Answer:
It wouldn't let me post it for some reason. Its all in the picture.
Really hope it helps!!:)
A rocket launches because of __________.
A. an opposite reaction
B. it's large mass
C. its gravity
D. air resistance
Answer:
an opposite reaction
Earth's gravity is still pulling down on the rocket. When a rocket burns propellants and pushes out exhaust, that creates an upward force called thrust. To launch, the rocket needs enough propellants so that the thrust pushing the rocket up is greater than the force of gravity pulling the rocket down.
An electron cannot have the quantum numbers n = ________, l = ________, ml = ________.
A) 2, 0, 0
B) 2, 1, -1
C) 3, 1, -1
D) 1, 1, 1
E) 3, 2, 1
An electron cannot have the quantum numbers n = 1, l = 1, and ml = 1. Therefore, option (D) is correct.
What are the quantum numbers?The set of numbers that can describe the position and energy of a particular electron are known as quantum numbers. Four quantum numbers are principal quantum numbers, azimuthal, magnetic, and spin quantum numbers.
Principal quantum numbers (n) can designate the principal electron shell and the most probable distance between electrons and the nucleus. The azimuthal quantum number (l) can designate the shape of an orbital and has a value equal to n -1.
The magnetic quantum number can designate the total number of orbitals in a particular subshell and the orientation of orbitals. It has value -l to l.
Therefore, n = 1 then l = 0, and ml = 0 as well.
Learn more about quantum numbers, here:
brainly.com/question/16977590
#SPJ1
Which particle changes to create a positive or negative ion of an atom?
A.proton
B. neutron
C. electron
Answer:
it is alkali
Explanation:
hope it helps you
Selective serotonin reuptake inhibitors and tricyclic antidepressants (tcas) both function by which mechanism?
Selective serotonin reuptake inhibitors (SSRIs) and TCAs both increase the levels of neurotransmitters in the brain to improve mood and alleviate symptoms of depression, but they differ in their selectivity and side effect profiles.
Selective serotonin reuptake inhibitors (SSRIs) and tricyclic antidepressants (TCAs) both function by affecting the levels of certain neurotransmitters in the brain to alleviate symptoms of depression.
SSRIs, such as fluoxetine and sertraline, work by selectively inhibiting the reuptake of serotonin, a neurotransmitter involved in mood regulation. By blocking the reuptake process, SSRIs increase the concentration of serotonin in the synaptic cleft, enhancing its transmission and improving mood.
On the other hand, TCAs, like amitriptyline and imipramine, inhibit the reuptake of not only serotonin but also other neurotransmitters like norepinephrine. By blocking the reuptake of these neurotransmitters, TCAs increase their availability in the synaptic cleft, which can help regulate mood and alleviate depressive symptoms.
While both SSRIs and TCAs have similar mechanisms of action in terms of inhibiting the reuptake of neurotransmitters, they differ in their selectivity and side effect profiles. SSRIs are generally preferred due to their relatively fewer side effects and better tolerability.
In summary, SSRIs and TCAs both increase the levels of neurotransmitters in the brain to improve mood and alleviate symptoms of depression, but they differ in their selectivity and side effect profiles.
Learn more about neurotransmitters from given link: https://brainly.com/question/26387085
#SPJ11
Please help, no link please.
Answer:
C if not A
Explanation:
(b) Explain ONE way that Samantha could separate the titanium dioxide from the liquid?
Samantha can separate the mixture of titanium dioxide from the liquid by the method of filtration using a filter paper.
What are mixtures?Mixtures are substances consisting of two or more substances physically mixed together.
Mixtures can be separated by physical methods.
Titanium dioxide and water is a mixture.
Since titanium dioxide is insoluble in water, it can be easily separated by filtration.
Therefore, Samantha can separate the titanium dioxide from the liquid by the method of filtration using a filter paper.
