What type of activities do you like to do and why? How can these activities help your personal physical fitness?

Answers

Answer 1

Answer:

This is opinion, but i'll share some stuff, and reasons.

Explanation:

Push-ups- Muscular Strength. When we get older, it's good to do this exercise because it provides improved muscle and bone health with aging.

Burpees- Body composition. It's important do do this exercise because it can decrease the risk of type 2 diabetes, hypertension, and heart disease, and a lean and toned body.


Related Questions

SOLVE PLS EZ FOR POINTS

SOLVE PLS EZ FOR POINTS

Answers

The substance with meting point of 240 °C and boiling point of 300  °C is hard plastics. Any volume of alcohol has an 78 °C. Candle wax have higher melting point than water.

What is boiling point ?

Boiling point of a substance is the temperature at which the substance is converts from liquid state to vapor state at which the the vapor pressure equal to the atmospheric pressure.

It is clear from the table that, substance with meting point of 240 °C and boiling point of 300  °C is hard plastics. Boiling point of a substance does not change with change in volume.

Hence, any volume of alcohol has an 78 °C. Candle wax have higher melting point than water.

Oxygen and nitrogen can be differentiated based on their densities and mass.

Find more on boiling point:

https://brainly.com/question/24168079

#SPJ1

A No. _____ THHN conductor is required for a 19.7 ampere load if the ambient temperature is 75F and there are nine current-carrying conductors in the raceway.

Answers

A No. 12 THHN conductor is required for a 19.7-ampere load if the ambient temperature is 75F and there are nine current-carrying conductors in the raceway.

To determine the size of the THHN conductor required for a 19.7-ampere load, we will need to use the ampacity tables from the National Electric Code (NEC).

The ampacity tables provide the maximum current-carrying capacity of various types and sizes of conductors based on factors such as ambient temperature and the number of current-carrying conductors in the raceway or cable.

Assuming a copper conductor, we can use NEC Table 310.15(B)(16) to find the ampacity of a No. 12 THHN conductor at an ambient temperature of 75F with nine current-carrying conductors. According to the table, the ampacity of a No. 12 THHN conductor with nine current-carrying conductors at 75F is 20 amperes.

Learn more about the THHN conductor at

https://brainly.com/question/31197467

#SPJ4

Deanna placed a 14 kg box on top of a shelf. Assuming the height of the shelf was 3. 2 meters, what was the potential energy of the box?

Answers

According to given information, the potential energy of the box is 439.04 kg m²/s². The potential energy of an object is given by the formula PE = mgh

The potential energy of an object is given by the formula PE = mgh, where PE represents potential energy, m represents mass, g represents the acceleration due to gravity, and h represents the height.

In this case, the mass of the box is 14 kg and the height of the shelf is 3.2 meters. The acceleration due to gravity is approximately 9.8 m/s².

To find the potential energy of the box, we can substitute the given values into the formula:

PE = (14 kg)(9.8 m/s²)(3.2 m)

Multiplying these values together, we find:

PE = 439.04 kg x m²/s²

Simplifying, we can conclude that the potential energy of the box is 439.04 kg x m²/s².

To know more about acceleration visit:

https://brainly.com/question/2303856

#SPJ11


Question 1
What is a Static Load
A. is a load at rest like the weight of an object the structure is supporting or the weight of the structure itself.
B. in between radio stations
C. Aload in Motion
D. A force that is equal

Answers

A. A static load is a load at rest like the weight of an object the structure is supporting or the weight of the structure itself.

how much does it cost to charge an electric car at a public charging station

Answers

Answer:

Rs 16.5 lakh is a charge of an electric car at a public charging station

Let ϕ=e x
cosy. Let ϕ represent either temperature or electrostatic potential. Refer to Problem 11 for definitions and find: (a) The direction in which the temperature is increasing most rapidly at (1,−π/4) and the magnitude of the rate of increase. (b) The rate of change of temperature with distance at (0,π/3) in the direction i+j 3

