The density of air at STP is 1.285 g/L Which of the following cannot be used to fill a balloon that will float in air at STP?
a. NO
b. Ne
c. CH4
d. HF
e. HH3

Explanation:

The glucose molecules changes as following:

C6H12O6 —> C2H5OH + CO2

There are 12 atoms of H on the left side and 6 atoms of the right side. It can be balance by putting 2 in front of C2H5OH as shown below:

C6H12O6 —> 2C2H5OH + CO2

There are 6 atoms of C on the left side and 5 atoms on the right side. It can be balance by putting 2 in front of CO2 as shown below:

C6H12O6 —> 2C2H5OH + 2CO2

Explanation:

According to Charles law : V/T=k (constant).

the volume temperature relationship will be

V/T = 117.5/25 = 4.7

hope this helps you.

Answer:

6.25 moles of N₂ is produced, and 18.8 moles of Cu and H₂O is produced.

Explanation:

We are given the chemical equation:

\(\displaystyle 2\text{NH$_3$}_\text{(g)} + 3\text{CuO}_\text{(s)} \longrightarrow \text{N$_2$}_\text{(g)} + 3\text{Cu}_\text{(s)}+3\text{H$_2$O}_\text{(g)}\)

And we want to determine the amount of products produced when 12.5 moles of NH₃ is reacted with excess CuO.

Compute using stoichiometry. From the equation, we can see the following stoichiometric ratios:

Dimensional Analysis:

\(\displaystyle 12.5\text{ mol NH$_3$} \cdot \frac{1\text{ mol N$_2$}}{2\text{ mol NH$_3$}} = 6.25\text{ mol N$_2$}\)

\(\displaystyle 12.5\text{ mol NH$_3$} \cdot \frac{3\text{ mol Cu}}{2\text{ mol NH$_3$}} = 18.8\text{ mol Cu}\)

\(\displaystyle 12.5\text{ mol NH$_3$} \cdot \frac{3\text{ mol H$_2$O}}{2\text{ mol NH$_3$}} = 18.8\text{ mol H$_2$O}\)

In conclusion, 6.25 moles of N₂ is produced, and 18.8 moles of Cu and H₂O is produced.

Answer:

During the process of polymerization, monomers

combine by sharing electrons. This process forms a polymer, which is made of repeating subunits. The resulting material is used in a variety of ways.

Answer:

monomers and polymer.

Explanation:

Shortest wavelength of light that can be emitted by a hydrogen atom is 95.0 nm

Emission is the transfer of electron from higher energy level to lower energy level.

Shortest wavelength is the transition with higher energy.

So,

The electron emits from \($n=5$\) to \($n=1$\) level.

The lowest state is:

\(n_1=1$\\\mathrm{n}_2=5$$\)

The Balmer-Rydberg equation is

\($$\begin{aligned}& \frac{1}{\lambda}=R_{\infty}\left[\frac{1}{n_1^2}-\frac{1}{n_2^2}\right] \\& \mathrm{n}_2=5 \text { and } \mathrm{n}_1=1 \\& \mathrm{R}=1.097 \times 10^7 \mathrm{~m}^{-1}\end{aligned}$$\)

\(\frac{1}{\lambda}=R_{\infty}\left[\frac{1}{n_1^2}-\frac{1}{n_2^2}\right]$\\\\$\Rightarrow \frac{1}{\lambda}=1.097 \times 10^7 \mathrm{~m}^{-1}\left[\frac{1}{1^2}-\frac{1}{5^2}\right]$\\\\$\Rightarrow \frac{1}{\lambda}=1.097 \times 10^7 \mathrm{~m}^{-1} \times 0.96=10531200 \mathrm{~m}^{-1}$$\lambda\\\\=\frac{1}{10531200 \mathrm{~m}^{-1}}\\\\=9.50 \times 10^{-8} \mathrm{~m}$$\lambda\\\\=95.0 \times 10^{-9} \mathrm{~m}\\\\=\mathbf{9 5 . 0} \mathbf{n m}$\)

For more questions on Balmer-Rydberg equation

https://brainly.com/question/14915323

#SPJ4

What is the shortest wavelength of light that can be emitted by a hydrogen atom, if the electron is initially in the n=5 level? Give your answer accurate to three significant figures.