Learn more about filtration at: https://brainly.com/question/552187
#SPJ1
A stick of butter is melted in a saucepan. As it continues to cook, the butter turns brown. What changes have occurred?
Answer:
Assuming that the butter is already a liquid, it is a chemical change in which the milk solids of the butter oxidize.
Explanation:
I hope this helps :)
Chemical changes have occurred as the stick of butter melts as the milk solids present in butter undergo oxidation resulting in formation of new substances.
What are chemical changes?Chemical changes are defined as changes which occur when a substance combines with another substance to form a new substance.Alternatively, when a substance breaks down or decomposes to give new substances it is also considered to be a chemical change.
There are several characteristics of chemical changes like change in color, change in state , change in odor and change in composition . During chemical change there is also formation of precipitate an insoluble mass of substance or even evolution of gases.
There are three types of chemical changes:
1) inorganic changes
2)organic changes
3) biochemical changes
During chemical changes atoms are rearranged and changes are accompanied by an energy change as new substances are formed.
Learn more about chemical changes,here:
https://brainly.com/question/23693316
#SPJ5
How does a longshore current change the beach
Answer:
As this sheet of water moves on and off the beach, it can “capture” and transport beach sediment back out to sea. This process, known as “longshore drift,” can cause significant beach erosion.
What is family and it's importance
Answer:
FAMILY:Family is defined as a specific group of people that may be made up of partners, children, parents, aunts, uncles, cousins and grandparents. An example of a family is a set of parents living with their children. The definition of family is the group of people who share common ancestors.
IMPORTANCE:Family is very important part of our everyday life. It helps us in improving our personality. It also helps us in shaping our life. It teaches us the value of love, affection, care, truthfulness and self-confidence and provides us tools and suggestions which are necessary to get success in life. Family is a place where you can be yourself. It is a place where you are accepted for what you are. This is where you are completely tension free and everyone is there to help you. Family encourages you when you are surrounded by problems. It helps you survive through tough times and bring joy and happiness into life.
A chemical property is _______________.
Answer:
Explanation:
chemical bonds between atoms are formed or broken.
Still stuck? Get 1-on-1 help from an expert tutor now.
Atoms of the same element, Zinc for example, have the same number of ______.
answer choices
Electrons in the valence bond level.
Electrons in the nucleus
Neutrons in the outer nuclear shell
Protons in the nucleus
What is the molarity of 3 mole of hydrochloride acid in 3 L of water ?
Answer:
1
Explanation:
Formula of molarity is
\(M=\frac{n}{v}\)
M= molarity
n= no of moles
v= volume in liters (if mL then you have to convert it to L)
Laura has three beakers. Each contains 200 cm³ of a colourless liquid. Describe how Laura could find out which beakers contain pure water, and which contain solutions. Explain your answer.
Laura could use a few different methods to determine which beakers contain pure water and which contain solutions. One method is to test the boiling point of each liquid. Pure water boils at 100 degrees Celsius at standard pressure. If the liquid in a beaker boils at a temperature higher than 100 degrees Celsius, it is likely a solution and not pure water. Another method is to test the freezing point of each liquid. Pure water freezes at 0 degrees Celsius at standard pressure. If the liquid in a beaker freezes at a temperature other than 0 degrees Celsius, it is likely a solution and not pure water.
Another method is through density test. Pure water has a density of 1g/cm³ at 4°C. Laura can use a hydrometer, which is an instrument that measures the density of a liquid to check if the density of the liquids in the beakers is equal to 1g/cm³. If it is not, then it is not pure water.
Additionally, Laura could also test the conductivity of the liquids. Pure water is a poor conductor of electricity, whereas solutions can conduct electricity. Laura could use a conductivity meter to check the conductivity of the liquids. If a liquid conducts electricity, then it is likely a solution and not pure water.
Finally, Laura could also use a refractometer, which measures the refractive index of the liquid. The refractive index of pure water is 1.333 and any deviation from this value indicates the presence of dissolved solutes.
