what is fermentation​

Answers

Answer 1

Fermentation is a metabolic method that creates chemical changes in natural substrates through the action of enzymes.

Explanation: hope this helps :)


Related Questions

Attempt 2
Four marbles are made of different metals. Each marble has the same mass, but a different volume. The density of each
metal is given in the table.
Metal
Density (g/mL)
aluminum
2.70
silver
10.5
rhenium
20.8
nickel
8.90
Place the marbles in order from largest to smallest.
Largest

Answers

Lets let our mass equal 3 on alletals and solve using d=m/v equation

Aluminum
V=3/2.70=1.11
Silver
V=3/10.5=.286
Rhenium
V=3/20.8=.144
Nickel
V=3/8.90=.337
This gives us the following list from largest to smallest Aluminum, Nickel, Silver, and Rhenium

The order of marbles can be Aluminum, Nickel, Silver, and Rhenium.

What is volume?

If volume is the amount of three-dimensional space contained by a closed surface, such as the amount of space within a given cube, cylinder, or other three-dimensional shape.

Liquid volume is a way to measure an amount of liquid by describing how much three-dimensional space it occupies.

The mass of something is the amount of stuff it is made of. The volume of an object is the amount of space it usually takes up.

Density provides an easy way to calculate a body's mass from its volume or vice versa.

The mass is equal to the volume multiplied by the density (M = Vd), and the volume is equal to the mass divided by the density (V = M/d).

As per the density given, the volume of aluminum can be 1.11mL, Silver is 0.286mL, Rhenium is 0.144mL, Nickel is 0.337mL.

Thus, the order from largest to smallest will be Aluminum, Nickel, Silver, and Rhenium.

For more details regarding volume, visit:

https://brainly.com/question/1578538

#SPJ2

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What is the net ionic equation for this reaction?

What is the net ionic equation for this reaction?

Answers

The ionic equation represents the element in cation and anionic form. The equation is given as OH⁻ + 2H⁺ → 2H₂O. Thus, option A is correct.

What is the ionic equation?

The ionic reaction equation is the representation of the chemicals dissociated as the ions in an aqueous solution. The ionic reaction is given as the cations and anions dissociated from the respective molecule or compound.

The ionic equation between potassium hydroxide and sulfuric acid is shown as,

2K⁺ + OH⁻ + 2H⁺ + SO₄²⁻ → 2H₂O + 2K⁺ + SO₄²⁻

It can also be written as,

Net ionic equation: OH⁻ + 2H⁺ → 2H₂O

Here, others are eliminated as they are spectator ions.

Therefore, option A. OH⁻ + 2H⁺ → 2H₂O is the net ionic equation.

Learn more about ionic equation here:

https://brainly.com/question/27980783

#SPJ1

An atom has 30 protons, 35 neutrons, and 30 electrons. What is the charge of the atom's nucleus?
A. - 35
B. + 35
C. - 30
D. + 30

Answers

Answer:

B. + 35

Explanation:

An atom has 30 protons, 35 neutrons, and 30 electrons.  The charge of the atom's nucleus is + 30. Therefore, the correct option is option D.

What is atom?

The smallest unit of matter that may be split without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. Electric forces, which link electrons towards the nucleus of atoms, cause them to be drawn to any positive charge.

Space makes up the majority of an atom. The remainder is made up of a cloud of negatively charged electrons around a positively charged nucleus made up of protons and neutrons. Compared to electrons, that are the smallest charged particles in nature, the nucleus is tiny and dense.  An atom has 30 protons, 35 neutrons, and 30 electrons.  The charge of the atom's nucleus is + 30.

Therefore, the correct option is option D. An atom has 30 protons, 35 neutrons, and 30 electrons.  The charge of the atom's nucleus is + 30.

To learn more about atom, here:

brainly.com/question/29712157

#SPJ6

What are the possible consequences of adding a chemical to the environment

Answers

Answer:

The release into the air of chemicals and particles can cause direct damage to the troposphere (air pollution); alter the composition and function of atmospheric layers (greenhouse effect) or other indirect damages (ozone layer depletion).

