Answer:
A. Hund's rule has been violated
Explanation:
There must be one electron with the same spin in each orbital of the same energy before you can put two in the same orbital. In the photo, the 2s sublevel is completely filled before the 1s sublevel (if anything the 1s should have an up spin and down spin, with the 2s having one up spin).
From the figure , it can be concluded that Hund's rule is violated as 1s sub shell is not completely filled before moving to the 2s sub shell.
What is Hund's rule ?Hund's rule of maximum multiplicity is an atomic rule which is based on the observation of atomic spectra and is used for prediction of ground state of an atom or molecule which have one or more open electronic shells.
It states that, for a given electronic configuration lowest energy term is the one which has greatest value of multiplicities of spin. It implies to the fact that if two orbitals are present which are of equal energy, electrons will occupy them singly before pairing of electrons take place.
The rule finds tremendous use in atomic chemistry,spectroscopy and quantum chemistry.
Learn more about Hund's rule here:
https://brainly.com/question/12646067
#SPJ2
Identity the step that is not part of the scientific method.
Options:
conduct an experiment
form a hypothesis
draw a conclusion
state the cause
Answer:
'State the cause' is not part of the scientific method.
Explanation:
The scientific method has three wholistic steps:
Test the hypothesisMake observations from the experiment to the hypothesisDraw a conclusion or prediction from the experimental results.A cause is neither a scientific term nor is it part of the processes of experimentation.
I hope this was helpful.
What is the maximum mass of S8 that can be produced by combining 83.0 g of each reactant?
8SO2+16H2S⟶3S8+16H2O
Explanation:
Find number of moles in each reactant
SO2 moles=83/64 mol
H2S moles=83/34 mol
SO2 : H2S
8 : 16
1 : 2
(83/64) mol : (83/64)×2 mol
we need (83/32) moles of H2S to fully react with SO2
no of H2S moles needed to fully react with SO2> no of H2S moles involved in the reaction
83/32 mol> 83/34 mol
so we can see that H2S is the Limiting reagent
we should calculate no of product moles created from the reaction according to
Limiting reagent
H2S : S8
16.:3
1. :3/16
(83/34): 83/34×3/16
Molar mass of S8
=32×8
=256gmol-1
Maximum mass of S8 produced from the reaction;
n=m/M
m=(249/544)×256
=117.17 g
A rabbit has a mass of 2kg. What is its weight
Answer:
weight = Mass × gravity
P= m × g
P=mg
Weight (P) = ? , Mass (m) = 2 kg , gravity (g) = 9.8 m/s²
P= mg
p = 2 × 9.8
P= 19.6 kg.m/s²
P= 19.6 N
I hope I helped you^_^
4.1) An acid, H₂A, reacts with sodium hydroxide as shown in the equation below.
H₂A(aq) + 2NaOH(aq) → 2Na*(aq) + A²- (aq) + 2H₂O(1)
A solution of this acid was prepared by dissolving 2.02 g of H₂A in water and making the volume up to 250
cm³ in a volumetric flask.
A 25.0 cm³ sample of this solution required 22.80 cm³ of 0.150 mol dm3 aqueous NaOH for complete
reaction. Calculate the relative molecular mass, Mr, of H₂A
The relative molecular mass of the acid, H₂A, given that it required 22.80 cm³ of 0.150 moldm⁻³ aqueous NaOH for complete reaction is 1181.29 g/mol
How do I determine the molar mass of the acid, H₂A?We'll begin by obtaining the number of mole of the acid that reacted. Details below:
Volume of NaOH (n) = 22.80 cm³ = 22.80 / 1000 = 0.0228 dm³Molarity of NaOH (M) = 0.150 moldm⁻³Mole of base, NaOH = n × M = 0.150 × 0.0228 = 0.00342 moleNumber of mole of acid, H₂A =?H₂A(aq) + 2NaOH(aq) → 2Na*(aq) + A²⁻(aq) + 2H₂O(l)
From the balanced equation above,
2 moles of NaOH reacted with 1 mole of H₂A.
