A strong chemical bond is formed from the transfer or sharing of electrons between atomic centers.
Certain amounts of the hypothetical substances A2 and B are mixed in a 3. 00 liter container at 300. K. When equilibrium is established for the reaction the following amounts are present: 0. 200 mol of A2, 0. 400 mol of B, 0. 200 mol of D, and 0. 100 mol of E. What is Kp, the equilibrium constant in terms of partial pressures, for this reaction
To find the equilibrium constant in terms of partial pressures, we need to first write the balanced equation for the reaction and then determine the partial pressures of the gases at equilibrium.
Assuming the hypothetical reaction is:
A2 (g) + 2B (g) ⇌ 2C (g) + D (g) + E (g)
At equilibrium, the number of moles of each substance can be used to calculate the partial pressures using the ideal gas law:
PA2 = nA2 * RT / V = 0.200 mol * 0.0821 L·atm/(mol·K) * 300 K / 3.00 L = 4.10 atm
PB = nB * RT / V = 0.400 mol * 0.0821 L·atm/(mol·K) * 300 K / 3.00 L = 8.20 atm
PC = nC * RT / V = (0.200 mol / 2) * 0.0821 L·atm/(mol·K) * 300 K / 3.00 L = 2.05 atm
PD = 0.100 mol * 0.0821 L·atm/(mol·K) * 300 K / 3.00 L = 2.05 atm
PE = 0.200 mol * 0.0821 L·atm/(mol·K) * 300 K / 3.00 L = 4.10 atm
Kp can be calculated as the product of the partial pressures of the products, raised to their stoichiometric coefficients, divided by the product of the partial pressures of the reactants, raised to their stoichiometric coefficients:
Kp = (PC)^2 * (PD) * (PE) / (PA2) * (PB)^2
Kp = (2.05 atm)^2 * (2.05 atm) * (4.10 atm) / (4.10 atm) * (8.20 atm)^2
Kp = 0.0452 atm
Therefore, the equilibrium constant in terms of partial pressures (Kp) for this reaction is 0.0452 atm.
To know more about equilibrium refer here
https://brainly.com/question/14281439#
#SPJ11
Please help me!
I'm really stuck on this one problem, and it would really help me in my chemistry finals. The question is on the screenshot.
:)
A weak acid buffer with a strong acid added to it will match option D. The conjugate base neutralizes the hydronium ions.
A weak acid buffer with a strong base added to it will match option A. The acid neutralizes the hydroxide ions.
A weak base buffer with a strong acid added to it will match option B. The base neutralizes the hydronium ions.
A weak base buffer with a strong base added to it will match option C. The conjugate acid neutralizes the hydroxide ions.
What is a buffer solution ?A buffer solution is described as an acid or a base aqueous solution consisting of a mixture of a weak acid and its conjugate base, or vice versa.
We know the concept that buffers work by utilizing their conjugate acid-base pairs to maintain the pH of a solution.
The specific interactions between the components of a buffer and the added strong acid or base is a determining factor on how they stabilize the pH.
Learn more about buffer solutions at:
https://brainly.com/question/8676275
#SPJ1
Name the following Acid: HBO3 if (BO3)^-3 is called the borate ion.
a. borous acid
b. hydrogcn boratc
c. boric acid
d. triboric acid
Option (d) is correct, i.e. tri-boric acid is the following acid: HBO3 if (BO3)^-3 is called the borate ion.
Various borate ion [B2O5]4s, [B3O8]7s, [B4O12]12s, [B5O6(O)5]2s, [B6O13]8s, etc. are made up of trigonal planar B(O)3 or tetrahedral [B(O)4] structural units that are connected by shared oxygen atoms (corners) or atom pairs (edges) into bigger clusters. These anions can further polymerize into endless chains, layers, and frameworks and may have cyclic or linear structures. The terminal (unshared) O atoms in the anions can either carry a negative charge (O) or be capped with hydrogen atoms (OH). In order to have -conjugated molecular orbitals, the planar B(O)3 units may be stacked in the crystal lattice, which frequently produces advantageous optical features as strong harmonic production, birefringence, and UV transmission. Each linear chain of 2, 3, or 4 trigonal BO3 structural units in a polymeric borate anion shares oxygen atoms with an adjacent unit (s), has chains of trigonal BO3 structural units, similar to LiBO2. Cycles are present in other anions; for instance, the cyclic [B3O6]2 ion is present in NaBO2 and KBO2.
