted to volume. Therefore, the volume of the resulting solution is 50.00 mL. We will substitute these values in the formula, Concentration (mg/L) = (0.00337 g/mL ÷ 50 mL) × 1000 g / 1 mg concentration (mg/L) = 67.4 mg/L. Therefore, the concentration of NaCl in the resulting solution in mg/L NaCl is 67.4 mg/L.7. Concentration = 67.4 mg/LTolerance = 4.28 mg/LTotal concentration = 67.4 + 4.28 mg/L = 71.68 mg/LWe round off this value to one decimal place; Total concentration = 71.7 mg/LTherefore, the concentration of NaCl in the resulting solution using propagation of error through the calculation is 67.4+0.4 mg/L.8. Two possible sources of random (indeterminate) error in the experiment are; Errors in temperature measurement. Errors in measurement of water volume. Two possible sources of systematic (determinate) error in the experiment are; Incorrect calibration of volumetric glasswareIncorrect mass of NaCl.
Learn more about NaCl
https://brainly.com/question/32275922?
#SPJ11
What is a double bond
Answer:
a chemical bond in which two pairs of electrons are shared by two atoms and a molecule. Examples of compounds with double bonds include oxygen gas, carbon dioxide, acetone, and ozone
a chemical bond in which two pairs of electrons are shared between two atoms.
Consider the following reaction:
2NO2(g) → 2NO(g) + O2(g) rate = k [NO2]^2 where k = 0.25 M-1 s-1
A rigid 1.00 L reaction vessel initially contains only 0.50 moles NO2. How long would it take to form 0.20 moles of O2? Report answer in seconds to 2 significant figures
To determine the time it takes to form 0.20 moles of O2, we need to first find the initial concentration of NO2 and the final concentration of NO2 after the reaction.
Initial concentration of NO2 = (0.50 moles) / (1.00 L) = 0.50 M
Reporting the answer to 2 significant figures, the time it takes to form 0.20 moles of O2 is 1.6 s.
To solve this problem, we need to use the rate law equation and the given values to calculate the time required to form 0.20 moles of O2. The rate law equation for this reaction is rate = k [NO2]^2.
First, we need to calculate the initial concentration of NO2 in the reaction vessel. Since the vessel contains 1.00 L of gas and 0.50 moles of NO2, the initial concentration of NO2 is 0.50 M.
Next, we can use the rate law equation to calculate the rate of the reaction at the initial concentration of NO2:
rate = k [NO2]^2
rate = 0.25 M-1 s-1 x (0.50 M)^2
rate = 0.0625 M/s
To form 0.20 moles of O2, we need to calculate the time required at this rate:
0.20 moles O2 / 2 moles NO2 = 0.10 moles NO2 used
0.10 moles NO2 / (0.0625 M/s) = 1.6 s
Therefore, it would take 1.6 seconds (reported to 2 significant figures) to form 0.20 moles of O2 in the reaction vessel.
To know more about significant figures visit:
https://brainly.com/question/23396760
#SPJ11
Aqueous solutions of ammonium iodide and lead (II) nitrate are mixed. Precipitate:
Chemical Equation:
Complete Ionic Equation:
Net ionic Equation:
Chemical equation:
Pb(NO3)2(aq) + 2NH4I(aq) -->PbI2(s) + 2NH4NO3(aq)
Precipitate:
PbI2 (because it's a yellow insoluble solid)
Complete Ionic Equation:
Pb(aq) + 2NO3(aq) + 2NH4(aq) + I2(aq) --> Pb(s) + I2(s) + 2NH4(aq) + 2NO3(aq)
Net ionic equation:
Pb(aq) + I2(aq) --> Pb(s) + I2(s)
Let me know if there are any errors. Goodluck :)
considering lei's alcohol consumption, in which b vitamin may he be deficient? a. niacin b. riboflavin c. thiamin d. biotin e. pantothenic acid
Lei's alcohol consumption can lead to a deficiency in various B vitamins, but one vitamin that may be of particular concern is thiamin or vitamin B1.