Therefore,
0.00342 mole of NaOH will react with = 0.00342 / 2 = 0.00171 mole of H₂A
Finally, we shall determin what molar mass of the acid, H₂A. Details below:
Mole of acid, H₂A = 0.00171 moleMass of acid, H₂A = 2.02 gMolar mass of acid, H₂A =?Molar mass = mass / mole
Molar mass = 2.02 / 0.00171
Molar mass = 1181.29 g/mol
Thus, the molar mass of the acid, H₂A is 1181.29 g/mol
Learn more about molar mass:
https://brainly.com/question/15874532
#SPJ1
The bright-line spectra of four elements, G,J, L, and M, and a mixture of at
least two of these elements are given below.
Which elements are present in the mixture?
M
Mixture
750
750
G and J
G and L
M, J, and G
M, J, and L
700
700
650
650
Bright-Line Spectra
600
600
550 500
550
Wavelength (nm)
500
450
450
400
400
.
Based on the given bright-line spectra and the observed wavelengths in the mixture's spectrum, the elements G and J are the ones present in the mixture.
From the given bright-line spectra and the spectrum of the mixture, we can determine the elements present in the mixture by comparing the specific wavelengths observed. Examining the bright-line spectra, we can identify that G has a distinct wavelength at 650 nm, J at 600 nm, L at 550 nm, and M at 500 nm.
Looking at the spectrum of the mixture, we can observe two prominent wavelengths, 650 nm and 600 nm. These correspond to the wavelengths of G and J, respectively. Since the spectrum of the mixture does not exhibit the wavelengths specific to L (550 nm) or M (500 nm), we can conclude that only G and J are present in the mixture.
Therefore, based on the given bright-line spectra and the observed wavelengths in the mixture's spectrum, the elements G and J are the ones present in the mixture.
This analysis relies on the principle that each element has characteristic wavelengths at which they emit light. By comparing the observed wavelengths in the mixture's spectrum with those of the individual elements, we can determine the elements present in the mixture.
Know more about wavelengths here:
https://brainly.com/question/10750459
#SPJ8
Solve the following equation for
x. 4x+6=-10
\(\\ \sf\longmapsto 4x+6=-10\)
\(\\ \sf\longmapsto 4x=-10-6\)
\(\\ \sf\longmapsto 4x=-16\)
\(\\ \sf\longmapsto x=\dfrac{-16}{4}\)
\(\\ \sf\longmapsto x=-4\)
4x + 6 = - 10
4x = -10-6
4x = -16
x = -16/4
× = -4
Need answers asap!!!!!!!!!
The water cycle, also known as the hydrologic cycle, is the continuous movement of water on, above, and below the surface of the Earth.
What is the water cycle?The water cycle involves a series of physical processes, including evaporation, condensation, precipitation, and runoff, that work together to move water from one location to another and to maintain the balance of water on Earth.
The water cycle begins when water from oceans, lakes, rivers, and other bodies of water evaporates into the atmosphere due to the heat from the sun. As water vapor rises into the atmosphere, it cools and condenses into clouds. When the clouds become saturated with water vapor, precipitation occurs in the form of rain, snow, sleet, or hail.
Learn more about water cycle:https://brainly.com/question/31195929
#SPJ1
Convert 0.0338 moles of K3PO4 to grams.
What did Henry Moseley change about Mendeleev's Periodic table?
O He ordered the elements by atomic mass.
O He ordered elements with similar properties into columns.
O He ordered elements with similar properties into rows
O He filled in blanks by discovering new elements.
Answer: A. He Ordered them by atomic mass.
Explanation:
[H3O+] = 3.6 x 10-2 M
Answer:
om pH
The hydronium ion concentration can be found from the pH by the reverse of the mathematical operation employed to find the pH. [H3O+] = 10-pH or [H3O+] = antilog (- pH) Example: What is the hydronium ion concentration in a solution that has a pH of 8.34?
Explanation:
2. Which number is not a coefficient in the equation,
2C6H14+ 19O2,-- 12CO2,+ 14H2O?
Answer:
2, 19, 12 and 14 are the coefficients.
What is the temperature (in Kelvin) of a sample of neon with an rms speed of 500.0 m/s?
Answer: Approximately 267.5 Kelvin
Explanation:
To find the temperature of a sample of neon with an rms speed of 500.0 m/s, we can use the following formula that relates the root mean square (rms) speed of gas molecules to their temperature:
v_rms = sqrt((3kT) / m)
where v_rms is the rms speed of the gas molecules, k is the Boltzmann constant, T is the temperature in Kelvin, and m is the mass of a single gas molecule.
