If a body was lying on their back when they died, and was moved to their front after 12 hours, where would one see the skin discoloration from pooling blood?
Answer:the parts of the body which is nearest to the ground ie thier back will show discoloration
Explanation:
If the body remains at a position for long hours, the parts of the body which is nearest to the ground can develop a skin discoloration as a result of pooling of blood in the tissues and this is called livor mortis, which tends to be permanent from 8Hours upwards.
If you can answer this you a OG
Calculate the new volume if 12.78 L of a gas at -50*C is heated to a temperature of 28*C
When the gas is heated from -50°C to 28°C, the new volume is approximately 17.24 L.
To calculate the new volume of a gas when it is heated from -50°C to 28°C, we can use the combined gas law, which relates the initial and final conditions of temperature and volume.
The combined gas law is expressed as:
(P1 * V1) / T1 = (P2 * V2) / T2
Where:
P1 = Initial pressure
V1 = Initial volume
T1 = Initial temperature in Kelvin
P2 = Final pressure (assumed constant in this case)
V2 = Final volume (to be calculated)
T2 = Final temperature in Kelvin
First, we need to convert the initial and final temperatures from Celsius to Kelvin:
Initial temperature in Kelvin (T1) = -50°C + 273.15 = 223.15 K
Final temperature in Kelvin (T2) = 28°C + 273.15 = 301.15 K
Since the pressure is assumed to be constant, we can simplify the equation:
(V1 / T1) = (V2 / T2)
Now we can substitute the given values into the equation:
(12.78 L / 223.15 K) = (V2 / 301.15 K)
Cross-multiplying and solving for V2:
V2 = (12.78 L * 301.15 K) / 223.15 K
V2 ≈ 17.24 L
For more such question on volume. visit :
https://brainly.com/question/1972490
#SPJ8
Molecules have Question 19 options: A) only potential energy. B) neither kinetic nor potential energy. C) only kinetic energy. D) both potential and kinetic energy.
Answer:
D
Explanation:
molecules have potential energy and kinetic energy.
Tempreture is defined as the average kinetic energy and internal energy is PE+KE. Pptential energy in particles or molecules is just there position relative to one another. A gas which has seperated particles will have a greater potential energy than a solid/liquid.
Please help this is due soon
Pyridine, C5H5N, is a polar organic solvent. How many carbon atoms are in 7.05 moles of pyridine? 4.24 x 1024 4.24 x 10, 24 2.12 x 1024 2.12 x 10, 24 4.24 x 1023 4.24 x 10, 23 2.12 x 1025
Answer:
2.122×10^25atoms
Explanation:
number of moles=mass/molar mass
7.05moles= mass of pyridine/79
reacting mass of pyridine=556.95
C5H5N= (12×5)+(5)+(14)=79
C5=60
to find the mass of carbon in 556.95g of pyridine we take the stoichometric ratio
60[C5] -----> 79[C5H5N]
x[C5] --------> 556.95g[C5H5N]
cross multiply
x=(60×556.95)/79
x=423g of carbon
moles=mass/molar mass
moles of carbon=423/12
moles=35.25moles of carbon
moles=number of particles/Avogadro's constant
35.25=number of particles/6.02×10^23
number of particles=2.122×10^25atoms of carbon
The number of carbon atoms present in the 7.05 moles of pyridine is equal to 2.12 ×10²⁵. Therefore, option (D) is correct.
What is Avogadro's number?Avogadro’s number can be useful to express the number of particles in 1 mole of a chemical substance. Generally, these particles can be ions, atoms, molecules, electrons, or protons, according to the type of chemical reaction.
Avogadro’s constant is experimentally found approximately equal to 6.022 × 10²³ per mole.
Given, the number of moles of the Pyridine = 7.05 mol
The molar mass of the C₅H₅N = 79 g/mol
On molecule of pyridine has carbon atoms = 5
One mole of pyridine has carbon atoms = 5 × 6.022 × 10²³
Then 7.05 moles of pyridine have carbon atoms = 7.05 ×5 × 6.022 × 10²³
= 2.12 ×10²⁵ carbon atoms
Therefore, 2.12 ×10²⁵ carbons are present in 7.05 moles of pyridine.
Learn more about Avogadro's number, here:
brainly.com/question/11907018
#SPJ2
Convert -32 F into K
Answer:
-32 Fahrenheit converts to 237.594 Kelvin
Water flows steadily through a 35° pipe bend. At the inlet, the diameter is 0.3 m, the velocity is 10 m/s and the pressure is 128 kPa gauge. At the outlet, the diameter is 0.4 m and the pressure is 148 kPa. The mass of water in the bend is 145 kg. (a) Calculate the velocity at the bend exit (in m/s) and mass flow rate (in kg/s) (b) Determine the forces Fx (N) and Fy (N) necessary to hold the pipe bend in place.
