Y'all wanna help me with chemistry? The chart and bottom question for brainliest!

Y'all Wanna Help Me With Chemistry? The Chart And Bottom Question For Brainliest!

Answers

Answer 1

Answer:

As: Negative

Rb: Positive

Te: Positive

Al: Positive


Related Questions

16.21 rank the following compounds in order from increasing reactivity in electrophilic aromatic substitution

Answers

To rank the following compounds in order of increasing reactivity in electrophilic aromatic substitution, we need to consider the factors that influence reactivity. Electrophilic aromatic substitution is a reaction where an electrophile replaces a hydrogen atom on an aromatic ring.

Electron-donating groups (+M effect): These groups increase the electron density on the ring and make it more nucleophilic, enhancing its reactivity. Examples of electron-donating groups are alkyl groups (e.g., methyl, ethyl), amino groups (-NH2), hydroxyl groups (-OH), and methoxy groups (-OCH3).

Electron-withdrawing groups (-M effect): These groups decrease the electron density on the ring and make it less nucleophilic, reducing its reactivity. Examples of electron-withdrawing groups are nitro groups (-NO2), carbonyl groups (-C=O), and halogens (-F, -Cl, -Br, -I).

To know more about aromatic substitution visit :-

https://brainly.com/question/30761476

#SPJ11

What is the name of Neils Bohr's atomic
model?

Answers

Answer:

Bohr Model

Explanation:

How many L in 1.98m solution using 4.2mol

Answers

The volume needed to make 1.98 M of the solution is 2.12L

Molarity of a given solution is defined as the total number of moles of solute per litre of solution. One molar is the molarity of a solution where one gram of solute is dissolved in a litre of solution. As we know, in a solution, the solvent and solute blend to form a solution, hence, the total volume of the solution is taken.

Given,

Molarity = 1.98m

Moles = 4.2 mol

Molarity = number of moles of solute / volume of solution in L

Volume = moles / molarity

= 4.2 / 1.98

= 2.12 L

Learn more about Molarity, here:

https://brainly.com/question/8732513

#SPJ1

A hydrobromic acid (HBr) solution has a molar concentration of 0.055 M, Calculate the and pH of the solution. (Remember that Kw= 1.0x10-14M2.)
A) [H3O+]= 5.5x10-2M, [OH-]=1.82x10-13M, pH=1.26
B) [H3O+]= 3.8x10-13, [OH-]=2.6x10-2M, pH=12.42
C) [H3O+]= 4.8x10-3, [OH-]=1.6x10-12M, pH=9.2
D) [H3O+]= 1.0x10-8 [OH-]=1.0x10-6M, pH=8.0
E) cannot be calculated with the information given

Answers

Answer: Im not sure but i think its B

Explanation: Its hard to explain so im

not gonna do it

Taking into account the definition of strong acid, pH and pOH, it is obtained that the correct option is option A) [H₃O⁺]= 5.5×10⁻² M, [OH⁻]= 1.82×10⁻¹³ M, pH= 1.26

It is called strong acid, that acid that dissociates completely in solution at constant temperature and pressure. Under these conditions, the concentration of a strong acid is equal to the concentration of hydrogen ions (Hydronium or H₃O⁺). In other words, a strong acid is an acid that completely dissociates into hydrogen ions and anions in solution.  

Hydrobromic acid HBr is a strong acid, so a concentration of 0.055 M of the acid generates a H₃O⁺ concentration of the same value. This is:

[HBr]= [H₃O⁺]= 0.055 M= 5.5×10⁻² M

On the other hand, pH is a measure of acidity or alkalinity that indicates the amount of hydrogen ions present in a solution or substance. Mathematically it is calculated as the negative logarithm in base 10 of the activity of hydrogen ions:

pH= -log [H₃O⁺]

Being [H₃O⁺]= 5.5×10⁻² M, the pH in this case is:

pH= -log (5.5×10⁻² M)

Solving:

pH= 1.26

Similarly, pOH is defined as the negative base 10 logarithm of the activity of the OH⁻ ions:

pOH= - log [OH⁻]

