What is another way to describe the vector below?
"40 feet to the right"
A. 40 feet to the left
B. -40 feet to the left
C. -40 m to the left
D. 40 m to the left

Answers

Answer 1

Answer:

-40 feet to the left

Explanation:

opposite of 40 feet from right is -40 to left

Answer 2

Answer:

B. -40 feet to the left


Related Questions

A body of mass 0.1 kg is moving in a uniform horizontal circular path with a speed of 2 m/s, so the magnitude of change in its momentum after completing half a revolution equals (a) zero (b)60.2 kg.m/s (c) 0.4 kg.m/s (d)0.8 kg.m/s​

Answers

The magnitude of the change in momentum after completing half a revolution is zero,The correct answer is option(a).

To determine the magnitude of the change in momentum after completing half a revolution, we need to consider the principles of circular motion and conservation of momentum.

The change in momentum of an object is given by the equation Δp = mΔv, where Δp represents the change in momentum, m is the mass of the object, and Δv is the change in velocity.

In this scenario, the body of mass 0.1 kg is moving in a uniform circular path with a speed of 2 m/s. Since the speed remains constant, there is no change in velocity during the circular motion. Therefore, Δv is equal to zero.

Applying the equation Δp = mΔv, we find that Δp = (0.1 kg)(0) = 0 kg·m/s.

It's important to note that while the body is continuously changing its direction during the circular motion, the magnitude of its velocity remains constant. As a result, there is no change in momentum, as indicated by the answer (a) zero.
For more such questions on momentum ,click on:

https://brainly.com/question/1042017

#SPJ11

The table shows the specific heat capacities of various substances. An iron block of mass 2kg is heated. Calculate the amount of energy needed to raise its temperature from 20°C to 30°C. Use the table to help you.

Answers

Answer:

9000 J

Explanation:

a space shuttle travels in orbit at 21,000 km/hr. how far will it travel in 5 hr

Answers

Answer:

Explanation:

distance = speed * time  

distance = 21000 * 5 = 105000 km

please mark me as Brainliest

I am pushing on a box with 15 N of force, and my younger cousin is pushing the box (in the same direction as me) with 10 N of force. How much is the net force on the box?


Help

Answers

25N
:)
Hope this helps

consider two blocks a and b. a is resting on top of b on top of a table. someone (your little brother?) comes along and pushes the bottom block out to the left from under the top block. does the friction force on the top block act to the right or the left?

Answers

Consider two blocks a and b. a is resting on top of b on top of a table. someone (your little brother) comes along and pushes the bottom block out to the left from under the top block. The friction force on the top block acts to the right. When someone (who could be the asker's little brother) pushes block B out to the left from under block A, the friction force on the top block acts to the right.

When an object moves over the surface of another object, the frictional force is the resistance it encounters. The amount of friction that develops between two objects is determined by a variety of factors, including the force pushing the objects together and the coefficient of friction between them. The frictional force always opposes the motion of the object. If you push a book across a table, for example, the frictional force will always act in the opposite direction to the book's motion, causing the book to slow down and eventually come to a halt.

The frictional force on the top block, Block A, acts to the right in this case. Since block B is pushed out from under block A, block A will begin to slide to the left. However, due to friction, there will be a force acting on the right side of block A, opposing the motion to the left, and helping it to maintain its position. Since friction opposes the motion of the object, it will always act in the opposite direction of the object's motion, in this case, to the right.

Learn more about force at:

https://brainly.com/question/25790086

#SPJ11

a) Under what circumstances would a constant force result in increasing acceleration on a body? b) Under what circumstances would a constant force result in zero acceleration on a body?

Answers

Answer:

Remember the equation:

F = m*a

where F is force, m is mass and a is acceleration.

If we have F constant. and we want that increases, then we can have the case where m decreases.

The mass can decrease in cases like a rocket, where as the fuel of the rocket consumes, the mass of the rocket decreases and the acceleration increases.

b) The cases where a constant force results in a constant acceleration of zero, is when the force is canceled, an example of this is the constant force of the gravity in all the objects. The objects that are in the ground are being affected by this force, but the gravitational force is canceled with the normal force of the ground. Then we have a constant force that does not cause any acceleration.

