Answer:
your should probably be warming the acid
Explanation:
because when you are it is disappearing
Answer:
Warming the acid
Explanation:
This is because when the acid is heated, the particle of the acid gain more energy (kinetic to be more precise) causing more collisions to occur, colliding even more with the particles of the magnesium ribbon. This increases the rate of disappearance of the magnesium ribbon.
which statement about the solubility of methanol, ch3oh , and methanethiol, ch3sh , are true?
Methanol (CH3OH) is highly soluble in water and many polar solvents due to its polar nature, while methanethiol (CH3SH) has lower solubility in water and is more soluble in organic solvents.
The solubility of methanol (CH3OH) and methanethiol (CH3SH) can be described as follows:
Methanol (CH3OH):
Methanol is a polar molecule due to the presence of the hydroxyl group (OH). It is highly soluble in water and many polar solvents. This is because the polar nature of methanol allows it to form hydrogen bonds with water molecules, enhancing its solubility. Methanol can mix in all proportions with water and readily dissolves in it.
Methanethiol (CH3SH):
Methanethiol is a slightly polar molecule due to the presence of the sulfur atom. However, the polarity is significantly lower compared to methanol. Methanethiol has a characteristic foul odor and is less soluble in water compared to methanol. Its solubility in water decreases with increasing molecular size. Methanethiol exhibits limited solubility in water but is more soluble in organic solvents, such as alcohols and ethers.
Know more about Methanol here:
https://brainly.com/question/3909690
#SPJ11
which statement about the solubility of methanol, ch3oh , and methanethiol, ch3sh , are true? _______
Question 14 PM2.5 is defined as ________
- the mass concentration of particles in the air less than or equal to 2.5 micrometers in diameter. - the mass concentration of particles in the air equal to 2.5 micrometers in diameter. - the mass concentration of particles in the air greater than or equal to 2.5 micrometers in diameter. Question 15 Carbon dioxide (CO2) is a criteria air pollutant. - True - False Question 16 Roughly percent of emissions of carbon monoxide in Santa Clara County come from mobile sources (select the choice closest to the correct answer). - 50 - 75 - 25 Question 17
The term "photochemical smog" is most synonymous with which of the following criteria air pollutants? - lead (Pb) - carbon monoxide (CO) - sulfur dioxide ( SO2) - ozone (O3) Question 18 "Attainment" of ambient air quality standards requires that measured concentrations at all monitoring stations within an air district are below ambient air standards. - True - False
: PM2.5 is defined as the mass concentration of particles in the air less than or equal to 2.5 micrometers in diameter.Question 15: False, carbon dioxide (CO2) is not considered a criteria air pollutant.
Question 16: The closest answer is 50%, but the exact percentage is not provided in the question.Question 17: The term "photochemical smog" is most synonymous with ozone (O3), which is a criteria air pollutant.Question 18: True, attainment of ambient air quality standards requires that measured concentrations at all monitoring stations within an air district are below ambient air standards.
Question 14 asks about the definition of PM2.5. PM2.5 refers to particulate matter with a diameter less than or equal to 2.5 micrometers. It represents the mass concentration of particles suspended in the air, which are small enough to be inhaled into the respiratory system and can have adverse health effects.
Question 15 states whether carbon dioxide (CO2) is a criteria air pollutant. Criteria air pollutants are a set of pollutants regulated by environmental agencies due to their detrimental impact on air quality and human health. However, carbon dioxide is not considered a criteria air pollutant because it does not directly cause harm to human health or the environment in the same way as pollutants like ozone or particulate matter.
Question 16 asks about the percentage of carbon monoxide (CO) emissions from mobile sources in Santa Clara County. While the exact percentage is not provided in the question, the closest answer option is 50%. However, it is important to note that the precise percentage may vary depending on specific local conditions and emissions sources.
Question 17 inquires about the criteria air pollutant most synonymous with the term "photochemical smog." Photochemical smog is primarily associated with high levels of ground-level ozone (O3). Ozone is formed when nitrogen oxides (NOx) and volatile organic compounds (VOCs) react in the presence of sunlight, creating a hazy and polluted atmospheric condition.
Question 18 addresses the concept of "attainment" of ambient air quality standards. To achieve attainment, measured concentrations of pollutants at all monitoring stations within an air district must be below the established ambient air quality standards. This ensures that the air quality in the given area meets the required standards for protecting human health and the environment.