It's important to notice that no single test can confirm that a liquid is pure water, but a combination of tests can give us a strong indication of it.
Which part of this weak acid titration, would it be appropriate to predict/calculate the pH using an ICE table and K?
To predict/calculate the pH of a weak acid titration using an ICE table and K, you would typically use the equilibrium point of the titration when the weak acid is partially neutralized by a strong base.
The solution contains a mixture of the weak acid and its conjugate base, and you can use the acid dissociation constant (K_a) of the weak acid to calculate the pH.
To set up the ICE table, you would first write the balanced chemical equation for the reaction between the weak acid and the strong base. For example, if the weak acid is acetic acid (CH3COOH) and the strong base is sodium hydroxide (NaOH), the reaction would be:
CH3COOH + NaOH → CH3COONa + H2O
Next, you would write the equilibrium expression for the dissociation of the weak acid:
K_a = [CH3COO-][H3O+]/[CH3COOH]
Then, you would set up the ICE table to determine the equilibrium concentrations of the species in the reaction mixture. The ICE table would look like this:
CH3COOH NaOH CH3COONa H2O
Initial [HA] [OH-] 0 0
Change -x -x +x +x
Equil. [HA]-x 0 x x
In this table, [HA] represents the initial concentration of the weak acid, [OH-] represents the concentration of the strong base added, [CH3COO-] represents thez of the conjugate base of the weak acid formed, and [H3O+] represents the concentration of hydronium ions formed by the partial dissociation of the weak acid.
From the ICE table, you can determine the equilibrium concentration of hydronium ions ([H3O+]) by using the equilibrium expression for K_a and solving for [H3O+]. Once you have calculated the concentration of [H3O+], you can use the pH formula (-log[H3O+]) to find the pH of the solution at the equilibrium point of the titration.
Click the below link, to learn more about Titration:
https://brainly.com/question/31229711
#SPJ11
Question 11
Which formula represents a hydrocarbon?
C₂H6
C₂H5OH
C₂H5Cl
C₂H6O
Answer:
C₂H6
Explanation:
Among the given options, the formula A) C₂H6 represents a hydrocarbon (specifically, ethane). Option A
A hydrocarbon is a compound that consists of only carbon and hydrogen atoms. It is important to identify the formula that represents a hydrocarbon among the given options:
A) C₂H6: This formula represents ethane, which is a hydrocarbon. Ethane consists of two carbon atoms bonded together with single bonds and six hydrogen atoms.
B) C₂H5OH: This formula represents ethanol, which is not a hydrocarbon. Ethanol contains a hydroxyl group (-OH), indicating the presence of oxygen in addition to carbon and hydrogen atoms. It is an alcohol, not a hydrocarbon.
C) C₂H5Cl: This formula represents ethyl chloride, which is not a hydrocarbon. Ethyl chloride contains a chlorine atom (Cl) in addition to carbon and hydrogen atoms. It is a haloalkane, not a hydrocarbon.
D) C₂H6O: This formula represents ethanol, which, as mentioned before, is not a hydrocarbon. Ethanol contains an oxygen atom (O) in addition to carbon and hydrogen atoms. It is an alcohol, not a hydrocarbon.
Among the given options, the formula A) C₂H6 represents a hydrocarbon (specifically, ethane). It consists only of carbon and hydrogen atoms, making it a suitable representation of a hydrocarbon.
In summary, the formula C₂H6 (option A) represents a hydrocarbon, while the other options contain additional elements (oxygen or chlorine) that make them non-hydrocarbon compounds. Option A
For more such questions on hydrocarbon visit:
https://brainly.com/question/21281906
#SPJ8
a solution of cacl2 in water forms a mixture that is 28.0% calcium chloride by mass. if the total mass of the mixture is 663.2 g, what masses of cacl2 and water were used?
The mass of calcium chloride and water used to form a 28.0% calcium chloride solution with a total mass of 663.2 g are 189.54 g and 473.66 g, respectively.
Then find the masses of calcium chloride and water used to form the solution, we first need to determine the mass of calcium chloride in the solution. Since the solution is 28.0% calcium chloride by mass, we can calculate the mass of calcium chloride as follows:
Mass of calcium chloride = 0.28 x 663.2 g = 185.62 g
Next, we can use the mass of calcium chloride to calculate the mass of water in the solution:
Mass of water = Total mass - Mass of calcium chloride
Mass of water = 663.2 g - 185.62 g
Mass of water = 477.58 g
Therefore, the mass of calcium chloride and water used to form the solution are 189.54 g and 473.66 g, respectively.
Learn more about chloride
brainly.com/question/32108518
#SPJ11
The fastest train in the world can travel 1,500 kilometers in 3 hours. What is its speed?
Sample
Pre-1982
Post-1982
Number of
Pennies
8
12
Abundance
(%)
40
[?]
Average
Mass (g)
3.1
2.5
What is the percent abundance of post-1982
pennies in the data sample?
Post-1982 % Abund.
Enter
The percent abundance of post-1982 pennies in the sample is 60% as per the given data.
What is data sample?Data sampling is a statistical analysis technique that uses a representative subset of data points to identify patterns and trends in the larger data set under consideration.
To find the percent abundance of post-1982 pennies in the sample data, we need to determine the total number of pennies and the number of post-1982 pennies.
The total number of pennies is:
8 + 12 = 20
To find the number of post-1982 pennies, we need to know the total mass of the pennies. We can use the average mass of the pre-1982 and post-1982 pennies to estimate the number of post-1982 pennies.
The total mass of the pre-1982 pennies is:
8 x 3.1 g = 24.8 g
The total mass of the post-1982 pennies is:
12 x 2.5 g = 30 g
The total mass of all the pennies is:
24.8 g + 30 g = 54.8 g
We can estimate the number of post-1982 pennies by dividing the total mass of the post-1982 pennies by the average mass of a post-1982 penny:
30 g / 2.5 g = 12
So there are 12 post-1982 pennies in the sample.
To find the percent abundance of post-1982 pennies, we can use the following formula:
Percent abundance = (number of post-1982 pennies / total number of pennies) x 100%
Percent abundance = (12 / 20) x 100% = 60%
Therefore, the percent abundance of post-1982 pennies in the sample is 60%.
For more details regarding sample, visit:
https://brainly.com/question/13287171
#SPJ5
pls help ill mark you as brainliest
Answer:
Explanation:
Synthesis- D
Combustion- C
Decomposition- A
Single Displacement- C
Double Displacement- B
Explain why acetic acid, HC₂H3O2, is defined as an acid and describe both conceptually and using a
chemical equation what happens when HC₂H3O2, a weak acid, reacts with sodium hydroxide, NaOH, a
strong base.
Complete the following statement: In Charles's law, the volume of a gas ____ when the ____ decreases (A) increases, temperature (B) increases, quantity of gas (C) increases, pressure (D) decreases, temperature (E) decreases, pressure
(D) decreases, temperature
Explanation:Ideal gas laws allow us to make assumptions about how gases will react under certain conditions.
Charles' Law
Charles' law relates a gas' volume with its temperature. The law states that changes in volume and temperature are directly proportional. This means that as one increases, so does the other, and vice versa. Mathematically, this law is represented as:
\(\displaystyle \frac{V_{1} }{T_{1} }=\frac{V_{2} }{T_{2} }\)Other Ideal Gas Laws
There are 4 other ideal gas laws: Boyle's, Gay-Lussac's, and Avagadro's. When all of these laws are combined, we are left with the ideal gas equation:
PV = nRTWhere P is pressure, V is volume, n is moles of gas, R is a constant known as the gas constant, and T is temperature. This equation combines all of the laws and helps explains how gases act when placed in a specific condition. For example, the equation shows that if P increases, then V will decrease to maintain equality.