An astronaut is said to be weightless when they travel in the satellite. What does this mean?

Answers

Answer:

The sense of weightlessness in orbiting satellite is because of the lack of any contact-forces. The only force that acts upon humans in space is the force of gravity, which acts at a distance; but as there is no counter-force, we do not experience the sensation of weight over there.

how much does the earth weigh

Answers

Answer:

5.972 × 10^24 kg

Explanation:

According to google, 5.972 x 10^24kg

Concave lens is also known as diverging lens. Why ? Explain with reason .​

Answers

Answer:

Concave lens is also known as diverging lens because it diverge the parallel beam of light after reflect through it.

A solid cube of mass 87 kg and edge length 0.95 m rests on a horizontal floor as shown below. A person then pushes on the upper edge of the cube with a horizontal force of magnitude F. At what value of F will the cube start to tip? Assume the frictional force from the floor is large enough to prevent the cube from sliding.

Answers

The force required to tip the cube is equal to the coefficient of static friction times the weight of the cube.

fx=μs * 87 kg * 9.8 m/s^2

What is the force required to tip the cube?

Generally, The cube will start to tip when the net torque about the point of contact between the cube and the floor is equal to zero. The torque is given by:

torque = force x distance from axis of rotation

The distance from the axis of rotation is half the edge length of the cube (0.475m), and the force is the force applied by the person (). Therefore, the torque is:

torque = fx x 0.475

For the cube to tip, the torque due to the person's force must be greater than the maximum torque the friction can provide, which is the friction force times the distance from the axis of rotation.

The maximum torque provided by friction is:

friction torque = friction force x 0.475

Since the friction force is equal to the normal force (mg) multiplied by the coefficient of static friction (μs), the maximum torque provided by friction is:

friction torque = μs * mg * 0.475

where m is the mass of the cube, g is the acceleration due to gravity and μs is the coefficient of static friction between the cube and the floor.

So, we can find the force needed to tip the cube by equating the torque due to the force with that of the friction torque.

Fx*0.475 = μs * m * g * 0.475

Fx= μs * m * g

Fx= μs * 87 kg * 9.8 m/s^2

Note: The coefficient of static friction (μs) is a dimensionless quantity between 0 and 1, it varies depending on the surfaces in contact.

Read more about coefficient of static friction

https://brainly.com/question/13828735

#SPJ1

Paritha is participating in a study in which her behaviors are studied in a natural setting. This is an example of a(n) ________ study.a. fieldb. analogc. between subjectsd. longitudinal

Answers

he Paritha is participating in a study in which her behaviors are studied in a natural setting. This is an example of a(n) option (a) field study.

In a field study, researchers observe and analyze participants' behaviors in their natural settings or real-life environments. The goal is to gather data in a context that closely resembles the participants' everyday lives, rather than in a controlled laboratory setting.

Paritha's participation in a study where her behaviors are observed in a natural setting indicates that she is involved in a field study. Researchers might observe Paritha's behaviors, interactions, and reactions in real-world situations to gain insights into her natural behavior patterns and better understand how certain factors or variables influence her behavior in her typical environment.

An analog study (option b) involves creating a simulated or artificial environment to observe participant behavior. Between subjects design (option c) refers to a study design where different groups of participants are assigned to different conditions.

Longitudinal study (option d) involves following a group of participants over an extended period to examine changes or development over time. Neither of these options accurately describes Paritha's study as described.The correct answer is option a.

Know more about  analog study here:

https://brainly.com/question/10808671

#SPJ11

Will give brainliest!! How would you write the direction of the vector above as a global angle?

Will give brainliest!! How would you write the direction of the vector above as a global angle?

Answers

Answer:

Assuming they're unit vectors (length of 1)

You simply add them together.

The vector pointing right can be described with X and Y

(1, 0).

The vector pointing down

(0, -1).

