Aldehydes and ketones exhibit different reactivity toward nucleophiles. Aldehydes generally show higher reactivity compared to ketones due to the absence of bulky alkyl groups. This higher reactivity is attributed to the electronic and steric factors associated with the carbonyl group.
The relative reactivity of aldehydes and ketones toward nucleophiles can be described as follows:
1. Aldehydes are generally more reactive than ketones: Aldehydes possess a hydrogen atom bonded directly to the carbonyl carbon, making them more susceptible to nucleophilic attack compared to ketones. This hydrogen atom facilitates easier access to the carbonyl carbon, resulting in increased reactivity.
2. Steric effects influence reactivity: Ketones have bulky alkyl groups attached to the carbonyl carbon, which creates steric hindrance and reduces the accessibility of the carbonyl carbon to nucleophiles. This steric hindrance decreases the reactivity of ketones compared to aldehydes.
3. Electronic effects affect reactivity: The electron-withdrawing nature of alkyl groups in ketones decreases the electron density around the carbonyl carbon, making it less susceptible to nucleophilic attack. In contrast, aldehydes lack such electron-withdrawing groups, leading to higher electron density around the carbonyl carbon and enhanced reactivity.
In summary, aldehydes generally exhibit higher reactivity toward nucleophiles compared to ketones due to the absence of bulky alkyl groups, which reduces steric hindrance and enhances accessibility to the carbonyl carbon. Additionally, the electronic effects of alkyl groups in ketones further contribute to their relatively lower reactivity.
Learn more about Aldehydes here:
https://brainly.com/question/31979953
#SPJ11
What is the coefficient for this formula? 9 NaCl2 A. 11 B. 9 C. 2 D. 1
Answer:
B. 9
Explanation:
The formula of the compound is given as:
9NaCl
Coefficient is the number before the compound. The compound here is made up of sodium and chlorine.
Therefore, we have 9 as the coefficient and it is 9 moles of NaCl.
The compound have 1 atoms of NaAlso 1 atom of ClNote, NaCl is an ionic compound.
31. The chart below summarizes the forces applied to four different objects.
Which object will experience the greatest acceleration?
A. Y
B. X
C. Z
D. W
Answer:
A. Y
Explanation:
force= mass × acceleration
acceleration= force / mass
because Y has the smallest mass it will experience the greatest acceleration
Which will change the value of Ksp for mercury (1) sulfate Hg2SO4? O adding Hg+ ions to the solution. decreasing the temperature of the solution removing SO42-ions from the solution decreasing the pH of the solution
Change in the value of Ksp or solubility product for mercury sulfate Hg₂SO₄ will observed in case of option (2) decreasing the temperature of the solution.
Ksp, or the solubility product, is a constant that describes the equilibrium between a solid and its dissolved ions in a solution. The solubility of a compound, such as Hg₂SO₄, is dependent on temperature and the concentration of its dissolved ions.
Lowering the temperature will decrease the solubility of the compound, which will in turn decrease the concentration of its dissolved ions and thus decrease the value of Ksp. Adding Hg+ ions, removing SO₄²⁻ ions, or decreasing the pH of the solution would not directly affect the solubility of the compound and therefore would not change the value of Ksp.
The solubility product constant (Ksp) of a compound like mercury sulfate is temperature-dependent. Changing the temperature will affect the solubility of the compound and therefore alter the Ksp value. The other options will not change the Ksp value, but rather affect the position of the equilibrium in the dissolution process of the compound.
Learn more about solubility product : https://brainly.com/question/1419865
#SPJ11
Explain how entropy would change in the process of flambeing (combustion of ethanol)
Entropy of the environment and the system (ethanol and oxygen being burned) both rise during the flambeating process. The second law of thermodynamics is in agreement with this increase in entropy.
How does combustion affect entropy?When a combustion reaction takes place, the system's entropy always goes up. Combustion processes must be spontaneous because of the interaction between an increase in entropy and a decrease in energy.