Explanation:

Ruins the soil and the weather

The vapor pressure of ethanol, CH3 CH2 OH, at 40.0 °C is 17.88 kPa. If 2.24 g of ethanol is enclosed in a 3.00 L container, how much liquid will be present?​

Answers

Answer:

7.13 L of ethanol, CH₃CH₂OH

Explanation:

We'll begin by calculating the number of mole in 2.24 g of ethanol. This can be obtained as follow:

Mass of CH₃CH₂OH = 2.24 g

Molar mass of CH₃CH₂OH = 12 + (3×1) + 12 + (2×1) + 16 + 1

= 12 + 3 + 12 + 2 + 16 + 1

= 46 g/mol

Mole of CH₃CH₂OH =?

Mole = mass / molar mass

Mole of CH₃CH₂OH = 2.24 / 46

Mole of CH₃CH₂OH = 0.049 mole

Next, we shall convert 40 °C to Kelvin temperature. This can be obtained as follow:

T(K) = T(°C) + 273

T(°C) = 40 °C

T(K) = 40 °C + 273

T(K) = 313 K

Finally, we shall determine the volume of ethanol, CH₃CH₂OH in present in the container. This can be obtained as follow:

Pressure (P) = 17.88 KPa

Temperature (T) = 313 K

Number of mole (n) = 0.049 mole

Gas constant (R) = 8.314 L.KPa/Kmol

Volume (V) =?

PV = nRT

17.88 × V = 0.049 × 8.314 × 313

Divide both side by 17.88

V = (0.049 × 8.314 × 313) / 17.88

V = 7.13 L

Thus, 7.13 L of ethanol, CH₃CH₂OH will be present in the container.

Based on the mass of ethanol provided, the mass of liquid ethanol is 1.61 g

What is the relationship between gas volume, pressure, temperature and moles?

The relationship between the gas volume, pressure, temperature and moles is given by the ideal gas equation:

PV = nRT

where:

P is pressureV is volumen is number of molesR is molar gas constant = 8.314 L.KPa/KmolT is temperature

From data provided:

P =  17.88 kPa

V = 3.00 L

T = 40.0 °C = 313 K

R = 0.049 mole

n = ?

n = PV/RT

n =  17.88 * 2/8.314  * 313

n = 0.0137 moles

Mass of ethanol gas = number of moles * molar mass

Mass of gaseous ethanol = 0.0137 mole * 46 g/mol

Mass of gaseous ethanol = 0.63 g

Then:

Mass of liquid ethanol, CH₃CH₂OH = 2.24 - 0.63

Mass of liquid ethanol, CH₃CH₂OH = 1.61 g

Therefore, the mass of liquid ethanol is 1.61 g

Learn more about vapor pressure and mass at:

How many atoms are in 2.5mol of sodium

Answers

Answer:

1024 sodium atoms.

_C₂H₄+ _ O₂ → _ CO₂ + _ H₂O If you start with 14.5 grams of ethylene (C₂H₄), how many grams of water(H₂O) will be produced?

Answers

Answer:

a. SOLUTION:

Step 1: Write the balanced chemical equation.

C₂H₄ + 3O₂ → 2CO₂ + 2H₂O

Step 2: Calculate the number of moles of CO₂ formed by each reactant.

• Using C₂H₄

Based on the balanced chemical equation, 1 mole of C₂H₄ is stoichiometrically equivalent to 2 moles of CO₂.

The molar mass of C₂H₄ is 28.054 g/mol.

• Using O₂

Based on the balanced chemical equation, 3 moles of O₂ is stoichiometrically equivalent to 2 mole of CO₂.

The molar mass of O₂ is 31.998 g/mol.

Step 3: Determine the limiting reagent.

Since O₂ produced less amount of CO₂ than C₂H₄, O₂ is the limiting reagent.

Step 4: Determine the mass of CO₂ formed.

Note that the (maximum) mass of a product that can be formed is dictated by the limiting reagent. In this case, we will start at the number of moles of CO₂ formed from the limiting reagent (O₂) which is equal to 0.11022 mol.

The molar mass of CO₂ is 44.009 g.

Hence, 4.85 g of CO₂ can be formed.

------------------------------------------------------------

b. ANSWER:

The LR is O₂ and the ER is C₂H₄.

------------------------------------------------------------

c. SOLUTION:

The theoretical yield of the reaction is 4.85 g.

Hence, the percent yield of the reaction is 87.6%.

#CarryOnLearning

Explanation:

brainliest pls

Which statement is a scientific theory? A. If I give a dog treats, I can teach him to sit on command. O B. All matter is made of tiny particles called atoms. OC. People who play video games are more creative than people who don't. D. Galaxies are moving away from one another at certain speeds.​

Answers

"All matter is made of tiny particles called atoms" is considered a scientific theory. Therefore the correct option is (B)

What is Scientific Theory?