The following relationship can be established between pH and pOH:

pH + pOH= 14

Then, being pH = 1.26, the pOH is calculated by:

1.26 + pOH= 14

pOH= 14 - 1.26

pOH= 12.74

Replacing in the definition of pOH:

12.74= - log [OH⁻]

and solving you get:

[OH⁻]= 1.82×10⁻¹³ M

Finally, the correct option is option A) [H₃O⁺]= 5.5×10⁻² M, [OH⁻]= 1.82×10⁻¹³ M, pH= 1.26

Learn more about pH and pOH with this example: https://brainly.com/question/13423425?referrer=searchResults




Cocoa beans are subjected to three processes during the manufacture of chocolate: cleaning, roasting, and 'nibbing'. Bags of cocoa beans are first cleaned, then cleaned beans are roasted, then roasted

Answers

Beans are processed through 'nibbing'. During the nibbing process, the roasted cocoa beans are crushed and ground into a paste called cocoa mass or cocoa liquor.

This cocoa mass can then be further processed to separate the cocoa solids from the cocoa butter, which is the fat component of the cocoa bean. The separated cocoa solids and cocoa butter are used in the production of chocolate. Pure cocoa mass (cocoa paste) in solid or semi-solid form is known as chocolate liquor. It includes about equal amounts of cocoa butter and solid cocoa, much like the cocoa beans (nibs) from which it is made. It is made from fermented, dried, roasted, and separated from their skins cocoa beans. To make cocoa mass (cocoa paste), the beans are pulverised.

To know more about cocoa liquor

https://brainly.com/question/5047676

#SPJ11

consider the reaction ag cl=agcl determine the temperatureabove which the reaction is nonspontaneous under standard conditions

Answers

The reaction between acetyl chloride (HAcCl) and sodium hydroxide (NaOH) is a chemical reaction that is exothermic and spontaneous under standard conditions. This means that the reaction occurs on its own, without the need for an external energy source, and that it releases heat.

The reaction between HAcCl and NaOH is often represented by the chemical equation:

HAcCl + NaOH → NaAc + \(H_2O\)

In this equation, HAcCl is the reactant, and NaAc is the product. The reaction is exothermic because it releases heat, and it is spontaneous because the forward reaction is favored over the reverse reaction. The temperature above which the reaction is nonspontaneous under standard conditions is not well defined. The reaction is exothermic and spontaneous over a wide range of temperatures, and it will continue to react as long as the reactants are present and the conditions are appropriate.

The reaction between HAcCl and NaOH is a spontaneous and exothermic reaction that occurs on its own, without the need for an external energy source, and it can continue to react as long as the reactants are present and the conditions are appropriate.  

Learn more about reaction visit: brainly.com/question/25769000

#SPJ4

ATCG combine different patterns to form different ____

Answers

Answer:

Chemicals

Explanation:

Your answer would be chemicals because of you have different inputs you would also have a different output depending.


I hope it helps! Have a great day!

Anygays-

Answer:

Chemicals

Explanation:

Different ATCG makes different chemicals.


I hope it helps! Have a great day!

Muffin °-°

What is the mass of ether(0. 71) which can be put into a beaker holding 130ml

Answers

The mass of ether that can be put into a 130 mL beaker is approximately 92.3 grams.

How to find the mass of the ether

To calculate the mass of ether that can be put into a 130 mL beaker, we need to know the density of ether.

The density of ether varies depending on the specific type of ether, but assuming you are referring to diethyl ether, the density is approximately 0.71 g/mL.

Using the density and the volume of the beaker, we can calculate the maximum mass of ether that can be put into the beaker as follows:

Mass of ether = Density x Volume

Mass of ether = 0.71 g/mL x 130 mL

Mass of ether = 92.3 grams

Therefore, the maximum mass of diethyl ether that can be put into a 130 mL beaker is approximately 92.3 grams.