. (c) The direction and magnitude of the electric field at (0,π). (d) The magnitude of the electric field at x=−1, any y. 14. (a) Suppose that a hill (as in Fig. 5.1) has the equation z=32−x 2
−4y 2
, where z= height measured from some reference level (in hundreds of feet). Sketch a contour map (that is, draw on one graph a set of curves z= const.); use the contours z=32,19,12,7,0. (b) If you start at the point (3,2) and in the direction i+j, are you going uphill or downhill, and how fast? 15. Repeat Problem 14b for the following points and directions. (a) (4,−2),i+j (b) (−3,1),4i+3j (c) (2,2),−3i+j (d) (−4,−1),4i−3j Determine whether the fol ∑ n=1
[infinity]

(−1) n+1
n 2
+16
10n

Answers

a)  The direction in which the temperature is increasing most rapidly is the direction of the gradient vector ∇ϕ, which is ((1/√2) * e)i + ((1/√2) * e)j.

b)  The rate of change of temperature with distance at (0, π/3) in the direction i + j√3 is (√2 + √3)/(2√2) * e.

c) The direction of the electric field is opposite to the gradient vector ∇ϕ

Let ϕ = e^x * cos(y), where ϕ represents either temperature or electrostatic potential.

I'll address each part of the problem separately:

(a) To find the direction in which the temperature is increasing most rapidly at (1, -π/4), we need to calculate the gradient of ϕ and evaluate it at that point.

The gradient of ϕ is given by ∇ϕ = (∂ϕ/∂x)i + (∂ϕ/∂y)j, where i and j are unit vectors in the x and y directions, respectively.

Taking partial derivatives of ϕ with respect to x and y, we have:

∂ϕ/∂x = e^x * cos(y)

∂ϕ/∂y = -e^x * sin(y)

Evaluating the partial derivatives at (1, -π/4), we get:

∂ϕ/∂x = e * cos(-π/4) = (1/√2) * e

∂ϕ/∂y = -e * sin(-π/4) = (1/√2) * e

Therefore, the gradient of ϕ at (1, -π/4) is:

∇ϕ = ((1/√2) * e)i + ((1/√2) * e)j

The direction in which the temperature is increasing most rapidly is the direction of the gradient vector ∇ϕ, which is ((1/√2) * e)i + ((1/√2) * e)j. The magnitude of the rate of increase is given by the magnitude of the gradient vector, which is √2 * e.

(b) To find the rate of change of temperature with distance at (0, π/3) in the direction i + j√3, we need to calculate the directional derivative of ϕ in that direction.

The directional derivative is given by the dot product of the gradient vector ∇ϕ and the unit vector in the given direction.

The unit vector in the direction i + j√3 is (1/2)i + (√3/2)j.

Calculating the dot product, we have:

∇ϕ · (1/2)i + (√3/2)j = ((1/2) * (1/√2) * e) + ((√3/2) * (1/√2) * e) = (1/2√2 + √3/2√2) * e = (√2 + √3)/(2√2) * e

So, the rate of change of temperature with distance at (0, π/3) in the direction i + j√3 is (√2 + √3)/(2√2) * e.

(c) To determine the direction and magnitude of the electric field at (0, π), we can use the relationship between the electric field and the gradient of the electrostatic potential.

The electric field E is given by E = -∇ϕ, where ∇ϕ is the gradient of the electrostatic potential.

Using the gradient formula from part (a), we have:

∇ϕ = ((1/√2) * e)i + ((1/√2) * e)j

Therefore, the electric field at (0, π) is:

E = -((1/√2) * e)i - ((1/√2) * e)j

The direction of the electric field is opposite to the gradient vector ∇ϕ,

Learn more about gradient vector from the given link

https://brainly.com/question/31584935

#SPJ11

Final answer:

This response addresses various math problems related to temperature, electric fields, and contour maps. It explains how to find the direction and magnitude of the temperature change, the rate of change of temperature with distance, the direction and magnitude of the electric field, and whether you are going uphill or downhill on a hill. It also mentions that the given series cannot be evaluated without more information.

