What type of bond is produced between the following atoms and provide numerical evidence 1. Li and F2. CI and CI3 C and O4 CA and S

Answers

Answer 1

Answer:

1. Ionic bond

2. Nonpolar covalent

3. Polar covalent

4. Polar covalent

Explanation:

Depending on the difference of electronegativity between elements, bonds can be classified into:

- Nonpolar covalent: less that 0.4

- Polar covanlent: between 0.4 and 1.7

- Ionic: more that 1.7

In this case, we have to calculate the difference of electronegativity:

- Li electronegativity: 1

- F electronegativity: 4

- Cl electronegativity: 3.2

- C electronegativity: 2.6

- O electronegativity: 3.4

- Ca electronegativity: 1

- S electronegativity: 2.6

• Li and F:

4 - 1 = 3 (Ionic bond)

• Cl and Cl:

3.2 - 3.2 = 0 (Nonpolar covalent)

• C and O:

3.4 - 2.6 = 0.8 (Polar covalent)

• Ca and S:

2.6 - 1 = 1.6 (Polar covalent)


Related Questions

01:58
Which is the amount of matter in an object?
weight
mass
volume
pounds

Answers

The answer for this question is Mass

50 points, and I’ll mark as brainliest!!!!!
Tasks are in the picture.

50 points, and Ill mark as brainliest!!!!!Tasks are in the picture.

Answers

pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.

Thus, The pH of a solution is defined mathematically as the negative logarithm of the molar concentration of hydrogen ions therein.

NaOH is a strong alkaline, as indicated by a pH testing strip, but in order to determine its exact pH, you must first determine its molarity.

A scale known as pH is used to describe how basic or acidic a water-based solution is. Basic solutions have a higher pH than acidic solutions, which have a lower pH.

Thus, pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.

Learn more about pH, refer to the link:

https://brainly.com/question/15289741

#SPJ1

The pH of HNO₂ is 2.15, pH of NH₄OH is 10.98 and pH of H₂S is 3.76.

pH is defined as the negative logarithm of H⁺ ion concentration.

pH is a measure of how acidic or basic a substance is. In our everyday routine, we encounter and drink many liquids with different pH. Water is a neutral substance. Soda and coffee are often acidic.

The pH is an important property, since it affects how substances interact with one another and with our bodies. In our lakes and oceans, pH determines what creatures are able to survive in the water.

Given,

1. Concentration = 0.1

Ka = 4.5 × 10⁻⁴

\(pH = \frac{1}{2} (pka - log c)\)

pH = 0.5 × ( 3.3 + 1)

= 2.15

2.  Concentration = 0.05

Ka = 1.8 × 10⁻⁵

\(pOH = \frac{1}{2} (pkb - log c)\)

pOH = 0.5 × ( 4.74 + 1.3)

= 3.02

pH = 14 - pOH

= 14 - 3.02

= 10.98

3. Concentration = 0.3

Ka = 1 × 10⁻⁷

\(pH = \frac{1}{2} (pka - log c)\)

pH =  0.5 × ( 7 + 0.52)

= 3.76

Learn more about pH, here:

https://brainly.com/question/15289714

#SPJ1

The image below shows uncharged particles bouncing around.
State of Matter
Which state of matter is most likely represented in the image? (5 points)

Gas
Solid

Liquid

Plasma

The image below shows uncharged particles bouncing around.State of MatterWhich state of matter is most

Answers

This problem is providing information about the states of matter and a given diagram showing a molecular arrangement it has. Thus, we can start off by analyzing the attached file, which shows molecular arrangements and movements each state exhibits.

Solids are quite organized so that they are able to form molecular networks in which molecules vibrate but do not displace anywhere. Liquid molecules are close enough to have small movements and vibrations but are not able to form any organized network.

Gases, however, exhibit no molecular organization but large movements inside the container whose walls the gas constantly crash against. Plasma do not have any order neither yet it contains ions.

In such a way, since the given diagram do not have any apparent order or ion, we infer this is about a gas that moves into the container and crash against its walls.

Learn more:

https://brainly.com/question/18538345https://brainly.com/question/9402776
The image below shows uncharged particles bouncing around.State of MatterWhich state of matter is most

I NEED HELP ASAPPPPP!!!!!!!

Objects with similar volume always have the same mass.

True or false?

Answers

The answer is true !!!!!