Learn more about density at

https://brainly.com/question/26364788

#SPJ1

Write balanced half-reactions for the following redox reaction: 2CO2(g)+12H+(aq)+6C2O2−4(aq)→ C2H5OH(l)+3H2O(l)+12CO2(aq) reduction: oxidation: Include state of matter

Answers

The reduction half-reaction is C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq), and the oxidation half-reaction is CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq).

In order to write the balanced half-reactions, we need to identify the species that are being reduced and oxidized in the given redox reaction.

The reduction half-reaction involves the species C2O2^4-(aq), which is being reduced to C2H5OH(l). In the process, two hydrogen ions (H+) and two electrons (2e-) are consumed. The state of matter for C2H5OH(l) is a liquid.

The oxidation half-reaction involves the species CO2(g), which is being oxidized to CO2(aq). Four hydrogen ions (4H+) and four electrons (4e-) are produced in this process. Additionally, two water molecules (2H2O(l)) are formed as a result of the oxidation.

By balancing the number of atoms and charges on both sides of the half-reactions, we obtain the following balanced half-reactions:

Reduction half-reaction: C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq)

Oxidation half-reaction: CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq)

The reduction half-reaction is C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq), and the oxidation half-reaction is CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq). These balanced half-reactions represent the reduction and oxidation processes occurring in the given redox reaction.

To know more about half-reaction, visit:

https://brainly.com/question/21851295

#SPJ11

how many grams of aluminum Al are needed to produce 12.0 G of aluminum oxide (A12 O3)​

Answers

4Al + 3O₂ ⇒ 2Al₂O₃

n(Al₂O₃) = m/M = 12/101.96 = 0.117693213mol

unknown/known = 2/4 = 1/2

n(Al) = n(Al₂O₃)/2 = 0.05884660651mol

m(Al) = n x M = 0.05884660651 x 26.98 = 1.59g (2dp)

in a Lewis structure, why must pairs of unshared of lone pairs if dots be placed around the outside of some of the atoms

Answers

Answer:

In a Lewis symbol, the symbol for the element is used to represent the atom and its core electrons. Dots placed around the atom are used to indicate the valence electrons. ... In 1916, Gilbert Newton Lewis, an American chemist, suggested that molecules were formed when atoms shared pairs of outer electrons.

Explanation:

Lewis structures show the electrons in the valence shell of atoms in molecules.

Lewis structures are representations of molecules. They consist of the symbol of the element and the valence electrons in the atoms. The electrons are often shown as dots.

The atoms in molecules could be lone pairs or bond pairs. The bond pairs are shown as two dots on an atom. Since lone pairs are localized on an atom, they are shown as dots on the symbol of the atom that contain them.

Learn more: https://brainly.com/question/25249351

For neap tides, what must the angular alignment be between the sun, earth and moon?

Answers

Answer:

The angular alignment is 90 degrees

Explanation:

The neap tide is a type of tide which occurs around seven days after a spring tide. This type of tide happens twice every month.

The tide is usually moderate and it exists when the sun and moon are usually at right angles to each other when it occurs. A right angle is also known as 90 degrees which validates the tide occurring at an angle 90.

grizzly bears are omnivores. this data (taken from bear fur samples to determine nitrogen content in their diet)x indicates that bears that consume ___ are more active

Answers

Grizzly bears are omnivores, meaning that they consume both plant and animal matter. This study, which analyzed nitrogen content in bear fur samples, indicates that bears that consume more animal matter have a higher nitrogen content in their diet and are therefore more active.

Nitrogen is an essential nutrient for building proteins and is found in higher amounts in animal matter compared to plant matter. Therefore, bears that consume more animal matter may have more energy and be more active.
Hi! Based on your question, it seems that you want to know which type of food, when consumed by grizzly bears, leads to higher activity levels, as indicated by nitrogen content in their fur samples. Grizzly bears are omnivores, meaning they eat both plants and animals. Nitrogen content in their fur samples can be used as an indicator of the bear's diet. Typically, higher nitrogen content is associated with a diet richer in animal protein. Therefore, we can conclude that grizzly bears consuming more animal protein are more active.

learn more about nitrogen here

https://brainly.com/question/4492682

#SPJ11

Grizzly bears are omnivores. this data (taken from bear fur samples to determine nitrogen content in their diet)x indicates that bears that consume ___ are more active

Grizzly bears are omnivores, which means that they consume both plants and animals. The data taken from bear fur samples to determine nitrogen content in their diet indicates that bears that consume more animal protein are more active. Animal protein provides bears with the necessary energy and nutrients to support their active lifestyles, including hunting, scavenging, and defending their territories.