Explanation:

(a) To find the direction in which the temperature is increasing most rapidly at (1, -π/4), we need to find the gradient of ϕ at that point. The gradient is a vector that points in the direction of the steepest slope of a function. So, we take the partial derivatives of ϕ with respect to x and y and evaluate them at (1, -π/4). The direction of the gradient vector gives us the direction of the fastest increase in temperature. The magnitude of the rate of increase is the length of the gradient vector.

(b) To find the rate of change of temperature with distance at (0, π/3) in the direction i+j√3, we need to find the directional derivative of ϕ in that direction. The directional derivative measures the rate at which a function changes in the direction of a given vector. It can be found by taking the dot product of the gradient vector and the unit vector in the given direction.

(c) To find the direction and magnitude of the electric field at (0, π), we need to find the gradient of ϕ at that point. The gradient gives us the direction of the electric field, and its magnitude gives us the strength of the field.

(d) To find the magnitude of the electric field at x = -1, any y, we need to find the gradient of ϕ at (x, y) and then evaluate it at x = -1. The magnitude of the gradient vector gives us the magnitude of the electric field.

(a) The contour map for z = 32 - x^2 - 4y^2 with contours z = 32, 19, 12, 7, and 0 is a set of curves that represent points on the surface of the hill with the same height. Each contour corresponds to a different height level.

(b) To determine if you are going uphill or downhill and how fast from the point (3, 2) in the direction i+j, you need to find the gradient of the hill function at (3, 2) and take the dot product of the gradient vector and the unit vector in the given direction. The sign of the dot product tells us the direction of the slope (uphill or downhill) and the magnitude tells us how fast you are going.

(a) To determine if you are going uphill or downhill and how fast from the point (4, -2) in the direction i+j, you need to find the gradient of the hill function at (4, -2) and take the dot product of the gradient vector and the unit vector in the given direction. The sign of the dot product tells us the direction of the slope (uphill or downhill) and the magnitude tells us how fast you are going.

(b) To determine if you are going uphill or downhill and how fast from the point (-3, 1) in the direction 4i+3j, you need to find the gradient of the hill function at (-3, 1) and take the dot product of the gradient vector and the unit vector in the given direction. The sign of the dot product tells us the direction of the slope (uphill or downhill) and the magnitude tells us how fast you are going.

(c) To determine if you are going uphill or downhill and how fast from the point (2, 2) in the direction -3i+j, you need to find the gradient of the hill function at (2, 2) and take the dot product of the gradient vector and the unit vector in the given direction. The sign of the dot product tells us the direction of the slope (uphill or downhill) and the magnitude tells us how fast you are going.

(d) To determine if you are going uphill or downhill and how fast from the point (-4, -1) in the direction 4i-3j, you need to find the gradient of the hill function at (-4, -1) and take the dot product of the gradient vector and the unit vector in the given direction. The sign of the dot product tells us the direction of the slope (uphill or downhill) and the magnitude tells us how fast you are going.

The given series, ∑[infinity](−1)^(n+1)/(n^2+16)/(10n), can be simplified into a summation series. However, it is incomplete and may contain typos or irrelevant parts, so it cannot be evaluated further without additional information or corrections.

Learn more about Temperature, Electric Fields, Contour Maps here:

https://brainly.com/question/32301310

#SPJ12

The battleship and enemy ships A and B lie along a straight line. Neglect air friction. A battleship simultaneously fires two shells with the same initial velocity at these two enemy ships. If the shells follow the parabolic trajectories shown in the figure, which ship gets hit first?
1. need more information
2. both hit at the same time
3. A
4. B

The battleship and enemy ships A and B lie along a straight line. Neglect air friction. A battleship

Answers

Answer:   A

Explanation:

it is closer

What is Justice according to philosophy​

Answers

Answer:

justice. just in nature.

Explanation:

the concept of a proper proportion between a person's deserts (what is merited) and the good and bad things that befall or are allotted to him or her. ... Aristotle's discussion of the virtue of justice has been the starting point for almost all Western accounts.

Pls Help Thx!! I’d Really Appreciate It

Pls Help Thx!! Id Really Appreciate It

Answers

The charge on the moving particle is -5.38 x 10^-21 C and the potential difference between the two locations is 1300 V.

How do we calculate?