Is entropy increased by burning?A fire is exothermic, which means that it loses energy as heat is released into the surrounding space. As the bulk of a fire's byproducts are gases, such as carbon dioxide and water vapour, the system's entropy increases during the majority of combustion episodes.
To know more about thermodynamics visit:-
https://brainly.com/question/30207871
#SPJ1
List the 5 characteristics of minerals
Answer:
Solid, Naturally Occurring, Inorganic, Fixed Composition, Crystal-like internal structure
Explanation:
use lewis structures to show the electron transfer that enables these ionic compounds to form: (a) k2s (b) ca3n2
(a) K₂S: Each potassium atom donates one electron to sulfur, forming K⁺ and S₂⁻ ions, which then attract each other to form K₂S via electrostatic forces.
(b) Ca₃N₂: Each calcium atom donates two electrons to one nitrogen atom, forming Ca²⁺ and N³⁻ ions. Three nitrogen atoms then bond with two calcium ions each to form Ca³N².
(a) The Lewis structure of K₂S can be shown as follows:
K K
\ /
S²⁻
K K
| |
S₂- + 2 K+ → K₂S
The sulfur atom gains two electrons from two potassium atoms to form S²⁻on while each potassium atom loses one electron to form K⁺ ion. The two K+ ions combine with the S²⁻ ion to form K₂S.
(b) \(Ca_3N_2\):
The Lewis structure for \(Ca_3N_2\) can be written as:
:N≡C:
/ \
Ca Ca
| |
Ca Ca
The electron transfer occurs as follows:
3 Ca + N₂ → Ca₃N₂
Each nitrogen atom shares its three valence electrons with three calcium atoms. Each calcium atom gives two electrons to the nitrogen atom to form the Ca₃N2 ionic compound.
To learn about Lewis's structure:
https://brainly.com/question/31509183
#SPJ4
Which are critical success factors? multiple select question. number of new customers create high-quality products retain competitive advantages reduce product costs
Critical success factors are specific elements or activities that are essential for achieving success in a particular endeavor.
They are key areas or factors that have a significant impact on the success of a business or project. Based on the options provided, the critical success factors are:
1. Create high-quality products: This factor is critical because delivering products of high quality is crucial for attracting and retaining customers, building a positive brand reputation, and gaining a competitive advantage in the market.
2. Retain competitive advantages: Maintaining a competitive advantage is crucial for long-term success. It involves continuously identifying and leveraging unique strengths, such as proprietary technology, superior customer service, or cost leadership, to stay ahead of competitors.
3. Reduce product costs: Managing and reducing product costs is essential for improving profitability and remaining competitive in the market. Cost reduction efforts can involve optimizing production processes, sourcing materials efficiently, and implementing cost-saving measures without compromising product quality.
These three factors—creating high-quality products, retaining competitive advantages, and reducing product costs—are critical for the success of a business.
By focusing on these areas, a company can enhance customer satisfaction, differentiate itself from competitors, and improve financial performance.
However, the number of new customers is not considered a critical success factor in this context, as it is more focused on business growth rather than core factors necessary for success.
for more questions on success
https://brainly.com/question/1078746
#SPJ8
witch substance exhibits metallic bonding in the solid state
Answer:
Explanation:
When in a solid state, the substances that exhibit metallic bonding include metals, metal alloys, and some metalloid elements. Metals always form metallic bonds when bonding to other metal atoms.
What is the maximum number of electrons in an atom that can have the quantum numbers n=4,m=+1?a. 4b. 15c. 3d. 6
The total maximum number of electrons with the given quantum numbers is 2 (from the p-orbital) + 4 (from the d-orbital) is 6.
The maximum number of electrons in an atom that can have the quantum numbers n=4, m=+1 is 6.
1. The principal quantum number (n) refers to the energy level of an electron in an atom, which is 4 in this case.
2. The magnetic quantum number (m) represents the orientation of an orbital in space and has a value of +1.
3. To determine the maximum number of electrons, we need to find the possible values of the angular momentum quantum number (l) for the given n and m values.