To know more about borate ion please refer: https://brainly.com/question/12104781
#SPJ4
The element that doesn't occur in elemental state in nature is
Answer:
technetium, atomic number 43; promethium, number 61; astatine, number 85; francium, number 87; neptunium, number 93; and plutonium, number 94.
Explanation:
11. Which do you think is more important in forming personality---environment or heredity? Explain your answer.
Answer:
I believe forming an environmental personality is more important than forming a hereditary personality. Why I said this is because of the people around out can change your personality, and sometimes if you're with the wrong people, it can go wrong, with your personality too. You could have been a nice person at some time, you bur you hung out with the wrong people and now you're just very inconsiderate. Another reason on why I believe forming an environmental personality is more important because of the fact that maybe you could've been born with a parent who has a bad personality. You could try your best to be nicer by the choice of people you choose to be friends with.
Explanation:
i hope this helped, im only in 7th
Which statement describes what happens when somebody slaps their hand on a wall?
Answer:
B. Wall applies equal reaction force on hand
Explanation:
This is newton's third law. You push something, that something pushes you back with same force. The direction is opposite, so if I push a wall, the wall pushes me back with same force just in opposite direction (so wall towards me). This is why option A is incorrect b/c it says force in same direction as wall. C and D talk about unequal force which is incorrect.
Answer:Wall applies equal reaction force on hand
Explanation:
write about grass land in long question
Grasslands are areas where the vegetation is dominated by grasses (Poaceae). However, sedge (Cyperaceae) and rush (Juncaceae) can also be found along with variable proportions of legumes, like clover, and other herbs. Grasslands occur naturally on all continents except Antarctica and are found in most ecoregions of the Earth. Furthermore, grasslands are one of the largest biomes on earth and dominate the landscape worldwide.[1] They cover 31-43% of the Earth's land area. There are different types of grasslands: natural grasslands, semi-natural grasslands, and agricultural grasslands.[1]
Answer:
Grasslands are areas where the vegetation is dominated by grasses (Poaceae). However, sedge (Cyperaceae) and rush (Juncaceae) can also be found along with variable proportions of legumes, like clover, and other herbs. Grasslands occur naturally on all continents except Antarctica and are found in most ecoregions of the Earth.
Explanation:
Yeast contribute to beer brewing by producing ________ during alcohol fermentation. ethanol ethanol methanol methanol oxygen
Yeast is a substance which contributes to beer brewing by producing ethanol during alcohol fermentation.
What is Fermentation?This a process in which carbohydrate is converted into an acid or alcohol. A common fungus used by brewing companies in fermentation processes is referred to as Yeast.
It converts Sugar to the following products:
ethanol, CO2HeatRead more about Fermentation here https://brainly.com/question/546578
The force of gravity pulling down on the
barbell is 756 newtons (N) How many
newtons of force are exerted by the
weightlifter to hold the barbell up?
Answer:
Explanation:
The same. The force down (the weight of the barbells) is counter balanced by the weight up ( a person holding the barbells). A little later on, you are going to draw force diagrams showing that these two forces are drawn acting in opposite directions.
You can satisfy yourself by drawing a box and putting 1 arrow pointing up on the bottom and labeling it 756 up and another arrow on the top of the box pointing down and labeling it 756. They balance.
to mix ingredients by gently turning one part over another with a spatula:____.
The process of mixing ingredients by gently turning one part over another with a spatula is known as folding.
Folding is a culinary technique used to combine delicate ingredients while minimizing the loss of air or altering the texture of the mixture. It is commonly used in recipes where a light and airy texture is desired, such as in cakes, soufflés, mousse, or whipped cream.