A scientific theory is a well-substantiated explanation of a natural phenomenon that has been repeatedly tested and confirmed through observation, experimentation, and data analysis.

From the statements in the question above, we can see that Option (B)  is a well-established and widely accepted explanation of a natural phenomenon that has been extensively tested through observation and experimentation.

Learn more about scientific theory here:

https://brainly.com/question/11555274

#SPJ1

What is the molecular weight of H2O

Answers

Answer:

18.015

Explanation:

Using the periodic table of the elements to find atomic weights, we find that hydrogen has an atomic weight of 1, and oxygen's is 16. In order to calculate the molecular weight of one water molecule, we add the contributions from each atom; that is, 2(1) + 1(16) = 18 grams/mole.

The direction of a reflected ray will always match its:
angle of incidence.
refracted ray.
diffused angle.
None of the choices are correct.

Answers

Answer:

angle of incidence.

Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C, given that [Sn2+]=0.0624 M, [Fe3+]=0.0437 M, [Sn4+]=0.00655 M, and [Fe2+]=0.01139 M. Standard reduction potentials can be found in this table.

Sn2+(aq)+2Fe3+(aq)↽−−⇀ Sn4+(aq)+2Fe2+(aq)

So far my incorrect answers have been:
0.28
0.798
0.178
0.142
0.881
0.61
and 0.812

Answers

Answer:

The cell potential for the given galvanic cell is 0.188 V.

Explanation:

To calculate the cell potential, we can use the Nernst equation:

Ecell = E°cell - (RT/nF)ln(Q)

where E°cell is the standard cell potential, R is the gas constant (8.314 J/mol·K), T is the temperature in Kelvin (25°C = 298 K), n is the number of moles of electrons transferred (in this case, n = 2), F is the Faraday constant (96,485 C/mol), and Q is the reaction quotient.

First, we need to write the half-reactions and their standard reduction potentials:

Sn4+(aq) + 2e- → Sn2+(aq) E°red = 0.15 V

Fe3+(aq) + e- → Fe2+(aq) E°red = 0.77 V

The overall reaction is the sum of the half-reactions:

Sn2+(aq) + 2Fe3+(aq) → Sn4+(aq) + 2Fe2+(aq)

The reaction quotient Q can be expressed as:

Q = [Sn4+][Fe2+]^2 / [Sn2+][Fe3+]^2

Substituting the given concentrations, we get:

Q = (0.00655)(0.01139)^2 / (0.0624)(0.0437)^2 = 0.209

Now we can calculate the cell potential:

Ecell = 0.15 V + 0.0592 V log([Fe2+]^2/[Fe3+]) + 0.0592 V log([Sn4+]/[Sn2+])

= 0.15 V + 0.0592 V log(0.01139^2/0.0437^2) + 0.0592 V log(0.00655/0.0624)

= 0.188 V

Therefore, the cell potential for the given galvanic cell is 0.188 V.

The cell potential for the given galvanic cell in which the given reaction occurs at 25 °C is 0.188 V.

How to the cell potential of galvanic cell?

To find the cell potential, we take the Nernst equation:

Ecell = E°cell - (RT/nF)ln(Q)

In which R is the gas constant (8.314 J/mol·K) and E° cell is the standard cell potential.

T temperature in Kelvin (25°C = 298 K), and n is the number of moles of electrons transferred (n = 2), Q is the reaction quotient and F is the Faraday constant (96,485 C/mol).

Firstly, write the half-reactions and then their standard reduction potentials:

Sn⁴⁺(aq) + 2e⁻  → Sn²⁺(aq) E°red = 0.15 V

Fe³⁺(aq) + e⁻ → Fe²⁺(aq) E°red = 0.77 V

The overall reaction is the sum of the half-reactions:

Sn²⁺(aq) + 2Fe³⁺(aq) → Sn⁴⁺(aq) + 2Fe²⁺(aq)

The Q reaction quotient can be written as:

Q = [Sn⁴⁺][Fe²⁺]² ÷ [Sn²⁺][Fe²⁺]²

Substituting the given concentrations, we observe:

Q = (0.00655)(0.01139)² ÷ (0.0624)(0.0437)² = 0.209

Next, we can find the cell potential:

Ecell = 0.15 V + 0.0592 V log([Fe²⁺]²/[Fe³⁺]) + 0.0592 V log([Sn⁴⁺]/[Sn²⁺])

= 0.15 V + 0.0592 V log(0.01139²÷0.0437²) + 0.0592 V log(0.00655÷0.0624)

= 0.188 V

Thus, the cell potential for the given galvanic cell is 0.188 V.