The formula for the electrical potential energy of a charge in an electric field is shown below:

ΔPE = qΔV

The given values are: :

distance moved, d = 4.0 m

magnitude of electric field, E = 325 N/C

change in potential energy, ΔPE = -6.9 x 10^-19 J

The  work done by the electric field on a charge q as it moves a distance d in the direction of the field is:

W = -ΔPE = qEd

solving for  the charge q as:

q = -ΔPE/Ed = -(6.9 x 10^-19 J)/(325 N/C × 4.0 m) = -5.38 x 10^-21 C

we can use the formula shown below to find the potential difference between the two locations, :

ΔV = Ed

ΔV = E × d = 325 N/C × 4.0 m = 1300 V

Learn more about potential difference  at: https://brainly.com/question/24142403

#SPJ1

ball is thrown upward from a window that is 12 m above the ground.  The ball reaches a maximum height of 4 m above the window before falling all the way down to the ground.  What distance did the ball travel?​

Answers

Answer:

20 m

Explanation:

The ball travels 4 m up, then 16 m down.  It travels a total distance of 20 m.

What is the total energy of a proton moving with a speed of 0.83c, (in MeV)? You Answered A. 2,049.8843 B. 1,682.2043 margin of error +/- 1%

Answers

The total energy of a proton moving with a speed of 0.83c is approximately 1,682.2043 MeV.

To calculate the total energy of a particle in the context of special relativity, we need to consider the relativistic energy equation.

We can calculate the Lorentz factor using the formula γ = 1 / sqrt(1 - (v/c)²), where v is the velocity of the particle and c is the speed of light.

Substituting the values into the equation, we get γ = 1 / sqrt(1 - (0.83c/c)²) = 1 / sqrt(1 - 0.6889) ≈ 1 / sqrt(0.3111) ≈ 1 / 0.5577 ≈ 1.7927.

Next, we multiply the Lorentz factor by the rest mass of the proton. The rest mass of a proton is approximately 938.27 MeV/c². Multiplying the Lorentz factor by the rest mass, we get E = 1.7927 * 938.27 MeV/c² ≈ 1,682.2043 MeV.

Therefore, the total energy of the proton moving at 0.83c is approximately 1,682.2043 MeV.

To learn more about proton, Click here:

https://brainly.com/question/32233047

#SPJ11

A ball is thrown vertically upward. As it rises, what happens to its potential energy?​

Answers

Answer:

Explanation:

As the ball rises, its PE increases because the potential energy is equal to the mass of the ball times gravity times the height of the ball. The higher the height, the higher the PE.

Answer:

According to the law of conservation of energy its kinetic energy is getting converted in to potential energy because of gain in height. So, if the velocity of a ball goes on decreasing when it is thrown vertically upwards. When its velocity becomes zero, its potential energy becomes maximum.

How far is the sun, alpha centauri A, Sirius B, Bernard's Star, Sirius A, and Proxima Centauri from the earth in light years

Answers

The distance of sun, alpha centauri A, Sirius B, Bernard's Star, Sirius A, and Proxima Centauri from the earth is 1.578 * \(10^{-5}\), 4.367, 8.611, 5.978, 8.611 and 4.264 light years.

The distance of the planet Earth from other celestial bodies are as mentioned below:

Sun = 1.578 * \(10^{-5}\) Light yearsAlpha Centauri A = 4.376 Light yearsSirius B = 8.611 Light yearsBernard's Star = 5.978 Light yearsSirius A = 8.611 Light yearsProxima Centauri = 4.264 Light years

A light year is measure of distance. It is distance covered by a light particle in a period of one year. Light travels at the speed of 3 * \(10^{8}\) m / s. So one light year will be equal to a distance of 9.46 trillion kilometers.

Therefore, the distance from Earth to

Sun = 1.578 * \(10^{-5}\) Light yearsAlpha Centauri A = 4.376 Light yearsSirius B = 8.611 Light yearsBernard's Star = 5.978 Light yearsSirius A = 8.611 Light yearsProxima Centauri = 4.264 Light years

To know more about light years

https://brainly.com/question/1302132

#SPJ1

Describe an object's velocity when an acceleration-time graph is zero?