A solution is composed of a solute and a solvent

Your question is incomplete but I can see that you want to know something about solutions.

A solution in chemistry is a hom----ogeneous mixture of two or more substances. In a solution, the solute is the substance that is dissolved in the solvent to form the mixture. The solute particles are evenly dispersed in the solvent, resulting in a uniform composition throughout the solution.

Solutions can be either liquid, gaseous, or solid, depending on the state of the solute and solvent. For example, a sugar solution is a mixture of sugar dissolved in water, where the water is the solvent and the sugar is the solute. A gaseous solution is a mixture of gases, such as air, which is a mixture of nitrogen, oxygen, and other gases.

Learn more about solutions:https://brainly.com/question/7932885

#SPJ1

Large particles usually get smaller as a result of surface reactions. Both heating and freezing effects of tiny particles on the climate are seen.

Weathering can be classified as either physical or chemical. There is a wide variety in soil particle size due to variations in weathering processes.The overall surface area increases when the size is reduced more. This is significant since most chemical changes start at an object's surface.

The Earth's materials are the four major elements that make up the earth's crust. The earth is made up of minerals, rocks, soil, and water. Earth materials include the necessary building components for life, agriculture, and industry.

Learn more about earth materials here:

https://brainly.com/question/154923

Yes, I have tried eating delicious delicacies served in the school canteen during recess time.

The combination of these components in food produces different end products like vitamins, minerals, and many other nutrients which are beneficial for a healthy body.

Learn more about vitamins here

https://brainly.com/question/27585440

#SPJ9

Pollution is a significant environmental issue that affects various aspects of our planet.

Here are some general observations and descriptions of different types of pollution:

Air Pollution: Air pollution refers to the contamination of the air by harmful substances, such as particulate matter, gases (e.g., nitrogen dioxide, sulfur dioxide), and volatile organic compounds. Common sources include industrial emissions, vehicle exhaust, burning of fossil fuels, and agricultural activities. Air pollution is often visible as smog or haze, and it can have detrimental effects on human health, ecosystems, and climate.

Water Pollution: Water pollution occurs when pollutants enter bodies of water, including rivers, lakes, oceans, and groundwater. It can result from industrial waste discharge, sewage contamination, oil spills, agricultural runoff, and improper disposal of chemicals. Water pollution can lead to the depletion of oxygen levels, the loss of biodiversity, and the contamination of drinking water sources, impacting both aquatic life and human communities.

Soil Pollution: Soil pollution refers to the degradation of soil quality due to the presence of harmful substances. It can occur through the accumulation of industrial waste, agricultural chemicals (e.g., pesticides, fertilizers), mining activities, and improper waste disposal. Soil pollution can affect plant growth, contaminate food crops, and pose risks to ecosystems and human health.

Noise Pollution: Noise pollution is the excessive or disturbing noise that disrupts the environment and causes discomfort or harm to humans and wildlife. Sources of noise pollution include transportation (e.g., road traffic, airplanes), industrial activities, construction sites, and recreational activities. Prolonged exposure to high levels of noise can lead to hearing loss, stress, and other health issues.

Light Pollution: Light pollution refers to the excessive or misdirected artificial light that brightens the night sky and disrupts natural light patterns. It is primarily caused by streetlights, outdoor advertising, and excessive illumination of buildings. Light pollution can have adverse effects on ecosystems, disrupting wildlife behavior, and obscuring our view of stars and other celestial objects.