Which of the following statements about substances X and Y are true? Assume ideal behavior.

Choose one or more:
A. Y is the solvent in this solution.

B. The presence of Y in the solution lowers the vapor pressure of X.

C. If Y were not present, there would be more X particles in the gas above the liquid solution.

D. Pure Y has a higher vapor pressure than pure X.

Which of the following statements about substances X and Y are true? Assume ideal behavior.Choose one

Answers

The statements about substances X and Y are true are Y is the solvent in this solution, The presence of Y in the solution lowers the vapor pressure of X and if Y were not present, there would be more X particles in the gas above the liquid solution. Therefore, option A, B and C are correct.

What is the solution ?

A mixture in which one substance dissolves in the other is called a solution. The solute is the substance that dissolves. The solvent is the substance that does not dissolve. Salt water is an example of a solution.

In a mixture called a solution, every component is well combined. Solutions can contain solids, liquids, and gases and are regarded as homogenous mixes. A solute and a solvent makeup a solution. Any substance that dissolves in a solvent is referred to as a solute.

Thus, option A, B and C are correct.

To learn more about the solution, follow the link;

https://brainly.com/question/1616939

#SPJ1

Why does reducing solute particle size increase the speed at which the solute

dissolves in water?

A. It makes the temperature of the water significantly higher.

B. It exposes morg of the solute to the water molecules.

C. It makes the water molecules move around faster.

O

D. It raises the pressure of the water molecules on the solute.

Answers

Answer: B. It exposes more of the solute to the water molecules.

Explanation:

Rate of a reaction is dependent on following factors:

a) adding a catalyst: Adding a catalyst increases the rate of reaction

b) reducing the surface area: The rate of the reaction will decrease by reducing the surface area

c) raising the temperature: Increasing the temperature increases the rate of the reaction.

d) increasing the amount of reactants : Increasing the amount of reactants increases the rate of reaction.

If the reactants are present in smaller size, more reactants can react as decreasing the size increases the surface area of the reactants which will enhance the contact of molecules. Hence, more products will form leading to increased rate of reaction.

Thus reducing solute particle size increase the speed at which the solute dissolves in water by exposing more of the solute to the water molecules.

Answer:

B. It exposes more of the solute to the water molecules.

932.7 mol ÷ 30.737 L​

Answers

Answer:

the answer is

963.437 L

Explanation:

hope this helps:)

The gas in the discharge cell of a laser contains (in mole percent) 11% CO2, 5.3% N2, and 84% He. (a) What is the molar mass of this mixture

Answers

Answer:

\(MM_{mixture}=9.68g/mol\)

Explanation:

Hello!

In this case, since the molar mass of gaseous mixtures can be determined via a weighted average containing the molar mass of each gas and the mole fraction (mole percent divided by 100) as shown below:

\(MM_{mixture}=x_{CO_2}M_{CO_2}+x_{N_2}M_{N_2}+x_{He}M_{He}\)

Now, we plug in to obtain:

\(MM_{mixture}=0.11*44g/mol+0.053*28+0.84*4\\\\MM_{mixture}=9.68g/mol\)

Best regards!

A powder contains feso47h2o

Answers

The mass of FeSO4*7H2O in the sample is 1.21 grams.

Calculate moles of Fe2O3

moles of Fe2O3 = mass of Fe2O3 / Molar mass of Fe2O3

moles of Fe2O3 = 0.348 grams / 159.69 g/mole = 0.00218 moles

Calculate moles of Fe

4 Fe + 3O2 → 2Fe2O3

For 4 moles of Fe consumed there is 2 moles of Fe2O3 produced

This means it has a ratio 2:1

So 0.00218 moles of Fe2O3 produced , there is 2*0.00218 = 0.00436 moles of Fe consumed

Calculate moles of FeSO4*7H2O

Fe + H2SO4 + 7H2O → FeSO4*7H20 + H2

For 1 mole of Fe consumed there is 1 mole of FeSO4*7H2O produced

This means for 0.00436 moles there is 0.00436 moles of Fe2SO4*H2O produced

Calculate the mass of FeSO4*7H2O in the sample

mass of FeSO4*7H2O = 0.00436 moles * 278.01 g/mole = 1.212 g

The mass of FeSO4*7H2O in the sample is 1.21 grams.