Learn more about cell potential, here:

https://brainly.com/question/29719917

#SPJ2

How many moles of water are needed to react to produce 5.0 moles of sodium hydroxide?
Please help!!!

How many moles of water are needed to react to produce 5.0 moles of sodium hydroxide?Please help!!!

Answers

Answer:

2,5

Explanation:

GG x Gg

what percent of Offspring will be homeozgous recessive?

Answers

The answer is 50% good luck

Solve for x , where M is molar and s is seconds.
Enter the answer. Include units. Use the exponent key above the answer box to indicate any exponent on your units.
x=(3.7×103M−2s−1)(0.37M)3

Solve for x , where M is molar and s is seconds.Enter the answer. Include units. Use the exponent key

Answers

Answer:

187.416 M/s

Explanation:

First the units    M^-2 s^-1   *  M^3   =  M/s

now the numbers

3700 * .37^3 = 187.416

1. A solution contains an unknown amount of dissolved magnesium. Addition of0.0877 mol of Na2CO3 causes complete precipitation of all of the magnesium.What mass of magnesium was dissolved in the solution?

Answers

Answer:

4.25 g of magnesium.

Explanation:

What is given?

moles of Na2CO3 = 0.0877 moles.

molar mass of Mg (magnesium) = 24.3 g/mol.

Step-by-step solution:

First, let's state the chemical equation between Mg (magnesium) and Na2CO3:

\(\text{2 Mg+Na}_2CO_3\rightarrow Mg_2CO_3+2Na.\)

You can see that 1 mol of Na2CO3 reacts with 2 moles of Mg, so let's see how many moles of Mg are being produced by 0.0877 moles of Na2CO3:

\(0.0877\text{ moles Na}_2CO_3\cdot\frac{2\text{ moles Mg}}{1\text{ mol Na}_2CO_3}=0.175\text{ moles Mg.}\)

And the final step is to convert from 0.175 moles of Mg to grams using its molar mass. The conversion will look like this:

\(0.175\text{ moles Mg}\cdot\frac{24.3\text{ g Mg}}{1\text{ mol Mg}}=4.25\text{ g Mg.}\)

The answer is that there is 4.25 g of magnesium dissolved in the solution of 0.0877 moles of Na2CO.

Which of the following best describes a pair of elements that will form an ionic bond?
• C and H: Hydrogen easily loses electrons, and carbon gains them.
• Li and O: Oxygen easily loses electrons, and lithium gains them.
O P and Cl: Phosphorus easily loses electrons, and chlorine gains them.
• Ca and Br: Calcium easily loses electrons, and bromine gains them.

Answers

According to the description of an ionic bond, the last choice is the right response: Ca and Br are the two components that will combine to form an ionic connection. Bromine gets electrons quickly whereas calcium loses them easily.

Between metallic and non-metallic atoms, an ionic bond is created in which all of the electrons from one atom are transferred to the other. One atom loses electrons and another receives them during this process, resulting in the formation of ions.

In general, nonmetals are willing to take electrons to form anions while metal elements are willing to donate them to make cations.

On the other hand, the octet rule describes an attribute of atoms that they require eight electrons to complete their final energy level in order to ensure stability. The noble gases that have served as the foundation for this rule.

In order to adhere to the octet rule and ensure that the elements are stable, electrons are transferred in the ionic connection in this manner.

Ca and Br are the two elements that will combine to form an ionic connection because Ca is a metal and will give electrons while Br is a non-metal and will accept them.

The final option, Ca and Br, is the pair of elements that will form an ionic bond, making it the correct response. Bromine gets electrons quickly whereas calcium loses them easily.

To know more about ionic bond, please refer:

https://brainly.com/question/14614895

#SPJ1

Which sample uses the substance(s) that Jacob and Natalie
should use to make a cold pack that will do the BEST job of
keeping food cool

Which sample uses the substance(s) that Jacob and Natalieshould use to make a cold pack that will do

Answers

The sample that uses the substance that Jacob and Natalie should use to make a cold pack that will do the best job of keeping food cool is sample 2, because it absorbs the most energy (option B).