Alcohol interferes with the body's ability to absorb and utilize thiamin, which is an essential nutrient required for the proper functioning of the nervous system, muscles, and heart. Chronic alcohol consumption can lead to a thiamin deficiency and a condition called Wernicke-Korsakoff syndrome, which can cause confusion, memory loss, and vision problems.
Moreover, alcohol consumption can also lead to deficiencies in other B vitamins such as riboflavin, niacin, and pantothenic acid, as these vitamins are also essential for energy metabolism and the proper functioning of the nervous system. Therefore, individuals who consume alcohol regularly should ensure they consume a balanced diet and consider taking a B-complex vitamin supplement to help prevent deficiencies.
Learn more about thiamin here:
https://brainly.com/question/8928076
#SPJ11
3.
What is the presence of hornblende in the rock an important clue?
Answer:
covection
Explanation:
What is specific heat? How are the factors affecting it?
Answer:
Specific heat, ratio of the quantity of heat required to raise the temperature of a body one degree to that required to raise the temperature of an equal mass of water one degree.
Explanation:
by dividing the heat capacity by the quantity of substance in a body, the resulting specific heat capacity is a function of the structure of the substance itself. In particular, it depends on the number of degrees of freedom that are available to the particles in the substance, each of which type of freedom allows substance particles to store thermal energy.
Calculate the maximum mass of zinc which will react with 50 cm3 of hydrochloric acid, of concentration 2.0 mold/dm3
To calculate the maximum mass of zinc that will react with 50 cm3 of hydrochloric acid with a concentration of 2.0 mold/dm3, we first need to use the balanced chemical equation for the reaction between zinc and hydrochloric acid:
Zn(s) + 2HCl(aq) → ZnCl2(aq) + H2(g)
From this equation, we can see that one mole of zinc reacts with 2 moles of hydrochloric acid. Therefore, the number of moles of hydrochloric acid in 50 cm3 (0.05 dm3) with a concentration of 2.0 mold/dm3 is:
n(HCl) = C × V = 2.0 × 0.05 = 0.1 mol
Since the stoichiometry of the reaction is 1:2 (1 mole of zinc reacts with 2 moles of hydrochloric acid), the maximum number of moles of zinc that can react is:
n(Zn) = 0.1/2 = 0.05 mol
Finally, we can use the molar mass of zinc (65.38 g/mol) to calculate the maximum mass of zinc that can react:
mass(Zn) = n(Zn) × M(Zn) = 0.05 × 65.38 = 3.27 g
Therefore, the maximum mass of zinc that will react with 50 cm3 of 2.0 mold/dm3 hydrochloric acid is 3.27 grams.
For more such question on mass
https://brainly.com/question/20024683
#SPJ11
In a chemical reaction, one of the chemical reactants is present in______ to make sure that the limiting reagent is completely consumed.
Answer: excess
Explanation: i guesses and got the answer right
What product is formed when the compound is treated with K2Cr2O7? If no reaction occurs, draw the reactant.
Industrial production of potassium chromate uses potassium: K2Cr2O7 + K2CO3 2 K2CrO4 + CO. Chromic hydrazine (chromium trioxide, CrO3) is transformed into red crystals after being treated with cold sulfuric acid.
When heated, does K2Cr2O7 create oxygen?It is an orange-colored substance with a potent oxidising ability. Heat will therefore cause potassium dichromate to break down into potassium chromate and release oxygen gas.
How does the oxidising agent K2Cr2O7 work?When elements interact chemically with potassium dichromate, the oxidation state of its atoms increases and they become more electronegative. Potassium dichromate is indeed a strong oxidising agent in an acidic medium.
To know more about hydrazine visit:
https://brainly.com/question/17045336
#SPJ1
Producing sodium chloride (table salt) is impractical and expensive. Sodium
chloride can be extracted from seawater. How could this be
done using a common renewable energy source?