Answers

Anything times zero is zero

At a drag race, a jet car travels 1/4 mile in 5.2 seconds. What is the final speed of the
car and its acceleration?

Answers

Answer:

1609.3

Explanation:

Device A has a current of 0.4 A and a resistance of 3 Ω. Device B has a current of 0.6 A and a resistance of 3Ω. Which device would be more energy efficient?

Answers

Your answer would be Device A.

Answer:

Device A because it would use more voltage :D

Explanation:

Calculate the gravitational force between two 112 kg objects located 100 m from each other

Answers

The gravitational force between the two objects is 8.37×10^-11 N

What is Newton Law of universal gravitation?

Newton Law of universal gravitation states that the force of attraction or repulsion between two object is directly proportional to the product of their masses and inversely proportional to the square of the distance between them. From the law

This means that F = G×(mass1 × mass2)/(radius)²

Where G is the gravitational constant ,which is given as 6.67×10^-11 Nm²/kg² and r is the distance between them

the force between two objects with masses 112kg is F= 6.67×10^-11×112²/100²

F= 8.37×10^-11/10000

F= 8.37×10^-11 N

therefore the force of gravity between the two objects is 8.37×10^-11 N

learn more about Newton law of universal gravitation from

https://brainly.com/question/9699135

#SPJ1

A student pushes against a wall with 20N of force and the wall does not move. In this situation, the wall exerts -
F 0N of force.
G 20N of force.
H less than 20N of force.
J more than 20N of force.

Answers

Answer:

G 20N of force

Explanation:

Every action has an equal and opposite reaction. The wall exterts as much force as you push on it.

Answer:

It is g

Explanation:

The wall is not moving nor is the kid therefore the force is equal

9. A speedboat engine exerts 90000 W of power in moving the boat through the water. The velocity of the boat is 1P = 5 m/s. What force does the engine apply to do this?

P = F x V

Answers

Answer:

it g hope it helps you out

A ball of mass 0.440 kg moving with a speed of 3.70 [m / s] collides head-on with a 0.220 [kg] ball at rest. If the 0.440 [kg] ball moves at 1.23 [m / s] in its original direction, what is the speed of the 0.220 [kg] ball after the collision?

Answers

Answer:  3.0 m/s

Explanation:

Conservation of momentum:  total momentum before collision = total momentum after collision

momentum = p = mv

(0.440 kg)(3.70 m/s) + (0.220 kg)(0.0 m/s) = (0.440 kg)(1.23 m/s) + (0.220 kg)(x)

Solve for x, speed of the 0.220 kg ball after the collision:

1.628 + 0 = 0.54x

x = 1.628/.54 = 3.0 m/s

Which of these abundance patterns is an unrealistic
chemical composition for a star?
A. 70% H, 28% He, 2% other
B. 95% H, 5% He, less than 0.02% other
C. 75% H, 25% He, less than 0.02% other
D. 72% H, 27% He, 1% othe

Answers

The unrealistic chemical composition for a star is 95% H, 5% He, less than 0.02% other. The correct option is B).

The reason is that stars primarily consist of hydrogen (H) and helium (He), with trace amounts of other elements. Hydrogen is the most abundant element in the universe, and helium is the second most abundant. Hence, it is reasonable to have a high percentage of hydrogen and a significant portion of helium in a star's composition.

Option B deviates from this pattern by having an excessively high percentage of hydrogen (95%) and an unusually low percentage of helium (5%).

It is highly unlikely to find a star with such a high hydrogen content because the fusion processes in stellar cores convert hydrogen into helium, leading to a lower proportion of hydrogen as compared to helium.

Furthermore, the extremely low concentration of other elements (less than 0.02%) in option B suggests an improbable absence of heavier elements typically found in stars. Therefore, the correct option is B).

To know more about chemical composition, refer to the link :

https://brainly.com/question/1194814#

#SPJ11

we divide the electromagnetic spectrum into six major categories of light, listed below. rank these forms of light in order of increasing wavelength
- ultraviolet
- gamma rays
- radio waves
- visible light
- infrared
- X rays

Answers

Ranking the forms of light in order of increasing wavelength:
1. Gamma rays, 2. X-rays, 3. Ultraviolet, 4. Visible light, 5. Infrared, 6. Radio waves.