What is endothermic process?

Endothermic refers to a chemical reaction that absorbs heat energy from its surroundings. This ensures that the temperature of the surroundings is cool or has a lower temperature.

According to this question, Jacob and Natalie are asked by their science teacher to design a warming or cooling device. They make use of certain substances, however, sample 2 has the lowest final temperature of -4°C.

This shows that sample 2 absorbs the most energy, hence, would be the best for keeping the food cool.

The incomplete question is as follows:

Jacob and Natalie are asked by their science teacher to design a warming or cooling device. They decide to design a cold pack that can be used to help keep food cool. Jacob and Natalie read about different substances that can be used inside cold packs and learn that most cold packs use endothermic reactions to cool objects.

Learn more about endothermic at: https://brainly.com/question/28909381

#SPJ1

a student has a 1 L solution of 2 M HCL and wants to increase the HCL concentration to 3 M

Answers

The student needs to add approximately 83.3 mL of 12 M HCl solution to the existing 1 L of 2 M HCl solution to increase the concentration to 3 M. It is important to handle concentrated acids with caution and follow proper safety procedures.

To increase the concentration of a 1 L solution of 2 M HCl to 3 M, the student needs to calculate the volume of concentrated HCl needed and add it to the existing solution. Here's how the calculation can be done:

Given:

Initial concentration of HCl solution = 2 M

Final concentration desired = 3 M

Initial volume of HCl solution = 1 L

Step 1: Calculate the moles of HCl in the initial solution.

Moles of HCl = Initial concentration × Initial volume = 2 M × 1 L = 2 moles

Step 2: Calculate the moles of HCl needed for the desired concentration.

Moles of HCl needed = Final concentration × Final volume = 3 M × 1 L = 3 moles

Step 3: Calculate the moles of HCl to be added.

Moles of HCl to be added = Moles needed - Moles present = 3 moles - 2 moles = 1 mole

Step 4: Convert the moles of HCl to the required volume of concentrated HCl.

To calculate the volume, we need to know the concentration of the concentrated HCl solution. Assuming it is 12 M, we can use the following formula:

Volume of concentrated HCl = Moles of HCl to be added / Concentration of concentrated HCl

Volume of concentrated HCl = 1 mole / 12 M = 0.0833 L or 83.3 mL

For more such questions on concentration visit:

https://brainly.com/question/28564792

#SPJ8

please help me with this!

please help me with this!

Answers

Answer:

mole fraction of Oxygen = mole of oxygen/ total mole

Explanation:

please help me with this!

300 ml of nitrogen react with 300 ml of hydrogen to form ammonia. N₂ + 3H₂ ---> 2NH3 What volume of ammonia will be formed, if the reaction gets over at the same temperature? a) 100 ml b) 200 ml c)300 ml d) 400 ml​

Answers

Answer:

According to the balanced chemical equation for the reaction:

N₂ + 3H₂ → 2NH₃

1 volume of nitrogen (N₂) reacts with 3 volumes of hydrogen (H₂) to form 2 volumes of ammonia (NH₃) at the same temperature and pressure.

Therefore, if 300 ml of nitrogen (N₂) reacts with 300 ml of hydrogen (H₂), the limiting reactant will be hydrogen, since it is present in the smallest amount. To find the volume of ammonia (NH₃) formed, we can use the volume ratio from the balanced chemical equation:

1 volume of N₂ + 3 volumes of H₂ → 2 volumes of NH₃

Since we have 300 ml of H₂, which is equivalent to 3 volumes of H₂, the maximum volume of ammonia (NH₃) that can be formed is:

2 volumes of NH₃ = 300 ml of H₂ × (2 volumes of NH₃ / 3 volumes of H₂) = 200 ml

Therefore, the correct option is (b) 200 ml.

How do particles tend to move in solids?


They vibrate about fixed points.

They move randomly through the solid while remaining in close contact with other particles.

They move in orbits around a center.

They move randomly through the solid and separately from other particles.

Answers

The answer is A. They vibrate about fixed points. Explanation: particles in a solid are too close together to move freely.

if a -2 ion has 34 protons, what element is it?