(a) The velocity at the bend exit is approximately 7.07 \(m/s\) , and the mass flow rate is 7.25 \(kg/s\).
(b) The forces Fx and Fy necessary to hold the pipe bend in place are dependent on the fluid momentum change.
(a) To calculate the velocity at the bend exit, we can use the principle of conservation of mass. The mass flow rate remains constant throughout the pipe, so we can equate the mass of water entering the bend to the mass exiting the bend. Given the mass of water in the bend and the diameter at the inlet and outlet, we can calculate the velocity at the bend exit using the equation of continuity.
The velocity at the bend exit (v₂) can be determined using the equation: A₁v₁= A₂v₂, where A₁ and A₂ are the cross-sectional areas at the inlet and outlet, respectively. Solving for v₂, we can find the velocity at the bend exit.
To calculate the mass flow rate, we can use the equation: mass flow rate = density × velocity × area. Given the mass of water in the bend, we divide it by the time it takes for the water to pass through the bend to obtain the mass flow rate.
(b) The forces Fx and Fy necessary to hold the pipe bend in place can be determined using Newton's second law. Since the water is flowing steadily, there is no acceleration in the y-direction. Therefore, the force in the y-direction is zero.
The force in the x-direction (Fx) is equal to the change in momentum of the water as it flows through the bend. The change in momentum is caused by the pressure difference between the inlet and outlet of the bend. We can calculate Fx using the equation: Fx = mass flow rate × (v₂ - v₁), where v₁ is the velocity at the inlet.
Learn more about Velocity
brainly.com/question/30559316
#SPJ11
What is the water referred to as in a solution of a carbonated beverage?
(A) a precipitate
(B) a solvent
(C) a solute
(D) saturated
Answer: B: a solvent
Explanation: I hope this helps!
Which roller coaster
car has the least potential energy due to gravity
Answer:
the roller coaster car with the least potential energy would be the one at the bottom of the roller coaster
Explanation:
Hope this helped
Which best describes nitrogen fixation?
Answer:
Nitrogen fixation is the process of converting nitrogen to a usable form.
NO LINKS please help!
Answer:
True True False
Explanation:
What is the Ka of a 0.0796 M solution of nitrous acid (HNO2) with a pH of 2.95?
Answer:
Coefficient = 1.58
Exponent = - 5
Explanation:
pH = 2.95
Molar concentration = 0.0796M
Ka = [H+]^2 / [HA]
Ka = [H+]^2 / 0.0796
Therefore ;
[H+] = 10^-2.95
[H+] = 0.0011220 = 1.122 × 10^-3
Ka = [H+] / molar concentration
Ka = [1.122 × 10^-3]^2 / 0.0796
Ka = (1.258884 × 10^-6) / 0.0796
Ka = 15.815 × 10^-6
Ka = 1.58 × 10^-5
Coefficient = 1.58
Exponent = - 5
6
Which subatomic particle can be found revolving around the nucleus?
proton
neutron
electron
Answer : The correct option is, electron.
Explanation :
As we know that,
An atom is the smallest unit of a matter that consist of three subatomic particles which are electrons, protons and neutrons.
The protons and the neutrons are located inside the nucleus or the center of the nucleus where the mass of the an atom is concentrated.
The electrons are located around the nucleus.
The protons are positively charged, the electrons are negatively charged and the neutrons are neutral that means it has no charge.
According to the question, the electron subatomic particle found revolving around the nucleus.
Hence, the correct option is electron.
DESPERATE WILL GIVE BRAINLIST AND THANKS
Which phase of cell division is shown?
prophase
metaphase
anaphase
telophase
anaphase
or if not
telophase
What must be true of a substance with a lot
of mass?
A.It has a lot of matter
B.It is dense
C.It is a gas
D.It has a huge volume
Answer:
A is the answer.
Explanation:
Answer:
It has a lot of matter
plz mark brainliest
Select any and all of these molecules that have at least one chiral carbon atom. Group of answer choices 3,4-dimethylhexane 3,3-dimethylpentane CH3CH2CH(OH)CH3 CH3CH2CH(CH3)CH2CH2CH3 CH3C(CH3)2CH(CH2CH3)C(CH3)3
Answer:
3,4-dimethylhexane, CH3CH2CH(OH)CH3, CH3CH2CH(CH3)CH2CH2CH3
Explanation:
A chiral carbon atom is also referred to as a asymmetric carbon atom. This is a carbon atom that is bonded to four different substituents.