Complete question: A powder contains FeSO4⋅7H2O (molar mass=278.01 g/mol), among other components. A 3.930 g sample of the powder was dissolved in HNO3 and heated to convert all iron to Fe3+. The addition of NH3 precipitated Fe2O3⋅xH2O, which was subsequently ignited to produce 0.348 g Fe2O3. What was the mass of FeSO4⋅7H2O in the 3.930 g sample?

To learn more about Molar mass visit:https://brainly.com/question/12127540

#SPJ9

i just told the guy i like that I like him and he said he wants to get to know me better before making a decision. but now everything feels different. he's been really distant. what does that mean and how do I stop getting so attached?

Answers

Answer: you have to talk to someone who wont mind wanting to wanting to like you a lot like that.

Explanation:  I wish I could be able to talk to someone who would want to get to like me like that, so its a very relatable situation.

Describe how this instrument works.

Operation:

Describe how this instrument works.Operation:

Answers

Answer:

Microscope

Explanation:

Answer:

its a telescope you see stars or plants

Explanation:

The pH at the Half-equivalence point of a weak base - strong acid tritation is:
A. Equal to pka
B. Equal to pKb
C. Less than 7.0
D. Equal to 7.0
E. Greater than 7.0

Answers

Answer:

Less than 7

Explanation:

during the titration of strong acid and weak base, the weak base is usually kept in the flask and strong acid is kept in the burette. So when we add strong acid slowly drop by drop, slowly the pH level of solution starts to decrease and at equivalence point the acid overpowers the base as a strong acid was taken over a weak base.

someone pls help T-T

100 points

someone pls help T-T100 points

Answers

Layer 1 because it is closest to the surface

For Hydrogen bonding H atom needs to be bonded to which other atoms?

Answers

Answer:

Hydrogen bonding occurs when a hydrogen atom is covalently bonded to N, O, or F atom.

Why do elements not have a numerical value for standard heats of formation and Free energies of formation but do have a numerical value for standard molar entropies?

Answers

Because it takes no energy to generate a naturally occurring compound, the enthalpy of formation for an element in its elemental state will always be 0.

What do you mean by formation standard free energies?

The free energy shift that happens when 1 mole of a material is created from its component elements in their standard states is referred to as the standard free energy of formation. The standard free energy of production of a pure element in its standard state is zero.

The distinction between Gibbs free energy and standard free energy is that the former is dependent on the experimental circumstances, whilst the latter describes the Gibbs free energy for reactants and products in their standard state.

learn more about standard free energy

https://brainly.com/question/14415025

#SPJ1

What is the mass percentage of C in morphine, C₁7H19NOs? Provide an
answer to two decimal places.

What is the mass percentage of C in morphine, C7H19NOs? Provide ananswer to two decimal places.

Answers

The mass percentage of C in morphine would be 4.21%.

What is mass percentage?

The mass percentage of a composition in a compound is the mass of the composition relative to the mass of the entire compound. This can be mathematically expressed as:

Mass percentage = mass of component/mass of substance x 100%

In this case, we are looking for the mass percentage of C in \(C_{17}H_{19}NO_3\).

Molar weight of C = 12 g/mol

Molar mass of  \(C_{17}H_{19}NO_3\) = (12x17) + (1x19) + (14x1) + (16x3)

                                             = 285 g/mol

Mass percentage of C = 12/285

                                     = 4.21% to 2 decimal places.

In other words, the mass percentage of C in morphine is 4.21%.

More on mass percentage can be found here: https://brainly.com/question/16885872

#SPJ1

What is the percent of S in
CuSO4?
(Cu = 63.55 g/mol, S = 32.07 g/mol,
O = 16.00 g/mol)
[?]% S

Answers

The percentage of the sulfur (S) in the compound CuSO₄ is 20.1 %.

What is the mass percentage?

The percentage of an element in a compound can be determined as the number of parts by mass of that element present in 100 parts by mass of the given compound.

First, calculate the molecular mass of the given compound by the addition of the atomic masses of all the present elements in the molecular formula. Then, the percentage of the elements can be determined by dividing the total mass of the element by the molar mass of the compound multiplied by 100.

Given, the atomic mass of copper, sulfur, and oxygen is 63.55 g, 32.07 g, and 16.0g respectively.