Answers

ANSWER

Selenium has 34 protons

1
Select the correct answer from each drop-down menu.
Complete the following statements to describe solids, liquids, and gases. Select the correct answer from each drop-down menu.
A solid
A liquid
A gas
а a definite volume and
a definite volume and
a definite volume and
a definite shape.
a definite shape.
a definite shape.

Answers

From each drop-down menu, a solid has (a definite volume and a definite shape), a Liquid has (a definite volume) and gas has ( non of the above)

The features of different states of Matter:

Matter is defined as anything that has weight and occupies space.

There are three states of matter that is in existence which include:

Solid: The particles of solid are closely packed together and vibrate around fixed axes. That is why they have a definite shape and volume.

Liquid: The particles of liquid, though attracted to each other,move freely over each other. That is why they have definite volume but not a definite shape.

Therefore, a liquid occupies the shape of its container.

Gas: The particles of gas contain scattered molecules that are dispersed across a given volume.

Therefore, a gas neither has a definite shape nor volume.

Learn more about matter here:

https://brainly.com/question/3998772

A sample of wastewater has 0.00048 g of lead in 100. g of solution. What is the ppm of lead in the solution?

Answers

The concentration of lead in the solution is 4.8 ppm.

The parts per million

The ppm (parts per million) is a unit used to express the concentration of a solution. It is defined as the number of parts (by mass) of a solute per million parts (by mass) of the solution. To convert from grams per 100 grams to ppm, we can use the following formula:

ppm = (mass of solute/mass of solution) x 10^6

In this case, the mass of solute (lead) is 0.00048 g, and the mass of solution is 100. g. Plugging these values into the formula, we get:

ppm = (0.00048/100) x 10^6

ppm = 4.8

Therefore, the concentration of lead in the solution is 4.8 ppm.

Learn more on parts per million here https://brainly.com/question/30661284

#SPJ1

A gas is at 273.9 K and 99.6 atm and its volume changed to 429.1 mL at STP. Find the original volume of the gas in mL

Answers

We are given a sample of gas and we know the initial temperature and pressure. The original volume is our unknown.

P₁ = 99.6 atm T₁ = 273.9 K V₁ = ?

We are told that the gas at the end of the process is at STP (standard temperature and pressure). The standard pressure is 1 atm and the standard temperature is 273.15 K. We are also given the final volume.

P₂ = 1 atm T₂ = 273.15 K V₂ = 429.1 mL

Since the temperature is not constant, we can use this formula to solve our problem:

P₁ * V₁ / T₁ = P₂ * V₂ / T₂

We can replace the given values and solve the equation for V1 to get the answer to our problem.

P₁ * V₁ / T₁ = P₂ * V₂ / T₂

V₁ = P₂ * V₂ * T₁/ (T₂ * P₁)

V₁ = 1 atm * 429.1 mL * 273.9 K/(273.15 K * 99.6 atm)

V₁ = 4.32 mL

Answer: the original volume of the gas was 4.32 mL.

In a science demonstration, a teacher mixed zinc (Zn) with hydrogen chloride (HCl) in a flask and quickly attached a balloon over the mouth of the flask. Bubbles formed in the solution and the balloon inflated.
What most likely occurred during this demonstration?

a.The Zn and HCl both retained their identity.
b.Either Zn or HCl, but not both, retained its identity.
c.Evaporation of one of the substances occurred.
d.One or more new substances formed.

Answers

Answer:

a. The Zn and HCl both retained their identity.

What affects how sound travels? (Select all that apply.)

a pressure

b temperature

c wavelength

d medium

Answers

Answer:

A. pressure and C. wavelength

Explanation:

All sound is different and many are affected differently but pressure and wavelength of it are the main ones.

Which solids are insoluble in water.​

Answers

Some types of solids that are insoluble in water are:

Metals. (most of them)Non-Metallic ElementsMetal OxidesSome Non-Metallic ElementsMetal Carbonates (most of them)Metal Sulfides (most of them)Salts (some of them)

Which solids are insoluble in water?

Many solids are insoluble in water, meaning they do not dissolve in water to a significant extent. Here are some examples of common solids that are generally insoluble in water:

Metals: Most metals, such as gold, silver, platinum, and copper, are insoluble in water.

Non-Metallic Elements: Many non-metallic elements, such as carbon (in the form of graphite or diamond), sulfur, phosphorus, and iodine, are insoluble in water.

Metal Oxides: Some metal oxides, particularly those of less reactive metals, are insoluble in water. Examples include aluminum oxide (Al2O3), iron(III) oxide (Fe2O3), and lead(II) oxide (PbO).