So what we need to do is to look at each compound and consider all the carbon atoms in each compound. Drawing out the full structural formula is very helpful here.
After drawing each structure out, we now look out for carbon atoms that have four dissimilar substituents. Those are the chiral carbons. If we do so for all the molecules listed in the answer, we will discover that each of them contains an asymmetric carbon atom.
Low mass stars are stars that _________ solar masses or less.
What is the relationship between the pressure of a gas and the absolute
temperature?
they don't have any relationship between them
Even before modern observations provided evidence supporting the theory of plate tectonics, people developed theories that the continents were once joined together. Using only maps, what did they observe?
Answer:
people or scientist tend to observe the nature of the continents that described by jigsaw fit,geological similarity among the continents
Which equation represents a double replacement reaction?
A) 2 Na + 2 H2O → 2 NaOH + H2
B) CaCO3 → CaO + CO2
C) LiOH + HCl → LiCl + H2O
D) CH4 + 2 O2 → CO2 + 2 H2O
Answer:
C) LiOH + HCl → LiCl + H₂O
General Formulas and Concepts:
Chemistry - Reactions
Synthesis Reactions: A + B → AB Decomposition Reactions: AB → A + B Single-Replacement Reactions: A + BC → AB + C Double-Replacement Reactions: AB + CD → AD + BCExplanation:
Step 1: Define
RxN A: 2Na + 2H₂O → 2NaOH + H₂
RxN B: CaCO₃ → CaO + CO₂
RxN C: LiOH + HCl → LiCl + H₂O
RxN D: CH₄ + 2O₂ → CO₂ + 2H₂O
Step 2: Identify
RxN A: Single Replacement Reaction
RxN B: Decomposition Reaction
RxN C: Double Replacement Reaction
RxN D: Combustion Reaction
2
Select the correct answer
Which is true with respect to the kinetic energy of a molecule?
OA it is the lowest at low temperatures
OB. it increases at low temperatures
OC it is the same at all temperatures
OD. it is the lowest at high temperatures
Reset
Ness
A
Ek = 1/2*m*V^2
Take ideal gas for example, the Vrms is (3RT/M)^1/2. Ek is proportional to T.
Therefore, Ek is the lower at the low temperature. Another perspective is the average kinetic energy. The average kinetic energy is equal to (3/2)RT, so the average kinetic energy is proportional to temperature.
What is the answer for O2 + C5H12O2 →?
Answer:
25.76
Explanation:
Ammonia (NH3) clouds are present around some planets. Calculate the number of grams of ammonia produced by the reaction of 5.4 g of hydrogen with an excess of nitrogen
N2 + 3 H2 -> 2 NH3
30.6 g of ammonia are produced.
Answer:
given
mass of hydrogen =5.4 gram
mass of NH3=?
we have
3 moles of H2=2 moles of NH3
3×2g of H2=2×(14+3) g of NH3
6 g of H2=34 g of NH3
5.4 g of H2=34×5.4/6=30.6 g of NH3
30.6 g of ammonia produced by the reaction of 5.4 g of hydrogen with an excess of nitrogen.
What is Mole?The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.
A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.
Given,
Mass of Hydrogen = 5.4 g
Moles of hydrogen = mass ÷ molar mass
= 5.4 ÷ 2 = 2.7 moles
From the reaction, 3 moles of hydrogen produce 2 moles of ammonia
So, 1 mole of hydrogen will produce 2 ÷ 3 moles of ammonia
Thus, 2.7 moles will give ( 2÷3) × 2.7
= 1.8 moles of ammonia
Mass of ammonia = 1.8 × 17
= 30.6 g
Therefore, 30.6 g of ammonia produced by the reaction of 5.4 g of hydrogen with an excess of nitrogen.
Learn more about Moles, here:
https://brainly.com/question/20486415
#SPJ2
If you dissolve 49.4 grams of cobalt (II) nitrate in 500 ml of water, what is the MOLALITY?
To calculate the molality of a solution, we need to know the number of moles of solute per kilogram of solvent. Therefore, the molality of the solution is 0.506 mol/kg.
In a solution example, what does a solvent mean?The substance that typically determines the solution's physical state is the solvent (solid, liquid or gas). The substance that dissolves in the solvent is known as a solute. For instance, in a solution of salt and water, salt serves as the solute and water as the solvent.