In this order, the wavelengths increase from shorter to longer as we move from gamma rays to radio waves. The electromagnetic spectrum is a continuum of electromagnetic waves arranged in order of increasing wavelength. Gamma rays have the shortest wavelength and the highest energy, followed by X-rays, ultraviolet, visible light, infrared, and radio waves with progressively longer wavelengths. This ranking represents the arrangement of these forms of light from shortest to longest wavelengths.

To know more about electromagnetic spectrum, click here https://brainly.com/question/16236894

#SPJ11

12 A car travels in a straight line at speed v along a horizontal road. The car moves
against a resistive force F given by the equation
F = 400+kv²
where F is in newtons, v in ms-1 and k is a constant.
At speed v = 15ms-1, the resistive force F is 1100 N.
a
Calculate, for this car:
i the power necessary to maintain the speed of 15ms-¹,
ii the total resistive force at a speed of 30 ms-¹,
iii the power required to maintain the speed of 30ms-¹.

Answers

Answer:

i) Power = Force * Velocity = 1100 * 15 = 16500 W = 16.5 kW(ii)  Find the value of k first: F = 400 + k(15^2)                                              k = 28/9    F = 400 +(28/9)(30^2) = 320

Explanation:

a. The power necessary to maintain the speed of 15ms^-1 can be found using the equation for power, P = Force * velocity, where P is in watts, force is in newtons and velocity is in meters per second. Substituting the values given in the question, we get:

P = (400 + k * 15²) * 15
P = (400 + 11250) * 15
P = 11650 Watts

Therefore, the power necessary to maintain the speed of 15ms^-1 is approximately 11650 Watts.

b. The total resistive force at a speed of 30ms^-1 can be found by substituting 30 for v in the force equation:

F = 400 + k * 30^2

F = 12000 N

Therefore, the total resistive force at a speed of 30ms^-1 is approximately 12000 N.

c. The power required to maintain the speed of 30ms^-1 can be found using the same equation as in part a:

P = (400 + k * 30^2) * 30
P = (1500 + 600000) * 30
P = 625000000 Watts

Therefore, the power required to maintain the speed of 30ms^-1 is approximately 625000000 Watts. This is a very large amount of power and would require a significant amount of energy to maintain.

What is the strength of the electric field at the position indicated by the dot in the figure?
E = _____ N/C
What is the direction of the electric field at the position indicated by the dot in the figure? Specify the direction as an angle above the horizontal line.
θ = ____ ⁰

Answers

The electric field has an angle of 0 degrees and a magnitude of 2546.35 N/C.

What is electric field?

An electric field is a physical field that surrounds electrically charged particles and acts as an attractor or repellent to all other charged particles in the vicinity. It can also refer to a system of charged particles' physical field. Each location in space where a charge exists in any form can be considered to have an electric field attached to it. The electric force per unit charge is another name for an electric field. E = F/Q is the formula for the electric field. Volts per meter is the SI unit for the electric field. The Newton's per coulomb unit is the same as this one. Newton is a unit of force and Coulomb is a unit of energy in these derived units.

Here,

E=kq/r^2

r= 5 x r^2 = 7.07 cm or .0707 m

E=(9 x 10^9)(1 x 10^-9)/(.0707)^2

= 1800.5 N/C

Now to find the x component,

cos 45 = x/1800.5

x= 1273.18 N/C

Now just multiply by 2 to accommodate both charges,

E=2546.35 N/C in direction of 0 degrees

The electric field has a magnitude of 2546.35 N/C and an angle of 0 degrees.

To know more about electric field,

https://brainly.com/question/15800304

#SPJ4

According to current FDA rules on "cola" drinks, ________.

Answers

Answer:

6 Mg caffeine per ounce

Explanation:

According to current FDA rules on "cola" drinks,

✓ They cannot contain more than 6 mg caffeine per ounce.