Learn more about mass concentration here:- brainly.com/question/23437000
#SPJ11
Except for ________ and ________, the occurrences of trace mineral deficiencies and toxicities are rare. a. iodine; selenium b. iodine; iron c. copper; chromium d. iron; copper
Except for iron and copper, the occurrences of trace mineral deficiencies and toxicities are rare. Trace minerals are required by the body in small quantities for various physiological functions. Iron is essential for the formation of hemoglobin in red blood cells, while copper is required for the formation of various enzymes that play a role in energy metabolism, connective tissue formation, and neurotransmitter synthesis. The answer to the question is option D,
Deficiencies in these trace minerals can lead to anemia, fatigue, weakness, and impaired immune function. Toxicity, on the other hand, can occur when these minerals are consumed in excess amounts. Excessive iron intake can lead to liver damage, joint pain, and diabetes, while copper toxicity can cause gastrointestinal distress, liver damage, and neurological symptoms.
However, deficiencies and toxicities of other trace minerals such as iodine, selenium, copper, and chromium are relatively rare. Iodine deficiency can lead to hypothyroidism, goiter, and mental disorder, while selenium deficiency can cause muscle weakness, cardiomyopathy, and thyroid dysfunction. Copper deficiency can cause anemia, neutropenia, and bone abnormalities, while chromium deficiency can lead to impaired glucose metabolism and increased risk of diabetes.
In conclusion, while deficiencies and toxicities of trace minerals can occur, it is important to ensure adequate intake of all trace minerals through a balanced diet or supplements to prevent these conditions. It is also essential to avoid excessive intake of trace minerals to prevent toxicity. Option D.
For more such questions on hemoglobin
https://brainly.com/question/4577862
#SPJ11
Is sodium ion or sodium metal in table salt?
Answer:
sodium ion
Explanation:
Temperature is an example of a variable that uses: a) the ordinal scale. b) the ratio scale. c) the interval scale. d) either the ratio
This translates to the fluctuating temperature using interval scale in Fahrenheit and Celsius.
What does interval scale mean in plain English?Periodic Scale
It is described as a quantitative measuring scale where a noticeable difference may be found between the two variables. In other words, the measurements are precise rather than relative, where the occurrence of zero is arbitrary.
Data on an interval scale is what?The definition of interval data, often known as an integer, is a data type that is measured along a scale with each point being situated at an equal distance from the other. Interval data always takes the form of integers or numerical values with a standard and equal distance between the two sites.
To know more about interval scale visit:
https://brainly.com/question/28197430
#SPJ1
A legal right to use the property owned by someone else in a specified manner is known as an?
Answer:
I believe as sharing bit
Answer:
easement
Explanation:
This is the definition of 'easement' .
Why don't incoming ocean waves bring more water on to the shore until the
beach is completely submerged?
HELP ME PLEASE!!!!!! BRAINLIEST FOR CORRECT ANSWER!!!!
Answer:
it changes from potential to kinetic
Explanation:
the coals are at rest and when a force acts upon it which makes it move from one position to another
A girl has a weight of 450 N and her feet have a total area of 300Cm2
Answer:
15000N/m²
Explanation:
Given parameters:
Force exerted by the girl = 450N
Area = 300cm²
Unknown:
Pressure exerted by her feet =?
Solution:
Pressure is the force per unit area on a body;
Pressure = \(\frac{force }{area}\)
We need to convert the given area to m²;
10000cm² = 1m²
300cm² = \(\frac{300}{10000}\) = 0.03m²
Pressure = \(\frac{450}{0.03}\) = 15000N/m²
The San Andreas fault is at the boundary between two tectonic plates. Earthquakes occur frequently along the fault as the plates slide past one another. The map below shows data on the intensity and location of earthquakes in California and Nevada during a one week period.
Image courtesy USGS
Which conclusion is supported by the data on the map?
A.
The most intense earthquake during the week was in California.
B.
More earthquakes were felt in Nevada than in California.
C.
Earthquakes along the fault were more frequent in the south than in the north.
Answer:
c.
earthquakes along the fault were more frequent in the south than in the north
what is the normal range for the extracellular concentration of sodium?
The average body sodium content of an adult male is 92 g, of which half (46 g) is found in the extracellular fluid (ECF) at a concentration of 135–145 mmol/L, 11 g is discovered in the intracellular fluid at a concentration of 10 mmol/L, and 35 g is discovered in the skeleton.