Here's how we can calculate the molality of the given solution:
Step 1: Calculate the number of moles of cobalt (II) nitrate
The molar mass of cobalt (II) nitrate is 194.99 g/mol. Therefore, the number of moles of cobalt (II) nitrate dissolved in 49.4 grams can be calculated as follows:
moles of Co(NO3)2 = mass ÷ molar mass
moles of Co(NO3)2 = 49.4 g ÷ 194.99 g/mol
moles of Co(NO3)2 = 0.253 moles
Step 2: Calculate the mass of water
The mass of 500 ml of water can be calculated as follows:
mass of water = volume of water × density of water
mass of water = 500 ml × 1 g/ml
mass of water = 500 g
Step 3: Calculate the molality
Now we can calculate the molality of the solution using the following formula:
molality = moles of solute ÷ mass of solvent in kilograms
mass of solvent in kilograms = mass of water ÷ 1000
molality = 0.253 moles ÷ (500 g ÷ 1000)
molality = 0.506 mol/kg
To know more about molality visit:-
brainly.com/question/26921570
#SPJ1
which of the following are arrhenius acids? select all that apply. nahso4 nah nh3 ch4
Only NaHSO₄ (sodium hydrogen sulfate) can be considered an Arrhenius acid among the given compounds.
An Arrhenius acid is a compound that increases the concentration of H⁺ ions when dissolved in water. Based on this definition, let's analyze the given compounds:
1. NaHSO₄ (Sodium hydrogen sulfate): When dissolved in water, it dissociates into Na⁺ and HSO₄⁻ ions. HSO₄⁻ can further dissociate into H⁺ and SO₄²⁻ ions, increasing the H⁺ ion concentration in the solution. Therefore, NaHSO₄ is an Arrhenius acid.
2. NaH (Sodium hydride): NaH dissociates into Na⁺ and H⁻ ions when dissolved in water. Since it doesn't increase the H⁺ ion concentration, NaH is not an Arrhenius acid.
3. NH₃ (Ammonia): NH₃ reacts with water to form NH₄⁺ and OH⁻ ions, increasing the concentration of OH⁻ ions. It acts as an Arrhenius base rather than an acid, so NH₃ is not an Arrhenius acid.
4. CH₄ (Methane): CH₄ doesn't dissociate or react with water to produce H⁺ ions, and therefore, is not an Arrhenius acid.
Learn more about Arrhenius acid here:
https://brainly.com/question/15324971
#SPJ11
Gina predicts that one really large cube of sugar will dissolve faster than the same
amount of sugar in several medium-sized cubes. She thinks that because there is only
one larger cube, it has more surface area and will dissolve faster than the several
medium-sized cubes. What is the best assessment of Gina's prediction?
The best assessment of Gina's prediction is that the several medium-sized cubes will dissolve faster than the large cube of sugar.
How does surface area affect solubility?The surface area of a substance refers to the total area on the surface of that object.
Surface area plays a vital role in the dissolution of a substance. When a solute dissolves, the action takes place only at the surface of each particle.
This suggests that when the total surface area of the solute particles is increased, the solute dissolves more rapidly, hence, the best assessment of Gina's prediction is that the several medium-sized cubes will dissolve faster.
Learn more about surface area at: https://brainly.com/question/2835293
#SPJ1
Magnets are classified based upon how they occur either naturally or man made true or false
Answer:
True
Explanation:
Permanent artificial, temporary artificial and natural. They are classified by the way in which they have achieved magnetism and by how long they remain magnetic.
Two stable isotopes of copper have the following masses and percent abundances in nature:
Cu-63; Isotopic mass: 62.93 amu; % abundance: 69.09
Cu-65; Isotopic mass: ? amu; % abundance: 30.91
If copper has an atomic mass of 63.55 g/mole, what is the isotopic mass of Cu-65?
OPTIONS
64.01 amu
64.53 amu
64.93 amu
65.03 amu
MAKE SURE TO REALLY EXPLAIN IT! HOW DID U DETERMINE THIS? WHAT STRATEGY DID U USE? STEP BY STEP I WANT TO KNOW EVERYTHING!!
Answer:
the option will be no.3
Explanation:
why? because I said so
1. How much energy (in calories and in Joules) will it take to raise the temperature of 75.0 g
of water from 20.0 to 55.0 °C? ( Specific Heat = 1 cal / ( g °C) and 4.184 J /(g°C) )
A. 2630 cal and 630. J
B. 2630 cal and 1.1 x 104 J
C. 1.1 x 10 + cal and 2630 J
D. 630. cal and 2630 J
E. None of these are correct.
I need help pls
The reaction between NH3 and O₂ produces 21.8 g of NO gas and some water. Determine the percent yield if the theoretical yield is 27.9 g of NO
gas. Please show your work on a scrap piece of paper.
128.0%
78.1 %
1.28 %
0.78%