For neon, the mass of a single molecule is approximately 20.18 atomic mass units (u), which is equivalent to 3.35 x 10^-26 kg.
Substituting the given values into the formula, we get:
500.0 m/s = sqrt((3kT) / (3.35 x 10^-26 kg))
Solving for T, we get:
T = (m / (3k)) * v_rms^2
T = (3.35 x 10^-26 kg / (3 * 1.38 x 10^-23 J/K)) * (500.0 m/s)^2
T ≈ 267.5 K
Therefore, the temperature of the neon sample with an rms speed of 500.0 m/s is approximately 267.5 Kelvin.
Consider the following reaction: 2N2O5(g) → 4NO2(g) + O2(g) Calculate the volume N2O5 that must decompose completely to produce 9.64 L nitrogen dioxide.
The volume of \(N_2O_5\) needed to produce 9.64 L of \(NO_2\) is 4.97 L, calculated using stoichiometry and the ideal gas equation.
The given chemical equation is \(2N_2O_5(g) \rightarrow 4NO_2(g) + O_2(g)\) .The volume of \(N_2O_5\) that decomposes completely to form 9.64 L of \(NO_2\) is to be calculated. For this, we can use the concept of stoichiometry. Stoichiometry is a branch of chemistry that deals with the quantitative relationships between reactants and products in a balanced chemical equation.To calculate the volume of \(N_2O_5\) that is needed to produce 9.64 L of \(NO_2\), we will first determine the number of moles of NO2 produced in the reaction. For this, we can use the ideal gas equation, PV = nRT. Here, we have the volume of NO2 and we can assume the pressure and temperature to be constant. Thus, we have PV = nRT, where P = pressure, V = volume, n = number of moles, R = ideal gas constant, and T = temperature. Substituting the given values in the ideal gas equation, we get,n = PV/RT = (1 atm × 9.64 L)/(0.0821 L atm K-1 mol-1 × 300 K) = 0.404 molFrom the chemical equation, we see that 2 moles of \(N_2O_5\) give 4 moles of \(NO_2\). Thus, 0.404 mol of \(NO_2\) must have been produced from (0.404/2) = 0.202 mol of \(N_2O_5\). Using the ideal gas equation, we can also find the volume of 0.202 mol of \(N_2O_5\) at the given conditions. Thus, V = nRT/P = (0.202 mol × 0.0821 L atm K-1 mol-1 × 300 K)/1 atm = 4.97 L. Thus, the volume of \(N_2O_5\) that must decompose completely to produce 9.64 L nitrogen dioxide is 4.97 L.For more questions on stoichiometry
https://brainly.com/question/14935523
#SPJ8
Chemistry Lab Determination of the Universal Gas Constant (R)
SHOW ALL WORK
Given:
Initial mass of butane lighter: 54.24g
Final Mass of Butane Lighter: 54.01g
Temperature of water: 23.0°C
Volume of gas collected: 100.0mL
FIND:
Barometric pressure of room: 766.86 mmHg CONVERTED TO atm
Vapor pressure of water at room temperature(PH2O) (IN atm)
FIND:
Mass difference if butane lighter in grams
Moles of Butane gas collected in moles of C4H10
Partial pressure if butane gas in atm
Converted temperature of water in Kelvin
Converted volume of gas collected in Liters
Experimental value of R in Latm/molk
Accepted value of R in Latm/molk
Percent error in experimental value of R in %
CONCLUSION QUESTIONS:
1. List at least 3 factors that either did it could contribute to the percent error
2. Should the value of R go up or down if the gas had not been corrected for the partial pressure of water. Why?
3. How could this experiment be repeated to increase the accuracy, or in other words, decrease the percent error?
NOTE: LET ME KNOW IF YOU WANT A PICTURE OF THE LAB INSTRUCTIONS TO HELP SOLVE
ALSO SHOW ALL WORK PLS
To solve this problem, I'll need some additional information related to the molar mass of butane (C4H10). Please provide the molar mass of butane so that I can proceed with the calculations.
Two solutions are separated by a semipermeable membrane. On one side of the semipermeable membrane is a 1.5 M NaCl solution. On the other side of the membrane there is a 0.5 M KBr solution. Which statement describes the direction water will flow?
If two solutions are separated by a semipermeable membrane with one side 1.5 M NaCl solution and other side 0.5 M KBr solution. Here water will flow from the KBr solution to the NaCl solution because of the water concentration difference.
When two solutions are separated with a semipermeable membrane, the water will flow from lower solute concentrated side to higher solute concentrated side.
Lower solute concentration means the water content will be high and that states higher water concentration.
Higher solute concentration means the water content will be low and that states low water concentration.
The water will flow from higher concentration to lower till the equilibrium where both sides the water and solute concentration is same.
In this case, the lower solute concentration is the 0.5 M KBr solution and the higher solute concentration is the 1.5 M NaCl solution.
Therefore, water will tend to flow from the KBr solution to the NaCl solution.
Learn more about concentration:
https://brainly.com/question/12417124
#SPJ4
What are the correct coefficients in order for the equation to be balanced ?
Answer:
1. 2
2. 2
3. 3
Explanation:
That's my answer
Choose the answer that shows the following number correctly
written in scientific notation.
430,000
a 4.3 x 104
b 43 x 104
C 0.43 x 106
d 4.3 x 105
What is the concentration of chloride ions when 2.5 g FeCl is dissolved in 150 mL water?
The concentration of chloride ions when 2.5 g of FeCl is dissolved in 150 mL of water is approximately 0.54 M.
To determine the concentration of chloride ions when 2.5 g of FeCl is dissolved in 150 mL of water, we need to consider the molar mass of FeCl and perform some calculations.
The molar mass of FeCl is 55.85 g/mol (for iron) + 35.45 g/mol (for chlorine), which gives a total molar mass of 91.3 g/mol for FeCl.
First, we need to calculate the number of moles of FeCl present in 2.5 g of the compound. This can be done using the formula:
moles = mass / molar mass
moles of FeCl = 2.5 g / 91.3 g/mol = 0.027 moles
Next, we convert the volume of water from milliliters (mL) to liters (L):
volume of water = 150 mL = 150/1000 L = 0.15 L
Now, we can calculate the concentration of chloride ions (Cl-) using the formula:
concentration (Cl-) = moles of Cl- / volume of water
Since FeCl dissociates into one Fe3+ ion and three Cl- ions, the number of moles of Cl- is three times the moles of FeCl:
moles of Cl- = 3 * moles of FeCl = 3 * 0.027 moles = 0.081 moles
concentration (Cl-) = 0.081 moles / 0.15 L = 0.54 M.
For more such questions on concentration visit:
https://brainly.com/question/28564792
#SPJ8
Write the first step of this elimination using curved arrows to show electron reorganization. Remember that a mechanism step may require more than one curved arrow.
Answer:
Explanation:
The missing image can be seen below.
From the given information:
The elimination process follows E2 mechanism which is a 2nd order kinetics.
At E2 mechanism, the base attaches with the beta hydrogen while also removing the leaving group in the same process. In the given compound 2-chloro-2-methylpropane, chloride is the leaving group that results in the product; 2-methylprop-1-ene.
The mechanism is seen in the second image,
The graph shows five data points collected in an investigation of the relationship between the concentration of alcohol dissolved in water and its density. The relationship was expected to be linear. Which of the data points most likely resulted from an error in procedure? a 1 b 2 c 4 d 5
In comparison to modern, highly accurate density meters or pycnometers, hydrometers are far less accurate and temperature.
Thus, Although they require very large sample sizes, hydrometers are rather simple to operate. Usually, 300 to 500 ml per measurement are required. Hydrometers frequently require calibration off-site as well.
With measurements taken by eye, user error is a major issue, and temperature management is especially challenging. Inaccurately bringing and maintaining samples at temperature might take a long time, and once more, user perception of temperature levels is used to determine temperature levels.
Pycnometers and hydrometers have a further problem in that the findings of alcohol measurement are challenging to evaluate and record.
Thus, In comparison to modern, highly accurate density meters or pycnometers, hydrometers are far less accurate and temperature.
Learn more about Temperature, refer to the link:
https://brainly.com/question/7510619
#SPJ1
Use what you know about valence electrons and the octet rule to explain why alkali
metals are more likely to lose electrons than gain them.
HELPPPPP (100 POINTS)
Assume that the water stream is replaced by a stream of CCl4. Predict what would happen in each case.
a. charged acetate strip:
b. charged vinyl strip:
c. Explain your predictions.