The numbers are taken from the axis in X and Y directions.

If you add them together you get a final vector.

(1, - 1)

This gives you -45° pointing South East.

Or 360°-45°=315°

two stars in a certain binary star system have angular separation of 5×10−55×10−5 degrees when viewed from earth. can they be resolved with the telescope described abo

Answers

We need to calculate the angular resolution to determine if the two stars in a binary star system can be resolved with the given telescope.

The angular resolution of a telescope is the smallest angle between two point sources that can be distinguished as separate sources. The formula gives it: angular resolution = 1.22 x (wavelength of light/diameter of a telescope)

Assuming that we are observing the stars in visible light with a wavelength of 500 nm and using the diameter of the Hubble Space Telescope (2.4 meters) as an example, we can calculate the telescope's angular resolution as: angular resolution = 1.22 x (500 nm / 2.4 m) = 0.025 arcseconds.

Now we can compare the angular separation of the binary star system (5 x 10^-5 degrees) to the telescope's angular resolution (0.025 arcseconds).

First, we need to convert the angular separation to arcseconds:

1 degree = 60 arcminutes

1 arcminute = 60 arcseconds

5 x 10^-5 degrees = 0.18 arcseconds

We can see that the angular separation of the binary star system is much larger than the telescope's angular resolution. Therefore, the two stars cannot be resolved with the given telescope.

To learn more about angular resolution, visit here

https://brainly.com/question/25014179

#SPJ4

there is a hill which has parallel train tracks on it. the tracks run for 6 miles up the hillside. one train is at the top of the hill, moving down at 19mi/h . another train is on the other set of tracks, moving up the hill at 10mi/h . the first train accelerates at 10mi/h2 as it goes down the hill, but the second train does not accelerate or decelerate. how far up the hill are they when they pass?

Answers

With a speed over 1.8 km/h, a man is walking on train A from the direction that the train is moving away from. As seen from a train, this person speed is 1 ms.

How do you overcome a hill start?

Choose first gear and depress the clutch. While slowly raising the clutch to the biting point, gradually depress the accelerator. When you are sure it is safe to move, release the handbrake and increase the clutch bite until the car begins to move.

How should I drive uphill?

As you approach a bend while traveling uphill, slow down, change into a lower gear, and then accelerate. A crucial thing to keep in mind is that if a vehicle is approaching from above, you must be extremely vigilant. When driving downhill, you should once more slow down well before turn and let off the gas.

To know more about speed visit:

https://brainly.com/question/28224010

#SPJ4

a grocery cart weighing 60.8 n is pushed 10.9 m across the floor by a shopper who exerts a constant horizontal force of 58.1 n. if all frictional forces are neglected, what is the final speed (in m/s) of the cart on the floor surface?

Answers

The final speed of the cart on the floor surface is 14.28m/sec if a grocery cart weight is  60.8N

Since, we need to find the final speed of the object and distance is given, it means that we can use third equation of motion, which is

v² - u² =2aS where v is the final velocity and u is the initial velocity,a is the acceleration of the object and S is the displacement of the object.

Since weight =60.8N,=W=mg

=>60.8=m×9.8

=>m=60.8/9.8

=>m=6.204kg

Now,we have mass and force,so we need to find the acceleration of cart which is given by the formula

=>F=ma

=>58.1N=6.204×a

=>a=(58.1)/6.204

=>a=9.364m/sec²

Now, we have acceleration and initial velocity of cart=0,so we can apply the third equation of motion

=>v²-0= 2×9.364×10.9

=>v²=204.155

=>v=√204.155

=>v=14.28m/sec

Hence, final speed is 14.28m/sec

To know more about speed, visit here:

https://brainly.com/question/28224010

#SPJ4

what 3 things make up a nucleotid

Answers

Answer:

A nucleotide consists of a sugar molecule (either ribose in RNA or deoxyribose in DNA) attached to a phosphate group and a nitrogen-containing base. The bases used in DNA are adenine (A), cytosine (C), guanine (G), and thymine (T).