The molecular mass of CuSO₄ =  63.55 + 32.07 + 4(16.0)  = 159.62 g

The mass percentage of the sulphur = (32.07/159.62) × 100 = 20.1 %

Therefore, the mass percentage of the sulfur is equal to 20.1 %.

Learn more about  the mass percentage, here:

brainly.com/question/16750428

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

1. Write a balanced equation for each of the following reactions. Be sure to include the state of matter for each reactant and product.
b) Solid calcium cyanide and liquid water react to generate calcium hydroxide and hydrogen cyanide, both in solution.

Answers

The balanced equation for the reaction between solid calcium cyanide and liquid water to generate calcium hydroxide and hydrogen cyanide would be \(Ca(CN)_2 (s) + 2H_2O(l)-- > Ca(OH)_2 (aq) + 2HCN (aq)\)

Balancing chemical equations

The reaction between solid calcium cyanide and liquid water to generate calcium hydroxide and hydrogen cyanide would be written as follows:

The chemical formula of solid calcium cyanide = \(Ca (CN)_2 (s)\)

The chemical formula of liquid water = \(H_2O (l)\)

The chemical formula of calcium hydroxide in solution = \(Ca(OH)_2 (aq)\)

The chemical formula of hydrogen cyanide in solution = \(HCN (aq)\)

Bringing all the species together, the equation for the reaction would be:

\(Ca(CN)_2 (s) + H_2O(l)-- > Ca(OH)_2 (aq) + HCN (aq)\)

But the above equation is not balanced. The number of hydrogen and cyanide atoms is not balanced. Balanced chemical equations always have an equal number of every atom in the reactants and in the products.

Thus, the balanced equation of the reaction would be;

\(Ca(CN)_2 (s) + 2H_2O(l)-- > Ca(OH)_2 (aq) + 2HCN (aq)\)

More on balancing chemical equations can be found here: https://brainly.com/question/28294176

#SPJ1

how can natural selection can cause organisms to change over generations.

Answers

Answer:

Natural selection changes how well a species can survive in an environment.

Explanation:

I'm not the best at biology, but natural selection a term we use that's describes nature's way of choosing the strongest to survive. The species with the strongest adaptations will survive while the others will die off. For example, if a school of fish was forced to live in a colder habitat than usual, over many years some fish will adapt to that environment and be able to withstand it. But, some fish won't get those adaptations and be killed off. But, future generations will be born with that ability to withstand the cold environment and it would become normal. So, natural selection changes the way a species lives. Hope this helps

Provide the Whole-number mole-ratio of O2 when the hydrocarbon C[X] H[Y] is combusted completely.

Answers

Answer:

CxHy+(x+y/4)O2‐>xO2+y/2H2O

Explanation:

mole ratio is equivalent to the volume ratio

Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?

Answers

Low quality pewter is tin, lead and a small amount of copper. In higher quality pewter, antimony or bismuth is used instead of lead. Pewter alloyed with antimony and bismuth can be polished to a bright, tarnish free finish. The alloying metals lower the melting temperature of tin, making it possible to cast molten alloy into detailed shapes.

PLEASE HELP!!!

How many calories are in 4,180 joules?

Answers

Answer:

To convert joules to calories, you can use the conversion factor:

1 calorie = 4.184 joules

To find out how many calories are in 4,180 joules, divide the given value by the conversion factor:

4,180 joules / 4.184 joules per calorie = 0.9 calories (approximately)

Therefore, there are approximately 0.9 calories in 4,180 joules.

A 0.036 M aqueous nitrous acid (HNO2) solution has an osmotic pressure of 0.93 atm at 25°C. Calculate the percent ionization of the acid.

Answers

The percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

How to calculate the percent ionization of the acid ?

The osmotic pressure (π) of a solution can be related to the molar concentration (M) of the solute and the temperature (T) of the solution by the following equation:

π = MRT

Where R is the gas constant.

We can use this equation to calculate the molar concentration of the nitrous acid solution:

M = π / RT

M = (0.93 atm) / (0.0821 L·atm/(mol·K) x 298 K)

M = 0.036 M

This is the molar concentration of the undissociated nitrous acid in the solution. To calculate the percent ionization of the acid, we need to know the concentration of the H+ and NO2- ions in the solution.