When folding, a spatula or a large spoon is used to gently lift and turn one part of the mixture over the other. The motion is typically performed in a semi-circular or figure-eight pattern, allowing the ingredients to be evenly incorporated without excessive stirring. This technique helps to maintain the airiness of the mixture and prevent overmixing, which can result in a dense or deflated final product.
Folding is particularly important when working with batters or mixtures that contain beaten egg whites or whipped cream, as these components contribute to the desired light and fluffy texture. By gently folding these ingredients into the mixture, their volume and structure are preserved, resulting in a delicate and evenly distributed final product.
To learn more about spatula, click here: brainly.com/question/31298399
#SPJ11
write the equation for the buffer system containing formic acid, hcooh, and sodium formate, nahcoo. write the net ionic equation for the reaction that would take place if hcl was added to the buffer. write the net ionic equation for the reaction that would take place if koh was added to the buffer.
The equation for the buffer system containing formic acid, HCOOH, and sodium formate, NaHCOO, is:
HCOOH + NaHCOO ↔ HCOO⁻ + Na⁺ + H⁺
The net ionic equation for the reaction that would take place if HCl was added to the buffer is:
H⁺ + HCOO⁻ ↔ HCOOH
The net ionic equation for the reaction that would take place if KOH was added to the buffer is:
OH⁻ + HCOOH ↔ HCOO⁻ + H₂O
What is formic acid?
Formic acid, also known as methanoic acid, is a colorless, pungent liquid with a chemical formula HCOOH. It is the simplest carboxylic acid and occurs naturally in various sources, including ant venom and some plants.
What is sodium formate?
Sodium formate is the sodium salt of formic acid, with the chemical formula NaHCOO. It is a white, crystalline powder that is soluble in water and slightly soluble in alcohol.
To know more about formic acid, visit:
https://brainly.com/question/13016575
#SPJ1
how many significant figures are in the number 0.04350 mm?
a. 6
b.5
c.4
d.3
I’m positive that its 4 or 3 or maybe 5?? idk
Answer:
Option c is correct = 4
Explanation:
Significant figures:
All non-zero digits are consider significant figures like 1, 2, 3, 4, 5, 6, 7, 8, 9.
Leading zeros are not consider as a significant figures. e.g. 0.03 in this number only one significant figure present which is 3.
Zero between the non zero digits are consider significant like 104 consist of three significant figures.
The zeros at the right side e.g 2400 are also significant. There are four significant figures are present.
In given measurement 0.04350 there are four significant number
4,3,5,0
These all are significant.
PLEASE HELP ME! WILL GIVE BRAINLIST
-506.9KJ is the enthalpy for the combustion of ethanol. It is a state function that is frequently employed in measurements of physical chemistry.
A thermodynamic system's enthalpy, which is one of its properties, is calculated by adding the internal energy of the system to the product of the volume and pressure of the system. It is a state function that is frequently employed in measurements of physical, chemical, and biological structures at constant pressure, which the sizable surrounding environment conveniently provides.
C\(_2\) H\(_5\) OH + 3O\(_2\) → 2CO\(_2\) + 3H\(_2\)O
ΔH= 2(-393.5)+3(-241.8) + 277.7 + 3(241.8)
= -787-723+277.7+725.4
= -1510+ 1003.1
= -506.9KJ
To know more about enthalpy, here:
https://brainly.com/question/16720480
#SPJ1
9. a pot of water is placed on a burner on a gas stove to heat. which part is the source of the activation energy required (the flame/the water), and is this reaction endothermic or exothermic?
The part that is the source of the activation energy required is the flame and the reaction is endothermic.
Endothermic reactionsIn this scenario, the source of the activation energy required is the flame on the gas stove. The flame provides the heat energy necessary to increase the kinetic energy of the water molecules and cause them to move faster, resulting in an increase in the temperature of the water.
The process of heating the water is an endothermic reaction because energy is being absorbed from the surroundings (in this case, from the flame) in order to increase the temperature of the water.
As the water absorbs heat energy from the flame, the potential energy of the water molecules increases, causing them to move faster and collide more frequently, which leads to an increase in the temperature of the water.
