write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Heat is added to ice at 0 °C. Explain why the temperature of the ice does not change. What does change?
Heat is added to ice at 0 °C. Explain why the temperature of the ice does not change. What does change?When heat is added to ice at 0°C, the temperature of the ice does not change. This happens because all the heat energy is used up in overcoming the intermolecular forces of attraction (hydrogen bonds) that exist between the water molecules in ice.
As a result, the ice undergoes a phase change, from a solid to a liquid. This process is called melting. During melting, the temperature of the ice remains constant at 0°C because all the heat energy is used up in overcoming the intermolecular forces of attraction.The energy required to melt ice is known as the heat of fusion. The heat of fusion is the amount of heat energy required to change 1 kilogram of a solid into a liquid at its melting point. For water, the heat of fusion is 334 kJ/kg. This means that 334 kJ of heat energy is required to melt 1 kg of ice at 0°C. Therefore, during the melting of ice, the temperature of the ice does not change, but the internal energy of the ice does change, and this is manifested in the change of phase from a solid to a liquid.In summary, when heat is added to ice at 0°C, the temperature of the ice does not change, and all the heat energy is used up in overcoming the intermolecular forces of attraction between the water molecules in ice. This results in the melting of ice without any change in temperature.For such more question on molecules
https://brainly.com/question/475709
#SPJ8
If 30.0 grams of sulfur dioxide and 8.4 grams of water combine to form sulfurous acid (H_2_SO_3_), how many grams of sulfurous acid (H_2_SO_3_) must form?
When 30.0 grams of sulfur dioxide and 8.4 grams of water combine then 38.27 grams of sulfurous acid (H₂SO₃) must form.
What is a limiting reagent?A limiting reagent is a reactant that is entirely consumed in the chemical reaction from the reaction mixture and indicates the completion of the reaction and is known as a limiting reactant.
The limiting reagent will decide the maximum quantity of product when reactants will not take in stoichiometric quantities.
Given, the chemical reaction of the formation of sulfurous acid:
SO₂ (g) + H₂O (l) → H₂SO₃ (l)
The molecular mass of the sulfur dioxide, water, and sulfurous acid is 64, 18, and 82g/mol respectively.
Given, the amount of sulfur dioxide, and water is 30 g and 8.4 g respectively.
If 18 grams of water react with sulfur dioxide = 64 g
Then 8.4 g of water reacts with sulfur dioxide = (64/18)×8.4 = 29.86 g
So, water is the limiting reagent in this reaction, which will decide the amount of sulfurous acid.
If 18 grams of water formed sulfurous acid = 82 g
Then 8.4 g of water will form sulfurous acid. = (82/18)×8.4 = 38.27 g
Learn more about limiting reagents, here:
brainly.com/question/26905271
#SPJ1
how many moles of glucose do I have if I have 26 grams of glucose
Answer:
0.1443194637888042 moles
Explanation:
Hope This Helps
Have A Great Day
~Zero~
shown below is the reaction of an alkene with an electrophile. reaction for the mechanism step below, draw curved arrows to show electron reorganization. use the arrow tool to specify the origin and the destination of the reorganizing electrons. consult the arrow-pushing i
The mechanism of the reaction of an alkene with an electrophile attached below
There's 2 steps in reaction between alkene and electrophile
an electrophilic attackThe K in the KI electrophile is attacked by the two pi electrons from the double bond during the first step of the process, which is denoted by a curved arrow. The hydrogen from HBr and a carbon from the double bond combine to produce a C-H sigma bond thanks to the two pi electrons. In order to create a halide anion, the electrons from the H-X bond simultaneously transfer to the halogen. One of the carbons becomes an intermediate carbocation with an electron deficit when pi electrons from the double bond are removed. The positive charge is housed in an unhybridized p orbital on this sp2 hybridized carbon atom.
Nucleophilic attack by halide anion.In order to receive an electron pair from the nucleophilic halide anion, the generated carbocation can now function as an electrophile. The neutral alkyl halide is the end result of electrophilic addition, and the electron pair transforms into an X-C sigma bond.
The HBr, HCl, HI, and HF halides can all take part in this reaction and add on in the same way. Although various halides do react at varying rates, this is because the H-X bond weakens with increasing X due to inadequate orbital overlap.
Your question is incomplete but most probably your full question attached below
Learn more about electrophile attack at https://brainly.com/question/14704243
#SPJ4
Perform the following calculations in indicate whether the solution will be acidic basic or neutral
Due to the nature of the reactants and the balanced chemical equations, the calculated solutions will be acidic, neutral, and neutral, respectively.
How can you tell whether a pH is neutral, acidic, or basic?Neutrality is represented by 7 on the scale, which ranges from 0 to 14. pH levels below 7 signify acidity, whereas pH values over 7 suggest baseness. The pH scale is really used to determine how much free hydrogen and hydroxyl ions are present in water.
When an acid is put to a neutral solution, what happens?This process of neutralising acid is known as. A basic solution goes away from being basic and towards the middle of the pH scale when an acid is introduced. It is known as neutralising.
To know more about reactants visit:-
https://brainly.com/question/17096236
#SPJ1
When olive oil and sodium hydroxide are mixed together, soap and glycerol are made. The solubility of each of the materials are shown in the table below.
Material olive oil sodium hydroxide soap glycerol
Solubility not soluble very soluble soluble soluble
What is the best conclusion, based on the information given?
A.
This is not a chemical reaction because all of the materials mixed can be dissolved in water, and dissolving is a physical change.
B.
This is not a chemical reaction because all of the materials are liquids and can be completely dissolved in water.
C.
This is a chemical reaction because the materials that were mixed have different solubilities than the materials that were made.
D.
This is a chemical reaction because all of the materials used can be combined with water to produce a mixture.
Answer:
C
Explanation:
This is a chemical reaction because the materials that were mixed have different solubilities than the materials that were made.
Answer:
C
Explanation:
When a chemical reaction occurs, new materials form. Different materials each have unique physical properties, such as solubility.
When olive oil and sodium hydroxide were mixed together, soap and glycerol were made. The table shows that olive oil and sodium hydroxide have solubilities that are different than soap and glycerol. This means that olive oil and sodium hydroxide are different materials than soap and glycerol. Therefore, this is a chemical reaction because the materials that were mixed have different solubilities than the materials that were made.
A 250.0-mL flask contains 0.2500 g of a volatile oxide of nitrogen. The pressure in the flask is 760.0 mmHg at 17.00°C. How many moles of gas are in the flask?
Answer:
0.0104 moles of gas in the flask.
Explanation:
To calculate the number of moles of gas in the flask, you can use the ideal gas law equation: PV = nRT. Where P is pressure, V is volume, n is the number of moles, R is the ideal gas constant and T is temperature.
First, you need to convert the pressure from mmHg to atm and the temperature from Celsius to Kelvin. The pressure in atm is 760.0 mmHg / 760 mmHg/atm = 1 atm. The temperature in Kelvin is 17.00°C + 273.15 = 290.15 K.
Next, you need to convert the volume from mL to L. The volume in L is 250.0 mL / 1000 mL/L = 0.2500 L.
Now you can plug all the values into the ideal gas law equation and solve for n: (1 atm)(0.2500 L) = n(0.08206 L·atm/mol·K)(290.15 K). Solving for n gives n = 0.0104 mol.
So there are approximately 0.0104 moles of gas in the flask.
The cooling curve for a pure substance as it changes from a liquid to a solid is shows above. The solid and the liquid coexist at
The solid and the liquid coexist at the melting point, which is the point where the temperature remains constant during the phase transition.
What point does solid and liquid coexist?In the given cooling curve, the melting point is at 50°C, indicated by the flat region on the curve between points C and D. At this point, the energy being released during cooling is used to overcome the energy required for the substance to transition from a liquid to a solid state.
Once all of the substance has solidified, the temperature begins to decrease again.
Learn more about cooling curve:https://brainly.com/question/31069932
#SPJ1
Answer: all points on the curve between Q and S
Explanation: Where the graph looks like <-------->horizontal.
_______-the phase where the
chromosomes pull apart
Answer:
The answer to your question is ⇔ anaphase
So it would be anaphase is the phase where the chromosones pull apart.
Explanation:
The sister chromatids are pairs of identical copies of DNA joined at a point called the centromere. During anaphase, each pair of chromosomes is separated into two identical, independent chromosomes. The chromosomes are separated by a structure called the mitotic spindle.
I hope this helps and have a wonderful day!
For each chemical equation below, write the number of product molecules that will form from the reaction. Then highlight the limfting reactant. (Note: The coefficients in front of the reactants indicate the number of reactant molecules or atoms present.) 5C + 60, 99a 5CO B. 4Na + 8C1, 9a 4NCI A c. 300, + 4H, 09a 3H,CO; D. 7N, + 9H, Q6NH, E. 10Zn + 16HCI P7ZnCl2 + 3H2
Answer:
5c + 60
Explanation:
dont mind me just doinf this for points
500 cc of 2N Na2CO3 are mixed with 400 cc of 3N H2SO4 and volume was diluted to one litre. Will the resulting solutiomacidic,basic or neutral?Also calculate the molarity of the dilute solution.
Answer:
Given info : 500 cc of 2N Na2CO3 are mixed with 400 cc of 3N H2SO4 and volume was diluted to one litre. To find : will the resulting solution is acidic , basic or neutral ? Calculate the molarity of the dilute solution. solution : no of moles of Na2CO3 = normality/n %3D - factor x volume 2/2 x 500/1000 = 0.5 mol %D no of moles of H2SO4 = 3/2 x 400/100O = 0.6 mol %3D We see, Na2CO3 + H2S04 => Na2S04 + CO2 + H2O Here one mol of Na2C03 reacts with one mole of H2SO4. So, 0.5 mol of Na2CO3 reacts with 0.5 mol of H2SO4. so, remaining 0.1 mol of H2SO4 makes solution acidic. Now molarity of solution = remaining no of moles of H2SO4/volume of solution= 0.1/1 = %3D 0.1M
"When 500 cc of 2N \(Na_{2}CO_{3}\) is mixed with the 400 cc of 3N \(H_{2} SO_{4}\) and volume was diluted to one liter then solution will be acidic and molarity will be 0.55 mol"
What is Molarity?
The molar concentration of a chemical species, specifically a solute in a solution, is measured in terms of the amount of material per unit volume of solution.
It is given that normality of \(Na_{2}CO_{3}\) is 2 and \(H_{2} SO_{4}\) is 3. It can be written in term of molarity like, the molarity of \(Na_{2}CO_{3}\) is 0.1 M and molarity of \(H_{2} SO_{4}\) is 1.5 M.
Now calculate the number of moles in \(Na_{2}CO_{3}\)
For \(Na_{2}CO_{3}\) = 500 cc / 1000 cc/L ×0.1 mol/L =0.05 mol.
For \(H_{2} SO_{4}\) = 400 cc/ 1000 cc/L × 1.5mol /L = 0.60 mol.
It can be said that 0.05 mol reacts with 0.05 mol \(H_{2} SO_{4}\) .
Now calculate the molarity of \(H_{2} SO_{4}\) solution= 0.55 mol /L = 0.55 mol.
Hence, remaining 0.1 mol solution will make acidic.
To know more about molarity click here.
https://brainly.com/question/4401006
#SPJ2
A gas mixture contains 1.26 g N2 and 0.76 g O2 in a 1.51 L container at 11 C. Calculate the partial pressure of N2?
When we have a mixture of gases, the pressure exerted by each depends on the number of moles present in the mixture, this contribution is called partial pressure. The sum of the partial pressures will be equal to the total pressure, this is called Dalton's law.
Partial pressure can be described by the following equation:
\(P_i=X_iP_T\)Where,
Pi is the partial pressure
Xi is the molar fraction
Pt is the total pressure
The molar fraction is calculated by the following equation:
\(X_i=\frac{n_i}{n_T}\)Where,
ni is the number of moles of the substance
nT is the total number of moles.
So, we have to find first the number of moles of each gas. We are given the grams of gases, to get the equivalent moles we must divide the mass by the molar mass.
Molar Mass N2=28.0134g/mol
Molar Mass O2=31.9988g/mol
\(\begin{gathered} molN_2=1.26g\times\frac{1molN_2}{28.0134gN_2}=0.045molN_2 \\ molO_2=0.76gO_2\times\frac{1molO_2}{31.9988gO_2}=0.024molO_2 \end{gathered}\)Now, the partial pressure of N2 will be:
\(P_{N2}=\frac{0.045molN_2}{0.045molN_2+0.024molO_2}\times P_T\)\(P_{N2}=\frac{0.045molN_2}{0.069mol}\times P_T\)\(P_{N2}=0.652\times P_T\)If we assume that the gas behavior is like an ideal gas, we can find the total pressure with the following equation:
\(\begin{gathered} PV=nRT \\ P_T=\frac{nRT}{V_T} \end{gathered}\)Where,
n is the total number of moles, 0.069mol
R is a constant, 0.08206atm.L/mol.K
V is the volume of the gas, 1.51L
T is the temperature of the gas, K.284.15K
We replace the known data:
\(P_T=\frac{0.069mol\times0.08206\frac{atm.L}{mol.K}\times284.15K}{1.51L}=1.06atm\)Now, the partial pressure of nitrogen will be:
\(P_{N2}=0.652*1.06atm=0.69atm\)Answer: The partial pressure of N2 is 0.69atm
If you have 2.60 X 1023 molecules of (NH4)3PO4, how many grams do you have?
If you have 2.60 x 10²³ molecules of (NH₄)₃PO₄, you have 64.7 grams of it.
The number of particles contained in a sample is measured in terms of the mole. One mole of a compound is the quantity of that substance that has a mass in grams equal to its relative atomic or molecular mass (atomic weight).To find the number of moles of (NH₄)₃PO₄, we'll need to use the Avogadro constant, which is 6.02 x 10²³. We can use the formula:moles = particles ÷ Avogadro constantThe number of particles is given as 2.60 x 10²³. Substituting the values:moles = 2.60 x 10²³ ÷ 6.02 x 10²³moles = 0.432Molar massNow that we have the number of moles of (NH₄)₃PO₄, we can compute its mass. The molecular mass of (NH₄)₃PO₄ is 149.0 g/mol. We can use the formula:mass = moles x molecular mass Substituting the values:mass = 0.432 x 149.0mass = 64.7 grams
For more such questions on molecules
https://brainly.com/question/475709
#SPJ8
Which part of the electromagnetic spectrum is nearest to X-rays?
Answer:
UV or Gamma Rays
Explanation:
X-rays: 10^-10
UV: 10^-8
Gamma Rays: 10^-12
Li3N(s) + 3H2O(l) → NH3(g) + 3LiOH(aq) What mass of water is needed to react with 98.7 grams of lithium nitride?
Step 1
The reaction must be written, completed, and balanced:
Li3N(s) + 3H2O(l) → NH3(g) + 3LiOH(aq)
----------
Step 2
Information provided:
The mass of Li3N = 98.7 g
Information needed:
The molar masses,
Li3N) 34.8 g/mol
H2O) 18.0 g/mol
----------
Step 3
By stoichiometry,
1 mole Li3N = 34.8 g
1 mole H2O = 18.0 g
Procedure:
Li3N(s) + 3H2O(l) → NH3(g) + 3LiOH(aq)
34.8 g Li3N ---------- 3 x 18.0 g H2O
98.7 g Li3N ----------- X
X = 98.7 g Li3N x 3 x 18.0 g H2O/34.8 g Li3N = 153 g approx.
Answer: 153 g of water
a
What is the functional group of propanal?
Answer:
(C 2 H 5 CHO) the functional present proposal of this is CHO
(aldehyde group). concept nomenclature of organic compounds (UIPAC)
Please help!!
See attachment
In KClO3, the proportions of K, Cl, and O are 31.9%, 28.9%, and 39.1%, respectively.
KClO3: Is it an acid or a base?There are three ways to define bases and acids. A strong base and a strong acid, respectively, called KOH K O H and HClO3 H C l O 3, react to form KClO3 K C l O 3, a salt.
Who or what is KClO3?A powerful oxidising agent with several applications is potassium chlorate (KClO3). It is or has formerly been a part of fireworks, explosives, safety matches, and disinfectants. The disproportionation of sodium hypochlorite results in the formation of sodium chloride and sodium chlorate initially.
To know more about KClO3 visit:-
https://brainly.com/question/19131349
#SPJ1
Which of the following equations represents an acid-base reaction?
Choose 1 answer:
The equations represent an acid-base reaction is Ca ( OH )₂ + 2HBr ⇒ CaBr₂ + 2H₂O . Therefore, option D is correct.
What is acid base reaction ?The acid-base reaction (neutralization reaction) A salt and water are created when an acid and a base interact and neutralize one another. neutralization. a reaction between an acid and a base that results in a solution that isn't as basic or acidic as the initial solutions.
Salts and water are always present in most acid-base interactions. For instance, sodium hydroxide (NaOH) and hydrochloric acid (HCl) react to produce sodium chloride (NaCl) salt and water (H2O).
A neutralizing reaction occurs when an acid and a base interact. This reaction yields a salt and water as byproducts.
Thus, option D is correct.
To learn more about the acid base reaction, follow the link;
https://brainly.com/question/10224396
#SPJ1
What are the coefficients when the chemical equation below is balanced?___ Fe + ___ H2SO4 -> ___ Fe2(SO4)3 + ___ H21,1,1,12,3,3,32,3,1,33,2,3,1
Answer:
2, 3, 1, 3.
Explanation:
Remember that a balanced chemical equation is when we have the same number of elements for reactant and product side.
Let's see the unbalanced equation:
\(Fe+H_2SO_4\rightarrow Fe_2(SO_4)_3+H_2.\)You can note that we have:
You can realize that we have Fe, S, and O unbalanced, but if we put '2' moles beside Fe, we will balance Fe, like this:
\(2Fe+H_2SO_4\operatorname{\rightarrow}Fe_2(SO_4)_3+H_2\)Now, if we put '3' moles beside H2SO4 we will balance S and O, obtaining 3 moles of S, and 12 moles of O for both sides:
\(2Fe+3H_2SO_4\operatorname{\rightarrow}Fe_2(SO_4)_3+H_2\)But H is unbalanced because on the left side we have 6 hydrogens but on the right side we have 2 hydrogens, so if we put '3' moles beside H2, we obtain the balanced chemical equation:
\(2Fe+3H_2SO_4\operatorname{\rightarrow}Fe_2(SO_4)_3+3H_2.\)The order of the coefficients is 2, 3, 1, 3.
Answer:
2,3,1,3
Explanation:
I took the test
A 13.0 ml sample of an acid requires 37,3 ml of 0.303N NaOH for neutralization. Calculate the normality of the acid.
The amount of 0.303N NaOH needed to neutralize a 13.0 ml sample of acid is 37,3 ml. Acid is 0.823N normal, according to the standard.
Explain about the neutralization.The idea of neutralization, according to which an acid reacts with a base to create salt and water. By comparing the molarity of the base to the amount of base needed for neutralization, it is possible to calculate the molarity of the acid. Once the molarity and the acid's valence (or charge) have been multiplied, the acid's normalcy can be determined.
By deducting the volume of NaOH (37.3 ml) from the volume of the acid sample in Step 1, you can calculate the amount of acid that was utilized in the neutralization procedure (13.0 ml).
Consequently, 13.0 ml to 37.3 ml
= -24.3 ml
Use the equation moles = normality x volume to determine the number of moles of acid that were used in the process.
Consequently, moles equal 0.303N x -24.3 ml.
= -7.33 moles
Determine the acid's normality by multiplying the volume by the formula normalcy = moles.
As a result: normalcy = -7.33 moles / 13.0 ml
= -0.823N
To learn more about neutralization, visit
brainly.com/question/15347368
#SPJ1
8.6 * 10^ 20 (1/S or Hz)
Answer:
infrared
Explanation:
Stephan’s mother cuts a twig from a rose bush and plants it in the soil. After a few days, Stephan observes a new plant growing. Which characteristic does the growth of the new plant depict?
The growth of the new plant depicts the asexual reproduction characteristic. The characteristic that describes the growth of the new plant in Stephan's mother cutting a twig from a rose bush and planting it in the soil is asexual reproduction.
Asexual reproduction is the mode of reproduction by which organisms generate offspring that are identical to the parent's without the fusion of gametes. Asexual reproduction is a type of reproduction in which the offspring is produced from a single parent.
The offspring created are clones of the parent plant, meaning they are identical to the parent.The new plant in Stephan’s mother cutting a twig from a rose bush and planting it in the soil depicts the process of asexual reproduction, which is the ability of a plant to reproduce without seeds. In asexual reproduction, plants can reproduce vegetatively by cloning themselves using their roots, bulbs, or stems.
Know more about characteristic here:
https://brainly.com/question/28790299
#SPJ8
Aluminum sulfate reacts with barium chloride to form the insoluble compound, barium sulfate. The reaction proceeds according to the balanced equation below:
1Al2(SO4)3 + 3BaCl2 → 2AlCl3 + 3BaSO4
Marie reacts 150 g of aluminum sulfate with 200 g of barium chloride in order to produce insoluble barium sulfate for her crystallography studies. Determine the limiting and excess reactants for this reaction.
Molar mass aluminum sulfate: 342.15 g/mol
Molar mass barium chloride: 208.23 g/mol
Molar mass barium sulfate: 233.38 g/mol
Answer: \(BaCl_2\) is the limiting reagent and \(Al_2(SO_4)_3\) is the excess reagent.
Explanation:
To calculate the moles :
\(\text{Moles of solute}=\frac{\text{given mass}}{\text{Molar Mass}}\)
\(\text{Moles of aluminium sulphate}=\frac{150g}{342.15g/mol}=0.438moles\)
\(\text{Moles of barium chloride}=\frac{200g}{208.23g/mol}=0.960moles\)
The balanced chemical reaction is:
\(Al_2(SO_4)_3+3BaCl_2\rightarrow 2AlCl_3+3BaSO_4\)
According to stoichiometry :
3 moles of \(BaCl_2\) require = 1 mole of \(Al_2(SO_4)_3\)
Thus 0.960 moles of \(BaCl_2\) will require=\(\frac{1}{3}\times 0.960=0.320moles\) of \(Al_2(SO_4)_3\)
Thus \(BaCl_2\) is the limiting reagent as it limits the formation of product and \(Al_2(SO_4)_3\) is the excess reagent as it is left.
How many moles of Sb,03 will be formed when you have 20.0 moles of oxygen gases?
20.0 moles of oxygen react with Antimony to form 13.3 moles of Antimony (III) Oxide. We want to calculate how many moles of Antimony (III) Oxide will be formed from 20.0 moles of oxygen. This is a stoichiometry problem.
What is stoichiometry?The link between the proportional amounts of components participating in a reaction or generating a compound is known as stoichiometry, and it is often expressed as a ratio of whole integers.
Assuming a balanced chemical equation, the stoichiometric ratio between Antimony (III) Oxide and oxygen can be used to determine the number of moles of Antimony (III) Oxide formed.
For example, the balanced equation for the reaction of Antimony with O2 to form Antimony (III) Oxide is:
4 Antimony + 3 O2 → 2 Antimony (III) Oxide
From this equation, it can be seen that 3 moles of oxygen react with 2 moles of Antimony (III) Oxide . Therefore, if there are 20.0 moles of O2, then the number of moles of Antimony (III) Oxide formed would be:
20.0 moles oxygen × (2 moles Antimony (III) Oxide / 3 moles oxygen) = 13.3 moles Antimony (III) Oxide.
To know more about moles visit:-
https://brainly.com/question/26416088
#SPJ1
If you have 492 moles of As you need moles of NaOH to use it all up
According to the given reaction, 2 moles of As react with 6 moles of NaOH. Use this ratio to find how many moles of NaOH react with 492 moles of As.
\(492molAs\cdot\frac{6molNaOH}{2molAs}=1476molNaOH\)It means that you need 1476 moles of NaOH to use 492 moles of As all up.
250 ml of a salt solution with a concentration of 15 g/l is mixer with 220 mL of salt solution containing 6% salt (m/v). What is the final concentration of salt in the solution in g/l
The final mass concentration of salt in the solution in g/l is 36.06 g/L.
What is the concentration of the mixture of the two salt solutions?The mass concentration of the mixture of the two salt solutions is calculated as follows:
Concentration of solution 1 = 15 g/l
mass of salt in the 250 mL solution = 15 g/l * 250 mL * 1 L/1000 mL
mass of salt in the 250 mL solution = 3.75 g
Concentration of solution = 6% (m/v)
This means that in 100 mL solution, 6 g of salt in present.
In 1000 mL or 1 L solution, 60 g of salt will be present.
Hence, the concentration of solution = 60 g/L
mass of salt in the 220 mL solution = 60 g/l * 220 mL * 1 L/1000 mL
mass of salt in the 220 mL solution = 13.2 g
Total mass of salt in the mixture = 16.95 g
Total volume of solution = 470 mL
mass concentration = mass / volume in LFinal mass concentration of solution = 16.95 g / 470 mL * 1000 mL/L
Final mass concentration of solution = 36.06 g/L
Learn more about mass concentration at: https://brainly.com/question/23437000
#SPJ1
how many atoms of hydrogen and oxygen are present in 5 gm of HNO3
ANSWER: note the amounts of atoms of all the component in HNO3, which are 1 atom of hydrogen, 1 atom of nitrogen and 3 atom of oxygen.
Which of the following functional groups is formed from the condensation of carboxylic acids???
a. acid anhydride
b. acid halide
c. amide
d. ester
e. ether
Answer:
a
Explanation:
its made up of carbon and hydrogen
How many kilograms of phosphorous are in a sample containing 1.00E31 phosphorous atoms?
Answer: \(5.15\times 10^5kg\)
Explanation:
According to avogadro's law, 1 mole of every substance weighs equal to the molecular mass and contains avogadro's number of particles.
To calculate the number of moles, we use the equation:
Putting in the values we get:
\(\text{Number of moles}=\frac{1.00\times 10^{31}}{6.023\times 10^{23}}=0.166\times 10^{8}moles\)
1 mole of phosphorous \(P\) weighs = 31 g
Thus \(0.166\times 10^8\) moles of phosphorous \(P\) weigh=\(\frac{31}{1}\times 0.166\times 10^8=5.15\times 10^8g=5.15\times 10^5kg\)