The balanced chemical equation for the dissociation of nitrous acid is:

HNO2(aq) ⇌ H+(aq) + NO2-(aq)

Let x be the extent of ionization of the nitrous acid. Then the concentration of H+ and NO2- ions can be expressed in terms of x as follows:

[H+] = x M

[NO2-] = x M

The concentration of the undissociated nitrous acid is (1-x)M.

The expression for the equilibrium constant (Ka) of the reaction can be written as:

Ka = [H+] [NO2-] / [HNO2]

Substituting the concentrations in terms of x, we get:

Ka = x^2M / (1-x)M

Simplifying the above equation, we get:

Ka = x^2 / (1-x)

The percent ionization of the acid is the fraction of the original HNO2 molecules that dissociate into H+ and NO2- ions. It can be calculated as follows:

% ionization = (concentration of H+ ions) / (initial concentration of HNO2) x 100

% ionization = (x M) / (M) x 100

% ionization = x x 100

Substituting the value of x from the above equation for Ka, we get:

Ka = x^2 / (1-x)

x = sqrt(Ka / (1+Ka))

We can calculate the value of Ka using the standard reference value of the acid dissociation constant (Ka) for nitrous acid at 25°C, which is 4.5 x 10^-4.

x = sqrt(4.5 x 10^-4 / (1+4.5 x 10^-4))

x = 0.021

% ionization = 0.021 x 100

% ionization = 2.1%

Therefore, the percent ionization of the nitrous acid in the 0.036 M aqueous solution is 2.1%.

Learn more about osmotic pressure here : brainly.com/question/25413362

#SPJ1

What does wadding do?

Answers

Answer:

Wadding is a disc of material used in guns to seal gas behind a projectile or to separate powder from shot. ... Wadding for muzzleloaders is typically a small piece of cloth, or paper wrapping from the cartridge.

Explanation:

Fructose-1-phosphate can be hydrolyzed into fructose + inorganic phosphate (Pi) with a ΔG° of –16.0 kJ/mol. If ATP can be hydrolyzed into ADP + Pi with a ΔG° of –30.5 kJ/mol, what is the free energy change for the reaction of fructose + ATP → fructose 1-phospate + ADP

Answers

To calculate the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP, we can use the concept of Gibbs free energy and apply the equation:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)

Given:
ΔG° for the hydrolysis of fructose-1-phosphate = -16.0 kJ/mol
ΔG° for the hydrolysis of ATP = -30.5 kJ/mol

The reaction we want to calculate the ΔG° for is:

fructose + ATP → fructose 1-phosphate + ADP

From the given information, we can break down the reactants and products:

Sum of reactants:
fructose + ATP

Sum of products:
fructose 1-phosphate + ADP

Now, we can calculate the ΔG° for the overall reaction:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)
ΔG° (overall reaction) = (-16.0 kJ/mol) + (-30.5 kJ/mol)

ΔG° (overall reaction) = -46.5 kJ/mol

Therefore, the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP is -46.5 kJ/mol.

prop-1-yne + 2HBr/H2O2 = A;
A + 2H2O = B;
B + K2CO3(aq) = C;
C + heat = D;
D + HBr = E.
find the compounds A, B, C, D and E

Answers

Based on the given reactions, the compounds are as follows:

A: The specific product formed from the reaction between prop-1-yne and either 2HBr or H2O2.

B: The product formed when compound A reacts with 2H2O.

C: The product formed when compound B reacts with K2CO3(aq).

D: The product formed from the heat-induced reaction of compound C.

E: The product formed when compound D reacts with HBr.

Based on the given reactions, let's analyze the compounds involved:

Reaction 1: prop-1-yne + 2HBr/H2O2 = A

The reactant prop-1-yne reacts with either 2HBr or H2O2 to form compound A. The specific product formed will depend on the reaction conditions.

Reaction 2: A + 2H2O = B

Compound A reacts with 2H2O (water) to form compound B.

Reaction 3: B + K2CO3(aq) = C

Compound B reacts with K2CO3(aq) (potassium carbonate dissolved in water) to form compound C.

Reaction 4: C + heat = D

Compound C undergoes a heat-induced reaction to form compound D.

Reaction 5: D + HBr = E

Compound D reacts with HBr (hydrobromic acid) to form compound E.

For more such questions on compounds

https://brainly.com/question/704297

#SPJ8

Why is scientific notation used?

to round numbers to the nearest whole number
to promote reproducibility of data
to increase the validity of data
to express very large or very small numbers

Answers

The correct option is (d) To express very large or very small number.