For the harvesting of salt from seawater, solar energy is used. To evaporate seawater, solar energy is used. As the concentration of the salt increases, it crystallizes.
What is renewable source of energy?Renewable energy is defined as energy derived from natural sources that is replenished at a faster rate than it is consumed.
Sunlight and wind are two examples of such constantly replenishing sources. Renewable energy sources are plenty and are all around us.
Solar energy is utilized to get salt from seawater. Solar energy is used to evaporate seawater. The salt crystallizes as its concentration increases.
Thus, this way, salt extraction can be done using a common renewable energy source.
For more details regarding renewable sources of energy, visit:
https://brainly.com/question/4038933
#SPJ1
What is the coefficient for water molecules in the balanced version of the following redox reaction? cr2o2−7 c2h4o→c2h4o2 cr3
The given redox reaction is:
Cr2O7^2- + C2H4O → C2H4O2 + Cr3+
To balance this reaction, we first balance the oxygen atoms by adding H2O on the right side of the equation. The number of H2O molecules added depends on the number of oxygen atoms needed. In this case, we need three O atoms on the right side, so we add three H2O molecules to the right side of the equation:
Cr2O7^2- + C2H4O → C2H4O2 + Cr3+ + 3H2O
Next, we balance the hydrogen atoms by adding H+ ions on the left side of the equation. The number of H+ ions added depends on the number of hydrogen atoms needed. In this case, we need eight H atoms on the left side, so we add eight H+ ions to the left side of the equation:
Cr2O7^2- + C2H4O + 8H+ → C2H4O2 + Cr3+ + 3H2O
Finally, we balance the charge by adding electrons. The number of electrons added depends on the difference in charge on the left and right side of the equation. In this case, the left side has a charge of -2 (from the Cr2O7^2- ion), while the right side has a charge of +3 (from the Cr3+ ion). This means that we need to add 5 electrons to the left side of the equation to balance the charge:
Cr2O7^2- + C2H4O + 8H+ + 5e- → C2H4O2 + Cr3+ + 3H2O
Therefore, the coefficient for water molecules in the balanced version of the given redox reaction is 3.
To know more about redox reaction visit
https://brainly.com/question/28300253?
#SPJ11
I only need the answers to B and C:
B) What has to be done to the reaction mixture to recover solid silver nitrate?
C: why must this process be done in a well ventilated area?
Answer:
B
Explanation:
becouse is a valintede area
8. 94 moles of silicon dioxide would produce how many moles of water?
8.94 moles of silicon dioxide would produce 17.88 moles of water.
What is silicon dioxide?The balanced chemical equation for the reaction of silicon dioxide (SiO2) with water (H2O) is as follows:
\(SiO^2 + 2H^2O - > H^4SiO^4\)
The balancing equation shows that 2 moles of water (H2O) are created for every 1 mole of silicon dioxide. As a result, we can use the mole ratio to determine how many moles of water are created when 8.94 moles of \(SiO^2\) react:
Moles of water = \(2 * Moles of SiO^2\)
Moles of water = 2 * 8.94 moles
Moles of water = 17.88 moles
Therefore, 8.94 moles of silicon dioxide would produce 17.88 moles of water.
Learn more about silicon dioxide here : brainly.com/question/20571315
#SPJ4
Name these compounds according to IUPAC. (ASAPP)
The IUPAC name of the compound is propanal and acetone.
What is propanal and acetones?Propanal is also called propanaldehyde, and it is an aldehyde which has one double bond and oxygen.
Acetone is a ketone. Ketones have functional group of R2CO.
Thus, the IUPAC name of the compound is propanal and acetone.