2. Two vectors with magnitudes of 1 meters and 3 meters cannot have a resultant of (5.0 points)
3 meters
4 meters
O meters
2 meters

Answers

Answer:

the correct answer is 3 meters

What is the energy density inside of a 1 m long coil with 2000 turns that carries 25 a?

Answers

The energy density inside a coil can be calculated using the formula:

Energy density (u) = (1/2) * (μ₀ * B^2)

Where u is the energy density, μ₀ is the permeability of free space, and B is the magnetic field strength.

The magnetic field strength (B) inside a solenoid (coil) is given by:

B = μ₀ * n * I

Where μ₀ is the permeability of free space, n is the number of turns per unit length, and I is the current flowing through the coil.

Given:

Length of the coil (l) = 1 m

Number of turns (n) = 2000

Current (I) = 25 A

First, we need to calculate the magnetic field strength (B) inside the coil:

B = μ₀ * n * I

Next, we can calculate the energy density (u) using the magnetic field strength:

u = (1/2) * (μ₀ * \(B^2\))

Let's substitute the given values into the formulas:

B = μ₀ * n * I

B = (4π × \(10^{-7}\)) T·m/A) * (2000 turns/m) * 25 A

Calculate the value of B.

Once we have the value of B, we can calculate the energy density (u):

u = (1/2) * (μ₀ * \(B^2\))

Substitute the value of B and evaluate the expression to find the energy density inside the coil.

To learn more about energy density visit:

https://brainly.com/question/29559959

#SPJ11

the water pressure at the mid-ocean ridges exceeds times greater than atmospheric pressure at sea level.question 44 options:1000 or more500-700100-300300-500700-900

Answers

The mid-ocean ridges are underwater mountain ranges that run through the center of the Earth's oceans. They are formed by the movement of tectonic plates, which causes volcanic activity and the creation of new oceanic crust. The water pressure at the mid-ocean ridges is extremely high due to the depth of the ocean and the weight of the water above it.

At sea level, the atmospheric pressure is around 1013 millibars or 14.7 pounds per square inch (psi). In contrast, the water pressure at the depths of the mid-ocean ridges can reach up to 11,000 pounds per square inch (psi), which is more than 1000 times greater than atmospheric pressure at sea level. This extreme pressure makes it difficult for humans and equipment to explore and study the deep ocean environments found at the mid-ocean ridges.

To know more about oceans refer here

https://brainly.com/question/9081383#

#SPJ11

4.
An "extreme" pogo stick utilizes a spring whose uncompressed length is 46 cm and whose force constant is 1.4 x 104 N/m. A 60-kg person is jumping on the pogo stick,
compressing the spring to a length of only 5.0 cm at the bottom of their jump. Which is the upward acceleration of the person at the moment the spring reaches its greatest
compression at the bottom of their jump?
6 m 2​

Answers

Answer:

a = 85.9 m / s²

Explanation:

For this exercise we can use Newton's second law in the most compressed part

             F - W = m a

force is the spring elastic force

             F = - k Δx

          k Δx - m g = m a

          a = k/m  Δx - g

         Δx = x₀ -\(x_{f}\)

         ΔX = 46 - 5 = 41cm (1m / 100cm) = 0.41  m

let's calculate

          a = 1.4 10⁴/60 0.41 - 9.8

          a = 85.9 m / s²

which two actions would strengthen an electromagnet?

A. Add and ammeter into the circuit.
B. Decrease the size of the permanent magnet in the circuit.
C. increase the number of wraps of wire around the core.
D. Replace the magnetic core with aluminum nails.
E. Connect a second battery in the circuit.

please help!!!!, ONLY ANSWER IF YOU KNOW IT

Answers

Answer:

C. increase the number of wraps of wire around the core.

E. Connect a second battery in the circuit.

Explanation:

got the question current on a p e x

increase the number of wraps of wire around the core and Connect a second battery in the circuit are the two actions would strengthen an electromagnet.

what are the types of wiring ?

The  distribution electrical power  through wires in a perfect manner inside a building or a room with better load control is known as electrical wiring.