3. The value of frictional force on block in the given
diagram is (Take g = 10 m/s2)
5N
m = 3 kg
8.
u = 0.3
(1) 4N
(2) 5 N
(3) 6 N.
(4) 9 N​

3. The value of frictional force on block in the givendiagram is (Take g = 10 m/s2)5Nm = 3 kg8.u = 0.3(1)

Answers

I need help with my homework it’s due tomorrow and I feel like I failed can u help me bro

the astronaut must make water for himself and for his plants. for just the astronaut, how much water is lost each day and how is it lost? choose the best answer.

Answers

He may shiver to increase body temperature. and 2.5 liters are lost each day, and most of it is lost through a combination of the kidneys and GI tract with a little more lost through respiration.

He may shiver to increase body temperature. Average temperature of a healthy human adult it 36.8 °C. Hypothermia can set in if it drops below 35 °C. Insensible perspiration is the main source  for loss of heat from body, so the body will try to minimise it.He may shiver to increase body temperature. Average temperature of a healthy human adult it 36.8 °C. Hypothermia can set in if it drops below 35 °C. Insensible perspiration is the main source  for loss of heat from body, so the body will try to minimise it. Water is something that many of us take for granted on Earth, but finding it in space is more difficult. The International Space Station (ISS) uses chemicals to recycle a large portion of its water, but it still needs significant shipments of water from Earth to supply its astronauts with clean water.

Learn more about temperature here:

https://brainly.com/question/900679

#SPJ4

A system contains a number N of distinguishable atoms, with N large. Each atom can be in two (non-degenerate) energy levels: 0, € > 0. The total energy of the system is E. (a) What state of the syst

Answers

The state of the system is determined by the distribution of energy levels among the distinguishable atoms.

In a system with a large number (N) of distinguishable atoms, each atom can exist in one of two non-degenerate energy levels: 0 or € (>0). The total energy of the system is denoted by E. The question asks about the state of the system.

The state of the system refers to the specific arrangement or configuration of energy levels among the atoms. Since each atom can be in one of two energy levels, there are 2^N possible configurations for the system. Each configuration corresponds to a different state of the system.

The distribution of energy levels among the atoms affects the total energy of the system. The energy of the system is the sum of the energy levels of all the atoms. Depending on how the energy levels are distributed, the total energy of the system can vary.

To determine the state of the system, we need to consider all possible configurations and their corresponding total energies. The state of the system will be the configuration that corresponds to the given total energy E.

Learn more about energy levels

brainly.com/question/30546209

#SPJ11

which of the following are likely to play a role in determining whether a galaxy is spiral or elliptical? select all that apply. select all that apply. the density of the protogalactic cloud from which the galaxy was born the rotation rate of the protogalactic cloud from which the galaxy was born the age of the universe at the time the galaxy first formed collisions or other interactions that the galaxy has had with other galaxies in the past

Answers

To determine if a galaxy is spiral or elliptical we use a combination of factors, including the density of the protogalactic cloud.

Which factors play a role in determining whether a galaxy is spiral or elliptical?

The morphology, or shape, of a galaxy, is determined by a combination of factors, including the density of the protogalactic cloud from which it formed and any interactions it has had with other galaxies over time.

Spiral galaxies, for example, are characterized by a central bulge and a flattened disk with spiral arms extending outward. These features are thought to arise from a combination of factors, including the density and temperature of the protogalactic cloud, the rate at which gas is able to cool and collapse to form stars, and the presence of a rotating disk of gas and dust. Collisions or interactions with other galaxies can also influence the shape and structure of spiral galaxies by disrupting their disks or triggering bursts of star formation.

Elliptical galaxies, on the other hand, are typically round or oval-shaped and lack the flattened disk and spiral arms of spiral galaxies. They are thought to form when two or more galaxies collide and their stars and gas are mixed together in a chaotic process that ultimately leads to the formation of a smooth, featureless structure. The density of the protogalactic cloud and the rotation rate of the cloud may play some role in determining whether a collision will result in an elliptical or spiral galaxy, but the main factor is likely the severity and timing of the collision.

