If a photon has a frequency of 3.67 x 10^14 Hz, what is
its wavelength?

The molar mass of MgCrO4 is approximately 140.30 g/mol.

To determine the molar mass of MgCrO4 (magnesium chromate), we need to calculate the sum of the atomic masses of each individual element in the compound.

The chemical formula MgCrO4 indicates that the compound consists of one magnesium atom (Mg), one chromium atom (Cr), and four oxygen atoms (O).

The atomic masses of the elements can be found on the periodic table:

Magnesium (Mg) has an atomic mass of approximately 24.31 g/mol.

Chromium (Cr) has an atomic mass of around 51.99 g/mol.

Oxygen (O) has an atomic mass of about 16.00 g/mol.

Now, we can calculate the molar mass of MgCrO4 by summing up the atomic masses of each element, considering the respective subscripts:

Molar mass = (Atomic mass of Mg) + (Atomic mass of Cr) + 4 × (Atomic mass of O)

Molar mass = (24.31 g/mol) + (51.99 g/mol) + 4 × (16.00 g/mol)

Molar mass = 24.31 g/mol + 51.99 g/mol + 64.00 g/mol

Molar mass ≈ 140.30 g/mol

for more such questions on mass

https://brainly.com/question/24191825

#SPJ8

Answer:

Jupiter

Explanation:

Answer:

C) one magnesium and one oxygen

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

A chemical reaction is the process in which atoms present in the starting substances rearrange to give new chemical combinations present in the substances formed by the reaction. These starting substances of a chemical reaction are called the reactants, and the new substances that result are called the products.

Answer:

lever Levers

Types of lever

Levers are all around us. Hammers, axes, tongs, knives, screwdrivers, wrenches, scissors—all these things contain levers.

Explanation:

Answer:

If you left a block of dry ice in a bow of room temperature all day, it would evaporate.dry ice undergo sublimation,it will go from solid to gas instead of going through the normal process

solid-liquid- gas

Both changing particle size and adding a catalyst can influence the reaction rate, while adding heat specifically affects the rate by increasing the kinetic energy of the reactant particles.

The correct option are A and C.

Both changing particle size and adding a catalyst can alter the reaction rate.

Changing particle size can affect the reaction rate because it influences the surface area available for the reactant particles to interact. Smaller particle sizes result in a larger surface area, increasing the frequency of collisions between particles and accelerating the reaction. Conversely, larger particle sizes reduce the surface area, leading to fewer collision events and slower reaction rates.

Adding heat can also alter the reaction rate. Increasing the temperature provides more thermal energy to the reactant particles, causing them to move faster and collide with greater energy. This enhanced kinetic energy leads to more successful collisions and an increased reaction rate.

Adding a catalyst can significantly affect the reaction rate. A catalyst provides an alternative reaction pathway with lower activation energy, enabling the reaction to occur more easily. By lowering the energy barrier, a catalyst increases the rate of reaction without being consumed or permanently altered in the process.

The correct option are A and C.

For more such questions on catalyst

https://brainly.com/question/21598276

#SPJ8

Answer:

203 grams

Explanation:

The no. of moles of (6.3 x 10²⁴ molecules--Avagadros number) of NH₃ = (1.0 mol)(7.2 x 10²⁴ molecules)/(6.022 x 10²³ molecules) = 11.96 mol.

The no. of grams of NH₃ present = no. of moles x molar mass = (11.96 mol)(17.0 g/mol) = 203.3 g ≅ 203.0 g.

The answer is the mass of a sample of NH3 containing 7.20 x 1024 molecules of NH3 is 203 grams.

A molecule is a group of two or more atoms that form the smallest identifiable unit into which a pure substance can be divided and still retain the composition and chemical properties of that substance.

6.02214076 × 10²³  molecules constitutes 1 mole of NH₃

7.20 x 10²⁴ molecules constitutes of

\(\rm\dfrac{7.20 \times 10^{24}}{6.02\times 10^{23}}\\\)

=11.19 moles

1 mole of NH₃ = 17 gm

11.19 mole will be = 17 * 11.19

= 203 grams

Therefore the mass of a sample of NH3 containing 7.20 x 1024 molecules of NH3 is  203 grams.

To know more about molecule

https://brainly.com/question/19922822

#SPJ2

To solve such this we must know the concept of displacement reaction. Therefore, the correct option is option C that is displacement reaction.

Chemical reaction is a process in which two or more than two molecules collide in right orientation and energy to form a new chemical compound. The mass of the overall reaction should be conserved. There are so many types of chemical reaction reaction like combination reaction, double displacement reaction.

when zinc reacts with copper oxide then zinc displace copper from copper oxide as zinc is more reactive than copper on the reactivity series. So, copper is displaced by zinc.

Therefore, the correct option is option C that is displacement reaction.

Learn more about the chemical reactions, here:

brainly.com/question/3461108

#SPJ1

Answer:

D

Explanation:

The ratio of C6H12O6 (which will be referred to as "the carb") to oxygen is 1 to 6, so if we find an answer which has the same ratio, it should be chosen. A is 1:3
B is even worse with a ratio of the carb to oxygen of 1:2
C is the same as B, 1:2
D has a ratio of the carb to oxygen of 1:6, which is what we are looking for.

Answer:

Explanation:

So chemical changes require a change on a molecular level that cannot be reversed because they form some new substance. Souring milk is not something you can reverse, and the process of it souring produces new molecules.

Answer:

The correct option is a: Hg-183.

Explanation:

The alpha decay is given by:

\(^{A}_{Z}X \rightarrow ^{A-4}_{Z-2}Y + ^{4}_{2}He\)

Hence, if Polonium-191 decays by emitting an alpha particle we have:

\(^{191}_{84}Po \rightarrow ^{187}_{82}Pb + ^{4}_{2}He\)        

Now, if Pb-187 also decays by emitting an alpha particle we have:

\(^{187}_{82}Pb \rightarrow ^{183}_{80}Hg + ^{4}_{2}He\)        

Therefore, the correct option is a: Hg-183.

I hope it helps you!

Answer:

i dont know but it is probily 4 and 6

Ions can be made by single element or covalently bonded group of elements. The covalently bonded group of elements is called polyatomic ions or polyatomic atoms. Electron configuration of O²⁻ is 1s² 2s² 2p⁶.

Any species that contain charge whether it is positive charge or negative charge is called ions. The example of polyatomic ions are sulfate, phosphate, nitrate etc.

Cation is the species that loose electron and attain positive charge while anion is a species which gain electron and attains negative charge so when anion and cation combine in fixed ration the the overall charge of the molecule is zero that is molecule is neutral, the charge over cation and anion is also called oxidation state.

The electron configuration of O²⁻ is 1s² 2s² 2p⁶. It is also known as noble gas like configuration.

Therefore, electron configuration of O²⁻ is 1s² 2s² 2p⁶.

To learn more about ions, here:

https://brainly.com/question/13692734

#SPJ2

The chemical formulas for the ions and compounds you listed:

Copper (II) ion: Cu²⁺

Bromide ion: Br⁻

Magnesium ion: Mg²⁺

Phosphide ion: P³⁻

Copper (I) Bromide: CuBr

Sulfur Dichloride: SCl₂

Barium Fluoride: BaF₂

Magnesium Phosphate: Mg₃(PO₄)₂

Lithium Permanganate: LiMnO₄

Strontium Sulfite: SrSO₃

Nitrogen Monoxide: NO

Diselenium Tetraoxide: Se₂O₄

Aluminum Sulfide: Al₂S₃

Tin (IV) Iodide: SnI₄

Beryllium Oxide: BeO

Potassium Hydroxide: KOH

Copper (II) ion: Cu²⁺

Copper (II) ion has a charge of 2+ and is represented by Cu²⁺. This means that copper has lost two electrons, resulting in a 2+ charge.

Bromide ion: Br⁻

The bromide ion has a charge of 1- and is represented by Br⁻. This means that bromine has gained one electron, resulting in a 1- charge.

Magnesium ion: Mg²⁺

The magnesium ion has a charge of 2+ and is represented by Mg²⁺. This means that magnesium has lost two electrons, resulting in a 2+ charge.

Phosphide ion: P³⁻

The phosphide ion has a charge of 3- and is represented by P³⁻. This means that phosphorus has gained three electrons, resulting in a 3- charge.

Copper (I) Bromide: CuBr

Copper (I) bromide is a compound formed by combining copper (I) ion (Cu⁺) and bromide ion (Br⁻). The charges of the ions balance each other, resulting in a neutral compound.

Sulfur Dichloride: SCl₂

Sulfur dichloride is a compound consisting of one sulfur atom (S) and two chlorine atoms (Cl). The subscript "2" indicates the presence of two chlorine atoms.

Barium Fluoride: BaF₂

Barium fluoride is a compound composed of one barium ion (Ba²⁺) and two fluoride ions (F⁻). The charges of the ions balance each other, resulting in a neutral compound.

Magnesium Phosphate: Mg₃(PO₄)₂

Magnesium phosphate is a compound consisting of one magnesium ion (Mg²⁺) and two phosphate ions (PO₄³⁻). The charges of the ions balance each other, resulting in a neutral compound. The subscript "3" indicates the presence of three magnesium ions, and the subscript "2" indicates the presence of two phosphate ions.

Lithium Permanganate: LiMnO₄

Lithium permanganate is a compound composed of one lithium ion (Li⁺) and one permanganate ion (MnO₄⁻). The charges of the ions balance each other, resulting in a neutral compound.

Strontium Sulfite: SrSO₃

Strontium sulfite is a compound consisting of one strontium ion (Sr²⁺) and one sulfite ion (SO₃²⁻). The charges of the ions balance each other, resulting in a neutral compound.

Nitrogen Monoxide: NO

Nitrogen monoxide is a compound composed of one nitrogen atom (N) and one oxygen atom (O). Since the compound does not contain ions, it is represented by its elemental symbols.

Diselenium Tetraoxide: Se₂O₄

Diselenium tetraoxide is a compound consisting of two selenium atoms (Se) and four oxygen atoms (O). The prefix "di-" indicates the presence of two selenium atoms.

Aluminum Sulfide: Al₂S₃

Aluminum sulfide is a compound composed of two aluminum ions (Al³⁺) and three sulfide ions (S²⁻). The charges of the ions balance each other, resulting in a neutral compound. The subscript "

2" indicates the presence of two aluminum ions, and the subscript "3" indicates the presence of three sulfide ions.

Tin (IV) Iodide: SnI₄

Tin (IV) iodide is a compound formed by combining tin (IV) ion (Sn⁴⁺) and iodide ion (I⁻). The charges of the ions balance each other, resulting in a neutral compound.

Beryllium Oxide: BeO

Beryllium oxide is a compound composed of one beryllium ion (Be²⁺) and one oxygen ion (O²⁻). The charges of the ions balance each other, resulting in a neutral compound.

Potassium Hydroxide: KOH

Potassium hydroxide is a compound consisting of one potassium ion (K⁺) and one hydroxide ion (OH⁻). The charges of the ions balance each other, resulting in a neutral compound.

For more question on ions click on

https://brainly.com/question/1310794

#SPJ11

Answer:In order to be able to calculate the volume of oxygen gas produced by this reaction, you need to know the conditions for pressure and temperature.

Since no mention of those conditions was made, I'll assume that the reaction takes place at STP, Standard Temperature and Pressure.

STP conditions are defined as a pressure of

100 kPa

and a temperature of

0

∘

C

. Under these conditions for pressure and temperature, one mole of any ideal gas occupies

22.7 L

- this is known as the molar volume of a gas at STP.

So, in order to find the volume of oxygen gas at STP, you need to know how many moles of oxygen are produced by this reaction.

The balanced chemical equation for this decomposition reaction looks like this

2

KClO

3(s]

heat

×

−−−→

2

KCl

(s]

+

3

O

2(g]

↑

⏐

⏐

Notice that you have a

2

:

3

mole ratio between potassium chlorate and oxygen gas.

This tells you that the reaction will always produce

3

2

times more moles of oxygen gas than the number of moles of potassium chlorate that underwent decomposition.

Use potassium chlorate's molar mass to determine how many moles you have in that

231-g

sample

231

g

⋅

1 mole KClO

3

122.55

g

=

1.885 moles KClO

3

Use the aforementioned mole ratio to determine how many moles of oxygen would be produced from this many moles of potassium chlorate

1.885

moles KClO

3

⋅

3

moles O

2

2

moles KClO

3

=

2.8275 moles O

2

So, what volume would this many moles occupy at STP?

2.8275

moles

⋅

22.7 L

1

mol

=

64.2 L

Explanation:

The binding energy per nucleon for the ¹⁹F nucleon is equal to 7.786 MeV/nucleon.

Binding energy can be defined as the minimum quantity of energy that is required to remove the particle from the system. Nuclear binding energy can be described as the energy required to dismantle a nucleus of an atom into free neutrons and protons.

The binding energy will be determined from the mass defect. Mass defect is calculated from the difference between the mass observed and the expected combined mass.

Given the mass of the ¹⁹F = 18.9984 a.m.u.

The mass defect for the ¹⁹F can be calculated as:

Δm = \((M _n +M_p) - M_F\)

\(\triangle m =( 9\times 1.0078 + 10 \times 1.0087 )- 18.9984\)

\(\triangle m =0.1588 \;a.m.u.\)

The binding energy for the fluorine can be calculated as:

E = Δmc²

E = 0.1588 × 931.5

E = 147.92 MeV

The binding energy per nucleon of ¹⁹F can be calculated as:

B.E.N. = 147.92/18.9984 = 7.786 MeV per nucleon

Learn more about binding energy, here:

https://brainly.com/question/10095561

#SPJ1

The concentration of the standard naoh solution after dilution is 0.1 M.

The concentration of a standard NaOH solution after dilution can be calculated using the formula:

M1V1 = M2V2.

This formula is used when a certain volume of a stock solution of known concentration (M1) is diluted with a certain volume of water to obtain a new solution of a lower concentration (M2).

Let's assume that we have a 1 M NaOH stock solution and we want to dilute it to a concentration of 0.1 M.

The volume of the diluted solution we want to obtain is 500 mL.

Using the formula M1V1 = M2V2, we can calculate the volume of the stock solution required to obtain the desired concentration of the diluted solution:

M1V1 = M2V2

=> V1 = M2V2/M1V1

= (0.1 M) (500 mL) / (1 M)

= 5 mL.

So, we need to take 5 mL of the 1 M NaOH solution and dilute it to 500 mL with water to obtain a 0.1 M NaOH solution.

To verify the result, we can calculate the concentration of the diluted solution using the formula:

C = n/V,

where C is the concentration of the solution in units of moles per liter

n is the number of moles of solute

V is the volume of the solution in liters

The number of moles of NaOH in the diluted solution can be calculated using the formula:

n = C x V.

The volume of the diluted solution is 0.5 L, since we diluted the 5 mL stock solution to a total volume of 500 mL or 0.5 L.

The concentration of the diluted solution is 0.1 M.

So, we have:

n = C x V

= (0.1 M) (0.5 L)

= 0.05 moles of NaOH in the 0.5 L diluted solution.

The concentration of the diluted solution is therefore:

C = n/V

= 0.05 moles / 0.5 L

= 0.1 M, which is the desired concentration.

For such more questions on concentration

https://brainly.com/question/30273212

#SPJ8

Answer:

ok, here is your answer

Explanation:

i am going to solve this problem by using the ICE table method which is an easy method to determine the pH of a weak base with the given data of the problem.Given:Initial volume of NH3 solution (Vi) = 75.0 mLInitial concentration of NH3 solution (Ci) = 0.200 MInitial moles of NH3 solution (Ni) = Ci x Vi = 0.200 M x 75.0 mL = 0.0150 molesKb = 1.8 x 10^-5Moles of HNO3 added (n) = 0.500 M x 17.0 mL = 0.00850 molesVolume of NH3 solution after the addition of HNO3 (Vf) = 75.0 mL + 17.0 mL = 92.0 mLConcentration of NH3 solution after the addition of HNO3 (Cf) = Ni / Vf = 0.0150 moles / 92.0 mL = 0.163 MTo find the pH after the addition of 17.0 mL of HNO3, we need to use the ICE table method.ICE table method:Initial: NH3 + H2O ⇌ NH4+ + OH-Change: -x 0 +x +xEquilibrium: 0.0150 - x 0 x xKb = [NH4+][OH-] / [NH3]1.8 x 10^-5 = x^2 / 0.163Solving for x, x = 0.00171 M[OH-] = 0.00171 M[OH-] = Kw / [H3O+] = 1.0 x 10^-14 / [H3O+][H3O+] = 5.85 x 10^-12pH = -log[H3O+]pH = -log(5.85 x 10^-12)pH = 11.23Therefore, the pH after the addition of 17.0 mL of HNO3 is approximately 11.23.

___________________________________________________________

Answer:

Chemical reactions that take place inside living things are called biochemical reactions. The sum of all the biochemical reactions in an organism is referred to as metabolism. Metabolism includes both exothermic (heat-releasing) chemical reactions and endothermic (heat-absorbing) chemical reactions.

___________________________________________________________

Answer: Industrial processes including mining and manufacturing historically have been leading causes of soil pollution. Industrial areas typically have much higher levels of trace elements and organic contaminants. This is due to intentional and unintentional releases from industrial processes directly into the environment, including to the soil, adjacent water bodies, and the atmosphere.

Explanation:

B. It will be slow because you will have to wait for natural processes to affect each area.

What is Ocean?

An ocean is a vast body of saltwater that covers more than 70% of the Earth's surface. Oceans are the largest bodies of water on our planet and are essential for supporting life on Earth. Oceans play a crucial role in regulating the Earth's climate, absorbing heat and carbon dioxide, and generating oxygen.

The impact of human activities on ocean shores zones, such as coastal development, pollution, and overfishing, can have long-lasting and sometimes irreversible effects on these ecosystems. Restoring or mitigating the impacts of human activities on ocean shores zones requires time and effort, as natural processes need to take place to restore the affected areas.

Learn more about Ocean from the given link

https://brainly.com/question/15087582

#SPJ1

Similarities:

-They allow the union of two or more atoms.

-They both have high melting points.

-They both conduct electricty.

Differences:

-It's harder to break down a covalent bond than a ionic bond.

-Covalent bond makes atoms to share electrons, in ionic bonds it does not happen since one atom donates its electrons to the other one.

-Ionic bonds are between atoms with different charges, one anion (-) and one cation (+). Covalent bonds can be between atoms with the same charge or with different charges.

Hope this helps you a lot...

162.75 g

So 1 mol of Pt contains 195.08 g, and 1 mol = 6.022*10^23 atoms, so when you do the math, you will have the value of 162.75 g of mass

6.022*10^23 = 195.08 g

5.024*10^23 = x grams

6.022*10^23x = 980.08

x = 980.08/6.022*10^23

x = 162.75 g