Different types of wiring such as Tee system or Joint box system where the connection of appliances is done with this wiring, which does not  consume too much cable size.

Loop-in system means the system is used in lamps and other appliances are parallelly connected so that each appliance is controlled individually.

Cleat Wiring consists of ordinary VIR or PVC insulated wires is compounded on walls and ceilings by means of porcelain cleats, wood, or plastic, temporary system and is not suitable for domestic usage. For example, used in an under-construction building.

For more details wire, visit

brainly.com/question/9910056

#SPJ5

Other Questions
although originally developed for use by the united states military, many believe the innovation that will surpass the telephone and television in global importance is the if the bookstore pays $60 to the publisher what will be the selling price? Consider the reaction between NiS2 and O2:2NiS2(s)+5O2(g)2NiO(s)+4SO2(g) When 11.2 g of NiS2 are allowed to react with 5.43 g of O2, 4.29 g of NiO are obtained.Determine the theoretical yield of NiO for the reaction. Determine the percent yield for the reaction. when the apc is greater than 1, the aps must beA) Equal to 1.B) Greater than 1 also.C) Between 0 and 1.D) Negative. According to the US Constitution, states have legislative powers that a. are delegated to the federal government. b. relate to currency, the economy, and trade. c. are not assigned to the federal government. d. relate to the declaration of war and the military. Investors bragged about their investing expertise during the stock market rally between 1996 and early 2000, then blamed analysts, brokers, and the Federal Reserve when the market imploded in 2000. What type of bias were these investors most probably guilty of ____________. In dna replication what is the difference between the leading and lagging strands. what quote from the passage, "Shakespeare's Other World," describe the author's main purpose in the passage? Which sentence contains an error?A. The data revealed that one in three children contract lice each year.B. Sources say the chicken pox epidemic affected twenty-seven children at the school.C. Five children were taken to the hospital after the crash.D. The school was given $37,000 to buy new computer equipment.I'll mark as brainliest Find the unknown lights in the right triangle. If necessary, approximate the length to the nearest thousandth community health status and long-term outcomes in 1-year survivors of autologous and allogeneic hematopoietic cell transplantation helpWhat minor injury does Jim suffer in chapters 19-21 of Treasure Island?A. A black eyeB. A sprained ankleC. A broken toeD. A cut across the knuckles A)Choose and write the indirect object pronoun the best fits the sentence.1) A nosotros gusta practicar deportes.(les/nos)2)A mi padre gusta estar en casa. (le/les)3)A .. gusta mucho usar la computadora. (te/me)4) A ustedes gusta correr en el parque? (les/nos)5)A migusta ir de compras. (te/me)B)Use the right form of the verb "llevar" to complete the sentences.1) Maria una vestido amarillo muy bonito.2) Yo a la escuela el uniforme de sexto grado.3)Carlota y yo pantalones cortos al juego de futbol.4) Y t, Que alla fiesta de tus amigos? 68 divided by 0.4Show work please is a technology that uses mirrors and lenses to reflect and concentrate solar radiation from a large area into one place.A. EncapsulationB. DopingC. IslandingD. Concentrating solar power (CSP) The Claims that Darius1 made about him self with what he actually did it? a copyright is the exclusive right to distribute, display, perform, or reproduce an original work in copies or to prepare derivative works based on the work. Record the issue of 4,000 shares of $5 par value common stock for $35000 cash An article presents a study of the failure pressures of roof panels. A sample of 15 panels constructed with 8-inch nail spacing on the intermediate framing members had a mean failure pressure of 8.48 kPa with a standard deviation of 0.96 kPa. A sample of 15 panels constructed with 6-inch nail spacing on the intermediate framing members had a mean failure pressure of 9.93 kPa with a standard deviation of 1.02 kPa. Can you conclude that 6-inch spacing provides a higher mean failure pressure Burruss Company developed a static budget at the beginning of the company's accounting period based on an expected volume of 7,000 units: Per Unit Revenue$8.00 Variable costs 3.00 Contribution margin$5.00 Fixed costs 3.00 Net income$2.00 If actual production totals 8,000 units, which is within the relevant range, the flexible budget would show fixed costs of: