Answer:
Volume = 19.68 ml
Explanation:
The equation of the reaction is given as;
HNO3 + KOH ---> KNO3 + H2O
1 mol of HNO3 reacts 1 mol of KOH
Converting 0.276 g of KOH to mol;
Number of moles = Mass / Molar mass
Number of moles = 0.276g / 56.1056 g/mol
Number of moles = 0.00492
Since the mole relationship is 1 = 1;
This means 0.00492 mol of HNO3 reacts with 0.00492 mol of KOH
The relationship between molarity and volume id given as;
Molarity = Number of moles / Volume
Volume = Number of moles / Molarity = 0.00492 mol / 0.250 M
Volume = 0.01968 L
Volume = 19.68 ml
What is the volume in liters occupied by 3.25 moles of an ideal gas at a temperature of 18.00? R= 0.08205 L.atm/K.mol P= 1.13 atm
Considering the ideal gas law, the volume occupied by 3.25 moles of an ideal gas at a temperature of 18.00°C is 686.71 L.
Definition of ideal gas lawAn ideal gas is the behavior of those gases whose molecules do not interact with each other and move randomly. Under normal conditions and under standard conditions, most gases exhibit ideal gas behavior.
An ideal gas is characterized by three state variables: absolute pressure (P), volume (V), and absolute temperature (T), related by a simple formula called the ideal gas law:
P×V = n×R×T
Where:
P is the gas pressure.V is the volume that occupies.T is its temperature.R is the ideal gas constant. The universal constant of ideal gases R has the same value for all gaseous substances. n is the number of moles of the gas. Volume in this caseIn this case, you know:
P= 1.13 atmV= ?T= 18 C= 291 K (being 0 C= 273 K)R= 0.8205 L.atm/K.moln= 3.25 molReplacing in the ideal gas law:
1.13 atm×V = 3.25 mol× 0.8205 L.atm/K.mol× 291 K
Solving:
V = (3.25 mol× 0.8205 L.atm/K.mol× 291 K)÷ 1.13 atm
V= 686.71 L
Finally, the volume is 686.71 L.
Learn more about ideal gas law:
https://brainly.com/question/4147359
#SPJ1
If 0.499 g of NaOH (MM = 40.00 g/mol) is dissolved in 150.00 mL of water, what is the theoretical molarity of NaOH? (do not forget about SF)
Molarity is an important method which is used to calculate the concentration of a solution. The molarity of 0.499 g of NaOH dissolved in 150.00 mL of water is 0.082 M.
Molarity of a solution is defined as the number of moles of the solute present per litre of the solution. The unit of molarity is mol L⁻¹ and it is represented as 'M'.
Molarity = Number of moles of solute / Volume of solution in L
150.00 mL = 0.15 L
Number of moles:
n = 0.499 / 40.00 = 0.0124 moles
M = 0.0124 / 0.15
M = 0.082
To know more about molarity, visit;
https://brainly.com/question/16727614
#SPJ1
1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5
1. The IUPAC name of N is nitrogen.
2. Nitrogen dioxide
3.The IUPAC name of O is oxygen
4.The IUPAC name of OH is hydroxyl.
The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.
IUPAC names for the given compounds are:1.1. N: Nitrogen
The IUPAC name of N is nitrogen.
It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide
Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.
The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen
Explanation: The IUPAC name of O is oxygen.
It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.
X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.
Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.
It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.
for more question on electronic configuration
https://brainly.com/question/26084288
#SPJ8
Note: The complete question is given below
Provide the IUPAC names for the following compounds:
\(CH_3CH_2CH(CH_3)CH_2CH_2CH_2CH_3\)
C6H5CH(CH3)2
H2NCH2CH2CH2CH2CH2NH2
CH3CH2CH2CH2CH2OH
CH3CH2CH2CHOHCH3
Balance the following chemical equations.
Zn + HCI -> H2+ZnCI2
CS2+O2 -> CO2 + SO2
30 POINTS FOR ALL
if its incomplete or wrong ill report you lol
Answer:
Zn + 2HCl -> H2 + ZnCl2
CS2 + 2O2 -> CO2 + S2O2
Explanation:
A sample of the compound has 9 grams of cobalt. How many grams of fluorine does the sample have?
The mass (in grams) of fluorine the sample have is 2.91 g
How do I determine the mass of fluorine?First, we shall determine the mole of 9 grams of cobalt. Details below:
Mass of cobalt = 9 grams Molar mass of cobalt = 58.93 g/mol Mole of cobalt =?Mole = mass / molar mass
Mole of cobalt = 9 / 58.93
Mole of cobalt = 0.153 mole
Finally, we shall determine the mass of fluorine the present in the compound. Details below:
Molar mass of fluorine = 19 g/mol Mole of cobalt = 0.153 moleMole of fluorine = Mole of cobalt = 0.153 moleMass of fluorine = ?Mole = mass / molar mass
0.153 = Mass of fluorine / 19
Cross multiply
Mass of fluorine = 0.153 × 19
Mass of fluorine = 2.91 g
Thus, the mass of fluorine is 2.91 g
Learn more about mass:
https://brainly.com/question/21940152
#SPJ1
Select the correct answer.
Based on the reactivities of the elements involved, which reaction will form products that are more stable than the reactants?
The correct option is B. CaBr2 + 2Na → 2NaBr + Ca because In option B, the reactants CaBr2 and Na are both metals with similar reactivities.
Which chemical reactions will result in more durable products than the reactants?Exothermic reactions release energy and are defined as producing products with higher stability (lower energy) than the reactants. The exothermic reaction that happens during a fire and releases energy in the form of heat and light is the combustion reaction.
Which substance will respond the quickest?In terms of reactivity, the metals that are listed in the periodic table's lower left corner are the most active. Lithium, sodium, and potassium, for instance, all interact with water.
To know more about reactants visit:-
https://brainly.com/question/17096236
#SPJ1
Question:
Based on the reactivities of the elements involved, which reaction will form products that are more stable than the reactants?
A. 2AlBr3 + 3Zn → 3ZnBr2 + 2Al
B. CaBr2 + 2Na → 2NaBr + Ca
C. MgBr2 + H2 → 2HBr + Mg
D. BaBr2 + Ca → CaBr2 + Ba
E. 2LiBr + Ba → BaBr2 + 2Li
Question In nickel-cadmium batteries: Select the correct answer below: the anodes are nickel-plated and the cathodes are cadmium-plated the anodes are cadmium-plated and the cathodes are nickel-plated both the anodes and cathodes are plated with a nickel-cadmium alloy none of the above
Answer:
the anodes are cadmium-plated and the cathodes are nickel-plated
Explanation:
Nickel cadmium battery works on the principle as by the other cell. There is anode and a cathode which is separated by a separator (spiral shaped inside the case). The anode is negative and is cadmium plated while the cathode is positive and is nickel plated. An electrolyte is also used.
So the correct answer is : "The anodes are cadmium-plated and the cathodes are nickel-plated."
how many moles of h2 can be made from the complete reaction of 3.5 moles of al?
Given: 2Al+6HCL 2Alcl3+3h2
Answer:
From the given equation, we can see that for every 2 moles of Al, we get 3 moles of H2
So, we can say the the number of moles of H2 is 3/2 times the number of moles of Al
We are given the number of moles of Al and we have to find the number of moles of H2
We have deduced the relationship:
Moles of Al * 3 / 2 = Moles of H2
Replacing the variables with given values
3.5 * 3 / 2 = Moles of H2
Moles of H2 = 5.25 moles
AlF3 → Al + F2balance the equation
Explanation:
We have to balance the following equation:
__ AlF₃ ---> ___ Al + __ F₂
First we have to determine the number of atoms of each element that we have on both sides of the equation.
__ AlF₃ ---> ___ Al + __ F₂
Al = 1 Al = 1
F = 3 F = 2
As we can see we have 1 atom of Al on both sides of the equation. Al is already balanced. Then, we have 3 atoms of F on the left side of the equation and 2 atoms of F on the right side of the equation. The coefficient for F₂ should be 3/2 to have the same number of F atoms on both sides.
__ AlF₃ ---> ___ Al + 3/2 F₂
Al = 1 Al = 1
F = 3 F = 3
But we can't have a fraction as coefficient. So make that fraction an entire number we can multuply all the coefficients by 2.
2 AlF₃ ---> 2 Al + 3 F₂
Al = 2 Al = 2
F = 6 F = 6
The balanced equation is:
2 AlF₃ ---> 2 Al + 3 F₂
Answer: 2 AlF₃ ---> 2 Al + 3 F₂
Thermal Energy and Kinetic Molecular Theory Quick Check
The Kinetic Molecular Theory is a scientific model that states atoms in a compound are found in a constant state of motion (movement).
What is the Kinetic Molecular Theory?The Kinetic Molecular Theory is a scientific model that states atoms in a compound are found in a constant state of motion (movement).
Thermal energy refers to the movement of particles and therefore both concepts are interrelated.
In conclusion, the Kinetic Molecular Theory is a scientific model that states atoms in a compound are found in a constant state of motion (movement).
Learn more about the Kinetic Molecular Theory here:
https://brainly.com/question/134712
#SPJ1
Use the equation qliquid = m × c × ΔT to calculate the heat gained by the cold liquid. Use the specific heat for the liquid you selected.
Use the equation qwater = m × c × ΔT to calculate the heat lost by the hot water. Show your work using the problem-solving method shown in previous rubrics.
Complete question :
Use the equation qliquid = m × c × ΔT to calculate the heat gained by the cold liquid. Use the specific heat for the liquid you selected.
m = 248.9 g ; T = 72.6°C ; C = 3.73 j/g°C
Use the equation qwater = m × c × ΔT to calculate the heat lost by the hot water. Show your work using the problem-solving method shown in previous rubrics.
M = 237 g ; T = 41.2°C ; C = 4.184 j/g°C
Answer:
Quantity of heat gained = 67401.6 Joules
Quantity of heat lost by hot water = 40854.25 Joules
Explanation:
The heat gained by cold liquid :
Q = m × c × ΔT
m = 248.9 g ; T = 72.6°C ; C = 3.73 j/g°C
Q = 248.9 * 3.73 * 72.6
Q = 67401.6 Joules
Quantity of heat gained = 67401.6 Joules
Heat lost by hot water :
m × c × ΔT
M = 237 g ; T = 41.2°C ; C = 4.184 j/g°C
Q = 237 * 41.2 * 4.184
Q = 40854.25 Joules
Quantity of heat lost by hot water = 40854.25 Joules
The chemical formula for magnesium oxide is 2MgO. The number 2 represents the number of ___.
oxygen atoms
magnesium atoms
magnesium oxide molecules
Answer:
magnesium oxide molecules
Explanation:
this is because the two is before the formula of MgO
Write a net ionic equation to show that benzoic acid, C6H5COOH, behaves as a Brønsted-Lowry acid in water.
Answer:
H⁺(aq) + H₂O(l) ⇄ H₃O⁺(aq)
Explanation:
According to Brönsted-Lowry acid-base theory, an acid is a substance that donates H⁺. Let's consider the molecular equation showing that benzoic acid is a Brönsted-Lowry acid.
C₆H₅COOH(aq) + H₂O(l) ⇄ C₆H₅COO⁻(aq) + H₃O⁺(aq)
The complete ionic equation includes all the ions and molecular species.
C₆H₅COO⁻(aq) + H⁺(aq) + H₂O(l) ⇄ C₆H₅COO⁻(aq) + H₃O⁺(aq)
The net ionic equation includes only the ions that participate in the reaction and the molecular species.
H⁺(aq) + H₂O(l) ⇄ H₃O⁺(aq)
30.The type of chemical reaction represented by the following equation is....HBr + NaOH ---> H2O + NaBrSelect one:a. decomposition. b. double displacement.c. single displacement.d. synthesis.
Answer:
b. Double displacement.
Explanation:
It is a double displacement reaction, because in this case, hydrogen atom in HBr is replaced by a sodium atom (from NaOH), and the sodium atom (in NaOH) is replaced by another H atom from HBr molecule, to form H2O.
When fossil fuels are burned, they emit carbon dioxide into the atmosphere. After centuries of large amounts of carbon dioxide accumulating in the atmosphere, the earth's temperature increases by 1°C.
What is the connection between increasing carbon dioxide and increasing temperature?
The connection between increasing carbon dioxide and increasing temperature is: carbon dioxide absorbs heat from the sun and traps it in earth's atmosphere. Since the heat cannot escape, it causes the earth's temperature to increase which is the first option.
When carbon dioxide (CO₂) and other greenhouse gases are present in the atmosphere, they act as a natural blanket, allowing sunlight (solar radiation) to pass through and reach the Earth's surface. Some of this solar radiation is absorbed by the Earth's surface, while the rest is reflected back towards space as heat (infrared radiation). However, greenhouse gases like carbon dioxide have the property of absorbing and re-emitting infrared radiation.
Learn more about fossil fuel here
https://brainly.com/question/2029072
#SPJ1
What is SO2 shape name?
Answer:Molecular Formula SO2
Hybridization Type sp2
Bond Angle 119o
Geometry V-Shaped or Bent
Explanation:
hope this helped <3
20 POINTS AWNSER ASAP!!! ILL MARK BRAINESIT!!!
Which choice best compares these two observations?
A Observation 1 describes a physical change, and Observation 2 describes a chemical change.
В Observation 1 describes a chemical change, and Observation 2 describes a physical change.
C Each observation describes a physical change.
D Each observation describes a chemical change.
Answer:
the answer is a man
Explanation:
it describes the physical change
Answer:
C
Explanation:
When you decide whether or not the data supports the original hypothesis, you are
O creating a theory
forming a hypothesis
O contributing to the body of knowledge
stating a law
O asking questions
Contributing to the body of knowledge.
When you decide whether or not the data supports the original hypothesis, you are "contributing to the body of knowledge." Explanation:Scientific investigation is a way of answering questions about the natural world. An inquiry or investigation can be initiated by a researcher or a group of researchers who have questions regarding a certain phenomenon. The inquiry or investigation is usually done by conducting an experiment or making an observation and then collecting data. After collecting the data, the researchers analyze it to check if it supports their hypothesis or not.The body of knowledge refers to the totality of data that has been collected and analyzed. It comprises all the data that researchers have acquired over time through scientific investigations. When researchers decide whether or not the data supports their original hypothesis, they contribute to this body of knowledge. The new data may either confirm the hypothesis or lead to a revision or rejection of it, adding to the body of knowledge.
for more questions on knowledge
https://brainly.com/question/29610548
#SPJ8
According to Graham’s law, the rate of effusion of a gas is inversely proportional to
A.
the pressure of the gas.
B.
the kinetic energy of the particles.
C.
the square root of the mass of the particles.
D.
the square root of the diffusion of the gas in another gas.
C. the square root of the mass of the particles.
Further explanationGraham's law: the rate of effusion of a gas is inversely proportional to the square root of its molar masses or
the effusion rates of two gases = the square root of the inverse of their molar masses:
\(\rm \dfrac{r_1}{r_2}=\sqrt{\dfrac{M_2}{M_1} }\)
or
\(\rm M_1\times r_1^2=M_2\times r_2^2\)
From this equation shows that the greater the mass of the gas, the smaller the effusion rate of the gas and vice versa, the smaller the mass of the gas, the greater the effusion velocity.
So if both gases are at the same temperature and pressure, the above formula can apply
Why is it not necessary to test the reactivity of the elemental metals with solutions of the same metal ion?
It is not necessary to test the reactivity of the elemental metals with solutions of the same metal ion because it won't react with itself.
What is Reactivity?
This is referred to as the relative capacity or how readily a substance undergoes a chemical reaction.
Reactivity of elements are dependent on various types of parameters such as the number of valence electrons, shells etc and can be tested with other substances. However, it can't be tested with the solutions of the same metal ion because no reaction will occur thereby making it the most correct reason in this scenario.
Read more about Reactivity here https://brainly.com/question/28815106
#SPJ1
Convert 6.75 cm to mm
Answer: 67.5
Explanation:
Brainliest pls
PLEASE HELP ! :D
WILL GIVE BRAINLIEST
Given that4 NH3 (g) + 5 O2(g) > 4 NO(g) + 6 H2O(g)If 8.20 moles of NH3 react with sufficient oxygen, how many moles of water should form?1. 6.11 moles2. 12.0 moles3. 22.0 moles4. 8.25 moles5. 15.1 moles
Answer:
\(12.3\text{ moles}\)Explanation:
Here, we want to get the number of moles of water that would form
From the equation of reaction, 4 moles of ammonia produced 6 moles of water
However, 8.2 moles of ammonia will produce x moles of water
To get the value of x, we have it that:
\(\begin{gathered} \text{ 4 }\times x\text{ = 8.2}\times\text{ 6} \\ x\text{ = }\frac{8.2\text{ }\times6}{4} \\ \text{ x= 12.3 moles} \end{gathered}\)write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
in another experiment, dilute sulfuric acid is titrated with 0.100mol dm-3 sodium hydroxide solution.
2NaOH + H2SO4 = Na2SO4 + 2H2O
26.60cm^3 of dilute sulfuric acid is needed to neutralise 25.00cm^3 of the sodium hydroxide solution.
Calculate the concentration of the dilute sulfuric acid in mol dm-3
The concentration of the dilute sulfuric acid is 0.047 mol dm-3.
What is a neutralization reaction?We know that a neutralization reaction has to do with the kind of reaction that occurs between an acid and a base. The acid is made to react with the base and the product of the reaction would be salt and water only. We can now be able to find the concentration of the dilute sulfuric acid in mol dm-3 form the procedure that have been laid down below.
Concentration of the base \(C_{B}\) = 0.100mol dm-3
Volume of the base \(V_{B}\)= 25.00cm^3
Concentration of the acid \(C_{A}\) = ?
Volume of the acid \(V_{A}\) = 26.60cm^3
Number of moles of the acid \(N_{A}\) = 1
Number of moles of the base \(N_{B}\) = 2
Now;
\(C_{A}\) \(V_{A}\)/ \(C_{B}\) \(V_{B}\) = \(N_{A}\)/ \(N_{B}\)
\(C_{A}\) = 0.100mol dm-3 * 25.00cm^3 * 1/26.60cm^3 * 2
\(C_{A}\) = 2.5/53.2
\(C_{A}\) = 0.047 M
Learn more about concentration:https://brainly.com/question/10725862
#SPJ1
Rank each of the following elements by the common number of single bonds the element makes when it bears no formal charge. Each element is from
the second row of the periodic table F,O,N,C,NE
In this ranking we would have; C > N > O > F > Ne.
What is the formal charge?The term formal charge has to do with the charge that an atom appears to have in compound. We can obtain the formal charge from the formula;
Formal charge = [# of valence electrons] – [electrons in lone pairs + 1/2 the number of bonding electrons]
Let us now consider the atoms; F, O, N, C, Ne. We have to rank the atoms by the common number of single bonds the element makes when it bears no formal charge.
In this ranking we would have; C > N > O > F > Ne.
Learn more about formal charges:https://brainly.com/question/11723212
#SPJ1
If 7.50 mol of NH₃ and 8.15 mol of O₂ react in the following reaction, how many moles of H₂O will be formed? 4 NH₃ (g) + 5 O₂ (g) → 4 NO (g) + 6 H₂O (g)
If 7.50 mol of NH₃ and 8.15 mol of O₂ react in the following reaction. The number of moles of H₂O that will be formed is 9.84 moles.
What are moles?The mole is a SI unit of measurement that is used to calculate the quantity of any substance.
Using the molar coefficients in the balanced equation, 6 moles of water are formed for every 4 moles of NH₃.
6 moles of water are formed for every 5 moles of O₂.
So (7.5 moles NH₃)(6 moles H₂O)/4 moles NH₃) = 11.25 moles water
For (8.20 moles O₂) / (6 moles H₂O)(5 moles O₂) = 9.84 moles H₂O.
So O₂ is the limiting reagent, and we can only make as much product as allowed by the limiting reagent.
Thus, the number of moles is 9.84 moles of water.
To learn more about moles, refer to the link:
https://brainly.com/question/26416088
#SPJ1
Part 2 The student wanted to know if the value obtained from their experiment (part 1) is similar to that calculated using average bond enthalpy data.
a) Using the balanced equation and the data in the table below, calculate the theoretical enthalpy of combustion.
Note: you will need to include the enthalpy of vaporisation for the liquid components which are also given.
C₂H5OH()+302(g) → 2CO2(g) + 3H₂O(1)
Average Bond Enthalpies (kJ mol-¹)
C-H 412
C-C 348
C-O 358
O=O 496
C=O 743
O-H 463
Enthalpy of Vaporisation (kJ mol-¹)
Ethanol 42.5
Water 41
-1113.5kJ is the theoretical enthalpy of combustion.
What makes energy different from enthalpy?
The entire amount of heat energy that is either absorbed or released in a thermodynamic system is measured by enthalpy. Internal energy denotes all of the potential or moving energy present in a thermodynamic system.
Enthalpy of combustion is the term used to describe the change in a system's enthalpy that occurs when one mole of a substance fully burns in oxygen or air at a specific temperature.
C₂H5OH()+302(g) → 2CO2(g) + 3H₂O(1)
Reactants:
5 C-H : 5*412
1 C-C : 348
1 C-O: 358
3 O=O: 3* 496
1 O-H: 463
Products:
2*2 C=O : 4*743
2*3 O-H: 6*463
Enthalpy of Vaporization (kJ mol-¹) for :
Ethanol 42.5
Water 41
Enthalpy of combustion : (5*412 + 348 + 358 + 3* 496 + 463 + 42.5) - ( 3*41 + 4*743 + 6*463)
: -1113.5kJ
To learn more about enthalpy use :
https://brainly.com/question/5374936
#SPJ1
Which of the following is an ozone-depleting substance? aCarbon dioxide bCarbon monoxide cMethyl bromide dNitrogen dioxide
Answer
c. Methyl bromide
Explanation
Ozone-depleting substances are:
i. chlorofluorocarbons (CFCs)
ii. halon.
iii. carbon tetrachloride (CCl4)
iv. methyl chloroform (CH3CCl3)
v. hydrobromofluorocarbons (HBFCs)
vi. hydrochlorofluorocarbons (HCFCs)
vii. methyl bromide (CH3Br)
viii. bromochloromethane (CH2BrCl)
Therefore the correct answer to you question is option:
c. Methyl bromide
How many significant figures is this and 40.5184 rounded
Answer:
forty point five one eight four
Explanation:
40.5184
Sig Figs
6
40.5184
Decimals
4
40.5184
Scientific Notation
4.05184 × 101
E-Notation
4.05184e+1
Words
forty point five one eight four