Metal Carbonates: Most metal carbonates are insoluble in water. Examples include calcium carbonate (CaCO3), lead(II) carbonate (PbCO3), and copper(II) carbonate (CuCO3).

Metal Sulfides: Many metal sulfides are insoluble in water. Examples include lead(II) sulfide (PbS), silver sulfide (Ag2S), and mercury(II) sulfide (HgS).

Insoluble Salts: Certain salts have limited solubility in water. Examples include silver chloride (AgCl), lead(II) iodide (PbI2), and calcium sulfate (CaSO4).

It's important to note that while these solids are generally insoluble in water, they may exhibit some solubility to a small extent. The solubility of a solid in water can vary depending on factors such as temperature, pressure, and the presence of other solutes.

Learn more about solubility:

https://brainly.com/question/23946616

#SPJ1

what are the harmful effects of water pollution​

Answers

Answer:

- Reduced biodiversity

- Health problems from drinking the water

- Diseases

There are various types of pollution like air pollution, water pollution , noise pollution etc. Therefore, in below given ways we can see harmful effects of water pollution​.

What is pollution?

The introduction of hazardous elements into the environment is pollution. Pollutants are the name for these dangerous substances. They can also be brought by by human activities, such as factory runoff or waste.

Following are a few harmful outcomes of water pollution: The health and existence of humans, animals, and plants are all negatively impacted by water pollution. Because it harms crops and soil fertility, polluted water is also bad for agriculture. Ocean life suffers as a result of ocean water pollution.

Therefore, in above ways we can see harmful effects of water pollution​.

To know more about pollution, here:

https://brainly.com/question/15032151

#SPJ2

Other Questions
A female is heterozygous for all three traits, and she iscrossed with a male that is homozygous recessive for all threetraits. The results of the cross are as follows:___MutantPhenotypes Read the passage.Bears on the Lewis and Clark ExpeditionCourtesy of the Library of CongressMeriwether Lewis and William Clark are best known for their expedition from the Mississippi River to the West Coast and back. The expedition, called the Corps of Discovery, was President Thomas Jefferson's visionary project to explore the American West. It began in May of 1804 and ended in September 1806. On their journey, Lewis and Clark have many interesting experiences with both people and animals.It was the largest bear they'd ever seen, a great grizzly bear that weighed an estimated 600 pounds. A "most tremendous looking animal, and extremely hard to kill," wrote Lewis in his journal on May 5, 1805. Clark described the grizzly as "very large and a terrible looking animal." Clark and another member of the expedition fired 10 shots at it before it died.Several tribes of Native Americans had told Lewis and Clark about grizzly bears. The tribes would only attack these great bears if there were 6-10 people in their hunting party, and even then the bears would sometimes kill one of them. The first grizzlies Lewis saw during the expedition were two somewhat smaller bears. He and another hunter had easily killed one of them. That day Lewis wrote in his journal that although the Native Americans with their bows and arrows might be vulnerable to bears, the grizzlies were no match for highly skilled riflemen. He soon changed his mind when he found himself alone and easy prey.Lewis was out scouting on June 15, 1805. He decided to make camp and shot a buffalo. As he was watching the buffalo fall, a grizzly bear came rushing toward him. Lewis raised his gun to shoot and then realized he had not reloaded his rifle and there was no one there to help him. The bear was getting closer. There were no trees or bushes nearby, but there was a river. Lewis quickly ran into the water. The bear followed. When the bear saw Lewis in the water, for no apparent reason he stopped and ran in the other direction. Lewis was unclear about why the bear left, but he knew he was lucky! After that he thought that the Corps (Lewis and Clark's expedition party) should not go out alone. Even at camp, he insisted they should sleep with their guns beside them in case of sudden bear attacks.Bears seemed to be everywhere! Bears chased members of the Corps through the woods, into bushes, and into the water on several occasions. On July 15, 1806, Hugh McNeal was out alone on horseback. All of a sudden he saw a grizzly bear in the bushes. His horse bucked and threw McNeal in proximity to the bear. The bear raised itself up to attack. What could McNeal do at such close range? He hit the bear with his gun. The bear was temporarily stunned and fell down. McNeal quickly climbed out of reach in the branches of a nearby tree. Because of their large size and straight claws, grizzly bears aren't good tree climbers, so the bear waited at the base of the tree. And waited. And waited. Finally just before dark, the bear gave up and left. McNeal climbed down and made it back to camp safely.By the end of the expedition Lewis believed that the Corps had been very lucky to not lose anyone to a grizzly bear. He wrote that "the hand of providence has been most wonderfully in our favor."QuestionWhich statement is a main idea of Bears on the Lewis and Clark Expedition?ResponsesNative Americans preferred using bows and arrows over rifles when hunting for grizzly bears.Native Americans preferred using bows and arrows over rifles when hunting for grizzly bears.Members of the Corp learned the importance of being prepared for bear attacks. Members of the Corp learned the importance of being prepared for bear attacks. Lewis once had to jump into the water when he encountered a bear while scouting alone.Lewis once had to jump into the water when he encountered a bear while scouting alone.While some bears can climb trees easily, grizzly bears bodies are not suited for climbing.While some bears can climb trees easily, grizzly bears bodies are not suited for climbing. sum of 4(3x + 2) 9 this is for algebra 2 explain the obstacles grace and kathryn faced to learning the truth about their circumstances? radium girls act 1 Sara is making fruit baskets. She has 27 apple and 36 oranges. Sara wants to make all the fruit baskets identical without having any pieces of fruit left over. What is the greatest number of fruit baskets Sara can make? Why is it helpful to represent fractions and division with models? (pls make answer pretty long, thanks :) Sandy wants to buy 5 pounds of apples. She has a coupon for $1.00 off for every 3 pounds of apples. She gets to the store and discovers that apples are on sale for $0.75 a pound. Is it cheaper for her to buy 5 pounds or 6 pounds? Explain. Find the area of the figure.BRAINLEST if right someone is measuring the performance of dog grooming professionals by using supervisor ratings. he or she finds that when the supervisors rate the groomers' performance, the ratings are biased because higher ratings are given to groomers who are well liked, regardless of their actual job performance. the supervisors' bias has resulted in: your class agreed to have a fundraising for the upcoming christmas party on amount of 4 pesos will be paid for the first day and will increase by one peso for each following day based on the project based on the projected budget needed each of you in the class should have 165 pesos at the end find the maximum number of days by which you can complete paying they 165 pesos To which class do honey bees belong? a. arthropoda b. insecta c. hymenoptera d. apidae list some positive benefits that the invention of the airplane has on society. Indicate the answer choice that best completes the statement or answers the question.Which two points represent integers with the same absolute value?VFTAPNU-6-5-4-3-2-1 0 1 2 3 4 5 6 calculate the cost (omit commission) of buying the 3,000 shares of apple, incorporated (aapl) at $127.60. Quand j'tais un enfant. Je nageais beaucoup le week-end. Je suis all la piscine et mon frre. J'aimais manger de la glace. Je suis alle au supermarch avec ma mre le week-end. Nous avons achet des fruits de mer, des repas et des porcs. Ma grand-mre venait nous rendre visite. Nous avons mang des mangues. J'ai dbarrass la table. J'ai fait le mnage. J'ai fait la lessive. Je suis all au stade le week-end. J'adorais le sport. Je suis all la pche. J'ai jou au baseball avec mon ami. J'ai jou au football. Je suis all skier. Il faisait mauvais. Il faisait froid. C'tait une vocation en hiver. Je suis all dans diffrents pays. J'ai pris un vol. Je suis all en Angleterre. J'ai roul en voiture pendant deux heures. J'adorais danser. Je suis alle dans une bote de nuit. J'ai invit mon ami. Nous avons mang un dessert. I am writing a small composition, talk about the thing I used to do using Imperfect and passe compose, but I think I screwed up, can someone help me correct the tense I used. Which of the following best defines average speed? It is the speed of an object in a specific direction. It is an object's speed at a specific point in time. It is the total distance traveled over the total time. It is a measure of how far an object moves in a certain time. Its worth 100 points and if you get it right you get a brainliest and get a 50 points bonus value(S)of x in the interval 0 if two similar polygons have corresponding sides that measure 6 and 8 inches respectively and the are of the smaller one si 36 sq. inches what would be the area of hte larger polygon. The radius of a circle is 4 centimeters. What is the area of a sector bounded by a 135 degrees arc? Calculate the inductance of an L C circuit that oscillates at 120 \mathrm{~Hz} when the capacitance is $8.00 \mu \mathrm{F}$.