The age of the universe at the time the galaxy formed is less likely to have a direct impact on its morphology, as galaxies can continue to evolve and change over billions of years due to ongoing interactions with other galaxies and the effects of gravity and other physical processes.

Learn more about galaxy

brainly.com/question/31361315

#SPJ11

1. Find FG between the earth and a football player 100 kg in mass. Fgrav =980 N

2. What is the radius of the moon when an astronaut of madd 70kg is having a gravitational force
117 N when standing in the surface of the moon

3. Determine the mass of Jupiter if a gravitational force on a scientist whose weight when in earth is 686 N, is Fgrav = 1823 N

Answers

1. To find the force of gravity (Fgrav) between the earth and a football player with a mass of 100 kg, we can use the formula:

Fgrav = G * (m1 * m2) / d^2

where G is the gravitational constant (6.67 x 10^-11 Nm^2/kg^2), m1 is the mass of the earth (5.97 x 10^24 kg), m2 is the mass of the football player (100 kg), and d is the distance between their centers of mass.

Since the football player is standing on the surface of the earth, we can assume that the distance between their centers of mass is equal to the radius of the earth (6.37 x 10^6 m).

Plugging in the values, we get:

Fgrav = (6.67 x 10^-11 Nm^2/kg^2) * (5.97 x 10^24 kg) * (100 kg) / (6.37 x 10^6 m)^2

Fgrav = 981 N

Therefore, the force of gravity between the earth and the 100 kg football player is approximately 980 N (rounded to the nearest whole number).

2. To find the radius of the moon when an astronaut with a mass of 70 kg is experiencing a gravitational force of 117 N while standing on the surface of the moon, we can use the same formula as above:

Fgrav = G * (m1 * m2) / d^2

where G is the gravitational constant (6.67 x 10^-11 Nm^2/kg^2), m1 is the mass of the moon (7.35 x 10^22 kg), m2 is the mass of the astronaut (70 kg), and d is the distance between their centers of mass, which is equal to the radius of the moon (r).

Plugging in the values, we get:

117 N = (6.67 x 10^-11 Nm^2/kg^2) * (7.35 x 10^22 kg) * (70 kg) / r^2

Solving for r, we get:

r = 1.74 x 10^6 m

Therefore, the radius of the moon when an astronaut with a mass of 70 kg is experiencing a gravitational force of 117 N while standing on the surface of the moon is approximately 1.74 x 10^6 m.

3. To determine the mass of Jupiter if a gravitational force on a scientist whose weight is 686 N on earth is Fgrav = 1823 N, we can use the same formula as above:

Fgrav = G * (m1 * m2) / d^2

where G is the gravitational constant (6.67 x 10^-11 Nm^2/kg^2), m1 is the mass of Jupiter, m2 is the mass of the scientist (weight on earth divided by gravitational acceleration on earth, which is 9.81 m/s^2), and d is the distance between their centers of mass, which is the radius of Jupiter (r).

Plugging in the values, we get:

1823 N = (6.67 x 10^-11 Nm^2/kg^2) * (m1) * (686 N / 9.81 m/s^2) / (r^2)

Solving for m1, we get:

m1 = 1.90 x 10^27 kg

Therefore, the mass of Jupiter is approximately 1.90 x 10^27 kg.

True or False, Massive stars have lower absolute brightness.

Answers

Answer:

the statement is false that massive stars have low absolute brightness.

Explanation:

The brightness of the luminous intensity depends on the distance between the star and the observer. The intensity is directly proportional to the square of the distance between the observer and the star.

Why is a spectrum of colors produced when white light passes through a prism?

Answers

Explanation: White light is all colors of light in one, so when white light passes through a prism, the light gets refracted and breaks apart into all of the colors on the visible light spectrum.

Waves cause beach sand to be ____________. a. well rounded b. poorly sorted

Answers

Waves cause beach sand to be well rounded.The effects of wave action on beach sand is crucial for coastal management and engineering.

How does wave action impact the shape of beach sand?