These are just a few examples of pollution types and their general impacts. It's important to note that the specific observations and severity of pollution can vary significantly depending on geographical location, industrial activities, local regulations, and the level of environmental awareness and action taken by communities and governments.

for more such questions on environmental

brainly.com/question/1186120

#SPJ8

Answer: monomers

Explanation: Most macromolecules are made from single subunits, or building blocks, called monomers. The monomers combine with each other using covalent bonds to form larger molecules known as polymers.

In order to determine how much more acid Cameron used in the second experiment:

If you have the amounts of acid used in both experiments, you can subtract the amount used in the first experiment from the amount used in the second experiment to find the difference.

For example, if Cameron used 100 ml of acid in the first experiment and 200 ml of acid in the second experiment, the difference would be 200 ml - 100 ml = 100 ml.

To calculate the difference, use the formula:

Difference = Amount in the second experiment - Amount in the first experiment.

Replace the "Amount in the second experiment" and "Amount in the first experiment" with the actual values you have.

Remember to provide the specific values of acid used in both experiments to determine the exact difference.

Learn more about Cameron from:

https://brainly.com/question/29121542

#SPJ11

I believe that the answer is

A) Neutrons

I hope this helps you ^-^

Answer:

neutrons

Explanation:

The new volume of the balloon is 0.57 L. The temperature inside the store where you bought the helium balloon was 60°C which is equal to 333K. The volume of the balloon at this temperature was 0.5L. When you took the balloon to your car, the temperature dropped to -6.6°C which is equal to 266.5K. The volume of the balloon at this temperature can be calculated using the combined gas law which states that PV/T = constant.

Initial pressure and moles of helium are the same so we can write:

P1V1/T1 = P2V2/T2

Substituting the values, we get:

P1 = P2 (since the pressure is the same)
V1 = 0.5 L
T1 = 333 K
T2 = 266.5 K

So, we can calculate V2 as:

V2 = V1 x T2/T1

V2 = 0.5 x 266.5/333

V2 = 0.57 L

Therefore, the new volume of the balloon is 0.57 L. The decrease in temperature caused the gas particles inside the balloon to lose kinetic energy and move slower, which in turn decreased the pressure inside the balloon. This caused the volume of the balloon to increase, in order to maintain the constant pressure and number of moles of helium inside.

learn more about pressure and moles

https://brainly.com/question/30544349

#SPJ11

Answer:

C

Explanation:

The student is incorrect.

The atmosphere weighs very little compared to the material the earth is made of. Gravity is effected by mass. The more mass, the more gravity. The only correct (and it is totally correct) answer is C

Answer:

There are 6.022 × 10²³ atoms in one molecule of aluminium

One mole of any element contains exactly 6.022⋅1023 atoms of that element.

Answer: what materials transmits the most light waves?

Explanation:

The result table indicate that A. The solute is a SOLID because it has a DECREASE in the amount dissolved as temperature decreases.

The solubility of a solid solute in a liquid solvent generally decreases as the temperature decreases. This is because the kinetic energy of the solute molecules decreases as the temperature decreases. As the kinetic energy of the solute molecules decreases, they are less likely to have enough energy to escape from the solution and enter the gas phase.

In the table, as the temperature decreases, the concentration of the solute in the solution decreases. This indicates that the solute is a solid and that the solubility of the solute decreases as the temperature decreases.

Find out more on solute here: https://brainly.com/question/25326161

#SPJ1

Answer:

Metals

Explanation:

If you look on the periodic table metals are the most abundant.

To predict/calculate the pH of a weak acid titration using an ICE table and K, you would typically use the equilibrium point of the titration when the weak acid is partially neutralized by a strong base.

The solution contains a mixture of the weak acid and its conjugate base, and you can use the acid dissociation constant (K_a) of the weak acid to calculate the pH.