What is the Scientific Notation?

Scientific notation is a way to present numbers that are too large or too small to be easily written in decimal form. The three components of  scientific notation are coefficient, base and exponent. The proper format to write a scientific notation is a x 10^b, where a is a number or decimal number and b is the power of 10 to make scientific notation equivalent to original number. When a number between 1 and 10 is multiplied by a power of 10 then the number is expressed in scientific notation. For example,  10000000 can be written as 10⁷, which is the scientific notation and the exponent is positive here. Similarly, for the negative exponent 0.000001 can be can be represented as 10-⁷.                             Hence, the scientific notation is used to express very large or very small numbers.

Learn more about Scientific Notation here: https://brainly.com/question/15361382

#SPJ1

Chemicals that control weeds are called
A. acaricides.
B. herbicides.
C. insecticides.
D. pesticides.

Answers

Answer:

The answer is D

Explanation:

because insecticides are used for insects but pesticides are used to kill off unwanted plants

Answer:

B. herbicides

Explanation:

it kills weeds.

A teacher showed this animal to studenst on a field trip

Answers

If a teacher showed an animal to students on a field trip. The  tool will allow the students to best see the animal up close is the hand lens.

Option D is correct.

What is a  Hand lens?

A hand lens is known as a magnifying glass  which is a convex lens that is used to produce a magnified image of an object. The lens is usually mounted in a frame with a handle.

A hand lens  has two essential properties which are its focal length and its diameter.

The students will therefore require a hand lens to look up the animal close.

Learn more about hand lens at:https://brainly.com/question/12027484

#SPJ1

#complete question:

A teacher showed this animal to students on a field trip. Which tool will allow the students to best see the animal up close? O A Tape measure O B Graduated cylinder O c. Notebook O D. Hand lens

Other Questions
a. Find a basis for the kernel of the matrix A, As(6-36-1) -4 2-4-2 b. Find a basis for the column space of the matrix B 5 -4 14 B 5-4 1 N3 4 9 What does it mean to be Commander in Chief of the armed forces? How have Civil Rights Changed? Find the area of a triangle with the given base b and height h . b=6 in., h=15 in. in the original 1934 comic strip, the character flash gordon was fond of playing what four-letter sport? the physician has prescribed cromolyn (intal) for the client with asthma. the nurse plans to do medication education. what will the best plan by the nurse include? Discuss any four ways in which Specialization hasimproved the economic development of Nigeria The given sequence converges to {n3/(n4-1)}[infinity]/(n=1) 1 0 [infinity] -1 You are the general manager for a luxury resort hotel. You have a full slate of staff-related activities to complete this month. For each of the following activities, categorize its phase in HRM by using the drop-down list. Build a new training program to teach the shift supervisors about proper scheduling. Megan has to spinners. Its been one is divided into six equal parts. Spenard two is divided into four equal parts. If she spends both spinners what is the probability thats been a one will land on for an spinner to land on Blue? Question 8 of 10How does the interconnectedness of modern media affect society?A. It contributes to the fast spread of ideas.B. It ensures that the Internet offers quality multimedia.C. It makes it hard to obtain information.O D. It results in communication breakdowns. What organ is NOT potentially damaged by hypertension? explain how you can use fractions strips or number lines to show that 3/4 and 6/8 are equivalent. The diagram shows a sector of a circle, radius 45 cm, with angle 84.45 cm840Diagram NOTaccurately drawnCalculate the area of the sector.Give your answer correct to 3 significant figures. Which equations have the same solution as p3=5?Hint: There are 3 equations3p=303 p is equal to 30p+2=10p plus 2 is equal to 10p8=1p over 8 is equal to 1p+7=16p plus 7 is equal to 164p=32 Mis amigos_______________________(practicar) deportes en la clase de educacin fsica.Instrucciones: For each sentence, write the correct form of the verb in parentheses so that it agrees with the subject.Help me please Use your knowledge of Greek and Latin roots to find the word which best replaces the underlined word.The pain was so acute that I screamed.a.dullc.sharpb.heavyd.numbPlease select the best answer from the choices providedABCD What is an algebraic expression for the quotient of w and 7 ? A. W-7 B. W+7 C.W/7 D.7w Please answer this question for me The moon has a radius of approximately 1737 km. What is the length of the equator