The sodium-potassium pump action moves sodium and potassium, respectively, from within to outside the cell and vice versa against the concentration gradient using the energy provided by ATP. This maintains the concentration gradient between the ECF and intracellular fluid. Sodium enters the polarised cells of the renal tubular epithelium or the intestinal wall through specific channels or other transport mechanisms from the tubular lumen or the gut, and is then extruded from the cell into the neighbouring capillaries due to the action of the pump, which is primarily distributed on the basolateral sides of the cell. Sodium transport in these cells is typically linked to the transport of other substrates, such as phosphates, amino acids, glucose, and galactose.
Learn more about ECF here:
https://brainly.com/question/30159647
#SPJ4
The atomic number of oxygen is 8. The mass number of an atom of oxygen is 17. Describe the number and type of particles in the nucleus of this atom.
Answer:
protons: 8
neutrons: 9
Explanation:
the atomic number tells you how many protons are in a element. The mass is the number of protons + neutrons.
17 - 8 = 9 neutrons
There are 8 protons and 9 neutrons in the nucleus of the oxygen atom.
What is the atomic number and mass number of an atom?The atomic number of an atom is the number of protons in atom of an element.
It can also be defined as the number of electrons in a neutral atom of an element.
The mass number is the number of protons and neutrons in the nucleus of an atom of an element.
The proton number of the oxygen atom is 8
The neutron number is 17 - 8 = 9
Therefore, in the nucleus of the oxygen atom, there are 8 protons and 9 neutrons.
Learn more about atomic number and mass number at: https://brainly.com/question/12169134
#SPJ6
assuming no other unlisted ions are present in the water, use an anion-cation charge balance to estimate the concentration of sodium ion [na ]. give your answer in mg/l units.
Assuming no other unlisted ions are present in the water, the estimated concentration of \(Na^+\) (in mg/L as \(Na^+\)) is 21.2 mg/L.
Using an anion-cation balance, we may estimate the concentration of Na+ (in mg/L as Na+) by ensuring that the total positive charge from cations matches the total negative charge from anions.
The total positive charge from cations = (\(Ca^{+2} + M^g{+2} + Na^+ + K^+\))
The total negative charge from anions = (\(HCO^{3-} + SO_4^{2-} + Cl^-\))
Total positive charge = (40.0 + 10.0 + Na+ + 7.0)
Total negative charge = (67.2 + 11.0)
Total positive charge = Total negative charge
(40.0 + 10.0 + \(Na^+\) + 7.0) = (67.2 + 11.0)
Simplifying the equation:
57.0 + Na+ = 78.2
Subtracting 57.0 from both sides:
Na+ = 78.2 - 57.0
Na+ = 21.2 mg/L
Therefore, the estimated concentration of \(Na^+\) (in mg/L as \(Na^+\)) is 21.2 mg/L.
For more details regarding concentration, visit:
https://brainly.com/question/30862855
#SPJ4
Your question seems incomplete, the probable complete question is:
2. A sample of water has the following concentrations of ions (and pH = 7.0):
cations mg/L
anions mg/L
Ca+2
40.0
Mg+2
10.0
Na+
?
K+
7.0
HCO3 110.0
SO42-
67.2
Cl-
11.0
Assuming no other constituents are missing, use an anion-cation balance to estimate the concentration of Na* (in mg/L as Na*)? Remember that the balance cannot be in mg/L.
An ionic bond is the attraction between _____.
Answer:
oppositely charged ions in a chemical compound
Explanation:
Answer:
Between ions
Explanation:
. The speed of a sound in air is 343 m/s. The sound wave has a frequency of 436 HZ and its period is 0.0023 s. What is the wavelength of the sound?
Answer: 0.79
Explanation:
Answer: 0.79
Explanation:
air quality index (aqi) outside is 120, and your 5 year old neighbor with
Air Quality Index (AQI) outside is 120, and your 5-year-old neighbor with asthma is playing outside.
What is AQI? AQI is a measure of how polluted the air is and how unhealthy it is to breathe. The AQI ranges from 0 to 500 and is divided into six categories, with each category indicating a different level of health risk. An AQI reading of 120 indicates that the air is "unhealthy for sensitive groups," which means that people with pre-existing health issues, such as asthma, are more likely to experience health problems as a result of exposure to the pollution.