For n = 4, the possible values of l are: 0, 1, 2, and 3. However, since m = +1, the l values that can accommodate this m value are 1 and 2.
4. The l = 1 corresponds to the p-orbital, which can accommodate 2 electrons with m = +1 (spin up and spin down).
5. The l = 2 corresponds to the d-orbital, which can accommodate 4 electrons with m = +1 (two spin up and two spin down).
To learn more about electrons click here https://brainly.com/question/28977387
#SPJ11
how many moles of ba(oh)2 are present in 275 ml of 0.400 m ba(oh)2 ?
The number of moles of Ba(OH)₂ present in 275 ml of 0.400 M Ba(OH)2 solution is 0.11 moles.
Moles of Ba(OH)₂ present in 275 ml of 0.400 M Ba(OH)₂ solution can be calculated as follows:
First of all, we should be familiar with the formula of Molarity which is as follows:
Molarity (M) = moles of solute / liters of solution We can rearrange this formula to calculate the moles of solute as follows:
moles of solute = Molarity (M) × liters of solution (L)Now let's apply the above formula to the given problem. Molarity (M) = 0.400 M, liters of solution (L) = 275 ml or 0.275 L (since 1 L = 1000 ml)moles of Ba(OH)₂ = 0.400 M × 0.275 L= 0.11 moles.
Therefore, the number of moles of Ba(OH)₂ present in 275 ml of 0.400 M Ba(OH)₂ solution is 0.11 moles.
To know more about moles refer here: https://brainly.com/question/29724957#
#SPJ11
what species are produced at the positive and negative electrodes during the electrolysis of molten sodium chloride?
The species are produced at the positive and negative electrodes during the electrolysis of molten sodium chloride is at the positive and the species is Cl₂(g) and at the end of negative is Na(l).
The net effect of the passing the electric current to the molten salt in this cell that is to decompose the sodium chloride into the its elements, the sodium metal and the chlorine gas. The anode is called as the positive end and the cathode is called as the negative end.
During the process of the electrolysis the chlorine gas are produce at the positive end that is anode. The sodium metal is produce at the negative end that is the catode.
To learn more about electrolysis here
https://brainly.com/question/9977624
#SPJ4
Which is an energy source for a coyote?
Answer:
The coyotes are both a plant and meat eaters whose common food is 90% of their diet, is small animals. Rabbits, hares, birds, snakes, fish, crustaceans, and insects are all on the menu.
hopefully this is right :))
Answer:
sun
Explanation:
Explain why the product at the negative electrode is not always a metal.
The product at the negative electrode is not always a metal because it will only be produced if it is less reactive than hydrogen.
What is a Metal?These are materials which donate electrons in a chemical reaction and have high heat and electrical conductivity.
Metals are more reactive than hydrogen which is why it is not always produced at the cathode.
Read more about Metals here https://brainly.com/question/4701542
#SPJ2
asymmetrical alkene + X₂ + H₂O →
The reaction you're describing is a halogenation reaction where an unsymmetrical alkene reacts with a halogen (X2) and water (H2O) to form a halohydrin. The general reaction can be represented as follows:
Asymmetrical alkene + X2 + H2O → Halohydrin
For example, let's consider the reaction between propene (an asymmetrical alkene) and chlorine gas (Cl2) in the presence of water (H2O):
CH3CH=CH2 + Cl2 + H2O → CH3CH(Cl)CH2OH
In this reaction, the double bond of propene is broken and a chlorine atom is added to one carbon atom, while a hydroxyl group (-OH) is added to the other carbon atom.
This forms a halohydrin, which in this case is 2-chloropropanol. The reaction mechanism involves the formation of a cyclic intermediate called a halonium ion, which is then attacked by water to form the halohydrin.
Note that the halogenation of an unsymmetrical alkene can lead to the formation of different products, depending on the regioselectivity of the reaction. In the example above, the reaction is regioselective because the chlorine atom is added to the less-substituted carbon atom of the alkene.
learn more about halogenation here:
https://brainly.com/question/31033378?utm_source=android&utm_medium=share&utm_campaign=question
#SPJ11
What could the fourth quantum number of a 3p3 electron be?
A. ms=-1/2
B. ms=-1
C. ms=+1
D. ms=0
Explain the need of the term avarage atomic mass
Answer:
The average atomic mass of an element is the sum of the masses of its isotopes, each multiplied by its natural abundance (the decimal associated with percent of atoms of that element that are of a given isotopе). An element does not have an absolute atomic mass.
Hope this helps :)
During witch process dose carbon dioxde gas move from the atmosphere
Answer: it is density
Explanation:
Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 and CH3CH2CH(CH3)CH2CH2CH3. CH3CH(CH3)CH2CH2CH(CH3)CH3 and CH3CH2CH2CH2CH2CH2CH2CH3. CH3CH(CH3)CH2CH3 and CH3CH2CH2CH2CH3
The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.
Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.
These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.
They are isomers because they have the same molecular formula C6H14, but different structures.4.
In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.
They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.
They are isomers because they have the same molecular formula C3H7, but different structures.
In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.
To know more about isomers visit:
brainly.com/question/32508297
#SPJ11
A man earned a $7,500 commission by selling a coin-operated laundry business, which has six more years before the expiration of its present lease. The man
A man earned a $7,500 commission by selling a coin-operated laundry business, which has six more years before the expiration of its present lease. To evaluate whether or not this sale was worth it, we must calculate the total amount of money that the laundry business will generate in the remaining six years of its current lease.
This can be calculated as follows: Monthly revenue from laundry business = $2,500Commission paid to man = $7,500Revenue generated in one year = Monthly revenue x 12 = $2,500 x 12 = $30,000Revenue generated in six years = Revenue generated in one year x 6 = $30,000 x 6 = $180,000Therefore, the laundry business will generate $180,000 in the remaining six years of its lease. Given that the man earned a $7,500 commission by selling the business, this sale was definitely worth it as the amount of money generated from the business in the remaining six years of its lease far exceeds the commission paid to the man.
The man earned a $7,500 commission by selling a coin-operated laundry business that still had six years remaining on its current lease. To determine whether this sale was worthwhile, we must first calculate the amount of money the laundry business will generate during the remaining six years of its current lease. We can do this by determining the laundry business's monthly revenue and multiplying it by 12 to get the yearly revenue.
After that, we can multiply the yearly revenue by 6 to obtain the total revenue for the next six years.Since the monthly revenue from the laundry business is $2,500, the yearly revenue is $30,000 (2,500 x 12 = 30,000). The business will earn $180,000 in the six years remaining on its lease (30,000 x 6 = 180,000).Given that the man received $7,500 in commission by selling the business, we can determine that this was a profitable sale since the total revenue generated from the business in the next six years far exceeded the commission paid to the man.
It is clear that selling the coin-operated laundry business was worth it since the total revenue generated in the remaining six years of the lease was $180,000, whereas the man earned only $7,500 in commission for selling the business. This demonstrates that this was a profitable sale and an excellent business decision.
To know more about revenue :
brainly.com/question/27325673
#SPJ11
The man in question is a commission-based sales agent who earned $7,500 by selling a coin-operated laundry business. The laundry business is still leased for another six years before the lease expires.This information alone is insufficient to make any meaningful conclusions about the man in question.
However, we can surmise a few things based on the information provided.First, we know that the man is a sales agent, and he likely works for a brokerage or agency that specializes in selling businesses. We can also assume that he is experienced in selling businesses, and that he has a good reputation in the industry, since he was able to sell the coin-operated laundry business and earn a commission of $7,500. Finally, we can speculate that he has good communication and negotiation skills, since he was able to successfully negotiate the sale of the business and earn a commission.The information provided does not give us any other details about the man in question, such as his age, background, or personal interests. However, based on the information we do have, we can assume that he is a successful sales agent who is well-regarded in his industry.For such more question on communication
https://brainly.com/question/28153246
#SPJ8
What must be true of a system where reactants are more abundant at equilibrium?
Keq>1, ΔG∘<0
Keq<1, ΔG∘>0
Keq=1, ΔG∘=0
depends on the temperature
The correct answer is:
Keq<1, ΔG∘>0
When a system is at equilibrium, the forward and reverse reactions occur at equal rates. At this point, the concentrations of the reactants and products do not change over time. The equilibrium constant (Keq) is a measure of the relative concentrations of the reactants and products at equilibrium.
If the reactants are more abundant at equilibrium, it means that the equilibrium lies towards the side of the reactants. This suggests that the value of Keq is less than 1, since the ratio of products to reactants is low. Additionally, a positive ΔG∘ (standard free energy change) indicates that the reaction is not spontaneous in the forward direction, meaning that energy must be added to the system to proceed in that direction.
Therefore, the correct statement is: Keq<1, ΔG∘>0.
It's important to note that this answer assumes standard conditions (25°C, 1 atm pressure, and 1 M concentration). At different temperatures and concentrations, the values of Keq and ΔG∘ may change.
To know more about equilibrium refer here:
https://brainly.com/question/30694482?#
#SPJ11
pls answer question will mark brainliset tyty
Answer:
A b/c aluminum
Explanation:
don't forget to follow rate like
complete combustion of 2.00 g2.00 g of a hydrocarbon produced 6.16 g6.16 g of co2co2 and 2.84 g2.84 g of h2o.h2o. what is the empirical formula for the hydrocarbon? insert subscripts as necessary. empirical formula:
The molecular formula of a compound is a whole number multiple of its empirical formula. The empirical formula of the hydrocarbon is C₄H₉.
What is empirical formula?The empirical formula of a compound can be defined as the formula which gives the simplest whole number ratio of atoms of various elements present in one molecule of the compound.
Here moles of 'C' = moles 'CO₂' = 6.16 / 44 = 0.14 moles
Moles of 'H' = 2 × moles 'H₂O' = 2 × 2.84/18.02 = 0.315 moles
Divide both number of moles by 0.14. Then we get
1 mol 'C' and 2.25 mol 'H'
Multiply both with 4 to obtain a whole number.
Then the number of carbon is 4 and that of hydrogen is 9.
Thus the empirical formula is C₄H₉.
To know more about empirical formula, visit;
https://brainly.com/question/14044066
#SPJ1
Identify the molecular geometry corresponding to each expected bond angle around the central atom.
a. Linear b. Trigonal pyramidal c. Trigonal planar d. Tetrahedral
In Linear molecular geometry, the bond angle is 90°, in trigonal pyramidal geometry, bond angle is 107°, in trigonal planar geometry, bond angle is 120° and in tetrahedral, the bond angle is 109.5°.
In the linear geometry, the central atom has two side atoms attached which are at and bond angle of 180°.
In trigonal pyramidal geometry, the central atom has four side atoms which resembles a pyramid like structure. The bond angle between the two consecutive side atoms is 107°.
In trigonal planar geometry, three atoms are attached on the sides of central atom. The bond angle between these side atom is equal and of 120°.
In Tetrahedral geometry, the central atom and the side atoms makes a triangular prism like structure, the bond angle between side atoms is 109.5°.
To know more about Molecular Geometry, visit,
https://brainly.com/question/19354582
#SPJ4
As the reaction in a galvanic cell proceeds towards products, which of the following are true?
A) ΔG starts at 0, stays same
B) ΔG starts < 0, becomes more negative
C) ΔG starts < 0, stays same
D) ΔG starts < 0, becomes more positive
E) ΔG starts > 0, stays same
In a galvanic cell, the reaction proceeds towards the production of products. ΔG starts < 0, becomes more negative
Option B is correct .
As the reaction proceeds, the Gibbs free energy (ΔG) reduces, and the following are true: ΔG starts < 0, becomes more negative.
When the reaction in a galvanic cell proceeds towards the production of products, the Gibbs free energy starts with a negative value, and it becomes even more negative.
The Gibbs free energy (ΔG) is a measure of the available energy in a system that can be used to do work. It measures the difference between the free energy of the final state and the initial state.The Gibbs free energy change of a system is dependent on the enthalpy and entropy change. If the enthalpy change is negative (exothermic), and the entropy change is positive (disorderly), the Gibbs free energy change is negative, and the reaction is spontaneous.
Learn more about Gibbs energy :
brainly.com/question/13765848
#SPJ11
The pH of a solution of Ca(OH)2 is 8.57. Find the [Ca(OH)2]. Be careful, the fact that this base produces 2 OH- is important!
The concentration of Ca(OH)2 in the solution is approximately 1.33 x 10^(-6) M.
To find the concentration of Ca(OH)2 in a solution with a pH of 8.57, we need to use the concept of pOH, which is the negative logarithm of the hydroxide ion concentration ([OH-]). The pOH can be calculated by subtracting the pH from 14, which gives us 14 - 8.57 = 5.43.
Since Ca(OH)2 produces two OH- ions for every molecule of Ca(OH)2 that dissolves, the concentration of OH- ions will be twice the concentration of Ca(OH)2. Thus, we have [OH-] = 2x, where x represents the concentration of Ca(OH)2.
Taking the antilogarithm of the pOH, we find that [OH-] = 10^(-pOH) = 10^(-5.43).
Since [OH-] = 2x, we can write 2x = 10^(-5.43) and solve for x.
x = (10^(-5.43))/2 ≈ 1.33 x 10^(-6) M
For more such questions on Ca(OH)2
https://brainly.com/question/31035177
#SPJ8
what does combustion mean
Answer:
combustion is a high-temperature exothermic redox chemical reaction between a fuel and an oxidant, usually atmospheric oxygen, that produces oxidized, often gaseous products, in a mixture termed as smoke.
The periodic table is divided into groups. In general,
The periodic table is divided into groups, which are columns representing elements with similar properties and electron configurations.
The periodic table is organized into groups or columns to classify elements based on their chemical and physical characteristics. Elements within the same group share similar properties because they have the same number of valence electrons, which determines their chemical reactivity. These groups are also known as families or vertical columns.
The periodic table consists of 18 groups, numbered from 1 to 18. Each group is labeled with a number and a letter designation, such as Group 1 (alkali metals) or Group 17 (halogens).
The elements within a group often display similar trends in atomic size, ionization energy, electronegativity, and chemical behavior. The grouping of elements helps scientists predict and understand the behavior of different elements based on their position in the periodic table.
For more questions like Periodic click the link below:
https://brainly.com/question/31672126
#SPJ11
Please help me out. Im stressed out enough. Ill give brainliest too.
The following completes the blanks;
1) Constant, constant
2) Increasing, increasing positive
3) constant , constant negative
4) decreasing, decreasing negative
What is acceleration?The term acceleration refers to the rate of change of the velocity with time. We know that when an unbalanced force acts on a body in motion, the acceleration is increased when the force acts the same direction as the motion and the acceleration is decreased when the force acts in opposite direction to the motion.
When there is no change in the magnitude of force that is applied, the acceleration remains constant. Recall that force produces acceleration according to the Newton's law.
The following completes the blanks;
1) Constant, constant
2) Increasing, increasing positive
3) constant , constant negative
4) decreasing, decreasing negative
The difference between speed and velocity is the speed is a scalar quantity and velocity is a vector quantity.
Learn more about acceleration:https://brainly.com/question/12550364
#SPJ1
Please somone help me with a chemistry question brainliest to whoever answers correctly and 20 points
Answer:
Polar
Explanation:
Electronegativity Difference:
0.7 Non-Polar Covalent = 0 0 < Polar Covalent < 2 Ionic (Non-Covalent) ≥ 2
the mass of a liquid is 11.50 g and its volume is 9.03 mL. How many significant figures should its density value have?
Answer:
3
Explanation:
The mass has 4 sig digits.
The volume has 3 sig digits
The density is = 11.50/9.03 = 1.2735
To 3 sig digits (determined by 9.03) the answer would be 1.27 gram/mL