Waves crashing onto the shore have a profound impact on the shape and texture of beach sand. The relentless force of waves breaking and washing up onto the beach causes the sand particles to undergo a process known as attrition. This process involves constant movement and collision between the sand grains, leading to abrasion and gradual wearing down of their edges and corners.

As waves repeatedly crash onto the beach, the sand grains rub against each other, causing them to become smoother and more rounded over time. The abrasive action of the waves breaks down larger grains into smaller ones, resulting in a finer sand texture. This process is especially noticeable in areas where the wave action is particularly strong, such as along exposed coastlines or during stormy weather.

The well-rounded nature of beach sand is not only a result of wave action but also of other factors such as the composition of the sand itself. Sands composed of harder minerals tend to resist rounding to a certain extent, while softer minerals are more easily worn down and shaped by wave action.

Learn more about Waves

brainly.com/question/29334933

#SPJ11

If you applied a force of 200 Newtons to lift a box 2.20 meters above the floor, how much work would you be doing?

Answers

Hi hi hhhhhjjjjjiiiijjjj

A microwave oven draws 0.62kW at an electrical energy rate of 6.8 cents per kWh. Using the GRASS method, calculate the cost of using the microwave for 30 minutes every day for 9 days. Show your work. Round your answer to the nearest cent. You may write out your answer on paper and upload the image. [3 pts]


G

R

A

S

S

Answers

Answer: The cost of using the microwave oven for 30 minutes every day for 9 days is $0.57

Explanation: The GRASS method is used to calculate the cost of using an appliance by multiplying the power rating of the appliance (in kW) by the hours of use, and then multiplying that by the rate per kWh.

Here's the calculation:

Power rating: 0.62 kW

Time of use: 30 minutes/day for 9 days = 30/60*9 = 13.5 hours

Cost per hour = 0.62 * 6.8 / 100 = 0.04236

Total cost = 0.04236 * 13.5 = $0.57

If a 10 kg ball and a 100 kg ball we’re dropped from a plane, which would hit the ground first?

Answers

Answer: The 100 kg ball

Explanation:

is a solar energy technology that uses unique properties of semiconductors to turn light into electricity

Answers

Solar energy technology utilizes the unique properties of semiconductors to convert sunlight into electricity. This process is called photovoltaic (PV) effect, where semiconductors, such as silicon, absorb photons from sunlight and release electrons.

These electrons are captured by an electric field, creating a flow of electricity. PV cells are grouped together to form solar panels, which can be installed on rooftops or large solar farms.

Solar energy is a clean, renewable, and sustainable source of power, reducing greenhouse gas emissions and reliance on fossil fuels.

Moreover, advancements in semiconductor materials and manufacturing techniques have improved the efficiency and affordability of solar technology, making it more accessible for a wide range of applications.

Learn more about solar energy at https://brainly.com/question/15447322

#SPJ11

A container of volume 0.4 m3 contains 3 mol of argon gas at 300C. Assuming argon behaves as an ideal gas, find the total internal energy of the gas?

Answers

11223.9J or 11.2239 kJ is the total internal energy of the gas.

What is internal energy?

Internal energy, which results from the motion of matter at the molecular level, is a type of energy that exists in all systems. For internal energy, the letter U is used, and the joule is the unit of measurement (J).

As a substance changes from one state or phase to another—from solid to liquid to gas—its internal energy also rises. It is possible to imagine planetary bodies as a fusion of heat engines and heat reservoirs.

The heat engines transform some of the thermal energy stored in the heat reservoirs into different forms of mechanical, electrical, and chemical energy.

The formula for total internal energy of gas is

(3/2)nRT

where n = amount of substance

R = Ideal gas constant

T = temperature

Put the value in the equation

(3/2)nRT

= (3/2)(3)( 8.314)(300)

= 11223.9J

Thus, 11223.9J or 11.2239 kJ is the total total internal energy of the gas.