If your 5-year-old neighbor has asthma, it's important to take extra precautions when the AQI is high. First and foremost, make sure that they are taking their medication as prescribed by their doctor. Additionally, try to keep them indoors as much as possible when the AQI is above 100. If they must be outside, encourage them to take frequent breaks and avoid playing in areas with heavy traffic. You can also invest in a high-quality air purifier for your home to help improve indoor air quality.
In conclusion, when the Air Quality Index (AQI) outside is 120 and your 5-year-old neighbor has asthma, it's important to take extra precautions to ensure their safety. Make sure they are taking their medication as prescribed and limit their exposure to outdoor air pollution as much as possible. Investing in a high-quality air purifier for your home can also help improve indoor air quality and reduce the risk of asthma attacks.
To know more about Air Quality Index visit:
https://brainly.com/question/30389712
#SPJ11
how much does the mass of a hydrogen atom change when it goes from the ground state to the first excited state (to three significant digits)?
The mass of a hydrogen atom changes by 1.14 x 10⁻³⁵ g when it moves from the ground state to the first excited state. Hydrogen atom's transition from the ground state to the first excited state can be explained using the Bohr model of an atom.
Bohr's model is used to describe an atom's structure. Hydrogen atom's transition from the ground state to the first excited state can be explained using the Bohr model of an atom. The transition occurs when the electron absorbs energy from a photon that has a frequency and is in the ultraviolet region.
When an atom is in its ground state, its electron is in the lowest energy level possible. Electrons in atoms can exist at higher energy levels, known as excited states, as a result of absorbing energy. When an electron moves from a lower energy level to a higher energy level, the electron absorbs the energy difference between the two levels. The atom's mass also changes when it moves from the ground state to the first excited state.
According to Einstein's theory of relativity, mass and energy are related. As a result, the mass difference between the two states can be calculated as follows:
In the ground state of hydrogen, the electron's energy is -13.6 eV.
The energy of the electron in the first excited state of hydrogen is -3.4 eV, which is more than the energy of the electron in the ground state by 10.2 eV.
The excitation energy is the amount of energy required to move an electron from the ground state to an excited state. ΔE is the symbol used to represent excitation energy.
ΔE = E₂ - E₁= -3.4 eV - (-13.6 eV) = 10.2 eV
The amount of energy absorbed by the hydrogen atom to transition from the ground state to the first excited state is 10.2 eV.
According to Einstein's theory, E=mc², the mass change can be calculated as follows: Δm = ΔE/c²
=10.2 eV / (3 x 10⁸ m/s)²
= 1.14 x 10⁻³² kg
= 1.14 x 10⁻³⁵ g
Therefore, the mass of a hydrogen atom changes by 1.14 x 10⁻³⁵ g when it moves from the ground state to the first excited state.
Learn more about the Bohr's model: https://brainly.com/question/30401859
#SPJ11
What proportion of the difference in temperature between inhaled and exhaled air can be attributed to the nasal passageways when nose breathing?
The proportion of the difference in temperature between inhaled and exhaled air that can be attributed to the nasal passageways when nose breathing varies, but it is estimated to be around 90%.
When we breathe through our nose, the air passes through the nasal passageways before reaching the lungs. The nasal passageways are lined with blood vessels and mucus membranes that help to warm the inhaled air before it reaches the lungs. This warming process is important because the air needs to be at a certain temperature for optimal gas exchange in the lungs.
The temperature difference between the inhaled and exhaled air is mainly due to the heat exchange that occurs in the nasal passageways. The inhaled air is colder than the body temperature, while the exhaled air is closer to body temperature. The nasal passageways warm up the inhaled air by transferring heat from the warm blood vessels and mucus membranes to the air.
While the exact proportion can vary depending on factors such as ambient temperature and individual physiology, it is estimated that around 90% of the difference in temperature between inhaled and exhaled air can be attributed to the nasal passageways when nose breathing. This demonstrates the important role that the nasal passageways play in regulating the temperature of the air we breathe.
learn more about blood vessels
https://brainly.com/question/11763276
#SPJ11
Match each scientist to their discovery regarding the atom
Thomson
Electrons have a charge of -1.
Rutherford
Atoms are indivisible
Millikan
Atoms have a positive nucleus
Dalton
Atoms contain electrons.