To set up the ICE table, you would first write the balanced chemical equation for the reaction between the weak acid and the strong base. For example, if the weak acid is acetic acid (CH3COOH) and the strong base is sodium hydroxide (NaOH), the reaction would be:

CH3COOH + NaOH → CH3COONa + H2O

Next, you would write the equilibrium expression for the dissociation of the weak acid:

K_a = [CH3COO-][H3O+]/[CH3COOH]

Then, you would set up the ICE table to determine the equilibrium concentrations of the species in the reaction mixture. The ICE table would look like this:

CH3COOH NaOH CH3COONa H2O

Initial [HA] [OH-] 0 0

Change -x -x +x +x

Equil. [HA]-x 0 x x

In this table, [HA] represents the initial concentration of the weak acid, [OH-] represents the concentration of the strong base added, [CH3COO-] represents thez of the conjugate base of the weak acid formed, and [H3O+] represents the concentration of hydronium ions formed by the partial dissociation of the weak acid.

From the ICE table, you can determine the equilibrium concentration of hydronium ions ([H3O+]) by using the equilibrium expression for K_a and solving for [H3O+]. Once you have calculated the concentration of [H3O+], you can use the pH formula (-log[H3O+]) to find the pH of the solution at the equilibrium point of the titration.

Click the below link, to learn more about Titration:

https://brainly.com/question/31229711

#SPJ11

In enzymatic regulation, different mechanisms can control enzyme activity. Positive allosteric regulation occurs when a substance binds to the enzyme and enhances its activity by inducing a conformational change.

Competitive inhibition happens when an inhibitor molecule competes with the substrate for the active site, and this inhibition can be reversed by adding more substrate.

Genetic regulation involves controlling enzyme production by regulating gene transcription.

In this case, the gene responsible for coding the enzyme is transcribed selectively, resulting in enzyme synthesis only under specific conditions or signals.

These regulatory mechanisms play crucial roles in modulating enzyme activity and ensuring appropriate enzyme function in response to cellular or organismal needs.

Read more about Allosteric regulation.

https://brainly.com/question/4384726

#SPJ11

a) Positive allosteric regulationa conformational change in the enzyme, enhancing its catalytic activity.

b) Competitive inhibition it outcompetes the inhibitor for binding to the active site.

c) Genetic regulation signaling molecules, or specific cellular states.

d) Zymogen activation is only activated when needed, preventing unnecessary activity.

e) Feedback control the end product and regulating the flux through the metabolic pathway.

a) Positive allosteric regulation: In this type of regulation, a substance other than the substrate binds to the enzyme, leading to an increase in its activity. This binding occurs at a site other than the active site and induces a conformational change in the enzyme, enhancing its catalytic activity.

b) Competitive inhibition: This type of regulation occurs when a molecule competes with the substrate for binding to the active site of an enzyme. The inhibitor molecule and the substrate have similar structural features, and the inhibition can be reversed by adding more substrate, as it outcompetes the inhibitor for binding to the active site.

c) Genetic regulation: This refers to the regulation of gene transcription, where the production of the enzyme is controlled by specific conditions. Gene transcription for the enzyme only occurs under certain conditions, which can be influenced by factors such as environmental cues, signaling molecules, or specific cellular states.

d) Zymogen activation: Some enzymes are initially synthesized in an inactive form called zymogen or proenzyme. Activation occurs when a specific bond within the polypeptide chain is broken, resulting in the structural rearrangement and activation of the enzyme. This mechanism ensures that the enzyme is only activated when needed, preventing unnecessary activity.

e) Feedback control: Enzymes involved in metabolic pathways are often regulated by feedback control. In this type of regulation, the end product of a pathway acts as an inhibitor, typically binding to an allosteric site on the enzyme, when its concentration is high. This inhibitory feedback helps maintain homeostasis by preventing overproduction of the end product and regulating the flux through the metabolic pathway.

Learn more about Regulation

brainly.com/question/15291433

#SPJ11

Answer:

answer is b

Explanation:

Answer:

be specific it's too little information

Answer and Explanation:

In an electric field generated between two electrodes there is a separation of charges: a negatively charged electrode called cathode and a positively charged electrode called anode. Ions are charged particles, so they can be positive or negative charges. Opposite charges attract each other. So, the cathode - negatively charged - attracts positively charged particles. On the other hand, the anode - positively charged - attracts negatively charged particles.