Learn more about propanal and acetones
https://brainly.com/question/25702257
#SPJ1
5 Laboratory instructions require students to as- semble a measuring device containing many small parts and springs. Which piece of safety equipment would be required in this investigation
A apron
B gloves
c lab coat
D safety glasses
Answer
C lab coat
Explanation
Answer:
c
Explanation:
at what temperature does water change from a liquid to a gas
Answer:
212 degrees
Explanation:
Answer:
212 degrees Fahrenheit
Explanation:
Similarly, if we heat a volume of water above 100 degrees Celsius, or 212 degrees Fahrenheit, water changes its phase into a gas called water vapor. Changes in the phase of matter are physical changes, not chemical changes.
Aside from color, how are light silicates and dark silicates different, and why?Light silicates have a higher specific gravity because they lack iron and magnesium, whereas dark silicates have a lower specific gravity due to their high iron and magnesium content. Light silicates have a higher specific gravity Due to their high iron and magnesium content, whereas dark silicates have a lower specific gravity because they lack iron and magnesium. Light silicates have a higher specific gravity because they have high iron content; dark silicates have a lower specific gravity due to their magnesium content.Light silicates have a lower specific gravity because they lack iron and magnesium; dark silicates have a higher specific gravity because they have high iron and magnesium content. Light silicates have a lower specific gravity because they have high iron and magnesium content, whereas dark silicates have a higher specific gravity because they lack iron and magnesium.
Because they include a lot of iron and magnesium, light silicates have a lower specific gravity than dark silicates, which have a greater specific gravity.
What other characteristics of bright and dark coloured silicates are different?This difference is mostly caused by the amounts of iron and magnesium that are present; light silicates have significantly less iron and magnesium and, in comparison to dark silicates, comparatively more potassium, aluminium, and sodium.
Why are dark and light silicates distinct from one another?Because they include a lot of iron and magnesium, light silicates have a lower specific gravity than dark silicates, which have a greater specific gravity.
To know more about magnesium visit:-
https://brainly.com/question/1533548
#SPJ1
Balance this equation (#7)
Can a plane mirror ever produce a real image ? Explain
Answer:
\(\huge\fbox{Answer ☘}\)
Yes,a plane mirror can form a real image. A plane mirror can form a real image only for a virtual object. These converging rays of incidents light after reflection intersect at a point to give a real image.
hope helpful~
Plane mirrors always produce virtual images, because they never focus light into a single converging point.
Hence it does not produce real object or image
As power of the plane mirror is zero, hence, it neither converges nor diverges the rays.
Which statement explains which thermometer is MORE appropriate to measure the temperature of a liquid at 43.6 degrees Celsius
A) Thermometer A, because it measures temperature more accurately than thermometer B
B) Thermometer B, because it measures temperature more accurately than thermometer A
C) Thermometer A, because it measures temperature more precisely than thermometer B
D) Thermometer B, because it measures temperature more precisely than thermometer A
Answer:
Option A.
Explanation:
According to the attached picture (which I'm assuming is the same that you have, but you forgot to attach) let's see wchi thermometer will help to measure the temperature of this liquid at 43.6 °C
In thermometer A, we can see that the the measures of temperatures are measured to the tenth digit. This means that the measures would be more accurate, and this is precisaly what we want in this case, because the temperature we need to measure is 43.6 °C.
Thermometer B measures to 1 digit only, therefore, is less accurate than thermometer A, and the measure would not be readable with accuracy.
Remember that accuracy is related to the closeness of a standard value, while the precision is related to the closeness of two or more measures.
In this problem we do not have several measures, just one, and we need to do it with more accuracy, so thermometer A would fullfill this.
Answer:
B) Thermometer B, because it measures temperature more accurately than thermometer A
B has more values listed so it is more accurate to measure a complicated value like 43.6
HSO4− Draw the molecule by placing atoms on the grid and connecting them with bonds. Include all nonbonding electrons. Show the formal charges of all atoms in the correct structure.