However, it is important to note that the amount of animal protein consumed by grizzly bears varies depending on factors such as season, location, and availability of food sources.

To know more about amount of animal protein:

https://brainly.com/question/31062670

#SPJ11

What is the correct balanced equation for the reaction of sodium with water?

What is the correct balanced equation for the reaction of sodium with water?

Answers

Answer:

 A.    2Na       +    2H₂O   →    2NaOH   +  H₂  

Explanation:

When sodium is reacted with water, a single replacement reaction occurs. The product of the reaction is typically sodium hydroxide and hydrogen gas.

Reactants:

        Sodium +  water

Product:

        Sodium hydroxide + hydrogen gas

So;

         2Na       +    2H₂O   →    2NaOH   +  H₂  

A molecular compound is found to consist of30.4% nitrogen and 69.6% oxygen. Ifthe molecule contains 2 atoms of nitrogen, what is the molar mass of the molecule

Answers

Answer:

92.01 g/mol

Explanation:

So first you need to find the empirical formula by the percents. That would be, assuming that you have 100 grams of the the sample, divide each quantity of each element found by its respective molar mass.

30.4 g of N ÷ 14 g/mol N= 2.17 mol of N

69.6 g of O ÷ 16g/mol= 4.35 mol of O

You can establish now the empirical formula.

N2.17O4.35,

but since you can't have a decimal subscript, you divide each subscript by the minimum subscript

NO2

So then you're said that the molecular formula derived from that empirical formula has 2 nitrogen, so you multiply all the subscripts, by 2:

N2O4

-Dinitrogen Tetraoxide

-Nitrogen oxide (IV)

Then all you have to do is find the molecular mass of the compound using the periodic table and what you obtain is the molar mass.

remember: molecular mass is correspondent to molar mass.

A 3.500 molar solution is to be diluted to 300.0-m L of a 0.750 M solution. How many milliliters (mL) of the 3.500 M solution are required?

Answers

The volume (in mL) of 3.500 M solution that are required to make 300.0 mL of with a molar concentration of 0.750 M is 64.3 mL

How do i determine the volume required?

The volume of the stock solution required to make 300 mL with a molarity of 0.750 M can be obtained as follow:

Molarity of stock solution (M₁) = 3.500 MVolume of diluted solution (V₂) = 300 mL Molarity of diluted solution (M₂) = 0.750 MVolume of stock solution needed (V₁) =?

M₁V₁ = M₂V₂

3.5 × V₁ = 0.75 × 300

Divide bioth sides by 3.5

V₁ = (0.75 × 300) / 3.5

V₁ = 64.3 mL

Thus, we can conclude that the volume of the 3.500 molar solution is 64.3 mL

Learn more about volume:

https://brainly.com/question/24159217

#SPJ1

How are acids described according to the bronsted-lowry definition?.

Answers

Answer:

an acid is a proton (H⁺) donor

Explanation:

hope this helps

pls nmark brainliest

How much force is needed to accelerate a 1000-kg car at a rate of 3 m/s2? a 1003 N b 0.003 N c 3000 N d 333.3 N

Answers

Answer:

Option c.

Explanation:

According to Newton's law, formula to solve this problem is:

F = m . a

Mass → 1000 kg

a → 3 m/s²

F = 1000 kg . 3m/s² →  3000 N

1 N = 1 kg .  m/s²  according to SI, Internation System of units.

how should a thermometer be dried after washing rinsing and sanitizing

Answers

After washing, rinsing, and sanitizing a thermometer, it should be dried using a clean and disposable paper towel or allowed to air dry in a clean and sanitary environment.

It is important to ensure that the thermometer is thoroughly dried to prevent the growth of bacteria or other contaminants. Using a paper towel helps to remove any remaining moisture from the thermometer, reducing the risk of contamination. Care should be taken to handle the thermometer with clean hands or gloves during the drying process to maintain its cleanliness. Once dry, the thermometer should be stored in a clean and designated area to prevent recontamination.

To know more about thermometer

brainly.com/question/16840415

#SPJ11

In a photochemical process a hydroen atom absorbs a 410 nm photon and shortly thereafter it emits a 2628 nm photon. what is the change in energy for the combination of these processes?

Answers

0.389×10^−19J  is the change in energy for the combination of these processes.

λ1=410nm=410×10^−9m

λ2=2628nm=2628×10^−9m

E1−E2 = Energy absorbed by the atom in the process =hc[1/λ1−1/λ2]

=6.63×3[1/410−1/2628]×10^−9 = 0.389×10^−19J

We get, 0.389×10^−19J.

Energy is the quantitative property that is transferred to a body or to a bodily system, recognizable in the performance of work and in the structure of warmth and light. Energy is a conserved quantity—the regulation of conservation of energy states that strength can be transformed in form, however not created or destroyed. The unit of size for energy in the International System of Units (SI) is the joule (J).

Learn more about energy here:

https://brainly.com/question/1932868

#SPJ4

4. One of the most common predation relationships that can be seen in the Florida Everglades is between the Florida
Panther and the White Tailed Deer. Since the Florida Panther is an endangered species, what would happen to the
deer population as the panther population decreases in size?
A. The deer population would decrease.
B. The deer population would not be affected.
C. The deer population would increase indefinitely.
D. The deer population would increase and then level off.

Answers

Answer:

D

Explanation:

It would be D because it would increse yes in population because the panthers are decreasing and attacking less. But, it would still level off because there are other predators who can kill the white tailed deer. Also the panther who is endangered could still atack even though theres just a few left that does not affect them from attacking. So it would increase but it would still level off.


Explain the relationship between primary, secondary, tertiary consumers, and decomposers

Answers

Answer:

The organisms that consume the primary producers are herbivores: the primary consumers. Secondary consumers are usually carnivores that eat the primary consumers. Tertiary consumers are carnivores that eat other carnivores.

How many moles are in 635 grams of LiOH?

Answers

Answer:

the answer is 0.041756547635452 we assume you are coverting between moles LiOH and gram

Explanation:

you can view details on each measurements units:monecular weight of LiOH or grams this compound is also known as lithium hydroxide the si base unit for amount of substance is the moles1 moles qual1 moles LiOH..... Sana makatulong sayo lods ang answer ko

what is the final temperature (in celsius) of this hot tea/ ice mixture as it is allowed to come to thermal equilibrium in the large, well-insulated thermos?

Answers

The final temperature (in celsius) of this hot tea/ ice mixture as it is allowed to come to thermal equilibrium in the large, well-insulated thermos is

\(T_{final} = (m_{hot} * c_{hot} * T_{hot} + m_{cold} * c_{cold} * T_{cold}) / (m_{hot} * c_{hot} + m_{cold}* c_{cold})\)

To determine the final temperature of a mixture of hot tea and ice, we need to use the principle of conservation of energy. Assuming that the thermos is well-insulated and there is no heat exchange with the surroundings, the total energy of the system (hot tea + ice) must remain constant.

We can use the following equation to calculate the final temperature of the mixture:

\(Q_{hot} + Q_{cold} = 0\)

where \(Q_{hot}\) is the heat gained by the cold tea from the hot tea, and \(Q_{cold}\) is the heat lost by the hot tea to the ice.

We can express the heat gained and lost in terms of the specific heat capacity, mass, and temperature change of each component:

\(Q_{hot} = m_{hot} * c_{hot} * (T_{final} - T_{hot})\)

\(Q_{cold} = m_{cold} * c_{cold} * (T_{final} - T_{cold})\)

where \(m_{hot}\) is the mass of the hot tea, \(c_{hot}\) is the specific heat capacity of the hot tea, \(T_{hot}\) is the initial temperature of the hot tea, \(m_{cold}\) is the mass of the ice, \(c_{cold}\) is the specific heat capacity of the ice, \(T_{cold}\) is the initial temperature of the ice, and \(T_{final}\) is the final temperature of the mixture.

At thermal equilibrium, the final temperature of the mixture will be the same for both the hot tea and the ice, so we can set \(Q_{hot}\) equal to -\(Q_{cold}\) and solve for \(T_{final}\):

\(m_{hot} * c_{hot} * (T_{final} - T_{hot}) = -m_{cold} * c_{cold} * (T_{final} - T_{cold})\)

Simplifying and solving for \(T_{final}\), we get:

\(T_{final} = (m_{hot} * c_{hot} * T_{hot} + m_{cold} * c_{cold} * T_{cold}) / (m_{hot} * c_{hot} + m_{cold}* c_{cold})\)

This equation gives us the final temperature of the mixture in terms of the initial temperatures, masses, and specific heat capacities of the hot tea and the ice.

Note that we need to make sure we are using consistent units for mass, temperature, and specific heat capacity (e.g., grams, Celsius, and joules per gram-degree Celsius).

In practice, the specific heat capacity of the tea may depend on its composition, as well as the specific heat capacity of the ice depending on its form, so we may not be able to get an exact value without further information.

Learn more about thermal equilibrium here https://brainly.com/question/29419074

#SPJ4

What pillar of sustainability is broken by recycling
electronics in India? Should the US make a law that electronics can
only be recycled in the US?

Answers

The pillar of sustainability broken by recycling electronics in India is environmental sustainability. Implementing a law that restricts electronics recycling to the US would not necessarily be the most effective solution, as it overlooks the complex global dynamics of electronic waste management.

Recycling electronics in India often involves improper disposal methods, such as burning or dismantling without proper safety measures. This leads to environmental pollution, including the release of hazardous substances into the air, soil, and water, thus violating the principle of environmental sustainability.

However, simply mandating that electronics can only be recycled in the US may not be the most optimal solution. Electronic waste is a global issue, and restricting recycling to a single country disregards the fact that electronic products are manufactured and consumed worldwide. A more comprehensive approach to addressing electronic waste would involve international cooperation, strict regulations, and monitoring of recycling practices to ensure they meet environmental standards.

Efforts should focus on improving recycling practices globally, including promoting responsible electronic waste management, developing sustainable recycling infrastructure in multiple countries, and encouraging the adoption of safe and environmentally friendly recycling practices. This approach would foster global sustainability and address the challenges associated with electronic waste disposal more effectively than a geographically limited restriction.

To learn more about sustainability, here

https://brainly.com/question/32771548

#SPJ4

What kind of bonds sulfur forms with halogens?

Answers

Answer:

Oxygen forms a double bond in the O2 molecule, and sulfur, selenium, and tellurium form two single bonds in various rings and chains. The halogens form diatomic molecules in which each atom is involved in only one bond. This provides the electron required necessary to complete the octet on the halogen atom.

Explanation:

The less energy a wave has, the smaller its
A. crest.
B. frequency.
C. wavelength.
D. amplitude.

Answers

Answer:

D. amplitude

Explanation:

Letter d is the answer

identify the conditions for a standard electrochemical cell. select one or more: pressure of 1 atm temperature of 298 k solution concentrations of 1 m pressure of 5 atm solute masses of 1 g temperature of 273 k

Answers

The conditions for a standard electrochemical cell. select one or more : pressure of 1 atm temperature of 298 k solution concentrations of 1 M.

The electrochemical cell is the cell that is capable of generating the electrical energy from the chemical reactions or by the use of the electrical energy to cause the chemical reaction. The conditions for a standard electrochemical cell. select one or more : pressure of 1 atm temperature of 298 k solution concentrations of 1 M.  

There are the two types of the electrochemical cells is as follows : the galvanic called the electrolytic cells. the galvanic cell is also called as the voltaic cell.

To learn more about temperature here

https://brainly.com/question/14995282

#SPJ4

Short- and medium-chain fatty acids are transported to the liver in the ------------, whereas long-chain fatty acids are circulated away from the small intestine in the __________.

Answers

Short- and medium-chain fatty acids are transported to the liver in the portal vein, whereas long-chain fatty acids are circulated away from the small intestine in the lymphatic system.

The portal vein is responsible for carrying nutrient-rich blood from the small intestine to the liver. Short- and medium-chain fatty acids, which are smaller in size and more water-soluble, are absorbed by the intestinal cells and directly transported to the liver through the portal vein. On the other hand, long-chain fatty acids, which are larger and less water-soluble, are first packaged into chylomicrons by the intestinal cells and then enter the lymphatic system before reaching the bloodstream. This allows for efficient absorption and transport of different types of fatty acids to their respective destinations.

In summary, the portal vein carries short- and medium-chain fatty acids to the liver, while the lymphatic system carries long-chain fatty acids away from the small intestine.

Learn more about chylomicrons here:

https://brainly.com/question/31141345

#SPJ11

What does a secondary consumer eat? Immersive Reader

Answers

Answer:

primary consumers and sometimes plants

Other Questions
Which of the following coordinate points have a y-value of 1? Select all that apply.A) (0, 1)B) (6, 1)C) (1,4)D) (1,6) (TCO C) For several years, Mountain Home University had used IBM computers. Recently, Apple Computers offered them a better machine at lower a price for one of the University's labs; however Mountain Home did not buy them because the _____ costs were too high.a. transactional.b. opportunity.c. marginal.d. switching. What is the historical event of the Napoleonic Code? what is the correct way to add 1 to the $count variable?$count =+1;++count;$count++;count++;I dont know Solve the equation for d.0.2d+3.14=5.06What is the value of d that correctly solves the equation?Enter your answer as a number with one decimal place, like this: 4.2Do not round your answer. What are the 5 roles of the president?. besides neisseria gonorrheae, what other diseases are the individuals in this socio-sexual network at risk for acquiring? a) influenza b) impetigo c) chlamydia d) mrsa e) tuberculosis If you mutated the laci gene resulting in a mutant lac repressor protein that could bind to the lac operator but not to allolactose, what would be the consequence for transcription of the lac operon?. Sherry's age is nine less than six times Fred's age. Write an equation and find Sherry'sage if Fred is 10 years old. HELP ME PLEASE!!!!! Question 14 what line in the speech best supports your answer to question 5? what to the slave is the 4th of july most african slaves found in the burial ground in new york died early. few lived past the age of Can we talk about the political and economical state of the world rn? Verify that the points are the vertices of a parallelogram, and then find its area. (1, 1, 1), (2, 5, 2), (4, 3, 6), (5, 7, 7) STEP 1: Compute the following two vectors. (2, 5, 2) (1, 1, 1) = (5, 7, 7) (4, 3, 6) = Are these two vectors equal? O Yes O No STEP 2: Compute the following two vectors. (4, 3, 6) (1, 1, 1) = (5, 7, 7) (2, 5, 2) = Are these two vectors equal? O Yes O No STEP 3: Compute the cross product of the two vectors from above. STEP 4: Compute the norm of the cross product to compute the area of the parallelogram. Solving the quadratic equations using by completing the square. a windows 10 user wants to display all the files in all the subdirectories on the e: drive with the file extension of doc. what command would perform this function? Help now Why might parents want to select an early care program that was accredited Mr. Shu Qinglin decides to raise next years dividend payout to $510,000, while keeping companys investments and borrowings constant. After next year, the company will go back to its policy of paying out $300,000 per year.a) The company will pay for the extra dividend payout by issuing new shares at the current market value now. What amount of new equity capital is needed?b) What would be the present value of total dividends paid to the new shareholders? With y(t) = yo e^kt, at what value of t (in terms of p and k) is y(t) = pyo? in the context of grit, excellence is the commitment to long-term goals through purposeful deliberate practice.