More on endothermic reactions can be found here: https://brainly.com/question/23184814
#SPJ1
predict the products of the following elimination reaction, and draw the major product formed. make sure to consider the stereochemistry of the reaction.
1) Draw the reactants in their anti-periplanar conformation.
2) Eliminate one of the hydrogens, forming a double bond between the two remaining atoms.
3) Consider the stereochemistry of the reaction to determine if the double bond is in a cis or trans conformation.
4) The resulting product is the major product formed from the elimination reaction.
The reaction you have provided is an elimination reaction, in which an alkene product is formed. The products of this reaction will depend on the reactants provided and the conditions used for the reaction. In particular, the major product of this reaction will be the one that follows the Zaitsev’s rule. When considering the stereochemistry of the reaction, the anti-periplanar conformation of the reactants must be taken into account.
The major product of the following elimination reaction will be an alkene with the double bond formed in the anti-periplanar conformation that follows Zaitsev's rule.
Learn more about Zaitsev’s rule
brainly.com/question/29675824
#SPJ11
Which set of reactants creates these products
during a double replacement reaction?
[?] → H₂O(1) + NaF (aq)
Remember that each formula must have a balanced charge.
A. HF (aq) + 2NaOH(aq)
B. HF (aq) + NaOH(aq)
C. NaH (aq) + FOH (aq)
D. 2HF (aq) + NaOH(aq)
Answer:
B. is the answer
Explanation:
(A) (B) + (C) (D) (AD) +(CB)
(H) (F) + (Na) (OH) --> H2O+NaF
(OH) counts as one because it's a polyatomic ion.
Which is correct?
a
Electrons in a p sublevel can shield the s electrons that are in the same
principal energy level.
b
Electrons in an s sublevel can shield the p electrons that are in the same
principal energy level.
с
Both a and b are true.
d
Neither a nor b are true.
Alcohol is removed by the _________ blank at a constant rate of 0.25 to 0.30 ounce of ethanol per hour
Answer:
Liver
Explanation:
Some of these intermediate metabolites can have harmful effects on the body. Most of the ethanol in the body is broken down in the liver by an enzyme called alcohol dehydrogenase (ADH), which transforms ethanol into a toxic compound called acetaldehyde (CH3CHO), a known carcinogen.
which of these pieces of equipment would be the most appropriate for precisely measuring 29 mL of liquid? Explain your reasoning, citing evidence related to the divisions on each tool and the concept of an estimated digit.
Answer:
The best equipment would be the graduated cylinder. Why?
Firstly, the smallest marking on the graduated cylinder is 2 mL, while on all the others the smallest marking is way above that, like 25 mL and 100 mL.
Without even going into the details, we can first rule out the volumetric flask, since its smallest marking is 100 mL and even that is already bigger than our sample size, hence we would have no markings to accurately measure out 29 mL of our sample had we used the volumetric flask.
Next to be ruled out would be the Erlenmeyer flask, as you can see in the image, it only has three marking, and as the smallest marking is 25 mL, each marking is at least 25 mL, and even so far as going up to 50 mL. This cannot let us accurately measure 29 mL out at all, due to the markings being way too big to do that. Hence, the Erlenmeyer flask is ruled out.
Finally, the beaker seems to be a worthy candidate! Unfortunately, for the same reason as the Erlenmeyer flask, as you can see in the image each marking represents 10 mL. We cannot measure 9 mL in the beaker accurately, and hence the beaker is ruled too.
We are left with the graduated cylinder, and that is our answer.
Explanation:
Hope this helped!
Answer:
This is the sample answer (assignment's correct answer):
The graduated cylinder is most appropriate. Because its smallest divisions are 2 mL, increments between each 2-mL division are estimated. Measurements can therefore be stated to a single milliliter.
Just make some changes to the writing and youre good to go.
pls help...
You are a forensic scientist working on a murder case. You have taken the blood sample from the crime scene and put it through Electrophoresis and Southern blotting. What step do you need to take next? A. Add ethanol B. Add restriction enzymes C. Add minisatellites D. Add radioactive probes
Add minisatellites. Hence, option C is correct.
What is Electrophoresis?Electrophoresis is a laboratory technique used to separate DNA, RNA or protein molecules based on their size and electrical charge.
You are a forensic scientist working on a murder case. You have taken the blood sample from the crime scene and put it through Electrophoresis and Southern blotting. you need to add minisatellites.
Hence, option C is correct.
Learn more about Electrophoresis here:
https://brainly.com/question/13949940
#SPJ2
write a balanced molecular equation for solid calcium carbonate is heated and decomposes to solid calcium oxide
The balanced molecular equation for the decomposition of solid calcium carbonate (CaCO3) into solid calcium oxide (CaO) and carbon dioxide (CO2) when heated is as follows:
CaCO3(s) → CaO(s) + CO2(g)
This equation shows that one molecule of calcium carbonate decomposes into one molecule of calcium oxide and one molecule of carbon dioxide. The solid calcium carbonate breaks down into solid calcium oxide and gaseous carbon dioxide when heat is applied.
To balance the equation, we need to make sure that the number of atoms of each element is equal on both sides. In this case, we have one calcium atom, one carbon atom, and three oxygen atoms on the left side, and one calcium atom, one carbon atom, and two oxygen atoms on the right side. Therefore, we need to adjust the coefficients to balance the equation. We can do this by placing a coefficient of 1 in front of CaCO3, and coefficients of 1 in front of CaO and CO2, resulting in the balanced equation:
CaCO3(s) → CaO(s) + CO2(g)
I hope that answers your question. Let me know if you have any more questions or need further clarification.
learn more about equation
https://brainly.com/question/30087623
#SPJ11
When is chemical energy released
Explanation:
Chemical energy is energy stored in the bonds of chemical compounds, like atoms and molecules. This energy is released when a chemical reaction takes place. Usually, once chemical energy has been released from a substance, that substance is transformed into a completely new substance.
Answer:
Breaking or making of chemical bonds involves energy, which may be either absorbed or evolved from a chemical system. Energy that can be released or absorbed because of a reaction between a set of chemical substances is equal to the difference between the energy content of the products and the reactants, if the initial and final temperatures are the same.
Explanation:
Time Limit: 0:25:00
Kelly Espinoza Gonzalez: Attempt 1
Question 5 (1 point)
Time Left: Time Exceeded
How many moles of iron (Fe) are in 279 g of iron?
O 0.2 mol Fe
15, 568 mol Fe
O 1 mol Fe
O 5 mol Fe
Iron has a molar mass of 55.84 grams/mole. So, five grams divided by 55.84 grams/mole gives us 0.089 moles of iron
How do you calculate moles?The unit is denoted by mol.The formula for the number of moles formula is expressed as.Number of moles formula is.Number of moles = Mass of substance / Mass of one mole.Number of moles = 95 / 86.94.1 mole is a number equal to. 022 x 10 23 particles, also known as the Avogadro's constant. To calculate the number of moles of any substance in the sample, we simply divide the given weight of the substance by its molar mass.One mole of a substance is equal to 6.022 × 10²³ units of that substance (such as atoms, molecules, or ions).To learn more about moles refers to:
brainly.com/question/15356425
#SPJ1
The ____________ of an atom is a relative measure of its mass compared to other atoms.
The atomic mass of an atom is a relative measure of its mass compared to other atoms.
What is atomic mass?An atom's mass is its atomic mass. Although the kilogram is the SI measure of mass, the unified atomic mass unit, or dalton, is a common way to express atomic mass. An unbound carbon-12 atom in its ground state has a mass of 112 of a Da.
Atomic mass is the amount of matter that makes up an element's atom. It is written as a multiple of 1.992646547 1023 gram, or one-twelfth of the mass of the carbon-12 atom, which is given an atomic mass of 12 units.
A fundamental physical quality of matter is mass. The term "atomic mass" refers to the weight of an atom or molecule.
To learn more about atomic mass visit:
brainly.com/question/22817140
#SPJ4
CH3CH2CHCHCHCH2CH3, with two CH2CH3 groups and an SH group attached
The chemical formula you provided is a representation of the molecule hexanethiol (C6H14S), which contains a chain of six carbon atoms with an SH group attached to the fifth carbon atom and two CH2CH3 groups attached to the second and sixth carbon atoms.
Hexanethiol is a colorless liquid with a strong, unpleasant odor and is commonly used as a reagent in organic chemistry.
It seems like you're describing a molecule with a specific structure. Based on the information provided, the molecule can be represented as follows:
CH3CH2C(CH2CH3)C(SH)CH(CH2CH3)CH2CH3
This molecule has a main carbon chain of 7 carbons (heptane) with two CH2CH3 (ethyl) groups and an SH (thiol) group attached to different carbon atoms along the chain.
Visit here to learn more about chemical formula : https://brainly.com/question/32018188
#SPJ11
Why is the reactivity of metal increase but that of non-metal decreases as we go down in a group of periodic table? (pls its important i need this question's ans for my exam so answer it fast thank you)
Answer:
Nonmetal reactivity decreases down a group because the nucleus' ability to gain more valence electrons weakens due to more nuclear shielding. For Metals: the most reactive metals are those that can lose their valence electrons the most easily. ... Francium is the most reactive metal
Explanation:
Answer:
While moving from top to bottom in a group of the periodic table, the reactivity of non- metals decreases. ... Thus, the tendency of gaining electron/s in the valence shell decreases as well as the chemical reactivity also decreases on moving from top to bottom in a group of non- metals.
an unknown compound exhibits a signal at 170 ppm in its 13c nmr spectrum. treatment with two equivalents of lialh4 followed by aqueous workup gives an amine. what could be the identity of the unknown compound?
The existence of a carbonyl group in the unidentified chemical is indicated by the signal at 170 ppm in the 13C NMR spectra.
What number of peaks or signals would you anticipate to see in the ethyl acetate C-13 NMR spectrum?It displays the four anticipated signals one for each of the carbonsas expected.
How many peaks does a carbon atom in a chemical cause the 13C NMR spectrum to produce?Four carbons and four peaks are present. No two carbons exist in the same environment exactly. The peak at slightly over 50 must be a carbon with a single bond connecting it to an oxygen.
To know more about carbon visit:-
https://brainly.com/question/22530423
#SPJ1
The oxide of which of the following metals should have the greatest lattice energy?
A.) calcium
B.) strontium
C.) magnesium
D.) beryllium
E.) barium
The oxide of the metal with the highest charge and smallest ionic radius is expected to have the greatest lattice energy.
Among the given options, the metal with the highest charge is beryllium (Be2+), which has a charge of +2. Beryllium also has a small ionic radius, meaning its ions are closely packed together. As a result, the oxide of beryllium (BeO) is likely to have the greatest lattice energy. Lattice energy is a measure of the energy released when gaseous ions come together to form a solid lattice structure. It is influenced by the magnitude of the charges on the ions and the distances between them. Higher charges and smaller ionic radii result in stronger attractions between ions, leading to higher lattice energy.
To learn more about metals click here: brainly.com/question/29404080 #SPJ11
If the molar mass of a compound is 78. 12 g and the empirical formula is ch, what is the value of the integer that relates the empirical formula to the molecular formula?.
Answer:
C6H6
Explanation:
The empirical formula, CH, has a unit mass of 13 (12+1). 78/13 = 6
There are 6 units of CH in the intact compound. The molecular formula must be C6H6.
C: 6 * 12 = 72
H: 6 * 1 = 6
Total = 78
You discovered a new compound with the following name: Feline (II) Canide. Based on the information below, what would be the correct formula for this compound?
*Canine is a halogen
*Feline has the following symbol: Fi
*Canine has the following symbol: Ci
*Answer choices*
*Fi2Ci3
*FiCi2
*CiFi
*Fi2Ci
Answer:
FiCi2
Explanation:
In relation of Iron(ii) chloride, FeCl2