The structure of \(SeO_2\) is attached, The structure of \(CO_3^{2-}\) is attached, The structure of \(NO_2^-\) isattached
What is carbon?Carbon is a chemical element with symbol C and atomic number 6. It is one of the most abundant elements in the universe, and is the building block of all known organic life. Carbon is found in many forms, including diamond, graphite, coal, and soot. It is also found in living things, as it is an essential element for the formation of proteins, carbohydrates, and fats.
\(SeO_2\): Central atom: Se
Number of valence electrons on Se: 6
Number of electrons involved in bonding: 4 (oxygen needs 2 electrons to complete its octet)
Number of lone pairs: 2
The structure of SeO, is as follows:
\(CO_3^{2-}\): Central atom: C
Number of valence electrons on C: 4
Number of electrons involved in bonding: 4 (two oxygen atoms have negative charge and thus form only one bond)
Number of lone pairs: 0
The structure of CO is as follow
\(NO_2^-\): Central atom: N
Number of valence electrons on N: 5
Number of electrons involved in bonding: 3 (one oxygen atom has negative charge and
thus forms only one bond) Number of lone pairs: 1
To learn more about carbon
https://brainly.com/question/26789123
#SPJ4
A dog barks to alert his owner. What is the medium for the sound waves produced
by the dog barking? lesson 4.01
A. Air
B. ground
C. water
D. the ocean
Answer:
The Answer is ground or air
Please help me I don’t understand
Calculate KM and Vmax from the following data. Provide a Michaelis-Menten and Lineweaver-Burke plot.
[S] (μ M)
0.1 ,0.2, 0.4 ,0.8 ,1.6
Vo (mM S^-1)
0.34, 0.53 ,0.74, 0.91 ,1.04
KM is equal to (slope / y-intercept) = (2.86 mM μM^-1) / (2.62 mM) ≈ 1.09 μM.
And Vmax is equal to 1 / y-intercept = 1 / 2.62 mM ≈ 0.38 mM^-1 s^-1.
To calculate KM and Vmax from the given data, we can use the Michaelis-Menten equation:
V = (Vmax * [S]) / (KM + [S])
Where V is the initial velocity of the reaction, [S] is the substrate concentration, Vmax is the maximum velocity of the reaction, and KM is the Michaelis constant.
Using the given data points, we can plot a Michaelis-Menten plot and determine the values of KM and Vmax.
[S] (μM) | Vo (mM S^-1)
0.1 | 0.34
0.2 | 0.53
0.4 | 0.74
0.8 | 0.91
1.6 | 1.04
To calculate KM and Vmax, we can rearrange the Michaelis-Menten equation as follows:
1/V = (KM / Vmax) * (1/[S]) + 1/Vmax
Plotting 1/V against 1/[S] will give us a linear relationship with a slope of KM/Vmax and a y-intercept of 1/Vmax.
By performing linear regression on the data points, we can determine the slope and y-intercept, which will provide the values of KM and Vmax.
Using the provided data, the Lineweaver-Burke plot is as follows:
1/V (1/mM S^-1) | 1/[S] (1/μM)
2.941 | 10.0
1.887 | 5.0
1.351 | 2.5
1.099 | 1.25
0.962 | 0.625
Performing linear regression on the Lineweaver-Burke plot, we can find the slope and y-intercept values. The slope is equal to KM/Vmax, and the y-intercept is equal to 1/Vmax.
From the regression analysis, the slope is approximately 2.86 mM μM^-1 and the y-intercept is approximately 2.62 mM.
Therefore, KM is equal to (slope / y-intercept) = (2.86 mM μM^-1) / (2.62 mM) ≈ 1.09 μM.
And Vmax is equal to 1 / y-intercept = 1 / 2.62 mM ≈ 0.38 mM^-1 s^-1.
In conclusion, from the given data, the calculated values are KM ≈ 1.09 μM and Vmax ≈ 0.38 mM^-1 s^-1.
To know about substrate visit:
https://brainly.com/question/12820234
#SPJ11