Answer:
Thomson--atoms cotain electron
Ernest Rutherford--atoms have a positive nucleus
R.A Millikan--electrons have Q=-1
Dalton--atoms are indivisible
Millikan---> Electrons have a charge of -1
Rutherford ---> Atoms have a positive nucleus
Thomson -----> Atoms contain electrons
Dalton --------> Atoms are indivisible
The atomic theory went through several modifications and different scientists proposed various models of the atom until our present conception of the atom was developed.
The atom was first defined as the smallest indivisible particle of a substance. This idea of "indivisibility" of the atom stems from Dalton's theory.
The fact that atoms were composed of negatively charged electrons was proven by the experiments of J.J Thompson using the cathode ray tube. Millikan's charge to mass experiment showed that the electron has a charge of -1.
Rutherford, in his famous gold foil experiment showed that atoms were composed of a positively charged nucleus.
Learn more: https://brainly.com/question/1596638
List the four common units of pressure and their relationship to 1 atmosphere (atm).
Answer:
Pascal (1 N/m²) (Pa) 101,325 Pa = 1 atm.
Pounds per square inch (psi) 14.7 psi = 1 atm.
Torr (1 mmHg) 760 torr = 1 atm.
Inches of Mercury (in Hg) 29.92 in Hg = 1 atm.
Atmosphere (atm) 1 atm = 1 atm.
Hope this helps :)
Pls brainliest...
Energy is defined as...
A.
the ability to do work.
B.
the ability to dissolve in water.
C.
the mass of a substance times its acceleration.
D.
how radioactive a substance is.
Answer:
A
Explanation:
the ability to dissolve in water
Answer: B.
Explanation: The ability to do work
Remember! All ___________________________ are __________________________
but not all Atoms are elements.
Answer:
all element are atom but all at all atom are element
Explanation:
because all atoms of an element are same whereas atom of different element are different
What are the current and or future uses of genetically modified strawberries
Can someone please help me? :(
Answer:
B
Explanation:
What kind of intermolecular forces act between a chloromethane molecule and a chloroacetylene molecule
Dipole to Dipole force
Explanation:
A dipole to dipole forces exists between these molecules
How many atoms are there in 3.3 moles of strontium?
Explanation:
Multiply the moles Fe by 6.022×1023 atoms/mol
Ethylene glycol is used as an automobile antifreeze and the manufacture of the polyester fires. Combustion of 6.38mg of ethylene glycol gives 9.06 mg co2 and 5.58mg H20. The compound contains only carbon, hydrogen and oxygen. What is the empirical formula of ethylene glycol
The empirical formula of ethylene glycol is C2H6O2. This can be determined using the given information of the combustion reaction. Ethylene glycol is composed of carbon, hydrogen and oxygen. By calculating the molar ratios of the elements present in the products of the combustion reaction, we can find the molar ratios of the elements present in the reactants.
For carbon, the molar ratio in the products is 9.06/12 = 0.755. For hydrogen, the molar ratio in the products is 5.58/2 = 2.79. For oxygen, the molar ratio in the products is 18.12/16 = 1.13.
By dividing the molar ratios of the products by the lowest value, 0.755, we can get the ratios of the reactants:
Carbon = 1, Hydrogen = 3.71, Oxygen = 1.49
The empirical formula of ethylene glycol is therefore C2H6O2.
For such more questions on Ethylene glycol:
brainly.com/question/11994953
#SPJ11
Will mark brainliest!!
Answer:
I think its B im not sure
but i hope this helps
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
An old refrigerator is rated at 500 W how many kilowatt hours of electric energy what does refrigerator use in 30 days assume the refrigerator is running 12 hours per day
The refrigerator would use 180 kilowatt-hours (kWh) of electric energy over the course of 30 days, assuming it runs for 12 hours each day.
To calculate the kilowatt-hours (kWh) of electric energy used by the refrigerator in 30 days, we need to multiply the power rating by the total running time.
Given:
Power rating of the refrigerator = 500 W
Running time per day = 12 hours
Number of days = 30
First, we need to convert the power rating from watts to kilowatts:
Power rating = 500 W / 1000 = 0.5 kW
Next, we calculate the total energy used in kilowatt-hours (kWh) over the 30-day period:
Energy used = Power rating × Running time × Number of days
Energy used = 0.5 kW × 12 hours/day × 30 days
Energy used = 180 kWh
Therefore, the refrigerator would use 180 kilowatt-hours (kWh) of electric energy over the course of 30 days, assuming it runs for 12 hours each day.
For more question on energy
https://brainly.com/question/29339318
#SPJ8