Therefore, positive ions move towards the cathode and negative ions move towards the anode.

Answer:

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

\(n = \frac{N}{L} \\\)

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

\(n = \frac{4.78 \times {10}^{24} }{6.02 \times {10}^{23} } \\ =7.940199...\)

We have the final answer as

Hope this helps you

In order to reduce the risk of radiation exposure to individuals and environmental contamination, radioactive wastes are kept. The wastes' radioactivity decreases over time.

Large steel and concrete barrels that contain the garbage are typically properly sealed, although accidents and leaks can still happen. Cancerous growths can result from the severe negative impacts of nuclear waste on life.

Currently, dry casks are used to store all of the nuclear waste that a power plant produces over the course of its lifetime. Since 1987, Yucca Mountain in Nevada has been intended as a permanent disposal location for spent nuclear material.

To know more about radioactive wastes visit :-

https://brainly.com/question/9816140

#SPJ1

The possible values you could measure for a particle's energy depend on the specific system and context. In quantum mechanics, the energy of a particle is quantized, meaning it can only take on certain discrete values rather than any arbitrary value.

For a particle confined within a potential well or bound within an atom or molecule, the energy levels are quantized, and the particle can only have certain specific energy values. The allowed energy values depend on the particular system and are determined by the solution of the Schrödinger equation.

In other cases, such as free particles with no potential confinement, the energy can be continuous and take on a range of values. For example, in classical mechanics, the kinetic energy of a free particle can vary continuously, depending on its speed.

In summary, the possible values you could measure for a particle's energy depend on whether the system is quantum or classical, and if it is quantum, it depends on the specific quantum system and its energy level structure.

To know more about quantum refer here

https://brainly.com/question/16977590#

#SPJ11

The compound formed when magnesium oxide reacts with water is magnesium hydroxide (Mg(OH)₂).

Magnesium oxide (MgO) is an ionic compound consisting of magnesium cations (Mg²⁺) and oxide anions (O²⁻). When it reacts with water (H₂O), the oxygen atom in water attracts the magnesium cation, leading to the formation of magnesium hydroxide.

The reaction can be represented as follows:

MgO + H₂O → Mg(OH)₂

In the resulting compound, magnesium hydroxide, there are two hydroxide ions (OH-) for every magnesium ion (Mg²⁺). The chemical formula Mg(OH)₂ represents this ratio.

Magnesium hydroxide is an alkaline compound and is commonly used as an antacid to treat heartburn and indigestion. It is also used in various industrial applications.

To know more about magnesium hydroxide, refer here:

https://brainly.com/question/12891796#

#SPJ11

The equilibrium vapor pressure with respect to water (eow) is 259.9 Pa. assume that saturation vapor pressure is same as equilibrium vapor pressure.

Therefore, the RH at the frost point is  

RH = (eow / saturation vapor pressure) × 100

= (259.9 Pa / 259.9 Pa) × 100

= 100%

b) At T = -11 °C, we need to compare the equilibrium vapor pressure with respect to water (eow) and the equilibrium vapor pressure with respect to ice (coi) to determine if ice particles will form. From the given table, at T = -11 °C, the equilibrium vapor pressure with respect to water (eow) is 237.7 Pa, and the equilibrium vapor pressure with respect to ice (coi) is 165.3 Pa.

The air is supersaturated with respect to ice, and the presence of Kaolinite particles can provide surfaces for water droplets to condense onto, leading to the formation of ice particles.

c) At T = -12 °C, we compare the equilibrium vapor pressure with respect to water (eow) and the equilibrium vapor pressure with respect to ice (coi). From the given table, at T = -12 °C, the equilibrium vapor pressure with respect to water (eow) is 217.3 Pa, and the equilibrium vapor pressure with respect to ice (coi) is 181.2 Pa.

Learn more about equilibrium vapor  here

https://brainly.com/question/15629887

#SPJ11