Answer:c
Explanation:c
Which of the following does NOT demonstrate the law of conservation of matter?
check all that apply
The one that does not demonstrates the law of conservation of matter would be the third option: \(2NO_2 + H_2O -- > HNO_3 + HNO_2\)
What is law of conservation of matter?It is a law that explains that matters are conserved during the course of chemical reactions. They can neither be destroyed nor created.
Thus, the number of moles of the species in a reaction remains the same before and after the reaction.
Thus, an equation that demonstrates the law of conservation of matter will be balanced in terms of the number of moles of species.
The only equation, in this case, is \(2NO_2 + H_2O -- > HNO_3 + HNO_2\)
There are 3 oxygen species on the reactant while 5 are present on the product side.
More on the law of conservation of matter can be found here: https://brainly.com/question/9434062
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
write the number represented by the following prefixes of tera?
Tera is 1 trillion
1 trillion has 12 zeros
10^12
How do you think the electrons, and the way the electrons are bonded or transfered,
affect how the two compounds dissolve?
Answer:
the electron will be drawn more toward the atom with the higher e lectronegativity resulting in a polar covalent bond.
Explanation:
When atoms of different elements share electrons through covalent bonding, the electron will be drawn more toward the atom with the higher e lectronegativity resulting in a polar covalent bond. When compared to ionic compounds, covalent compounds usually have a lower melting and boiling point, and have less of a tendency to dissolve in water.
QUESTION TO
What would I have to change to have a lunar eclipse happen every month?
You would have to fix the tilt of the Moon's orbit and make the Moon orbit planet Earth within the same plane that the Earth orbits the Sun.
What is a lunar eclipse?A lunar eclipse can be defined as a phenomenon which occurs when the planet Earth comes in between the Moon and the Sun, thereby causing the Earth to cover the Moon with its shadow.
In order to have a lunar eclipse occur every month, you would have to fix the tilt of the Moon's orbit and make the Moon orbit planet Earth within the same plane that the Earth orbits the Sun, so as to block any ray of sunlight from reaching the Moon.
Read more on lunar eclipse here: https://brainly.com/question/17067406
#SPJ1
At 1115 degrees Celcius, where iron is still a solid (melting point 1538 degrees Celcius), the unit cell for the most stable crystal lattice of the metal is face- centered cubic (fcc) with an edge length of 362 pm. What is the atomic radius of iron at this temperature?
Answer: The atomic radius of iron is 128 pm.
Explanation:
To calculate the radius of the metal having FCC crystal lattice, the relationship between edge length and radius follows:
\(4r=\sqrt{2}a\)
Where,
a = edge length = 362 pm
r = atomic radius of iron = ?
Plugging values in above equation, we get:
\(r=\frac{\sqrt{2}\times 362}{4}\\\\a=128pm\)
Hence, the atomic radius of iron is 128 pm.
Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K
At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
1: Write the balanced chemical equation:
\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)
2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.
Initial:
\(C_O\)(g) = 0.3500 mol
\(Cl_2\)(g) = 0.05500 mol
\(C_OCl_2\)(g) = 0 mol
Change:
\(C_O\)(g) = -x
\(Cl_2\)(g) = -x
\(C_OCl_2\)(g) = +x
Equilibrium:
\(C_O\)(g) = 0.3500 - x mol
\(Cl_2\)(g) = 0.05500 - x mol
\(C_OCl_2\)(g) = x mol
3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:
Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]
4: Substitute the given equilibrium constant (Kc) value into the expression:
1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)
5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:
1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x
6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.
7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.
8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):
\(Cl_2\)(g) = 0.05500 - x
9: Calculate the value of \(Cl_2\)(g) at equilibrium:
\(Cl_2\)(g) = 0.05500 - x
\(Cl_2\)(g) = 0.05500 - (positive value of x)
10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.
Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
For more such questions on equilibrium, click on:
https://brainly.com/question/517289
#SPJ8
Determine the volume of 15.5 g of a substance with a density of 6.89 g/ml
Answer:
The answer is 2.25 mLExplanation:
The volume of a substance when given the density and mass can be found by using the formula
\(volume = \frac{mass}{density} \\ \)
From the question
mass = 15.5 g
density = 6.89 g/mL
We have
\(volume = \frac{15.5}{6.89} \\ = 2.249637155...\)
We have the final answer as
2.25 mLHope this helps you