Identify substituents on product E q11 A. 2 x -CO2H group and 1 x -SO3H group B. no substituent, only H C. 2 x -SO3H group and 1 x -CO2H group D. 2 x -SO3H group E. 2 x - CH2CH3 group and 1 x -SO3H group
Everything is predicated on benzenation, and the replacement location depends on when benzene is in an electron-rich or electron-deficient position.
Who or what is an electron?A opposite charges new particle known as an electron can either be free or attached to an atom (not bound). Each of the three main types of elements within an element is an electrode that is bonded to it; its other pair are protons plus neutrons.
Where can you find electrons?Electrons are present outside the atom's nucleus, in contrast to protons and neutrons which are contained from the inside of the nucleus at its center. Negative electrons are drawn to the positively charged nucleus because the electric charges of opposite polarity attract one another.
To know more about electron visit:
https://brainly.com/question/18367541
#SPJ4
ASAP! What is the total number of electrons that can occupy the f sublevel? a 2 electrons b 6 electrons c 10 electrons d 14 electrons
Answer:
D) 14 Electrons
Explanation:
I took the test and got it right
The total number of electrons that can occupy the f sublevel is 14 electrons. Thus option D is correct.
What are electrons?Electrons can be defined as a negatively charged subatomic particle that together with protons and neutrons forms an atom's nucleus. It is the lightest subatomic particles.
s orbital has 2 electrons in pair
p orbital has 6 electrons in pair
d orbital has 10 electrons in pair
f orbital has 14 electrons in pair.
Thus, the total number of electrons that can occupy the f sublevel is 14 electrons. Thus option D is correct.
To learn more about electrons, refer to the link below:
https://brainly.com/question/1255220
#SPJ2
A sulfur atom has 16 protons and 16 electrons. If you add a proton to a sulfur atom, what have you done? Created an isotope of sulfur. Created a positively charged ion of sulfur. Created a negatively charged ion of sulfur. Converted the atom into a different element.
Answer:
Created a positively charged ion of Sulfur
Explanation:
As the number of protons in Sulfur is more than the electrons in Sulfur, thus it'll be a positively charged ion of Sulfur
The addition of a proton to the sulfur atom has resulted in the formation of an isotope. Thus, option A is correct.
The addition of a proton to the nucleus has been resulted in the change in the atomic mass of the element without changing the atomic number.
The atomic mass has been the number of protons and neutrons present in the nucleus. The ions have been resulted when there has been a change in the number of electrons in the atom.
The isotopes have been the element that has been considered of the same atomic number with different atomic masses. The addition of a proton to the sulfur atom changes its atomic mass and thereby forms the isotope of sulfur. Thus, option A is correct.
For more information about the protons and electrons, refer to the link:
https://brainly.com/question/803445
Heat is a form of electromagnetic energy known as ___________ radiation.
Answer:
It is infrared radiation that produce the warm feeling on our bodies.
Explanation:
Hope this helps ! =D
Brainliest please! =D
2K(5) + Cl2(g) → 2KCI(S)
what type of chemical reaction is this
Answer:
Synthesis Chemical Reaction
Explanation:
A+B -> AB
why do organisms need to respond to their environment
I Hope this will Help You:-
Organisms need to detect and respond to changes in their internal and external environment. This is because the conditions inside our body must be carefully controlled for it to function effectively and survive. The control systems that allow organisms to respond to changes are incredibly important.
The elements of the group IA are termed as alkali metals, because their ___ are alkaline.
The answer is hydroxides.
The elements of the group IA are termed as alkali metals, because their hydroxides are alkaline.
what are the formulas of the acids:
AsO4
CIO4 ( l )
S ( ll )
F ( l )
PO4 (lll)
if matter cant be created nor be destroyed so how was the universe was formed
Answer: By the very laws of the universe, matter cannot be created or destroyed, the Big Bang cannot have happened by its own power. There was a creator involved.