Learn more about internal energy

https://brainly.com/question/11278589

#SPJ4

is 468km per minute describing speed or velocity

Answers

velocity probably well that’s what i would put
Other Questions
The Scramble finally ended in the early 1900s with the French declaration of a protectorate over _______1. Libya2. Algeria3. Morocco4.Tunisia Camp Oaks gets 32 boxes of Orange juice and 56 boxes of apple juice. Each shelf in the cupboard can hold 8 boxes of juice. What is the least number of shelves needed for all the juice boxes. 4. Teanna drove 366 miles in 6 hours. How many miles did she drive in one hour? What is the molecular geometry of Water (H2O)? What is the number of the ways to arrange 6 objects from a set if10 different objects? 12: Find the indefinite integrals. Show your work. a) integral (8x - 2)dx suppose you have two bags of marbles that are in a box. bag 1 contains 7 white marbles, 6 black marbles, and 3 gold marbles. bag 2 contains 4 white marbles, 5 black marbles, and 15 gold marbles. the probability of grabbing the bag 1 from the box is twice the probability of grabbing the bag 2. if you close your eyes, grab a bag from the box, and then grab a marble from that bag, what is the probability that it is gold? You have selected an immigrant and gathered relevant information. Now you can describe the impact and contributions of the immigrant in a report. Here are some directions to follow: Write a title and introduction for your report. Answer these questions to help guide you in your writing for the body of the report. What was the immigrants impact and contribution? Did the immigrants life or experiences influence his or her impact? Explain. Why is the immigrants impact or contributions important? if a within-subjects experiment produces 50 scores in treatment 1 and 50 scores in treatment 2, then the experiment must have employed . which word is an antonym for desolate Please help me on these 4 ! Sampling distributions Today in modern China, Daoism is known primarily for its philosophical teachings rather than the practices of Religious Daoism. T/F? Using given data, calculate the change in Gibbs free energy for each of the following reactions. You may want to reference (Pages 831 - 832) Section 19.6 while completing this problem. Part A: 2Ag(s)+Cl2(g)2AgCl(s) Gibbs free energy for AgCl(s) is 109.70 kJ/mol Express your answer without scientific notation and using one decimal place.(units kJ) Part B: P4O10(s)+16H2(g)4PH3(g)+10H2O(g) Gibbs free energy for P4O10(s) is 2675.2 kJ/mol Gibbs free energy for PH3(g) is 13.4 kJ/mol Gibbs free energy for H2O(g) is 228.57 kJ/mol Express your answer without scientific notation and using one decimal place.(units kJ) Part C: CH4(g)+4F2(g)CF4(g)+4HF(g) Gibbs free energy for CH4(g) is 50.8 kJ/mol Gibbs free energy for CF4(g) is 635.1 kJ/mol Gibbs free energy for HF(g) is 270.70 kJ/mol Express your answer without scientific notation and using one decimal place. (unitskJ) 2H2O2(l)2H2O(l)+O2(g) Gibbs free energy for H2O2(l) is 120.4 kJ/mol Gibbs free energy for H2O(l) is 237.13 kJ/mol Express your answer without scientific notation and using one decimal place.(units kJ) Part D: 2H2O2(l)2H2O(l)+O2(g) Gibbs free energy for H2O2(l) is 120.4 kJ/mol Gibbs free energy for H2O(l) is 237.13 kJ/mol Two number cubes are rolled to determine how a token moves on a board game Which of the following Boolean expressions are equivalent to the expression num 15 ?Select two answers.(A) (num > 15) AND (num = 15)(B) (num > 15) OR (num = 15)(C) NOT (num < 15)(D) NOT (num < 16) a router receives a packet from the gigabit 0/0 interface and determines that the packet needs to be forwarded out the gigabit 0/1 interface. what will the router do next? see what you already know. which types of writing are business writing? drag each tile to the correct category. Most fishes have the same body temperature as the water they are swimming in. How would you describe their homeostatic control of temperature Use the data in the Production Possibilities Schedule below to answer the question Combination School Buses Refrigerators A 0 20 B 1 18 C 2 14 D 3 8 E 4 0 The opportunity cost of moving from point C to point D is _____ refrigerators.